GB1112394A - Water-soluble mono-and disazo dyestuffs containing a thiosulphuric acid group,complex metal compounds thereof and processes for their manufacture - Google Patents
Water-soluble mono-and disazo dyestuffs containing a thiosulphuric acid group,complex metal compounds thereof and processes for their manufactureInfo
- Publication number
- GB1112394A GB1112394A GB33839/65A GB3383965A GB1112394A GB 1112394 A GB1112394 A GB 1112394A GB 33839/65 A GB33839/65 A GB 33839/65A GB 3383965 A GB3383965 A GB 3383965A GB 1112394 A GB1112394 A GB 1112394A
- Authority
- GB
- United Kingdom
- Prior art keywords
- formula
- metal compounds
- complex metal
- methyl
- dyestuffs
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000002736 metal compounds Chemical class 0.000 title abstract 4
- 239000002253 acid Substances 0.000 title abstract 2
- 238000004519 manufacturing process Methods 0.000 title abstract 2
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 title 1
- 238000000034 method Methods 0.000 title 1
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 abstract 4
- 230000008878 coupling Effects 0.000 abstract 4
- 238000010168 coupling process Methods 0.000 abstract 4
- 238000005859 coupling reaction Methods 0.000 abstract 4
- 239000000975 dye Substances 0.000 abstract 3
- JUGUOIHHNUVIOM-UHFFFAOYSA-N 4-[ethenylsulfonyl(methyl)amino]benzoyl chloride Chemical compound CN(C1=CC=C(C=C1)C(=O)Cl)S(=O)(=O)C=C JUGUOIHHNUVIOM-UHFFFAOYSA-N 0.000 abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- 229910052751 metal Inorganic materials 0.000 abstract 2
- 239000002184 metal Substances 0.000 abstract 2
- 125000001424 substituent group Chemical group 0.000 abstract 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract 1
- KZKGEEGADAWJFS-UHFFFAOYSA-N 2-amino-5-methoxybenzenesulfonic acid Chemical compound COC1=CC=C(N)C(S(O)(=O)=O)=C1 KZKGEEGADAWJFS-UHFFFAOYSA-N 0.000 abstract 1
- MTJGVAJYTOXFJH-UHFFFAOYSA-N 3-aminonaphthalene-1,5-disulfonic acid Chemical compound C1=CC=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 MTJGVAJYTOXFJH-UHFFFAOYSA-N 0.000 abstract 1
- KYARBIJYVGJZLB-UHFFFAOYSA-N 7-amino-4-hydroxy-2-naphthalenesulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KYARBIJYVGJZLB-UHFFFAOYSA-N 0.000 abstract 1
- 239000004133 Sodium thiosulphate Substances 0.000 abstract 1
- 229910052783 alkali metal Inorganic materials 0.000 abstract 1
- 150000001340 alkali metals Chemical group 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 229910052802 copper Inorganic materials 0.000 abstract 1
- 238000004043 dyeing Methods 0.000 abstract 1
- 238000010438 heat treatment Methods 0.000 abstract 1
- 239000000543 intermediate Substances 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- 229910052759 nickel Inorganic materials 0.000 abstract 1
- WXWCDTXEKCVRRO-UHFFFAOYSA-N para-Cresidine Chemical compound COC1=CC=C(C)C=C1N WXWCDTXEKCVRRO-UHFFFAOYSA-N 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 238000002360 preparation method Methods 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 abstract 1
- 235000019345 sodium thiosulphate Nutrition 0.000 abstract 1
- 229920002994 synthetic fiber Polymers 0.000 abstract 1
- -1 vinylsulphonylamine compound Chemical class 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/44—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring
- C09B62/523—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring the reactive group being an esterified or non-esterified hydroxyalkyl sulfonyl amido or hydroxyalkyl amino sulfonyl group, a quaternised or non-quaternised amino alkyl sulfonyl amido group, or a substituted alkyl amino sulfonyl group, or a halogen alkyl sulfonyl amido or halogen alkyl amino sulfonyl group or a vinyl sulfonylamido or a substituted vinyl sulfonamido group
- C09B62/527—Azo dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF43675A DE1283989B (de) | 1964-08-06 | 1964-08-06 | Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen und deren Metallkomplexverbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1112394A true GB1112394A (en) | 1968-05-01 |
Family
ID=7099675
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB33839/65A Expired GB1112394A (en) | 1964-08-06 | 1965-08-06 | Water-soluble mono-and disazo dyestuffs containing a thiosulphuric acid group,complex metal compounds thereof and processes for their manufacture |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3426008A (enExample) |
| AT (2) | AT254355B (enExample) |
| BE (1) | BE668012A (enExample) |
| CH (2) | CH471877A (enExample) |
| DE (1) | DE1283989B (enExample) |
| FR (1) | FR1442899A (enExample) |
| GB (1) | GB1112394A (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL128673C (enExample) * | 1964-03-24 | |||
| US4046754A (en) * | 1969-08-29 | 1977-09-06 | Hoechst Aktiengesellschaft | Water-soluble naphyhyl-azo-pyrazolone fiber reactive dyestuffs |
| US3966704A (en) * | 1970-03-06 | 1976-06-29 | Hoechst Aktiengesellschaft | Naphthylazo naphthyl copper complex dyestuffs |
| US4035351A (en) * | 1972-07-22 | 1977-07-12 | Hoechst Aktiengesellschaft | Water-soluble monoazo dyestuff containing a phenylene diazo component |
| FR2219964B1 (enExample) * | 1973-03-02 | 1978-03-03 | Ugine Kuhlmann | |
| US4096134A (en) * | 1975-12-08 | 1978-06-20 | Dynapol | Ethylsulfonate-alkylamine copolymers as colorant backbones |
| US4178422A (en) * | 1975-12-08 | 1979-12-11 | Dynapol | Ethylsulfonate-alkylamine copolymers as colorant backbones |
| DE2817033C2 (de) * | 1978-04-19 | 1983-03-24 | Basf Ag, 6700 Ludwigshafen | Reaktivfarbstoffe |
| DE3724931A1 (de) * | 1987-07-28 | 1989-02-09 | Hoechst Ag | Wasserloesliche disazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| DE3828849A1 (de) * | 1988-08-25 | 1990-03-01 | Hoechst Ag | Wasserloesliche azoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| DE3829781A1 (de) * | 1988-09-02 | 1990-03-15 | Hoechst Ag | Wasserloesliche azoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| JP2748720B2 (ja) * | 1991-05-23 | 1998-05-13 | ダイキン工業株式会社 | ハロゲン化炭化水素のフッ素化方法 |
| TW223098B (enExample) * | 1991-10-24 | 1994-05-01 | Hoechst Ag |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR799316A (fr) * | 1935-03-07 | 1936-06-11 | Ig Farbenindustrie Ag | Procédé pour préparer des colorants azoïques |
| US2245971A (en) * | 1937-02-03 | 1941-06-17 | Soc Of Chemical Ind | Azo dyestuffs |
| US3097908A (en) * | 1960-03-16 | 1963-07-16 | Hoechst Ag | Dyeings and prints possessing fastness to wet processing and their manufacture on cellulose materials and protein fibers |
| FR1254830A (fr) * | 1960-04-25 | 1961-02-24 | Hoechst Ag | Colorants azoïques solubles dans l'eau contenant un ou plusieurs groupes thiosulfuriques et leur préparation |
| NL269801A (nl) * | 1960-10-04 | 1964-03-10 | Farbwerke Höchst Ag | Werkwijze ter bereiding van in water onoplosbare kleurstoffen |
| DE1289211B (de) * | 1961-08-26 | 1969-02-13 | Hoechst Ag | Verfahren zur Herstellung metallhaltiger Azofarbstoffe |
| BE639251A (enExample) * | 1962-10-26 |
-
1964
- 1964-08-06 DE DEF43675A patent/DE1283989B/de active Pending
-
1965
- 1965-08-03 US US477000A patent/US3426008A/en not_active Expired - Lifetime
- 1965-08-04 AT AT32966A patent/AT254355B/de active
- 1965-08-04 AT AT720565A patent/AT254353B/de active
- 1965-08-04 CH CH287768A patent/CH471877A/de not_active IP Right Cessation
- 1965-08-04 CH CH1094265A patent/CH465090A/de unknown
- 1965-08-06 BE BE668012A patent/BE668012A/xx unknown
- 1965-08-06 GB GB33839/65A patent/GB1112394A/en not_active Expired
- 1965-08-06 FR FR27502A patent/FR1442899A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BE668012A (enExample) | 1966-02-07 |
| AT254353B (de) | 1967-05-26 |
| CH465090A (de) | 1968-11-15 |
| US3426008A (en) | 1969-02-04 |
| AT254355B (de) | 1967-05-26 |
| FR1442899A (fr) | 1966-06-17 |
| CH471877A (de) | 1969-04-30 |
| DE1283989B (de) | 1968-11-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1112394A (en) | Water-soluble mono-and disazo dyestuffs containing a thiosulphuric acid group,complex metal compounds thereof and processes for their manufacture | |
| GB1101750A (en) | New copper complexes of disazo dyestuffs containing a triazine nucleus | |
| GB1037981A (en) | New naphthalene monoazo triazine dyestuffs | |
| GB1089993A (en) | Water-soluble azo dyestuffs containing at least one cyclobutane residue and process for their manufacture | |
| GB1117747A (en) | Water-soluble mono and disazo dyestuffs and processes for their manufacture | |
| GB1037012A (en) | Polyazo dyes their production and use | |
| DE1006988B (de) | Verfahren zur Herstellung von chromhaltigen Azofarbstoffen | |
| GB1029747A (en) | Azo dyestuffs containing a pyrazole ring | |
| GB899714A (en) | New metal-complexes of monoazo dyestuffs containing unsaturated acylamino groups | |
| DE3132334A1 (de) | Asymmetrische 1:2-chromkomplexfarbstoffe | |
| ES392895A1 (es) | Procedimiento para la preparacion de colorantes monoazoicossolubles en agua. | |
| US3211718A (en) | Azo dyes and intermediates therefor | |
| GB1106048A (en) | Disazo dyes containing a heterocyclic residue and free from sulphonic acid groups | |
| GB760347A (en) | Azo-dyestuffs, metalliferous azo-dyestuffs and process for making them | |
| GB986655A (en) | Chromium-containing azo dyestuffs and process for their manufacture | |
| GB1097361A (en) | Water-soluble, metal-containing azo dyestuffs and process for their manufacture | |
| GB982479A (en) | New azo dyestuffs | |
| DE2623361A1 (de) | Reaktivfarbstoffe | |
| GB1028562A (en) | Disazo dyestuffs and their use in colour photography | |
| GB994979A (en) | Dicyclohexylamine salts of complex metal compounds of azo-dyestuffs of the pyrazolone series, their manufacture and use | |
| GB660196A (en) | Manufacture of new monoazo-dyestuffs | |
| GB1096895A (en) | 1:2-chromium and cobalt complexes of dyes containing sulphonic acid groups | |
| GB743957A (en) | Tetrakisazo dyestuffs | |
| GB629473A (en) | Metallized azomethine dyes and nylon dyed therewith | |
| GB838728A (en) | New disazo triazine dyestuffs |