DE1447737A1 - Durch Waerme entwickelbares Reproduktionsmaterial fuer die Diazotypie - Google Patents
Durch Waerme entwickelbares Reproduktionsmaterial fuer die DiazotypieInfo
- Publication number
- DE1447737A1 DE1447737A1 DE19641447737 DE1447737A DE1447737A1 DE 1447737 A1 DE1447737 A1 DE 1447737A1 DE 19641447737 DE19641447737 DE 19641447737 DE 1447737 A DE1447737 A DE 1447737A DE 1447737 A1 DE1447737 A1 DE 1447737A1
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- layer
- diazotype
- heat
- aryl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000463 material Substances 0.000 title claims description 89
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 28
- -1 amino compound Chemical class 0.000 claims description 20
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- 125000003118 aryl group Chemical group 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 239000000126 substance Substances 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 9
- 230000009471 action Effects 0.000 claims description 8
- 125000000623 heterocyclic group Chemical group 0.000 claims description 7
- 125000002947 alkylene group Chemical group 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 6
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 6
- 125000003107 substituted aryl group Chemical group 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 229920000642 polymer Polymers 0.000 claims description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 150000001989 diazonium salts Chemical class 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 5
- 241000242759 Actiniaria Species 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 239000000243 solution Substances 0.000 description 77
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 63
- 238000000034 method Methods 0.000 description 39
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 37
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 32
- 235000005074 zinc chloride Nutrition 0.000 description 31
- 239000011592 zinc chloride Substances 0.000 description 31
- 239000002253 acid Substances 0.000 description 30
- 239000010410 layer Substances 0.000 description 29
- 150000001408 amides Chemical class 0.000 description 27
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 24
- 150000003839 salts Chemical class 0.000 description 24
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 22
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 22
- 235000019441 ethanol Nutrition 0.000 description 19
- 238000001035 drying Methods 0.000 description 16
- 230000001235 sensitizing effect Effects 0.000 description 16
- 238000000576 coating method Methods 0.000 description 15
- 150000001412 amines Chemical class 0.000 description 14
- 159000000000 sodium salts Chemical class 0.000 description 14
- 239000011248 coating agent Substances 0.000 description 13
- 229910021529 ammonia Inorganic materials 0.000 description 12
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 12
- DKJVSIITPZVTRO-UHFFFAOYSA-N 6,7-dihydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(O)C(O)=CC2=C1 DKJVSIITPZVTRO-UHFFFAOYSA-N 0.000 description 11
- 239000002250 absorbent Substances 0.000 description 11
- 230000002745 absorbent Effects 0.000 description 11
- 238000002360 preparation method Methods 0.000 description 11
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 9
- 239000002585 base Substances 0.000 description 9
- 238000004519 manufacturing process Methods 0.000 description 9
- 230000008569 process Effects 0.000 description 9
- 230000033458 reproduction Effects 0.000 description 9
- 239000011975 tartaric acid Substances 0.000 description 9
- 235000002906 tartaric acid Nutrition 0.000 description 9
- HRXKRNGNAMMEHJ-UHFFFAOYSA-K trisodium citrate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O HRXKRNGNAMMEHJ-UHFFFAOYSA-K 0.000 description 9
- CCIAVEMREXZXAK-UHFFFAOYSA-M 4-(dimethylamino)benzenediazonium;chloride Chemical compound [Cl-].CN(C)C1=CC=C([N+]#N)C=C1 CCIAVEMREXZXAK-UHFFFAOYSA-M 0.000 description 8
- 238000000354 decomposition reaction Methods 0.000 description 7
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 6
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 6
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical compound NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 239000003513 alkali Substances 0.000 description 6
- 239000001045 blue dye Substances 0.000 description 6
- 238000010168 coupling process Methods 0.000 description 6
- 150000008049 diazo compounds Chemical class 0.000 description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 230000004913 activation Effects 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 230000008878 coupling Effects 0.000 description 5
- 238000005859 coupling reaction Methods 0.000 description 5
- ZPBSAMLXSQCSOX-UHFFFAOYSA-N naphthalene-1,3,6-trisulfonic acid Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=CC2=CC(S(=O)(=O)O)=CC=C21 ZPBSAMLXSQCSOX-UHFFFAOYSA-N 0.000 description 5
- 229920002401 polyacrylamide Polymers 0.000 description 5
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 5
- 229940080818 propionamide Drugs 0.000 description 5
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 4
- SKZKKFZAGNVIMN-UHFFFAOYSA-N Salicilamide Chemical compound NC(=O)C1=CC=CC=C1O SKZKKFZAGNVIMN-UHFFFAOYSA-N 0.000 description 4
- 229960000581 salicylamide Drugs 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- PXBFMLJZNCDSMP-UHFFFAOYSA-N 2-Aminobenzamide Chemical compound NC(=O)C1=CC=CC=C1N PXBFMLJZNCDSMP-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 239000012876 carrier material Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000012954 diazonium Substances 0.000 description 3
- JRBPAEWTRLWTQC-UHFFFAOYSA-N dodecylamine Chemical compound CCCCCCCCCCCCN JRBPAEWTRLWTQC-UHFFFAOYSA-N 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 239000011570 nicotinamide Substances 0.000 description 3
- 229960003966 nicotinamide Drugs 0.000 description 3
- 235000005152 nicotinamide Nutrition 0.000 description 3
- 230000000087 stabilizing effect Effects 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- VKGQPUZNCZPZKI-UHFFFAOYSA-N (diaminomethylideneamino)azanium;sulfate Chemical compound NN=C(N)N.NN=C(N)N.OS(O)(=O)=O VKGQPUZNCZPZKI-UHFFFAOYSA-N 0.000 description 2
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- FJLUATLTXUNBOT-UHFFFAOYSA-N 1-Hexadecylamine Chemical compound CCCCCCCCCCCCCCCCN FJLUATLTXUNBOT-UHFFFAOYSA-N 0.000 description 2
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 2
- LSBDFXRDZJMBSC-UHFFFAOYSA-N 2-phenylacetamide Chemical compound NC(=O)CC1=CC=CC=C1 LSBDFXRDZJMBSC-UHFFFAOYSA-N 0.000 description 2
- YFCXTPKUVYRXFI-UHFFFAOYSA-M 4-(diethylamino)benzenediazonium;chloride Chemical compound [Cl-].CCN(CC)C1=CC=C([N+]#N)C=C1 YFCXTPKUVYRXFI-UHFFFAOYSA-M 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 2
- REYJJPSVUYRZGE-UHFFFAOYSA-N Octadecylamine Chemical compound CCCCCCCCCCCCCCCCCCN REYJJPSVUYRZGE-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 206010070834 Sensitisation Diseases 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- PLZVEHJLHYMBBY-UHFFFAOYSA-N Tetradecylamine Chemical compound CCCCCCCCCCCCCCN PLZVEHJLHYMBBY-UHFFFAOYSA-N 0.000 description 2
- IFVYHJRLWCUVBB-UHFFFAOYSA-N allyl thiocyanate Chemical compound C=CCSC#N IFVYHJRLWCUVBB-UHFFFAOYSA-N 0.000 description 2
- HAMNKKUPIHEESI-UHFFFAOYSA-N aminoguanidine Chemical compound NNC(N)=N HAMNKKUPIHEESI-UHFFFAOYSA-N 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- NVLHKSGUMYMKRR-UHFFFAOYSA-N dodeca-2,10-dienediamide Chemical compound NC(=O)C=CCCCCCCC=CC(N)=O NVLHKSGUMYMKRR-UHFFFAOYSA-N 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N hydrochloric acid Substances Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- JRNGUTKWMSBIBF-UHFFFAOYSA-N naphthalene-2,3-diol Chemical compound C1=CC=C2C=C(O)C(O)=CC2=C1 JRNGUTKWMSBIBF-UHFFFAOYSA-N 0.000 description 2
- 150000002897 organic nitrogen compounds Chemical class 0.000 description 2
- LPNBBFKOUUSUDB-UHFFFAOYSA-N p-toluic acid Chemical compound CC1=CC=C(C(O)=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-N 0.000 description 2
- CUQCMXFWIMOWRP-UHFFFAOYSA-N phenyl biguanide Chemical compound NC(N)=NC(N)=NC1=CC=CC=C1 CUQCMXFWIMOWRP-UHFFFAOYSA-N 0.000 description 2
- QCDYQQDYXPDABM-UHFFFAOYSA-N phloroglucinol Chemical compound OC1=CC(O)=CC(O)=C1 QCDYQQDYXPDABM-UHFFFAOYSA-N 0.000 description 2
- 229960001553 phloroglucinol Drugs 0.000 description 2
- NAYYNDKKHOIIOD-UHFFFAOYSA-N phthalamide Chemical compound NC(=O)C1=CC=CC=C1C(N)=O NAYYNDKKHOIIOD-UHFFFAOYSA-N 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 230000008313 sensitization Effects 0.000 description 2
- 239000002356 single layer Substances 0.000 description 2
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- TXTWXQXDMWILOF-UHFFFAOYSA-N (2-ethoxy-2-oxoethyl)azanium;chloride Chemical compound [Cl-].CCOC(=O)C[NH3+] TXTWXQXDMWILOF-UHFFFAOYSA-N 0.000 description 1
- OTXHZHQQWQTQMW-UHFFFAOYSA-N (diaminomethylideneamino)azanium;hydrogen carbonate Chemical compound OC([O-])=O.N[NH2+]C(N)=N OTXHZHQQWQTQMW-UHFFFAOYSA-N 0.000 description 1
- LNFXKMSPPDSZAT-UHFFFAOYSA-N 1,6-dihydroxynaphthalene-2-sulfonic acid Chemical compound OC1=C(S(O)(=O)=O)C=CC2=CC(O)=CC=C21 LNFXKMSPPDSZAT-UHFFFAOYSA-N 0.000 description 1
- LDMOEFOXLIZJOW-UHFFFAOYSA-N 1-dodecanesulfonic acid Chemical compound CCCCCCCCCCCCS(O)(=O)=O LDMOEFOXLIZJOW-UHFFFAOYSA-N 0.000 description 1
- ROHTVIURAJBDES-UHFFFAOYSA-N 2-n,2-n-bis(prop-2-enyl)-1,3,5-triazine-2,4,6-triamine Chemical compound NC1=NC(N)=NC(N(CC=C)CC=C)=N1 ROHTVIURAJBDES-UHFFFAOYSA-N 0.000 description 1
- AOPRXJXHLWYPQR-UHFFFAOYSA-N 2-phenoxyacetamide Chemical compound NC(=O)COC1=CC=CC=C1 AOPRXJXHLWYPQR-UHFFFAOYSA-N 0.000 description 1
- QRJZGVVKGFIGLI-UHFFFAOYSA-N 2-phenylguanidine Chemical compound NC(=N)NC1=CC=CC=C1 QRJZGVVKGFIGLI-UHFFFAOYSA-N 0.000 description 1
- GZVHEAJQGPRDLQ-UHFFFAOYSA-N 6-phenyl-1,3,5-triazine-2,4-diamine Chemical compound NC1=NC(N)=NC(C=2C=CC=CC=2)=N1 GZVHEAJQGPRDLQ-UHFFFAOYSA-N 0.000 description 1
- BMHHQPYFORGXQA-UHFFFAOYSA-N 7h-purine-2-carboxamide Chemical compound NC(=O)C1=NC=C2N=CNC2=N1 BMHHQPYFORGXQA-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 1
- ZDXPYRJPNDTMRX-VKHMYHEASA-N L-glutamine Chemical compound OC(=O)[C@@H](N)CCC(N)=O ZDXPYRJPNDTMRX-VKHMYHEASA-N 0.000 description 1
- 229930182816 L-glutamine Natural products 0.000 description 1
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 1
- JPYHHZQJCSQRJY-UHFFFAOYSA-N Phloroglucinol Natural products CCC=CCC=CCC=CCC=CCCCCC(=O)C1=C(O)C=C(O)C=C1O JPYHHZQJCSQRJY-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ANRCSZILOHNONR-UHFFFAOYSA-N acetic acid;hexadecan-1-amine Chemical compound CC([O-])=O.CCCCCCCCCCCCCCCC[NH3+] ANRCSZILOHNONR-UHFFFAOYSA-N 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- CLRSZXHOSMKUIB-UHFFFAOYSA-M benzenediazonium chloride Chemical compound [Cl-].N#[N+]C1=CC=CC=C1 CLRSZXHOSMKUIB-UHFFFAOYSA-M 0.000 description 1
- 239000001049 brown dye Substances 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- ICXXXLGATNSZAV-UHFFFAOYSA-N butylazanium;chloride Chemical compound [Cl-].CCCC[NH3+] ICXXXLGATNSZAV-UHFFFAOYSA-N 0.000 description 1
- XDSYAIICRRZSJX-UHFFFAOYSA-N carbamimidoyl(phenyl)azanium;hydrogen carbonate Chemical compound OC(O)=O.NC(N)=NC1=CC=CC=C1 XDSYAIICRRZSJX-UHFFFAOYSA-N 0.000 description 1
- 238000003763 carbonization Methods 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- ZINJLDJMHCUBIP-UHFFFAOYSA-N ethametsulfuron-methyl Chemical compound CCOC1=NC(NC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)C(=O)OC)=N1 ZINJLDJMHCUBIP-UHFFFAOYSA-N 0.000 description 1
- NTNZTEQNFHNYBC-UHFFFAOYSA-N ethyl 2-aminoacetate Chemical compound CCOC(=O)CN NTNZTEQNFHNYBC-UHFFFAOYSA-N 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- TVFIYRKPCACCNL-UHFFFAOYSA-N furan-2-carboxamide Chemical compound NC(=O)C1=CC=CO1 TVFIYRKPCACCNL-UHFFFAOYSA-N 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- DXTIKTAIYCJTII-UHFFFAOYSA-N guanidine acetate Chemical compound CC([O-])=O.NC([NH3+])=N DXTIKTAIYCJTII-UHFFFAOYSA-N 0.000 description 1
- 230000020169 heat generation Effects 0.000 description 1
- 150000004687 hexahydrates Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000003230 hygroscopic agent Substances 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- WRIRWRKPLXCTFD-UHFFFAOYSA-N malonamide Chemical compound NC(=O)CC(N)=O WRIRWRKPLXCTFD-UHFFFAOYSA-N 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 1
- 150000004780 naphthols Chemical class 0.000 description 1
- LGQLOGILCSXPEA-UHFFFAOYSA-L nickel sulfate Chemical compound [Ni+2].[O-]S([O-])(=O)=O LGQLOGILCSXPEA-UHFFFAOYSA-L 0.000 description 1
- 229910000363 nickel(II) sulfate Inorganic materials 0.000 description 1
- LYRFLYHAGKPMFH-UHFFFAOYSA-N octadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(N)=O LYRFLYHAGKPMFH-UHFFFAOYSA-N 0.000 description 1
- UPHWVVKYDQHTCF-UHFFFAOYSA-N octadecylazanium;acetate Chemical compound CC(O)=O.CCCCCCCCCCCCCCCCCCN UPHWVVKYDQHTCF-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000003415 peat Substances 0.000 description 1
- IPWFJLQDVFKJDU-UHFFFAOYSA-N pentanamide Chemical compound CCCCC(N)=O IPWFJLQDVFKJDU-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- JRRBJSPQEVZLPI-UHFFFAOYSA-N piperazin-1-ium;hydroxide Chemical compound O.C1CNCCN1 JRRBJSPQEVZLPI-UHFFFAOYSA-N 0.000 description 1
- 229960005141 piperazine Drugs 0.000 description 1
- 229960003641 piperazine hydrate Drugs 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 239000001397 quillaja saponaria molina bark Substances 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000001850 reproductive effect Effects 0.000 description 1
- 229930182490 saponin Natural products 0.000 description 1
- 150000007949 saponins Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 238000009999 singeing Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- VDWRUZRMNKZIAJ-UHFFFAOYSA-N tetradecylazanium;acetate Chemical compound CC(O)=O.CCCCCCCCCCCCCCN VDWRUZRMNKZIAJ-UHFFFAOYSA-N 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- SOBHUZYZLFQYFK-UHFFFAOYSA-K trisodium;hydroxy-[[phosphonatomethyl(phosphonomethyl)amino]methyl]phosphinate Chemical compound [Na+].[Na+].[Na+].OP(O)(=O)CN(CP(O)([O-])=O)CP([O-])([O-])=O SOBHUZYZLFQYFK-UHFFFAOYSA-K 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/52—Compositions containing diazo compounds as photosensitive substances
- G03C1/60—Compositions containing diazo compounds as photosensitive substances with macromolecular additives
Landscapes
- Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- General Physics & Mathematics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US266332A US3199982A (en) | 1963-03-19 | 1963-03-19 | Diazotype reproduction material |
| US266230A US3255007A (en) | 1963-03-19 | 1963-03-19 | Diazotype reproduction materials |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1447737A1 true DE1447737A1 (de) | 1969-01-09 |
Family
ID=26951714
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19641447737 Pending DE1447737A1 (de) | 1963-03-19 | 1964-03-14 | Durch Waerme entwickelbares Reproduktionsmaterial fuer die Diazotypie |
Country Status (6)
| Country | Link |
|---|---|
| US (2) | US3199982A (cg-RX-API-DMAC10.html) |
| AT (1) | AT277751B (cg-RX-API-DMAC10.html) |
| BE (1) | BE645321A (cg-RX-API-DMAC10.html) |
| DE (1) | DE1447737A1 (cg-RX-API-DMAC10.html) |
| GB (2) | GB1064975A (cg-RX-API-DMAC10.html) |
| NL (1) | NL6402881A (cg-RX-API-DMAC10.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3134113A1 (de) * | 1980-08-29 | 1982-04-01 | Ricoh Co., Ltd., Tokyo | Waermeentwickelbares diazo-kopier- und aufzeichnungsmaterial |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE635248A (cg-RX-API-DMAC10.html) * | 1962-07-25 | |||
| FR1377476A (fr) * | 1963-09-24 | 1964-11-06 | Bauchet & Cie Ets | Procédé de fabrication de feuilles héliographiques et articles analogues pour la reproduction de documents par diazotypie et feuilles photo-sensibles réalisées par la mise en oeuvre de ce procédé |
| GB1054697A (cg-RX-API-DMAC10.html) * | 1963-09-25 | |||
| DE1447736A1 (de) * | 1964-02-29 | 1969-01-09 | Kalle Ag | Durch Waerme entwickelbares Zweikomponenten-Diazotypie-Kopiermaterial und Verfahren zu dessen Herstellung |
| DE1303130B (de) * | 1964-03-10 | Van der Gnnten N V Venlo (Nieder lande) | Mit Warme zu entwickelndes Diazotypie material | |
| US3367776A (en) * | 1964-04-17 | 1968-02-06 | Addressograph Multigraph | Heat sensitive diazotype materials |
| US3386826A (en) * | 1964-05-08 | 1968-06-04 | Ibm | Process for producing improved diazotype elements |
| US3389995A (en) * | 1964-09-15 | 1968-06-25 | Gen Aniline & Film Corp | Two-component heat developable diazotypes containing amidine compounds |
| US3406072A (en) * | 1964-12-21 | 1968-10-15 | Gaf Corp | One-component diazotypes |
| GB1143703A (cg-RX-API-DMAC10.html) * | 1965-03-18 | |||
| DD54880A (cg-RX-API-DMAC10.html) * | 1965-07-01 | |||
| DE1572048C3 (de) * | 1965-09-10 | 1978-10-26 | Hoechst Ag, 6000 Frankfurt | Wärmeentwickelbares Diazotypiematerial |
| DE1572072C3 (de) * | 1966-03-19 | 1974-02-28 | Kalle Ag, 6202 Wiesbaden-Biebrich | Wärmeentwicke lbares Diazotypiematerial |
| US3512978A (en) * | 1966-03-21 | 1970-05-19 | Keuffel & Esser Co | Diazosulfonate composition,copying material,and method of use |
| US3420405A (en) * | 1966-08-04 | 1969-01-07 | Us Plywood Champ Papers Inc | Package for copy sheets |
| NL136527C (cg-RX-API-DMAC10.html) * | 1966-11-07 | |||
| US3480433A (en) * | 1967-03-22 | 1969-11-25 | Eastman Kodak Co | Thermally activatable diazotype compositions |
| US3918974A (en) * | 1970-05-01 | 1975-11-11 | Mita Industrial Co Ltd | Process for the diazo-type multicolor reproduction |
| FR2180529B1 (cg-RX-API-DMAC10.html) * | 1972-04-20 | 1974-07-26 | Cellophane Sa | |
| US3981730A (en) * | 1973-04-18 | 1976-09-21 | Mita Industrial Company, Ltd. | Diazo-type multicolor reproduction process |
| US3985562A (en) * | 1973-05-18 | 1976-10-12 | Agfa-Gevaert N.V. | Diazo recording process and material |
| DE2628094A1 (de) * | 1975-06-30 | 1977-01-27 | Ricoh Kk | Nassentwickler zum entwickeln von zweikomponenten-diazotypiematerialien |
| US4168171A (en) * | 1977-08-05 | 1979-09-18 | Minnesota Mining And Manufacturing Company | Light-sensitive thermal developable diazotype sheets with imidazoles |
| US4230789A (en) * | 1978-03-13 | 1980-10-28 | Minnesota Mining And Manufacturing Company | Thermal diazotype sheets |
| US4554236A (en) * | 1982-03-18 | 1985-11-19 | American Hoechst Corporation | Amino acid stabilizers for water soluble diazonium compound condensation products |
| US4419432A (en) * | 1982-09-22 | 1983-12-06 | Keuffel & Esser Company | Diazotype composition stabilization |
| JPS61104887A (ja) * | 1984-10-27 | 1986-05-23 | Kanzaki Paper Mfg Co Ltd | 感熱記録体 |
| CN109127055B (zh) * | 2018-08-20 | 2020-07-03 | 江苏广都建设有限公司 | 一种建筑工程使用的小型粉磨机 |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA564915A (en) * | 1958-10-21 | S. Schwartz Robert | Dry electric facsimile paper | |
| CA519408A (en) * | 1955-12-13 | J. Schwoegler Edward | Corrosion inhibiting compositions | |
| GB816601A (en) * | 1954-07-09 | 1959-07-15 | Arnold Tanenbaum | Improvements in or relating to diazotype processes |
| NL24938C (cg-RX-API-DMAC10.html) * | 1928-07-30 | |||
| US2047217A (en) * | 1935-03-15 | 1936-07-14 | Du Pont | Sizes |
| US2358871A (en) * | 1940-05-20 | 1944-09-26 | Du Pont | Textile treatment |
| US2459521A (en) * | 1944-10-14 | 1949-01-18 | Rca Corp | Electrolytic recording |
| US2593911A (en) * | 1948-12-31 | 1952-04-22 | Gen Aniline & Film Corp | Diazotypes containing a condensation product of dicyandiamide with formaldehyde and a salt of ammonia or an aromatic amine |
| US2545423A (en) * | 1949-02-10 | 1951-03-13 | Gen Aniline & Film Corp | Diazotypes containing a guanide base in a gelatin layer to prevent dye diffusion |
| NL76649C (cg-RX-API-DMAC10.html) * | 1949-04-09 | |||
| NL150528B (nl) * | 1949-05-14 | Hollandse Signaalapparaten Bv | Werkwijze voor het vervaardigen van twistloos of nagenoeg twistloos garen en het door toepassing van deze werkwijze verkregen garen. | |
| US2653091A (en) * | 1950-01-31 | 1953-09-22 | Rca Corp | Photographic diazotype composition and heat development thereof |
| US2822296A (en) * | 1951-11-01 | 1958-02-04 | Armour & Co | Rodent repellent material containing dodecylamine acetate |
| US2668111A (en) * | 1952-03-05 | 1954-02-02 | Certain Teed Prod Corp | Paper making processes |
| US2727820A (en) * | 1952-04-29 | 1955-12-20 | Gen Aniline & Film Corp | Light-sensitive diazotype layers containing carboxamides |
| US2683088A (en) * | 1952-06-10 | 1954-07-06 | American Cyanamid Co | Soft bibulous sheet |
| US2732299A (en) * | 1952-07-22 | 1956-01-24 | Light sensitive | |
| US2774669A (en) * | 1953-04-13 | 1956-12-18 | Dick Co Ab | Diazotype reproduction process |
| US2786807A (en) * | 1953-04-23 | 1957-03-26 | Faximile Inc | Dry electrical recording medium |
| NL279582A (cg-RX-API-DMAC10.html) * | 1958-07-03 | |||
| BE597307A (cg-RX-API-DMAC10.html) * | 1959-11-23 |
-
1963
- 1963-03-19 US US266332A patent/US3199982A/en not_active Expired - Lifetime
- 1963-03-19 US US266230A patent/US3255007A/en not_active Expired - Lifetime
-
1964
- 1964-03-14 DE DE19641447737 patent/DE1447737A1/de active Pending
- 1964-03-17 BE BE645321D patent/BE645321A/xx unknown
- 1964-03-18 NL NL6402881A patent/NL6402881A/xx unknown
- 1964-03-19 GB GB50143/66A patent/GB1064975A/en not_active Expired
- 1964-03-19 AT AT242364A patent/AT277751B/de not_active IP Right Cessation
- 1964-03-19 GB GB11670/64A patent/GB1064974A/en not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3134113A1 (de) * | 1980-08-29 | 1982-04-01 | Ricoh Co., Ltd., Tokyo | Waermeentwickelbares diazo-kopier- und aufzeichnungsmaterial |
Also Published As
| Publication number | Publication date |
|---|---|
| AT277751B (de) | 1970-01-12 |
| US3199982A (en) | 1965-08-10 |
| GB1064975A (en) | 1967-04-12 |
| US3255007A (en) | 1966-06-07 |
| BE645321A (cg-RX-API-DMAC10.html) | 1964-09-17 |
| GB1064974A (en) | 1967-04-12 |
| NL6402881A (cg-RX-API-DMAC10.html) | 1964-09-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1447737A1 (de) | Durch Waerme entwickelbares Reproduktionsmaterial fuer die Diazotypie | |
| DE1547704A1 (de) | Verfahren zum Entwickeln belichteter photographischer Silberhalogenidschichten auf trockenem Wege | |
| DE1100464B (de) | Kopierschichten zur Herstellung von Bildern durch Einwirkung von Waerme | |
| DE1572103C3 (de) | Warmeentwickelbares Diazotypie material | |
| DE1572072C3 (de) | Wärmeentwicke lbares Diazotypiematerial | |
| DE864657C (de) | Material fuer die Herstellung von Diazotypien | |
| DE869007C (de) | Stabilisiertes Lichtpausmaterial fuer das Diazotypieverfahren | |
| DE2425781A1 (de) | Verwendung von aldonamiden zur herstellung photographischer materialien | |
| DE1173798B (de) | Photographisches Silbersalzdiffusions-uebertragungsverfahren und hierfuer geeignetesBildempfangsmaterial | |
| DE1261866B (de) | Thermographisches Kopierverfahren und Kopiermaterial hierfuer | |
| DE1622940A1 (de) | Nasskopierbares Diazotypiekopiermaterial | |
| DE1472796A1 (de) | Fotografisches Behandlungsmittel | |
| DE1572158A1 (de) | Bilderwiedergabemedium fuer positive Diazotypien | |
| DE959516C (de) | Photographisches Verfahren zur Bilderzeugung durch Kontaktuebertragung und Material zur Durchfuehrung des Verfahrens | |
| DE1221899B (de) | Lichtempfindliches Einkomponenten-Diazotypiematerial | |
| DE1422892A1 (de) | Entwicklungsverfahren | |
| DE1597631C3 (de) | Verfahren zur Herstellung von Bildkopien | |
| DE413885C (de) | Gemisch zum Lichtempfindlichmachen von Oberflaechen und Anwendungsweise | |
| DE810107C (de) | Lichtempfindliche Schichten fuer Diazotypien | |
| DE1572048A1 (de) | Waermeentwickelbares Diazotypiematerial | |
| DE1814402A1 (de) | Durch Erwaermen entwickelbares Kopiermaterial | |
| DE960049C (de) | Verfahren zur Herstellung von Zwischenkopien fuer Diazotypieverfahren | |
| DE1597620C3 (de) | Verfahren zur Herstellung von Diazotypiekopien | |
| DE831803C (de) | Lichtempfindliche Schichten fuer die Diazotypie | |
| DE1772010C3 (de) | Wärmeentwickelbares Diazotypiematerial |