DE1271703B - Verfahren zur Herstellung von 2, 6-Dichlorbenzonitril - Google Patents
Verfahren zur Herstellung von 2, 6-DichlorbenzonitrilInfo
- Publication number
- DE1271703B DE1271703B DEP1271A DE1271703A DE1271703B DE 1271703 B DE1271703 B DE 1271703B DE P1271 A DEP1271 A DE P1271A DE 1271703 A DE1271703 A DE 1271703A DE 1271703 B DE1271703 B DE 1271703B
- Authority
- DE
- Germany
- Prior art keywords
- dichlorobenzamide
- anhydride
- acid
- dichlorobenzonitrile
- mono
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 13
- YOYAIZYFCNQIRF-UHFFFAOYSA-N 2,6-dichlorobenzonitrile Chemical compound ClC1=CC=CC(Cl)=C1C#N YOYAIZYFCNQIRF-UHFFFAOYSA-N 0.000 title claims description 12
- 238000002360 preparation method Methods 0.000 title claims description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 23
- JHSPCUHPSIUQRB-UHFFFAOYSA-N 2,6-dichlorobenzamide Chemical compound NC(=O)C1=C(Cl)C=CC=C1Cl JHSPCUHPSIUQRB-UHFFFAOYSA-N 0.000 claims description 17
- 239000003054 catalyst Substances 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 12
- 150000008064 anhydrides Chemical class 0.000 claims description 10
- 239000011701 zinc Substances 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 230000018044 dehydration Effects 0.000 claims description 8
- 238000006297 dehydration reaction Methods 0.000 claims description 8
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 7
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 7
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 6
- -1 anhydride Acetic anhydride Chemical class 0.000 claims description 6
- 229910052725 zinc Inorganic materials 0.000 claims description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 5
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 claims description 4
- 239000010949 copper Substances 0.000 claims description 4
- 229910052723 transition metal Inorganic materials 0.000 claims description 4
- 239000004246 zinc acetate Substances 0.000 claims description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 229910052759 nickel Inorganic materials 0.000 claims description 3
- 230000000737 periodic effect Effects 0.000 claims description 3
- 150000003624 transition metals Chemical class 0.000 claims description 3
- MQRWBMAEBQOWAF-UHFFFAOYSA-N acetic acid;nickel Chemical compound [Ni].CC(O)=O.CC(O)=O MQRWBMAEBQOWAF-UHFFFAOYSA-N 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 229910017052 cobalt Inorganic materials 0.000 claims description 2
- 239000010941 cobalt Substances 0.000 claims description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 2
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 2
- 229940078494 nickel acetate Drugs 0.000 claims description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims 1
- 150000001661 cadmium Chemical class 0.000 claims 1
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 23
- 229910052751 metal Inorganic materials 0.000 description 8
- 239000002184 metal Substances 0.000 description 8
- 150000002825 nitriles Chemical class 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 7
- 150000007513 acids Chemical class 0.000 description 6
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- 125000003047 N-acetyl group Chemical group 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- 239000011787 zinc oxide Substances 0.000 description 2
- ZHLCARBDIRRRHD-UHFFFAOYSA-N 2-chloro-6-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC=CC(Cl)=C1C#N ZHLCARBDIRRRHD-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- GVNWZKBFMFUVNX-UHFFFAOYSA-N Adipamide Chemical compound NC(=O)CCCCC(N)=O GVNWZKBFMFUVNX-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000158147 Sator Species 0.000 description 1
- BTGRAWJCKBQKAO-UHFFFAOYSA-N adiponitrile Chemical compound N#CCCCCC#N BTGRAWJCKBQKAO-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940011182 cobalt acetate Drugs 0.000 description 1
- NVIVJPRCKQTWLY-UHFFFAOYSA-N cobalt nickel Chemical compound [Co][Ni][Co] NVIVJPRCKQTWLY-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 235000015243 ice cream Nutrition 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C253/00—Preparation of carboxylic acid nitriles
- C07C253/20—Preparation of carboxylic acid nitriles by dehydration of carboxylic acid amides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL6505181A NL6505181A (enExample) | 1965-04-23 | 1965-04-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1271703B true DE1271703B (de) | 1968-07-04 |
Family
ID=19793008
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP1271A Pending DE1271703B (de) | 1965-04-23 | 1966-04-21 | Verfahren zur Herstellung von 2, 6-Dichlorbenzonitril |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3417124A (enExample) |
| BE (1) | BE679838A (enExample) |
| CH (1) | CH478765A (enExample) |
| DE (1) | DE1271703B (enExample) |
| DK (1) | DK112728B (enExample) |
| GB (1) | GB1081838A (enExample) |
| NL (1) | NL6505181A (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4222935A (en) * | 1978-08-07 | 1980-09-16 | Imperial Chemical Industries Limited | Process for the manufacture of aromatic nitriles |
| CA1122220A (en) * | 1978-11-02 | 1982-04-20 | Hans Hoffmann-Paquotte | Process for the manufacture of an oxazole |
| US5965764A (en) * | 1997-08-06 | 1999-10-12 | Toray Industries, Inc. | Process for producing a nitrile |
| CN113563225B (zh) * | 2021-08-11 | 2023-07-04 | 武汉有机实业有限公司 | 一种苯代三聚氰胺副产物回收再利用合成苯甲腈的方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB323948A (en) * | 1929-02-11 | 1930-01-16 | Ig Farbenindustrie Ag | Improvements in the manufacture and production of nitriles |
| US2205076A (en) * | 1937-11-06 | 1940-06-18 | Du Pont | Preparation of long-chain aliphatic mononitriles |
| US2288687A (en) * | 1939-06-07 | 1942-07-07 | Celanese Corp | Manufacture of dinitriles |
-
1965
- 1965-04-23 NL NL6505181A patent/NL6505181A/xx unknown
-
1966
- 1966-04-08 US US541094A patent/US3417124A/en not_active Expired - Lifetime
- 1966-04-21 DK DK204966AA patent/DK112728B/da unknown
- 1966-04-21 CH CH579666A patent/CH478765A/de not_active IP Right Cessation
- 1966-04-21 BE BE679838D patent/BE679838A/xx unknown
- 1966-04-21 GB GB17551/66A patent/GB1081838A/en not_active Expired
- 1966-04-21 DE DEP1271A patent/DE1271703B/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| GB1081838A (en) | 1967-09-06 |
| US3417124A (en) | 1968-12-17 |
| NL6505181A (enExample) | 1966-10-24 |
| BE679838A (enExample) | 1966-10-21 |
| CH478765A (de) | 1969-09-30 |
| DK112728B (da) | 1969-01-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1468753B2 (de) | Verfahren zur herstellung von 3oxapentan-1,2,4,5-tetracarbonsaeure und aepfelsaeure | |
| DE1196178B (de) | Verfahren zur Herstellung von carbonsauren Salzen oder deren gegebenenfalls noch carbon-saeurehaltigen Loesungen | |
| AT395975B (de) | Verfahren zur herstellung eines organischen carbonsaeureanhydrids | |
| DE1271703B (de) | Verfahren zur Herstellung von 2, 6-Dichlorbenzonitril | |
| DE3308922A1 (de) | Verfahren zur herstellung von fettsaeureestern der ascorbinsaeure | |
| DE2751610A1 (de) | Verfahren zur herstellung von cyclopropanderivaten | |
| CH627155A5 (enExample) | ||
| DE2424372C3 (de) | Verfahren zur Herstellung von Isonitrosoacetaniliden | |
| CH390271A (de) | Verfahren zur Herstellung von diarylaminoaromatischen Dicarbonsäuren | |
| DE2437220C3 (de) | Verfahren zur Herstellung von Anthrachinon | |
| DE2410537C3 (de) | Verfahren zur Herstellung von aromatische n Dica rbonsä urediamiden | |
| DE1768114A1 (de) | Verfahren zur Herstellung von alpha-Ketoglutarsaeure | |
| DE3148987A1 (de) | Verfahren zur herstellung eines dialkalimetallsalzes einer aromatischen dicarbonsaeure | |
| DE2725379A1 (de) | Verfahren zur herstellung von n-alkenylverbindungen | |
| DE749643C (de) | Verfahren zur Herstellung ungesaettigter Carbonsaeureamide | |
| EP0084329B1 (de) | Verfahren zur Herstellung von 1,4-Bis-(dicyanomethylen)-cyclohexan | |
| DE2016278C3 (de) | Verfahren zur Herstellung von Kupferphthalocyaninen | |
| DE2032219C (de) | Verfahren zur Herstellung von cyanathy lierten aliphatischen Ketonen | |
| AT99680B (de) | Verfahren zur Darstellung von Alkaminestern aromatischer Aminocarbonsäuren. | |
| DE950289C (de) | Verfahren zur Herstellung von N-Carboxyalkylhexitylaminen | |
| AT352097B (de) | Verfahren zur herstellung von cyanformamid aus cyanwasserstoff und sauerstoff | |
| DE2410537B2 (de) | Verfahren zur herstellung von aromatischen dicarbonsaeurediamiden | |
| DE2402354C2 (de) | Verfahren zur Herstellung von Oxamid | |
| EP0110235B1 (de) | Verfahren zur Herstellung von Terephthalsäure-monoamid-Derivaten | |
| DE1910463A1 (de) | Verfahren zur Herstellung von Carbonsaeureanhydriden |