DE1283989B - Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen und deren Metallkomplexverbindungen - Google Patents
Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen und deren MetallkomplexverbindungenInfo
- Publication number
- DE1283989B DE1283989B DEF43675A DEF0043675A DE1283989B DE 1283989 B DE1283989 B DE 1283989B DE F43675 A DEF43675 A DE F43675A DE F0043675 A DEF0043675 A DE F0043675A DE 1283989 B DE1283989 B DE 1283989B
- Authority
- DE
- Germany
- Prior art keywords
- acid
- parts
- group
- weight
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 metal complex compounds Chemical class 0.000 title claims description 41
- 238000000034 method Methods 0.000 title claims description 24
- 239000000987 azo dye Substances 0.000 title claims description 20
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 claims description 22
- 125000001424 substituent group Chemical group 0.000 claims description 16
- 150000001875 compounds Chemical class 0.000 claims description 13
- 150000003839 salts Chemical class 0.000 claims description 12
- 229910052751 metal Inorganic materials 0.000 claims description 11
- 239000002184 metal Substances 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 claims description 7
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical class OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 claims description 6
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 239000007864 aqueous solution Substances 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 239000000725 suspension Substances 0.000 claims description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 3
- 239000002152 aqueous-organic solution Substances 0.000 claims description 3
- 229910017052 cobalt Inorganic materials 0.000 claims description 3
- 239000010941 cobalt Substances 0.000 claims description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 3
- 239000010949 copper Substances 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 150000007522 mineralic acids Chemical class 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical group 0.000 claims description 2
- 230000009918 complex formation Effects 0.000 claims description 2
- 150000004696 coordination complex Chemical class 0.000 claims description 2
- 150000002816 nickel compounds Chemical class 0.000 claims 1
- 239000000975 dye Substances 0.000 description 60
- 239000000243 solution Substances 0.000 description 45
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 28
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 26
- 239000002253 acid Substances 0.000 description 26
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 25
- 239000000203 mixture Substances 0.000 description 24
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 20
- 238000005859 coupling reaction Methods 0.000 description 17
- 230000008878 coupling Effects 0.000 description 15
- 238000010168 coupling process Methods 0.000 description 15
- 238000004043 dyeing Methods 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 14
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 14
- 235000017557 sodium bicarbonate Nutrition 0.000 description 13
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 12
- 239000000843 powder Substances 0.000 description 12
- 229920000742 Cotton Polymers 0.000 description 11
- 239000000463 material Substances 0.000 description 10
- 239000001103 potassium chloride Substances 0.000 description 10
- 235000011164 potassium chloride Nutrition 0.000 description 10
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 8
- 235000019345 sodium thiosulphate Nutrition 0.000 description 8
- 206010039587 Scarlet Fever Diseases 0.000 description 7
- 239000011230 binding agent Substances 0.000 description 7
- 229910000029 sodium carbonate Inorganic materials 0.000 description 7
- 239000011780 sodium chloride Substances 0.000 description 7
- 239000004753 textile Substances 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 6
- 239000012954 diazonium Substances 0.000 description 6
- 150000001989 diazonium salts Chemical class 0.000 description 6
- 239000004744 fabric Substances 0.000 description 6
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 6
- 125000000542 sulfonic acid group Chemical group 0.000 description 6
- 238000011282 treatment Methods 0.000 description 6
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 125000004442 acylamino group Chemical group 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 229910052804 chromium Inorganic materials 0.000 description 4
- 239000011651 chromium Substances 0.000 description 4
- 238000006193 diazotization reaction Methods 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- 210000002268 wool Anatomy 0.000 description 4
- HGWQOFDAUWCQDA-UHFFFAOYSA-N 4-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(O)=CC=C(S(O)(=O)=O)C2=C1 HGWQOFDAUWCQDA-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical class O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 239000001044 red dye Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical class C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- TZBROGJRQUABOK-UHFFFAOYSA-N 4-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(O)=CC(S(O)(=O)=O)=CC2=C1 TZBROGJRQUABOK-UHFFFAOYSA-N 0.000 description 2
- HKWPUUYEGGDLJF-UHFFFAOYSA-N 4-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=CC=C2C(O)=CC(S(O)(=O)=O)=CC2=C1 HKWPUUYEGGDLJF-UHFFFAOYSA-N 0.000 description 2
- YLKCHWCYYNKADS-UHFFFAOYSA-N 5-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(O)=CC=CC2=C1S(O)(=O)=O YLKCHWCYYNKADS-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- CMUXEDXHXSGIRK-UHFFFAOYSA-N CN(C1=CC2=CC(=CC(=C2C=C1)O)S(=O)(=O)O)S(=O)(=O)C=C Chemical compound CN(C1=CC2=CC(=CC(=C2C=C1)O)S(=O)(=O)O)S(=O)(=O)C=C CMUXEDXHXSGIRK-UHFFFAOYSA-N 0.000 description 2
- 229920003043 Cellulose fiber Polymers 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 229920000297 Rayon Polymers 0.000 description 2
- 239000004133 Sodium thiosulphate Substances 0.000 description 2
- PJANXHGTPQOBST-VAWYXSNFSA-N Stilbene Natural products C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000004982 aromatic amines Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 150000005840 aryl radicals Chemical class 0.000 description 2
- DMLAVOWQYNRWNQ-UHFFFAOYSA-N azobenzene Chemical compound C1=CC=CC=C1N=NC1=CC=CC=C1 DMLAVOWQYNRWNQ-UHFFFAOYSA-N 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 125000006267 biphenyl group Chemical group 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 125000002843 carboxylic acid group Chemical group 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 150000008049 diazo compounds Chemical class 0.000 description 2
- ICIDZHMCYAIUIJ-UHFFFAOYSA-N dinaphthalen-1-yldiazene Chemical compound C1=CC=C2C(N=NC=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 ICIDZHMCYAIUIJ-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 125000002950 monocyclic group Chemical group 0.000 description 2
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 239000002964 rayon Substances 0.000 description 2
- 238000005185 salting out Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 235000021286 stilbenes Nutrition 0.000 description 2
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- OSTMCQXLMNDQGL-UHFFFAOYSA-N 1-azanylidyne-n-nitromethanesulfonamide Chemical compound [O-][N+](=O)NS(=O)(=O)C#N OSTMCQXLMNDQGL-UHFFFAOYSA-N 0.000 description 1
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical class C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- JVMSQRAXNZPDHF-UHFFFAOYSA-N 2,4-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(N)=C1 JVMSQRAXNZPDHF-UHFFFAOYSA-N 0.000 description 1
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 1
- HEAHMJLHQCESBZ-UHFFFAOYSA-N 2,5-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(N)C(S(O)(=O)=O)=C1 HEAHMJLHQCESBZ-UHFFFAOYSA-N 0.000 description 1
- QXSQBIQWTUTARS-UHFFFAOYSA-N 2-(5-oxo-1-phenyl-4h-pyrazol-3-yl)acetic acid Chemical compound O=C1CC(CC(=O)O)=NN1C1=CC=CC=C1 QXSQBIQWTUTARS-UHFFFAOYSA-N 0.000 description 1
- ZMCHBSMFKQYNKA-UHFFFAOYSA-N 2-aminobenzenesulfonic acid Chemical compound NC1=CC=CC=C1S(O)(=O)=O ZMCHBSMFKQYNKA-UHFFFAOYSA-N 0.000 description 1
- KNOUFVBOBNEGMH-UHFFFAOYSA-N 3,7-diaminonaphthalene-1,5-disulfonic acid Chemical compound C1=C(N)C=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 KNOUFVBOBNEGMH-UHFFFAOYSA-N 0.000 description 1
- ULUIMLJNTCECJU-UHFFFAOYSA-N 3-amino-4-hydroxybenzenesulfonate;hydron Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1O ULUIMLJNTCECJU-UHFFFAOYSA-N 0.000 description 1
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 1
- MTJGVAJYTOXFJH-UHFFFAOYSA-N 3-aminonaphthalene-1,5-disulfonic acid Chemical compound C1=CC=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 MTJGVAJYTOXFJH-UHFFFAOYSA-N 0.000 description 1
- OCISOSJGBCQHHN-UHFFFAOYSA-N 3-hydroxynaphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=CC(O)=CC2=C1 OCISOSJGBCQHHN-UHFFFAOYSA-N 0.000 description 1
- CWJQQASJVVAXKL-UHFFFAOYSA-N 4-(3-Methyl-5-oxo-4,5-dihydro-1H-pyrazol-1-yl)benzenesulfonic acid Chemical compound O=C1CC(C)=NN1C1=CC=C(S(O)(=O)=O)C=C1 CWJQQASJVVAXKL-UHFFFAOYSA-N 0.000 description 1
- RXLQXRJNFSMYDL-UHFFFAOYSA-N 4-(benzenesulfonamido)-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound C=12C(O)=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=CC=1NS(=O)(=O)C1=CC=CC=C1 RXLQXRJNFSMYDL-UHFFFAOYSA-N 0.000 description 1
- NZDXSXLYLMHYJA-UHFFFAOYSA-M 4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-n,n-dimethylaniline;chloride Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1N=NC1=[N+](C)C=CN1C NZDXSXLYLMHYJA-UHFFFAOYSA-M 0.000 description 1
- DACUJXBUANTBKE-UHFFFAOYSA-N 4-acetamido-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(NC(=O)C)=CC(S(O)(=O)=O)=CC2=C1 DACUJXBUANTBKE-UHFFFAOYSA-N 0.000 description 1
- SSOSFVFQZIRNQG-UHFFFAOYSA-N 4-hydroxynaphthalene-1,6-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C(O)=CC=C(S(O)(=O)=O)C2=C1 SSOSFVFQZIRNQG-UHFFFAOYSA-N 0.000 description 1
- SXCSXKQTOUHQIY-UHFFFAOYSA-N 4-hydroxynaphthalene-1,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(O)=CC=C(S(O)(=O)=O)C2=C1 SXCSXKQTOUHQIY-UHFFFAOYSA-N 0.000 description 1
- WPKYMUVIBSFZSU-UHFFFAOYSA-N 5-acetamido-4-hydroxynaphthalene-1,7-disulfonic acid Chemical compound C1=CC(O)=C2C(NC(=O)C)=CC(S(O)(=O)=O)=CC2=C1S(O)(=O)=O WPKYMUVIBSFZSU-UHFFFAOYSA-N 0.000 description 1
- REJHVSOVQBJEBF-OWOJBTEDSA-N 5-azaniumyl-2-[(e)-2-(4-azaniumyl-2-sulfonatophenyl)ethenyl]benzenesulfonate Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1\C=C\C1=CC=C(N)C=C1S(O)(=O)=O REJHVSOVQBJEBF-OWOJBTEDSA-N 0.000 description 1
- IMZSHPUSPMOODC-UHFFFAOYSA-N 5-oxo-1-phenyl-4h-pyrazole-3-carboxylic acid Chemical compound O=C1CC(C(=O)O)=NN1C1=CC=CC=C1 IMZSHPUSPMOODC-UHFFFAOYSA-N 0.000 description 1
- YKVBYISUDGOVDM-UHFFFAOYSA-N 6-acetamido-4-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(O)C2=CC(NC(=O)C)=CC=C21 YKVBYISUDGOVDM-UHFFFAOYSA-N 0.000 description 1
- KYARBIJYVGJZLB-UHFFFAOYSA-N 7-amino-4-hydroxy-2-naphthalenesulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KYARBIJYVGJZLB-UHFFFAOYSA-N 0.000 description 1
- XQAFHGXXHIZSGZ-UHFFFAOYSA-N 8-hydroxynaphthalene-1,6-disulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=C2C(O)=CC(S(O)(=O)=O)=CC2=C1 XQAFHGXXHIZSGZ-UHFFFAOYSA-N 0.000 description 1
- WDJHALXBUFZDSR-UHFFFAOYSA-N Acetoacetic acid Natural products CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 1
- NSDCRYRULURSKL-UHFFFAOYSA-N C(C)(=O)C=1C=C(C=C2C=C(C(=C(C=12)O)N)S(=O)(=O)O)S(=O)(=O)O Chemical compound C(C)(=O)C=1C=C(C=C2C=C(C(=C(C=12)O)N)S(=O)(=O)O)S(=O)(=O)O NSDCRYRULURSKL-UHFFFAOYSA-N 0.000 description 1
- TZASJHPXEDGRFV-UHFFFAOYSA-N CN(C1=CC=C(C=C1)C(=O)O)S(=O)(=O)C=C Chemical compound CN(C1=CC=C(C=C1)C(=O)O)S(=O)(=O)C=C TZASJHPXEDGRFV-UHFFFAOYSA-N 0.000 description 1
- REJHVSOVQBJEBF-UHFFFAOYSA-N DSD-acid Natural products OS(=O)(=O)C1=CC(N)=CC=C1C=CC1=CC=C(N)C=C1S(O)(=O)=O REJHVSOVQBJEBF-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical class OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- BIPJPKDBHQCDFT-UHFFFAOYSA-N N-(4-aminophenyl)-N-methylethenesulfonamide Chemical compound NC1=CC=C(C=C1)N(S(=O)(=O)C=C)C BIPJPKDBHQCDFT-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- DYRDKSSFIWVSNM-UHFFFAOYSA-N acetoacetanilide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1 DYRDKSSFIWVSNM-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229940051880 analgesics and antipyretics pyrazolones Drugs 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 description 1
- POJOORKDYOPQLS-UHFFFAOYSA-L barium(2+) 5-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylbenzenesulfonate Chemical compound [Ba+2].C1=C(Cl)C(C)=CC(N=NC=2C3=CC=CC=C3C=CC=2O)=C1S([O-])(=O)=O.C1=C(Cl)C(C)=CC(N=NC=2C3=CC=CC=C3C=CC=2O)=C1S([O-])(=O)=O POJOORKDYOPQLS-UHFFFAOYSA-L 0.000 description 1
- CLRSZXHOSMKUIB-UHFFFAOYSA-M benzenediazonium chloride Chemical compound [Cl-].N#[N+]C1=CC=CC=C1 CLRSZXHOSMKUIB-UHFFFAOYSA-M 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 150000004699 copper complex Chemical class 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- WOWBFOBYOAGEEA-UHFFFAOYSA-N diafenthiuron Chemical compound CC(C)C1=C(NC(=S)NC(C)(C)C)C(C(C)C)=CC(OC=2C=CC=CC=2)=C1 WOWBFOBYOAGEEA-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 229940083761 high-ceiling diuretics pyrazolone derivative Drugs 0.000 description 1
- 150000005204 hydroxybenzenes Chemical class 0.000 description 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 1
- ZBKFYXZXZJPWNQ-UHFFFAOYSA-N isothiocyanate group Chemical group [N-]=C=S ZBKFYXZXZJPWNQ-UHFFFAOYSA-N 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- ZDGGJQMSELMHLK-UHFFFAOYSA-N m-Trifluoromethylhippuric acid Chemical compound OC(=O)CNC(=O)C1=CC=CC(C(F)(F)F)=C1 ZDGGJQMSELMHLK-UHFFFAOYSA-N 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000000434 metal complex dye Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- FKNGBLJXFDHNES-UHFFFAOYSA-N n-(5-hydroxynaphthalen-2-yl)acetamide Chemical compound OC1=CC=CC2=CC(NC(=O)C)=CC=C21 FKNGBLJXFDHNES-UHFFFAOYSA-N 0.000 description 1
- TVEJCFVSJDAOMZ-UHFFFAOYSA-N n-(8-hydroxynaphthalen-2-yl)acetamide Chemical compound C1=CC=C(O)C2=CC(NC(=O)C)=CC=C21 TVEJCFVSJDAOMZ-UHFFFAOYSA-N 0.000 description 1
- YYHJPNVCYHVPJK-UHFFFAOYSA-N naphthalen-1-yl-(2-phenylnaphthalen-1-yl)diazene Chemical class C1=CC=CC=C1C1=CC=C(C=CC=C2)C2=C1N=NC1=CC=CC2=CC=CC=C12 YYHJPNVCYHVPJK-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 150000004780 naphthols Chemical class 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229960003540 oxyquinoline Drugs 0.000 description 1
- WXWCDTXEKCVRRO-UHFFFAOYSA-N para-Cresidine Chemical compound COC1=CC=C(C)C=C1N WXWCDTXEKCVRRO-UHFFFAOYSA-N 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000000985 reactive dye Substances 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 229920006297 regenerated protein fiber Polymers 0.000 description 1
- 239000010979 ruby Substances 0.000 description 1
- 229910001750 ruby Inorganic materials 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical compound C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 125000004963 sulfonylalkyl group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 1
- 235000019801 trisodium phosphate Nutrition 0.000 description 1
- 239000004552 water soluble powder Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/44—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring
- C09B62/523—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring the reactive group being an esterified or non-esterified hydroxyalkyl sulfonyl amido or hydroxyalkyl amino sulfonyl group, a quaternised or non-quaternised amino alkyl sulfonyl amido group, or a substituted alkyl amino sulfonyl group, or a halogen alkyl sulfonyl amido or halogen alkyl amino sulfonyl group or a vinyl sulfonylamido or a substituted vinyl sulfonamido group
- C09B62/527—Azo dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF43675A DE1283989B (de) | 1964-08-06 | 1964-08-06 | Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen und deren Metallkomplexverbindungen |
| US477000A US3426008A (en) | 1964-08-06 | 1965-08-03 | Water-soluble monoazo dyestuffs and their metal complex compounds |
| AT720565A AT254353B (de) | 1964-08-06 | 1965-08-04 | Verfahren zur Herstellung neuer, wasserlöslicher Mono- und Disazofarbstoffe und deren Metallkomplexverbindungen |
| CH287768A CH471877A (de) | 1964-08-06 | 1965-08-04 | Verfahren zur Herstellung von wasserlöslichen Azofarbstoffen oder deren Metallkomplexverbindungen |
| CH1094265A CH465090A (de) | 1964-08-06 | 1965-08-04 | Verfahren zur Herstellung von wasserlöslichen Azofarbstoffen und von deren Metallkomplexverbindungen |
| AT32966A AT254355B (de) | 1964-08-06 | 1965-08-04 | Verfahren zur Herstellung von neuen, wasserlöslichen Mono- und Disazofarbstoffen, sowie deren Metallkomplexverbindungen |
| GB33839/65A GB1112394A (en) | 1964-08-06 | 1965-08-06 | Water-soluble mono-and disazo dyestuffs containing a thiosulphuric acid group,complex metal compounds thereof and processes for their manufacture |
| FR27502A FR1442899A (fr) | 1964-08-06 | 1965-08-06 | Colorants azoïques et leur préparation |
| BE668012A BE668012A (enExample) | 1964-08-06 | 1965-08-06 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF43675A DE1283989B (de) | 1964-08-06 | 1964-08-06 | Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen und deren Metallkomplexverbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1283989B true DE1283989B (de) | 1968-11-28 |
Family
ID=7099675
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF43675A Pending DE1283989B (de) | 1964-08-06 | 1964-08-06 | Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen und deren Metallkomplexverbindungen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3426008A (enExample) |
| AT (2) | AT254355B (enExample) |
| BE (1) | BE668012A (enExample) |
| CH (2) | CH465090A (enExample) |
| DE (1) | DE1283989B (enExample) |
| FR (1) | FR1442899A (enExample) |
| GB (1) | GB1112394A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4096134A (en) * | 1975-12-08 | 1978-06-20 | Dynapol | Ethylsulfonate-alkylamine copolymers as colorant backbones |
| US4178422A (en) * | 1975-12-08 | 1979-12-11 | Dynapol | Ethylsulfonate-alkylamine copolymers as colorant backbones |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL128673C (enExample) * | 1964-03-24 | |||
| US4046754A (en) * | 1969-08-29 | 1977-09-06 | Hoechst Aktiengesellschaft | Water-soluble naphyhyl-azo-pyrazolone fiber reactive dyestuffs |
| US3966704A (en) * | 1970-03-06 | 1976-06-29 | Hoechst Aktiengesellschaft | Naphthylazo naphthyl copper complex dyestuffs |
| US4035351A (en) * | 1972-07-22 | 1977-07-12 | Hoechst Aktiengesellschaft | Water-soluble monoazo dyestuff containing a phenylene diazo component |
| FR2219964B1 (enExample) * | 1973-03-02 | 1978-03-03 | Ugine Kuhlmann | |
| DE2817033C2 (de) * | 1978-04-19 | 1983-03-24 | Basf Ag, 6700 Ludwigshafen | Reaktivfarbstoffe |
| DE3724931A1 (de) * | 1987-07-28 | 1989-02-09 | Hoechst Ag | Wasserloesliche disazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| DE3828849A1 (de) * | 1988-08-25 | 1990-03-01 | Hoechst Ag | Wasserloesliche azoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| DE3829781A1 (de) * | 1988-09-02 | 1990-03-15 | Hoechst Ag | Wasserloesliche azoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| JP2748720B2 (ja) * | 1991-05-23 | 1998-05-13 | ダイキン工業株式会社 | ハロゲン化炭化水素のフッ素化方法 |
| TW223098B (enExample) * | 1991-10-24 | 1994-05-01 | Hoechst Ag |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1254830A (fr) * | 1960-04-25 | 1961-02-24 | Hoechst Ag | Colorants azoïques solubles dans l'eau contenant un ou plusieurs groupes thiosulfuriques et leur préparation |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR799316A (fr) * | 1935-03-07 | 1936-06-11 | Ig Farbenindustrie Ag | Procédé pour préparer des colorants azoïques |
| US2245971A (en) * | 1937-02-03 | 1941-06-17 | Soc Of Chemical Ind | Azo dyestuffs |
| US3097908A (en) * | 1960-03-16 | 1963-07-16 | Hoechst Ag | Dyeings and prints possessing fastness to wet processing and their manufacture on cellulose materials and protein fibers |
| CH397115A (de) * | 1960-10-04 | 1965-08-15 | Hoechst Ag | Verfahren zur Herstellung wasserunlöslicher Farbstoffe |
| DE1289211B (de) * | 1961-08-26 | 1969-02-13 | Hoechst Ag | Verfahren zur Herstellung metallhaltiger Azofarbstoffe |
| BE639251A (enExample) * | 1962-10-26 |
-
1964
- 1964-08-06 DE DEF43675A patent/DE1283989B/de active Pending
-
1965
- 1965-08-03 US US477000A patent/US3426008A/en not_active Expired - Lifetime
- 1965-08-04 CH CH1094265A patent/CH465090A/de unknown
- 1965-08-04 CH CH287768A patent/CH471877A/de not_active IP Right Cessation
- 1965-08-04 AT AT32966A patent/AT254355B/de active
- 1965-08-04 AT AT720565A patent/AT254353B/de active
- 1965-08-06 FR FR27502A patent/FR1442899A/fr not_active Expired
- 1965-08-06 BE BE668012A patent/BE668012A/xx unknown
- 1965-08-06 GB GB33839/65A patent/GB1112394A/en not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1254830A (fr) * | 1960-04-25 | 1961-02-24 | Hoechst Ag | Colorants azoïques solubles dans l'eau contenant un ou plusieurs groupes thiosulfuriques et leur préparation |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4096134A (en) * | 1975-12-08 | 1978-06-20 | Dynapol | Ethylsulfonate-alkylamine copolymers as colorant backbones |
| US4107336A (en) * | 1975-12-08 | 1978-08-15 | Dynapol | Edibles containing colorants having ethylsulfonate-alkylamine backbones |
| US4178422A (en) * | 1975-12-08 | 1979-12-11 | Dynapol | Ethylsulfonate-alkylamine copolymers as colorant backbones |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1112394A (en) | 1968-05-01 |
| CH465090A (de) | 1968-11-15 |
| AT254353B (de) | 1967-05-26 |
| BE668012A (enExample) | 1966-02-07 |
| CH471877A (de) | 1969-04-30 |
| FR1442899A (fr) | 1966-06-17 |
| US3426008A (en) | 1969-02-04 |
| AT254355B (de) | 1967-05-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1283989B (de) | Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen und deren Metallkomplexverbindungen | |
| DE1289930B (de) | Verfahren zur Herstellung von Azofarbstoffen und deren Metallkomplexverbindungen | |
| DE1544539C3 (de) | Metallkomplex-Disazofarbstoffe und Verfahren zu ihrer Herstellung | |
| CH524673A (de) | Verfahren zur Herstellung von wasserlöslichen Disazofarbstoffen | |
| DE1230152B (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE1246906B (de) | Verfahren zur Herstellung von wasserloeslichen Mono- oder Disazofarbstoffen | |
| DE2812634A1 (de) | Anthrachinon-azo-reaktivfarbstoffe | |
| DE2852037C2 (enExample) | ||
| DE2154942A1 (de) | Neue monoazo-reaktivfarbstoffe, ihre verwendung und verfahren zu ihrer herstellung | |
| DE1204762B (de) | Verfahren zur Herstellung von aethionylamino-gruppenhaltigen Azofarbstoffen | |
| DE4425619A1 (de) | Reaktivfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung | |
| DE1276844B (de) | Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen | |
| DE1136039B (de) | Verfahren zur Herstellung von Disazofarbstoffen | |
| DE1136037B (de) | Verfahren zur Herstellung metallhaltiger Azofarbstoffe | |
| DE1544543C3 (de) | Wasserlösliche Metallkomplexazofarbstoffe, Verfahren zu ihrer Herstellung und ihrer Verwendung | |
| DE3835724A1 (de) | Faserreaktive metallisierte monoazoverbindungen | |
| DE1419840C (de) | Verfahren zur Herstellung von reaktiven Färb stoffen | |
| DE1134780B (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE1644200C3 (de) | Wasserlösliche Monoazofarbstoffe und Verfahren zu ihrer Herstellung | |
| DE1960895A1 (de) | Wasserloesliche Monoazofarbstoffe und Verfahren zu ihrer Herstellung | |
| DE1419840A1 (de) | Verfahren zur Herstellung von reaktiven Farbstoffen | |
| DE2047025A1 (de) | Wasserlösliche, gegebenenfalls metall haltige Disazofarbstoffe und Verfahren zu ihrer Herstellung | |
| DE3828849A1 (de) | Wasserloesliche azoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe | |
| DE1261257B (de) | Verfahren zur Herstellung von Farbstoffen | |
| DE1056758B (de) | Verfahren zur Herstellung von kupferbaren Disazofarbstoffen |