DE1445705C3 - 13-Diphenylpyrazoline - Google Patents
13-DiphenylpyrazolineInfo
- Publication number
- DE1445705C3 DE1445705C3 DE1445705A DEF0036436A DE1445705C3 DE 1445705 C3 DE1445705 C3 DE 1445705C3 DE 1445705 A DE1445705 A DE 1445705A DE F0036436 A DEF0036436 A DE F0036436A DE 1445705 C3 DE1445705 C3 DE 1445705C3
- Authority
- DE
- Germany
- Prior art keywords
- formula
- lightening
- diphenylpyrazolines
- fibers
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003795 chemical substances by application Substances 0.000 claims description 10
- 238000005282 brightening Methods 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 150000003219 pyrazolines Chemical class 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 230000003287 optical effect Effects 0.000 claims description 2
- GFJSEPREQTXWHA-UHFFFAOYSA-N 2,5-diphenyl-1,3-dihydropyrazole Chemical class C1C=C(C=2C=CC=CC=2)NN1C1=CC=CC=C1 GFJSEPREQTXWHA-UHFFFAOYSA-N 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 6
- 239000000835 fiber Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 4
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 229920002239 polyacrylonitrile Polymers 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 230000002087 whitening effect Effects 0.000 description 3
- ZHYAENSFCNMJQQ-UHFFFAOYSA-N (4-methylsulfonylphenyl)hydrazine Chemical compound CS(=O)(=O)C1=CC=C(NN)C=C1 ZHYAENSFCNMJQQ-UHFFFAOYSA-N 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- CQXIEWRZWQDAQF-UHFFFAOYSA-N 1-[3-(dimethylamino)phenyl]propan-1-one;hydrochloride Chemical compound Cl.CCC(=O)C1=CC=CC(N(C)C)=C1 CQXIEWRZWQDAQF-UHFFFAOYSA-N 0.000 description 1
- CDOAFWKIRQCVHW-UHFFFAOYSA-N 2-(4-methylsulfonylphenyl)-5-phenyl-1,3-dihydropyrazole Chemical compound CS(=O)(=O)C1=CC=C(C=C1)N1NC(=CC1)C1=CC=CC=C1 CDOAFWKIRQCVHW-UHFFFAOYSA-N 0.000 description 1
- BZRQXLXNEUBJOK-UHFFFAOYSA-N 5-(4-chlorophenyl)-2-(4-methylsulfonylphenyl)-1,3-dihydropyrazole Chemical compound C1=CC(S(=O)(=O)C)=CC=C1N1NC(C=2C=CC(Cl)=CC=2)=CC1 BZRQXLXNEUBJOK-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000008366 benzophenones Chemical class 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- -1 p - methylsulfonyl - phenyl Chemical group 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 150000004031 phenylhydrazines Chemical class 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- DNXIASIHZYFFRO-UHFFFAOYSA-N pyrazoline Chemical compound C1CN=NC1 DNXIASIHZYFFRO-UHFFFAOYSA-N 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/06—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06L—DRY-CLEANING, WASHING OR BLEACHING FIBRES, FILAMENTS, THREADS, YARNS, FABRICS, FEATHERS OR MADE-UP FIBROUS GOODS; BLEACHING LEATHER OR FURS
- D06L4/00—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs
- D06L4/60—Optical bleaching or brightening
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Plural Heterocyclic Compounds (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
- Paper (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL290832D NL290832A (enExample) | 1962-03-31 | ||
| DE1445705A DE1445705C3 (de) | 1962-03-31 | 1962-03-31 | 13-Diphenylpyrazoline |
| CH216765A CH405702A (de) | 1962-03-31 | 1963-03-18 | Verwendung von Pyrazolinen als optische Aufheller |
| AT218063A AT242087B (de) | 1962-03-31 | 1963-03-20 | Aufhellungsmittel |
| GB11266/63A GB1013454A (en) | 1962-03-31 | 1963-03-21 | Sulphone-substituted derivatives of pyrazoline |
| BE629875A BE629875A (fr) | 1962-03-31 | 1963-03-21 | Agents d'éclaircissement optique |
| US267920A US3378389A (en) | 1962-03-31 | 1963-03-26 | 1, 3-diphenyl pyrazolines and method for brightening synthetic material therewith |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1445705A DE1445705C3 (de) | 1962-03-31 | 1962-03-31 | 13-Diphenylpyrazoline |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1445705A1 DE1445705A1 (de) | 1969-01-23 |
| DE1445705B2 DE1445705B2 (de) | 1977-09-15 |
| DE1445705C3 true DE1445705C3 (de) | 1978-05-11 |
Family
ID=7096444
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1445705A Expired DE1445705C3 (de) | 1962-03-31 | 1962-03-31 | 13-Diphenylpyrazoline |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3378389A (enExample) |
| AT (1) | AT242087B (enExample) |
| BE (1) | BE629875A (enExample) |
| CH (1) | CH405702A (enExample) |
| DE (1) | DE1445705C3 (enExample) |
| GB (1) | GB1013454A (enExample) |
| NL (1) | NL290832A (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1286897B (de) * | 1965-10-27 | 1969-01-09 | Kalle Ag | Zweikomponentendiazotypiematerial |
| US3998812A (en) * | 1968-04-19 | 1976-12-21 | Hoechst Aktiengesellschaft | Styryl-pyrazoline compounds |
| US3754964A (en) * | 1971-02-26 | 1973-08-28 | Ciba Geigy Corp | Process for the continuous optical brightening of acylated cellulose fibre material |
| US4045169A (en) * | 1971-09-09 | 1977-08-30 | Hoechst Aktiengesellschaft | 3-[3',4'-Dichloro-6'-alkyl-phenyl]-Δ 2-pyrazoline derivatives and their use as optical brighteners |
| US3957815A (en) * | 1971-09-09 | 1976-05-18 | Hoechst Aktiengesellschaft | 3-[3',4'-Dichloro-6'-alkyl-phenyl]-Δ2 -pyrazoline derivatives and their use as optical brighteners |
| US4071466A (en) * | 1973-03-02 | 1978-01-31 | Bayer Aktiengesellschaft | Optical brighteners |
| NL7408047A (enExample) * | 1973-06-21 | 1974-12-24 | ||
| US4085101A (en) * | 1973-07-18 | 1978-04-18 | Sandoz Ltd. | 1,3-Diaryl-2-pyrazoline derivatives |
| DE2502434A1 (de) * | 1974-01-29 | 1975-07-31 | Sandoz Ag | Neue verbindungen der pyrazolinreihe |
| DE3409429A1 (de) * | 1984-03-15 | 1985-09-26 | Bayer Ag, 5090 Leverkusen | Pyrazolinverbindungen |
| US4904794A (en) * | 1987-03-05 | 1990-02-27 | Ciba-Geigy Corporation | Pyrazoline compounds |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3133080A (en) * | 1964-05-12 | Optical whitening agents of the | ||
| US2610969A (en) * | 1952-09-16 | production of diaryl pyrazolines | ||
| US2740793A (en) * | 1956-04-03 | Pyrazolines | ||
| US2454075A (en) * | 1947-04-02 | 1948-11-16 | Cities Service Oil Co | Steam turbine lubricating oils |
| US2640056A (en) * | 1949-06-03 | 1953-05-26 | Ilford Ltd | Pyrazoline sulphonic acids |
| GB669590A (en) * | 1949-06-03 | 1952-04-02 | Ilford Ltd | Improvements in or relating to a process for improving the whiteness of colour materials |
| DE1008569B (de) * | 1954-08-04 | 1957-05-16 | Ferrania Spa | Verfahren zur Unterscheidung verschiedener Typen von Rohfilmen |
| CH333182A (de) * | 1955-02-15 | 1958-11-29 | Ciba Geigy | Verwendung von Di-imidazolen zum optischen Aufhellen von Materialien aus Acrylnitrilpolymerisaten |
| NL97340C (enExample) * | 1956-03-03 | |||
| NL215410A (enExample) * | 1956-03-16 | |||
| NL228562A (enExample) * | 1957-06-14 | 1900-01-01 | Geigy Ag J R | |
| US2985593A (en) * | 1958-09-26 | 1961-05-23 | Borden Co | Scintillator composition |
| US3131079A (en) * | 1960-08-12 | 1964-04-28 | Bayer Ag | Brightening of fiber material by coating with 1, 3-diaryl- and 1, 3, 5-triaryl pyrazoline derivatives |
-
0
- NL NL290832D patent/NL290832A/xx unknown
-
1962
- 1962-03-31 DE DE1445705A patent/DE1445705C3/de not_active Expired
-
1963
- 1963-03-18 CH CH216765A patent/CH405702A/de unknown
- 1963-03-20 AT AT218063A patent/AT242087B/de active
- 1963-03-21 GB GB11266/63A patent/GB1013454A/en not_active Expired
- 1963-03-21 BE BE629875A patent/BE629875A/fr unknown
- 1963-03-26 US US267920A patent/US3378389A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE1445705B2 (de) | 1977-09-15 |
| CH405702A (de) | 1966-01-15 |
| GB1013454A (en) | 1965-12-15 |
| US3378389A (en) | 1968-04-16 |
| DE1445705A1 (de) | 1969-01-23 |
| NL290832A (enExample) | |
| BE629875A (fr) | 1963-07-15 |
| AT242087B (de) | 1965-08-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1445705C3 (de) | 13-Diphenylpyrazoline | |
| DE1210764B (de) | Verfahren zum optischen Aufhellen von organischem Fasermaterial | |
| DE1089721B (de) | Aufhellungsmittel | |
| DE1469222B1 (de) | Pyrazolinderivate sowie ihre Herstellung und Verwendung | |
| DE2503639A1 (de) | Sulfonierter diazofarbstoff | |
| DE904646C (de) | Verfahren zur Aufhellung von Faserstoffen | |
| DE1080963B (de) | Aufhellungsmittel | |
| CH510364A (de) | Schaltungsanordnung zum Erzeugen eines Zeilenfrequenz-Sägezahnstroms, dessen Amplitude sich im Takte der Teilbildfrequenz ändert, in einer Fernsehwiedergabevorrichtung | |
| DE1016230B (de) | Verfahren zur Herstellung echter Faerbungen | |
| DE1419330A1 (de) | Optische Aufhellungsmittel | |
| DE1245306B (de) | Aufhellungsmittel | |
| DE1094696B (de) | Verfahren zum optischen Aufhellen von Materialien aus Polyestern | |
| AT251532B (de) | Optische Aufhellungsmittel | |
| DE1469220C3 (de) | 4-eckige Klammer auf Pyrazolyl-(1)-eckfge Klammer zu -naphthalin-1,8-dicarbonsäureimide | |
| DE1155418B (de) | Aufhellungsmittel | |
| DE1469218B1 (de) | 4,4'-Bis-triazinylamino-stilbenverbindungen und ihre Verwendung als reaktive optischeAufhellungsmittel | |
| DE2503654C2 (de) | Neuer sulfonierter Triazofarbstoff | |
| DE178308C (enExample) | ||
| AT162913B (de) | Verfahren zum Veredeln von Fasermaterialien | |
| DE1063571B (de) | Optische Aufhellungsmittel | |
| DE1279638C2 (de) | Verfahren zur Erzeugung von wasserunloeslichen Azofarbstoffen auf Textilmaterial aus Cellulose- oder Eiweissfasern | |
| DE1223380B (de) | Verfahren zur Herstellung von wasserloeslichen Phosphonitrilverbindungen | |
| DE728486C (de) | Verfahren zur Herstellung von Disazofarbstoffen | |
| DE1262206B (de) | Optische Aufhellungsmittel | |
| DE1469222C (de) | Pyrazolinderivate sowie ihre Herstellung und Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |