DE1443877B2 - - Google Patents
Info
- Publication number
- DE1443877B2 DE1443877B2 DE1443877A DE1443877A DE1443877B2 DE 1443877 B2 DE1443877 B2 DE 1443877B2 DE 1443877 A DE1443877 A DE 1443877A DE 1443877 A DE1443877 A DE 1443877A DE 1443877 B2 DE1443877 B2 DE 1443877B2
- Authority
- DE
- Germany
- Prior art keywords
- amino
- parts
- reaction
- acid
- pyridine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000000034 method Methods 0.000 claims description 15
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 12
- 150000001491 aromatic compounds Chemical class 0.000 claims description 6
- 230000002378 acidificating effect Effects 0.000 claims description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 17
- -1 amino, aminomethyl Chemical group 0.000 description 15
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 11
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 9
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 9
- 238000005886 esterification reaction Methods 0.000 description 8
- 230000032050 esterification Effects 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 125000003545 alkoxy group Chemical group 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 229920000742 Cotton Polymers 0.000 description 5
- 125000003277 amino group Chemical group 0.000 description 5
- 239000000987 azo dye Substances 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 239000002253 acid Substances 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 239000000975 dye Substances 0.000 description 3
- 238000004043 dyeing Methods 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 3
- 150000003457 sulfones Chemical class 0.000 description 3
- QQLILYBIARWEIF-UHFFFAOYSA-N 2-(2-hydroxyethylsulfonyl)ethanol Chemical compound OCCS(=O)(=O)CCO QQLILYBIARWEIF-UHFFFAOYSA-N 0.000 description 2
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 2
- 125000002843 carboxylic acid group Chemical group 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000985 reactive dye Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000001424 substituent group Chemical class 0.000 description 2
- MBDUIEKYVPVZJH-UHFFFAOYSA-N 1-ethylsulfonylethane Chemical compound CCS(=O)(=O)CC MBDUIEKYVPVZJH-UHFFFAOYSA-N 0.000 description 1
- DACUJXBUANTBKE-UHFFFAOYSA-N 4-acetamido-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(NC(=O)C)=CC(S(O)(=O)=O)=CC2=C1 DACUJXBUANTBKE-UHFFFAOYSA-N 0.000 description 1
- ZFRBZRZEKIOGQI-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-1,3-disulfonic acid Chemical compound C1=CC(O)=C2C(N)=C(S(O)(=O)=O)C=C(S(O)(=O)=O)C2=C1 ZFRBZRZEKIOGQI-UHFFFAOYSA-N 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- BEHLMOQXOSLGHN-UHFFFAOYSA-N benzenamine sulfate Chemical compound OS(=O)(=O)NC1=CC=CC=C1 BEHLMOQXOSLGHN-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000013021 overheating Methods 0.000 description 1
- FWFGVMYFCODZRD-UHFFFAOYSA-N oxidanium;hydrogen sulfate Chemical compound O.OS(O)(=O)=O FWFGVMYFCODZRD-UHFFFAOYSA-N 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/44—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring
- C09B62/503—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring the reactive group being an esterified or non-esterified hydroxyalkyl sulfonyl or mercaptoalkyl sulfonyl group, a quaternised or non-quaternised aminoalkyl sulfonyl group, a heterylmercapto alkyl sulfonyl group, a vinyl sulfonyl or a substituted vinyl sulfonyl group, or a thiophene-dioxide group
- C09B62/507—Azo dyes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/26—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C317/32—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C317/34—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having sulfone or sulfoxide groups and amino groups bound to carbon atoms of six-membered aromatic rings being part of the same non-condensed ring or of a condensed ring system containing that ring
- C07C317/38—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having sulfone or sulfoxide groups and amino groups bound to carbon atoms of six-membered aromatic rings being part of the same non-condensed ring or of a condensed ring system containing that ring with the nitrogen atom of at least one amino group being part of any of the groups, X being a hetero atom, Y being any atom, e.g. N-acylaminosulfones
- C07C317/40—Y being a hydrogen or a carbon atom
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/44—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring
- C09B62/503—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring the reactive group being an esterified or non-esterified hydroxyalkyl sulfonyl or mercaptoalkyl sulfonyl group, a quaternised or non-quaternised aminoalkyl sulfonyl group, a heterylmercapto alkyl sulfonyl group, a vinyl sulfonyl or a substituted vinyl sulfonyl group, or a thiophene-dioxide group
- C09B62/507—Azo dyes
- C09B62/51—Monoazo dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Coloring (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19511443877 DE1443877A1 (de) | 1951-01-28 | 1951-01-28 | Verfahren zur Herstellung von sauren Schwefelsaeureestern von beta-Hydroxyaethylsulfongruppen enthaltenden aromatischen Verbindungen |
| US430771A US3414579A (en) | 1951-01-28 | 1965-02-05 | Process for preparing acid sulfuric acid esters from aromatic compounds containing beta-hydroxy-ethylsulfonyl groups |
| CH200865A CH438279A (de) | 1951-01-28 | 1965-02-15 | Verfahren zur Herstellung von sauren Schwefelsäureestern von B-Hydroxyäthylsulfongruppen enthaltenden aromatischen Verbindungen |
| FR6051A FR1424904A (fr) | 1951-01-28 | 1965-02-18 | Procédé de préparation d'esters sulfuriques acides de composés aromatiques contenant des groupes beta-hydroxyéthyl-sulfonyles |
| GB7095/65A GB1080764A (en) | 1951-01-28 | 1965-02-18 | Process for the manufacture of ammonium salts of acid sulphuric acid esters from aromatic compounds containing ª-hydroxyethyl-sulphonyl groups |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19511443877 DE1443877A1 (de) | 1951-01-28 | 1951-01-28 | Verfahren zur Herstellung von sauren Schwefelsaeureestern von beta-Hydroxyaethylsulfongruppen enthaltenden aromatischen Verbindungen |
| DEF0042033 | 1964-02-18 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1443877A1 DE1443877A1 (de) | 1968-12-12 |
| DE1443877B2 true DE1443877B2 (OSRAM) | 1973-10-11 |
| DE1443877C3 DE1443877C3 (OSRAM) | 1974-05-16 |
Family
ID=25752087
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19511443877 Granted DE1443877A1 (de) | 1951-01-28 | 1951-01-28 | Verfahren zur Herstellung von sauren Schwefelsaeureestern von beta-Hydroxyaethylsulfongruppen enthaltenden aromatischen Verbindungen |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3414579A (OSRAM) |
| CH (1) | CH438279A (OSRAM) |
| DE (1) | DE1443877A1 (OSRAM) |
| GB (1) | GB1080764A (OSRAM) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0180732A1 (de) * | 1984-09-07 | 1986-05-14 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von 3-Acylamino-4-alkoxy-phenyl-beta-hydroxysulfonen und -sulfon-schwefelsäureestern |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1795162C3 (de) * | 1968-08-17 | 1978-11-16 | Bayer Ag, 5090 Leverkusen | Reaktivazofarbstoffe und ihre Verwendung zum Färben und Bedrucken von natürlichen und synthetischen Cellulose- oder Polyamidmaterialien |
| US4139527A (en) * | 1968-08-28 | 1979-02-13 | Hoechst Aktiengesellschaft | Fiber reactive monoazo dyestuffs containing a --SO2 --CH2 --CH2 --O--PO3 H2 group |
| US4029644A (en) * | 1969-12-19 | 1977-06-14 | Hoechst Aktiengesellschaft | Water-soluble, fiber-reactive monoazo dyestuffs |
| US3939141A (en) * | 1970-12-07 | 1976-02-17 | Hoechst Aktiengesellschaft | Water-soluble copper complex phenyl azo naphthalene reactive dyestuffs |
| DE2163389C3 (de) * | 1971-12-21 | 1980-10-23 | Hoechst Ag, 6000 Frankfurt | Wasserlösliche Reaktivfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben und Bedrucken von Fasermaterial |
| US4191703A (en) * | 1976-08-03 | 1980-03-04 | Hoechst Aktiengesellschaft | Process for the manufacture of sulfuric acid semi-ester compounds |
| JPS55108848A (en) * | 1979-02-13 | 1980-08-21 | Sumitomo Chem Co Ltd | Preparation of sulfuric half ester compound |
| IN152895B (OSRAM) * | 1979-07-19 | 1984-04-28 | Sumitomo Chemical Co | |
| US4482501A (en) * | 1979-07-19 | 1984-11-13 | Sumitomo Chemical Company, Limited | Process for producing aminoaryl-β-sulfatoethylsulfone |
| DE3009178A1 (de) * | 1980-03-11 | 1981-10-15 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von aminobenzanilid-schwefelsaeurehalbester-verbindung |
| DE3009174A1 (de) * | 1980-03-11 | 1981-10-15 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von sulfatoaethylsulfonyl-verbindungen |
| DE3129401A1 (de) * | 1981-07-25 | 1983-02-24 | Hoechst Ag, 6000 Frankfurt | Wasserloesliche disazoverbindungen und aromatische diamine als deren vorprodukte, verfahren zur herstellung dieser verbindungen und die verwendung der disazoverbindungen als farbstoffe |
| US4637034A (en) * | 1984-04-19 | 1987-01-13 | Hylsa, S.A. | Cooling panel for electric arc furnace |
| DE3530338A1 (de) * | 1985-08-24 | 1987-02-26 | Hoechst Ag | Verfahren zur herstellung von arylamino-nitro-phenyl-oxethylsulfonen |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1931962A (en) * | 1930-08-21 | 1933-10-24 | Ig Farbenindustrie Ag | Sulphuric acid esters of alcohols and derivatives thereof |
| US2452943A (en) * | 1946-05-18 | 1948-11-02 | Colgate Palmolive Peet Co | Catalyzed sulfamic acid sulfation |
| US2642427A (en) * | 1951-08-01 | 1953-06-16 | Abbott Lab | Piperazine salts of cyclopentanopolyhydrophenanthrene-3-monosulfates |
| US2849450A (en) * | 1956-04-18 | 1958-08-26 | Eastman Kodak Co | Manufacture of salts of alkyl acid sulfates in one step |
-
1951
- 1951-01-28 DE DE19511443877 patent/DE1443877A1/de active Granted
-
1965
- 1965-02-05 US US430771A patent/US3414579A/en not_active Expired - Lifetime
- 1965-02-15 CH CH200865A patent/CH438279A/de unknown
- 1965-02-18 GB GB7095/65A patent/GB1080764A/en not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0180732A1 (de) * | 1984-09-07 | 1986-05-14 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von 3-Acylamino-4-alkoxy-phenyl-beta-hydroxysulfonen und -sulfon-schwefelsäureestern |
Also Published As
| Publication number | Publication date |
|---|---|
| DE1443877C3 (OSRAM) | 1974-05-16 |
| GB1080764A (en) | 1967-08-23 |
| CH438279A (de) | 1967-06-30 |
| US3414579A (en) | 1968-12-03 |
| DE1443877A1 (de) | 1968-12-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE944577C (de) | Verfahren zur Herstellung kupfer- oder nickelhaltiger Disazofarbstoffe | |
| DE1443877C3 (OSRAM) | ||
| DE2134518C3 (de) | Verfahren zur Herstellung von Verbindungen der Benzothloxanthenreihe | |
| DE2009421C3 (de) | Wasserlösliche Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken von Leder, Wolle, Seide, Polyamid-, Polyurethan- und/oder nativen oder regenerierten Cellulosefasermaterialien | |
| DE2423546A1 (de) | Verfahren zur herstellung von 4-amino-1,8- naphthalsaeure-n-arylimidverbindungen | |
| DE2236107C2 (de) | Wasserlösliche Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE888733C (de) | Verfahren zur Herstellung von substantiven 2, 3-Oxynaphthoesaeure-aryliden | |
| DE2162858A1 (de) | 3-Sulfoalkyl-6-hydroxy-pyridone-(2), deren Herstellung und Verwendung | |
| DE636358C (de) | Verfahren zur Herstellung von kupferhaltigen Azofarbstoffen | |
| DE2016862C3 (de) | Verfahren zur Herstellung von I zu 1- und I zu 2-Metailkomplexazofarbstoffen | |
| DE638830C (de) | Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen | |
| DE652868C (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE941988C (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| CH273297A (de) | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. | |
| DE2448911A1 (de) | Azofarbstoffe | |
| DE913458C (de) | Verfahren zur Herstellung komplexer Chromverbindungen von Monoazofarbstoffen | |
| DE1153029B (de) | Verfahren zur Herstellung von o-Aminophenol-ª‰-hydroxyaethylsulfon-schwefelsaeureestern | |
| DE936350C (de) | Verfahren zur Herstellung von Mono- oder Polyazofarbstoffen | |
| DE1917740A1 (de) | 4-v-Triazolyl-4'-phenylstilbene | |
| DE1769108C (de) | Saure Anthrachinonfarbstoffe, ihre Herstellung und Verwendung | |
| DE843450C (de) | Verfahren zur Herstellung von o-Oxyazofarbstoffen | |
| AT343243B (de) | Verfahren zur herstellung von benzidinpigmenten | |
| AT239934B (de) | Verfahren zur Herstellung von neuen unsymmetrischen Chrommischkomplex-Azofarbstoffen | |
| DE925904C (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE2107427C2 (de) | Monoazoverbindungen, deren Herstellung und Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| SH | Request for examination between 03.10.1968 and 22.04.1971 | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |