DE1470115C3 - N-(1-Arylalkyl-4-piperidyl)-Narylamide, deren Säureadditionssalze und Verfahren zu ihrer Herstellung - Google Patents
N-(1-Arylalkyl-4-piperidyl)-Narylamide, deren Säureadditionssalze und Verfahren zu ihrer HerstellungInfo
- Publication number
- DE1470115C3 DE1470115C3 DE1470115A DE1470115A DE1470115C3 DE 1470115 C3 DE1470115 C3 DE 1470115C3 DE 1470115 A DE1470115 A DE 1470115A DE 1470115 A DE1470115 A DE 1470115A DE 1470115 C3 DE1470115 C3 DE 1470115C3
- Authority
- DE
- Germany
- Prior art keywords
- parts
- piperidyl
- melting point
- base
- phenylethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000003839 salts Chemical class 0.000 title description 9
- 239000002253 acid Substances 0.000 title description 5
- 238000000034 method Methods 0.000 title description 4
- 238000002360 preparation method Methods 0.000 title description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- -1 methoxyphenyl Chemical group 0.000 description 33
- 238000002844 melting Methods 0.000 description 30
- 230000008018 melting Effects 0.000 description 30
- 239000002585 base Substances 0.000 description 25
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 21
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 20
- 150000001875 compounds Chemical class 0.000 description 18
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 15
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 14
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 13
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 10
- 239000000706 filtrate Substances 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 8
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 8
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 8
- 239000002199 base oil Substances 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- ZTHRQJQJODGZHV-UHFFFAOYSA-N N-phenyl-propionamide Natural products CCC(=O)NC1=CC=CC=C1 ZTHRQJQJODGZHV-UHFFFAOYSA-N 0.000 description 5
- 150000001408 amides Chemical class 0.000 description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 5
- 239000012044 organic layer Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- PMCBDBWCQQBSRJ-UHFFFAOYSA-N norfentanyl Chemical compound C=1C=CC=CC=1N(C(=O)CC)C1CCNCC1 PMCBDBWCQQBSRJ-UHFFFAOYSA-N 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 238000007920 subcutaneous administration Methods 0.000 description 4
- MNNZINNZIQVULG-UHFFFAOYSA-N 2-chloroethylbenzene Chemical compound ClCCC1=CC=CC=C1 MNNZINNZIQVULG-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 239000002262 Schiff base Substances 0.000 description 3
- 150000004753 Schiff bases Chemical class 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- XJWVCWQKZQENDS-UHFFFAOYSA-N 1-bromopropan-2-ylbenzene Chemical compound BrCC(C)C1=CC=CC=C1 XJWVCWQKZQENDS-UHFFFAOYSA-N 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 208000006550 Mydriasis Diseases 0.000 description 2
- BRQQOUNKQBWVTN-UHFFFAOYSA-N N-phenyl-N-piperidin-4-ylcyclopropanecarboxamide hydrochloride Chemical compound Cl.N1CCC(CC1)N(C(=O)C1CC1)C1=CC=CC=C1 BRQQOUNKQBWVTN-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 125000005059 halophenyl group Chemical group 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- GEVPUGOOGXGPIO-UHFFFAOYSA-N oxalic acid;dihydrate Chemical compound O.O.OC(=O)C(O)=O GEVPUGOOGXGPIO-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- MLEGMEBCXGDFQT-UHFFFAOYSA-N 1-benzylpiperidin-2-one Chemical compound O=C1CCCCN1CC1=CC=CC=C1 MLEGMEBCXGDFQT-UHFFFAOYSA-N 0.000 description 1
- NYMZRFRTLIPHOI-UHFFFAOYSA-N 2-(2-chloroethyl)furan Chemical compound ClCCC1=CC=CO1 NYMZRFRTLIPHOI-UHFFFAOYSA-N 0.000 description 1
- FMOIXKQKOWLYEK-UHFFFAOYSA-N 2-(2-chloroethyl)thiophene Chemical compound ClCCC1=CC=CS1 FMOIXKQKOWLYEK-UHFFFAOYSA-N 0.000 description 1
- DPZHKLJPVMYFCU-UHFFFAOYSA-N 2-(5-bromopyridin-2-yl)acetonitrile Chemical compound BrC1=CC=C(CC#N)N=C1 DPZHKLJPVMYFCU-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical group C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 1
- KFDVPJUYSDEJTH-UHFFFAOYSA-N 4-ethenylpyridine Chemical group C=CC1=CC=NC=C1 KFDVPJUYSDEJTH-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical compound NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- 244000223760 Cinnamomum zeylanicum Species 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- 244000131522 Citrus pyriformis Species 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-N Gluconic acid Natural products OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- XADCESSVHJOZHK-UHFFFAOYSA-N Meperidine Chemical compound C=1C=CC=CC=1C1(C(=O)OCC)CCN(C)CC1 XADCESSVHJOZHK-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- AKZWRTCWNXHHFR-PDIZUQLASA-N [(3S)-oxolan-3-yl] N-[(2S,3S)-4-[(5S)-5-benzyl-3-[(2R)-2-carbamoyloxy-2,3-dihydro-1H-inden-1-yl]-4-oxo-3H-pyrrol-5-yl]-3-hydroxy-1-phenylbutan-2-yl]carbamate Chemical compound NC(=O)O[C@@H]1Cc2ccccc2C1C1C=N[C@](C[C@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCOC2)(Cc2ccccc2)C1=O AKZWRTCWNXHHFR-PDIZUQLASA-N 0.000 description 1
- 229960001413 acetanilide Drugs 0.000 description 1
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 239000002830 appetite depressant Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 125000004799 bromophenyl group Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 230000001713 cholinergic effect Effects 0.000 description 1
- 235000017803 cinnamon Nutrition 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000006264 debenzylation reaction Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- FZERHIULMFGESH-UHFFFAOYSA-N methylenecarboxanilide Natural products CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- GOXLPDTZAWMNTG-UHFFFAOYSA-N n-phenyl-n-piperidin-4-ylbutanamide Chemical compound C=1C=CC=CC=1N(C(=O)CCC)C1CCNCC1 GOXLPDTZAWMNTG-UHFFFAOYSA-N 0.000 description 1
- ALKIXOSJRUZYPH-UHFFFAOYSA-N n-phenylpropanamide;hydrochloride Chemical compound Cl.CCC(=O)NC1=CC=CC=C1 ALKIXOSJRUZYPH-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 229960000482 pethidine Drugs 0.000 description 1
- SNQGOINUTYFSFX-UHFFFAOYSA-N phenylcarbamic acid;hydrochloride Chemical compound Cl.OC(=O)NC1=CC=CC=C1 SNQGOINUTYFSFX-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/56—Nitrogen atoms
- C07D211/58—Nitrogen atoms attached in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US144059A US3164600A (en) | 1961-10-10 | 1961-10-10 | 1-aralkyl-4-(n-aryl-carbonyl amino)-piperidines and related compounds |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1470115A1 DE1470115A1 (de) | 1969-05-29 |
| DE1470115B2 DE1470115B2 (de) | 1974-08-01 |
| DE1470115C3 true DE1470115C3 (de) | 1975-03-27 |
Family
ID=22506870
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1470115A Expired DE1470115C3 (de) | 1961-10-10 | 1962-09-28 | N-(1-Arylalkyl-4-piperidyl)-Narylamide, deren Säureadditionssalze und Verfahren zu ihrer Herstellung |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3164600A (enExample) |
| BE (1) | BE623427A (enExample) |
| CH (1) | CH446329A (enExample) |
| DE (1) | DE1470115C3 (enExample) |
| DK (1) | DK103351C (enExample) |
| FR (1) | FR1517671A (enExample) |
| GB (1) | GB992732A (enExample) |
| NL (2) | NL284196A (enExample) |
Families Citing this family (52)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3452030A (en) * | 1966-12-12 | 1969-06-24 | Aldrich Chem Co Inc The | 4-(n-isobutyrylanilino)-1-benzylpiperidine |
| DE2341965C3 (de) * | 1973-08-20 | 1979-01-25 | C.H. Boehringer Sohn, 6507 Ingelheim | 4- [N- (o-PyridyD- N-acyl] -aminolphenäthylpiperidine, Verfahren zu deren Herstellung sowie deren Verwendung bei der Bekämpfung von Schmerzzuständen |
| US3998834A (en) * | 1975-03-14 | 1976-12-21 | Janssen Pharmaceutica N.V. | N-(4-piperidinyl)-n-phenylamides and -carbamates |
| US4198411A (en) * | 1976-08-12 | 1980-04-15 | Janssen Pharmaceutica N.V. | N-aryl-N-(1-L-4-piperidinyl)-arylaceytamides |
| US4584303A (en) * | 1984-04-09 | 1986-04-22 | The Boc Group, Inc. | N-aryl-N-(4-piperidinyl)amides and pharmaceutical compositions and method employing such compounds |
| US5013742A (en) * | 1987-11-02 | 1991-05-07 | Boc, Inc. | 4-phenyl-4-N-(phenyl) amido piperidine derivatives and pharmaceutical compositions and method employing such compounds |
| US4921864A (en) * | 1987-11-02 | 1990-05-01 | Boc, Inc. | 4-Phenyl-4-(N-(phenyl)amido) piperidine derivatives and pharmaceutical compositions and method employing such compounds |
| USRE33495E (en) * | 1987-11-02 | 1990-12-18 | Boc, Inc. | Stereoselective preparation of 3-substituted-4-anilino-piperidine compounds and derivatives |
| US4957929A (en) * | 1987-11-02 | 1990-09-18 | Boc, Inc. | 4-phenyl-4-[N-(phenyl)amido]piperidine compounds and pharmaceutical compositions employing such compounds |
| US4849521A (en) * | 1987-11-02 | 1989-07-18 | Boc, Inc. | Stereoselective preparation of 3-substituted-4-piperidine compounds and derivatives |
| US4791121A (en) * | 1987-11-02 | 1988-12-13 | The Boc Group, Inc. | 4-phenyl-4-(N-(phenyl)amido) piperidine derivatives and pharmaceutical compositions and method employing such compounds |
| US4791120A (en) * | 1987-12-31 | 1988-12-13 | The Boc Group, Inc. | 4-heteropentacyclic-4-[N-(phenyl)amino] piperidine derivatives and pharmaceutical compositions and method employing such compounds |
| US4801615A (en) * | 1987-12-31 | 1989-01-31 | The Boc Group, Inc. | 4-heterohexacyclic-4-(N-(phenyl)amido) piperidine derivatives and pharmaceutical compositions and method employing such compounds |
| US5019583A (en) * | 1989-02-15 | 1991-05-28 | Glaxo Inc. | N-phenyl-N-(4-piperidinyl)amides useful as analgesics |
| KR900016129A (ko) * | 1989-04-20 | 1990-11-12 | 테리 아아르 커세트 | 4-알콕시알킬-4-아미노페닐피페리딘 및 그들의 유도체의 제조 방법 |
| US5053411A (en) * | 1989-04-20 | 1991-10-01 | Anaquest, Inc. | N-aryl-N-[4-(1-heterocyclicalkyl)piperidinyl]amides and pharmaceutical compositions and methods employing such compounds |
| US5145967A (en) * | 1989-04-20 | 1992-09-08 | Anaquest, Inc. | Method for preparing 4-alkoxyalkyl-4-phenylaminopiperdines and derivatives thereof |
| USRE34201E (en) * | 1989-04-20 | 1993-03-23 | Anaquest, Inc. | N-aryl-N-[4-(1-heterocyclicalkyl)piperidinyl]amides and pharmaceutical compositions and methods employing such compounds |
| US4939161A (en) * | 1989-05-12 | 1990-07-03 | Boc, Inc. | Analgesic N-aryl-N-[1-substituted-3,5-dimethyl-4-piperidinyl]amides |
| US5100903A (en) * | 1989-05-12 | 1992-03-31 | Anaquest, Inc. | N-aryl-n-(1-substituted-3-alkoxy-4-piperidinyl)amides and pharmaceutical compositions and methods employing such compounds |
| US4994471A (en) * | 1989-05-12 | 1991-02-19 | Boc, Inc. | N-aryl-N-(1-substituted-3-alkoxy-4-piperidinyl)amides and pharmaceutical compositions and methods employing such compounds |
| US5214148A (en) * | 1990-12-18 | 1993-05-25 | Glaxo Inc. | Analgesic N-phenyl-N-(3-OR1 -3-ME-4-piperidinyl)amides |
| US5130321A (en) * | 1990-12-18 | 1992-07-14 | Glaxo Inc. | Analgesic n-phenyl-n-(3-or 1-3-me-4-piperidinyl)amides |
| GB9707934D0 (en) * | 1997-04-18 | 1997-06-04 | Danbiosyst Uk | Improved delivery of drugs to mucosal surfaces |
| US6635661B2 (en) | 2000-05-25 | 2003-10-21 | Sepracor Inc. | Heterocyclic analgesic compounds and methods of use thereof |
| US7361666B2 (en) * | 1999-05-25 | 2008-04-22 | Sepracor, Inc. | Heterocyclic analgesic compounds and methods of use thereof |
| US6677332B1 (en) | 1999-05-25 | 2004-01-13 | Sepracor, Inc. | Heterocyclic analgesic compounds and methods of use thereof |
| JP2004515539A (ja) | 2000-12-15 | 2004-05-27 | アストラゼネカ・アクチエボラーグ | ジアリール−4−アミノ−ピペリジニル化合物の新しい調製方法 |
| CA2446904A1 (en) | 2001-05-24 | 2003-04-03 | Alexza Pharmaceuticals, Inc. | Delivery of drug esters through an inhalation route |
| US20070122353A1 (en) * | 2001-05-24 | 2007-05-31 | Hale Ron L | Drug condensation aerosols and kits |
| US7458374B2 (en) * | 2002-05-13 | 2008-12-02 | Alexza Pharmaceuticals, Inc. | Method and apparatus for vaporizing a compound |
| US7585493B2 (en) | 2001-05-24 | 2009-09-08 | Alexza Pharmaceuticals, Inc. | Thin-film drug delivery article and method of use |
| US7766013B2 (en) * | 2001-06-05 | 2010-08-03 | Alexza Pharmaceuticals, Inc. | Aerosol generating method and device |
| US7645442B2 (en) | 2001-05-24 | 2010-01-12 | Alexza Pharmaceuticals, Inc. | Rapid-heating drug delivery article and method of use |
| US7090830B2 (en) * | 2001-05-24 | 2006-08-15 | Alexza Pharmaceuticals, Inc. | Drug condensation aerosols and kits |
| US7666876B2 (en) * | 2002-03-19 | 2010-02-23 | Vernalis (R&D) Limited | Buprenorphine formulations for intranasal delivery |
| US7913688B2 (en) * | 2002-11-27 | 2011-03-29 | Alexza Pharmaceuticals, Inc. | Inhalation device for producing a drug aerosol |
| GB0300531D0 (en) * | 2003-01-10 | 2003-02-12 | West Pharm Serv Drug Res Ltd | Pharmaceutical compositions |
| ATE510174T1 (de) | 2003-05-21 | 2011-06-15 | Alexza Pharmaceuticals Inc | Schlag gezündete unabhängige heizeinheit |
| ES2320136T3 (es) * | 2003-10-29 | 2009-05-19 | Mallinckrodt Inc. | Metodo industrial para separacion y purificacion de fentanilo por cromatografia preparativa en fase inversa. |
| US7540286B2 (en) * | 2004-06-03 | 2009-06-02 | Alexza Pharmaceuticals, Inc. | Multiple dose condensation aerosol devices and methods of forming condensation aerosols |
| US20100006092A1 (en) * | 2004-08-12 | 2010-01-14 | Alexza Pharmaceuticals, Inc. | Aerosol Drug Delivery Device Incorporating Percussively Activated Heat Packages |
| AU2004322756B2 (en) * | 2004-08-12 | 2011-04-14 | Alexza Pharmaceuticals, Inc. | Aerosol drug delivery device incorporating percussively activated heat packages |
| ES2289888B1 (es) * | 2005-09-08 | 2008-12-16 | Consejo Superior Investig. Cientificas | Derivados de pirazolcarboxamida, su procedimiento de obtencion y sus aplicaciones como antagonistas/agonistas inversos del receptor cannabinoide cb1 y opioide mu. |
| WO2007061555A1 (en) * | 2005-11-17 | 2007-05-31 | Mallinckrodt Inc. | Process for synthesizing remifentanil |
| US20080216828A1 (en) | 2007-03-09 | 2008-09-11 | Alexza Pharmaceuticals, Inc. | Heating unit for use in a drug delivery device |
| US9889239B2 (en) | 2007-03-23 | 2018-02-13 | Allegiance Corporation | Fluid collection and disposal system and related methods |
| DK2139620T3 (en) | 2007-03-23 | 2016-03-07 | Allegiance Corp | Fluidopsamlings- and disposal system and related practices |
| WO2009077584A1 (en) * | 2007-12-19 | 2009-06-25 | Neurosearch A/S | N-aryl-n-piperidin-4-yl-propionamide derivatives and their use as opioid receptor ligands |
| RU2495871C2 (ru) * | 2008-03-19 | 2013-10-20 | Дайректор Дженерал, Дифенс Рисерч Энд Дивелопмент Организейшн, Министри Оф Дифенс | Способ получения фентанила |
| US20100076198A1 (en) * | 2008-09-19 | 2010-03-25 | Mallinckrodt Inc. | Crystalline forms of Fentanyl Alkaloid |
| US12214118B2 (en) | 2018-02-02 | 2025-02-04 | Alexza Pharmaceuticals, Inc. | Electrical condensation aerosol device |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2824875A (en) * | 1958-02-25 | Certificate of correction | ||
| US2914532A (en) * | 1955-09-12 | 1959-11-24 | Sterling Drug Inc | Lower alkyl 4-phenyl-1-(3-phenylpropyl) piperidine-4-carboxylates and their preparation |
| US2962501A (en) * | 1956-09-19 | 1960-11-29 | Merck & Co Inc | 1-substituted propyl piperidines and processes of preparing same |
| US3004977A (en) * | 1960-04-29 | 1961-10-17 | Paul A J Janssen | Lower alkyl esters of 1-(2-benzoylethyl)-3-methyl-4-phenylpiperidine-4-carboxylic acid and 1-(3-hydroxy-3-phenylpropyl)-3-methyl-4-phenylpiperidine-4-carboxylic acid |
| US3012030A (en) * | 1960-04-29 | 1961-12-05 | Paul A J Janssen | Lower alkyl esters of 1-cinnamyl-3-methyl-4-phenylpiperidine-4-carboxylic acid |
-
0
- BE BE623427D patent/BE623427A/xx unknown
- NL NL135583D patent/NL135583C/xx active
- NL NL284196D patent/NL284196A/xx unknown
-
1961
- 1961-10-10 US US144059A patent/US3164600A/en not_active Expired - Lifetime
-
1962
- 1962-09-27 DK DK418062AA patent/DK103351C/da active
- 1962-09-28 DE DE1470115A patent/DE1470115C3/de not_active Expired
- 1962-10-01 CH CH1152962A patent/CH446329A/de unknown
- 1962-10-09 GB GB38269/62A patent/GB992732A/en not_active Expired
- 1962-10-09 FR FR911730A patent/FR1517671A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DK103351C (da) | 1965-12-20 |
| DE1470115A1 (de) | 1969-05-29 |
| US3164600A (en) | 1965-01-05 |
| CH446329A (de) | 1967-11-15 |
| NL284196A (enExample) | |
| BE623427A (enExample) | |
| NL135583C (enExample) | |
| FR1517671A (fr) | 1968-03-22 |
| GB992732A (en) | 1965-05-19 |
| DE1470115B2 (de) | 1974-08-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1470115C3 (de) | N-(1-Arylalkyl-4-piperidyl)-Narylamide, deren Säureadditionssalze und Verfahren zu ihrer Herstellung | |
| DE1445080C3 (de) | l-(gamma-Benzoylpropyl>4-phenylpiperidin-4-carbonsäureamide und Verfahren zu ihrer Herstellung | |
| DE2941880A1 (de) | Diphenylbutyl-piperazincarboxamide und diese enthaltende arzneimittel | |
| DE2708236A1 (de) | 3-aryl-2-oxazolidinone, verfahren zu ihrer herstellung und arzneimittel | |
| EP0005231B1 (de) | Isochinolinderivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Zubereitungen | |
| DE2037852C3 (de) | Neue Piperazinderivate und Verfahren zu ihrer Herstellung | |
| CH675418A5 (enExample) | ||
| DE1445603A1 (de) | Verfahren zur Herstellung von neuen Oxadiazolderivaten | |
| DE1545670A1 (de) | Neue Diazacycloalkane | |
| US3371094A (en) | N-(amidoximino-lower-alkyl)-and n-amidino-n-[(1-piperidyl)-lower-alkyl]amines | |
| DE3025238C2 (enExample) | ||
| DE2126559B2 (de) | 2,2-Diaryl-4-piperidinbutyramide, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE2623075A1 (de) | Substituierte benzamide | |
| DE2342028A1 (de) | 3-(1-piperazinylalkyl)-2,4-chinazolindione | |
| DE3900028A1 (de) | Gegebenenfalls am phenylrest halogen- und/oder alkyl- und/oder alkoxy- oder methylendioxysubstituierte, 5,5-di-(methyl)-3-(phenylvinyl)-1-(substituiert amino-alkoxy-imino)-cyclohex-2-enderivate, verfahren zu ihrer herstellung sowie diese enthaltende arzneimittel | |
| EP0004332B1 (de) | Isochinole,Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| EP0740649A1 (de) | Nitroxy-gruppen enthaltende benzylaminderivate und ihre verwendung zur behandlung von cardiovasculären erkrankungen sowie erhöhtem augeninnendruck | |
| DE2356239A1 (de) | Benzophenon-derivate und verfahren zu ihrer herstellung | |
| DE1289845B (de) | 4-(4'-Hydroxy-4'-phenylpiperidino)-butyrophenone, deren Saeureadditionssalze sowie Verfahren zu deren Herstellung | |
| EP0007525A1 (de) | 2-(4-Aminopiperidino)-3,4-dihydrochinoline, Verfahren zu ihrer Herstellung, pharmazeutische Präparate auf Basis dieser Verbindungen sowie ihre Verwendung | |
| DE1445783A1 (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| EP0123977A1 (de) | Substituierte Piperazin-1-yl-essigsäure-amide, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| AT233013B (de) | Verfahren zur Herstellung von neuen Iminodibenzylderivaten | |
| DE2036181A1 (de) | Benzamidine und Verfahren zu ihrer Her stellung | |
| DE2613328C3 (de) | l-Methyl-2-(m-trifluormethyl-phenyl)äthylamid der p-Pentylamino-phenoxyessigsäure, ein Verfahren zu dessen Herstellung sowie Arzneimittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| SH | Request for examination between 03.10.1968 and 22.04.1971 | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |