DE1266310B - Verfahren zur Herstellung von 6-Chlor- bzw. 6-Bromphthalid - Google Patents
Verfahren zur Herstellung von 6-Chlor- bzw. 6-BromphthalidInfo
- Publication number
- DE1266310B DE1266310B DEB82735A DEB0082735A DE1266310B DE 1266310 B DE1266310 B DE 1266310B DE B82735 A DEB82735 A DE B82735A DE B0082735 A DEB0082735 A DE B0082735A DE 1266310 B DE1266310 B DE 1266310B
- Authority
- DE
- Germany
- Prior art keywords
- parts
- bromophthalide
- phthalide
- chlorine
- bromine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- BELKVKMBIAENSA-UHFFFAOYSA-N 6-bromo-3h-2-benzofuran-1-one Chemical compound BrC1=CC=C2COC(=O)C2=C1 BELKVKMBIAENSA-UHFFFAOYSA-N 0.000 title claims description 9
- 238000000034 method Methods 0.000 title claims description 8
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- NUAVXUHBPNMQEV-UHFFFAOYSA-N 6-chloro-3h-2-benzofuran-1-one Chemical compound ClC1=CC=C2COC(=O)C2=C1 NUAVXUHBPNMQEV-UHFFFAOYSA-N 0.000 title description 5
- WNZQDUSMALZDQF-UHFFFAOYSA-N 2-benzofuran-1(3H)-one Chemical compound C1=CC=C2C(=O)OCC2=C1 WNZQDUSMALZDQF-UHFFFAOYSA-N 0.000 claims description 26
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 20
- 239000000203 mixture Substances 0.000 claims description 13
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 8
- 229910052794 bromium Inorganic materials 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 6
- 125000003277 amino group Chemical group 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 5
- 239000002904 solvent Substances 0.000 claims description 5
- PUGUQINMNYINPK-UHFFFAOYSA-N tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCN(C(=O)CCl)CC1 PUGUQINMNYINPK-UHFFFAOYSA-N 0.000 claims description 5
- 239000000126 substance Substances 0.000 claims description 4
- 239000003513 alkali Substances 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 230000026030 halogenation Effects 0.000 description 6
- 238000005658 halogenation reaction Methods 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 235000013877 carbamide Nutrition 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- -1 phthalide Chemical class 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 239000012943 hotmelt Substances 0.000 description 3
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- ADCBKYIHQQCFHE-UHFFFAOYSA-N 1,3-dimethyl-1,3-diphenylurea Chemical compound C=1C=CC=CC=1N(C)C(=O)N(C)C1=CC=CC=C1 ADCBKYIHQQCFHE-UHFFFAOYSA-N 0.000 description 1
- GWEHVDNNLFDJLR-UHFFFAOYSA-N 1,3-diphenylurea Chemical compound C=1C=CC=CC=1NC(=O)NC1=CC=CC=C1 GWEHVDNNLFDJLR-UHFFFAOYSA-N 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical compound NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- OHLUUHNLEMFGTQ-UHFFFAOYSA-N N-methylacetamide Chemical compound CNC(C)=O OHLUUHNLEMFGTQ-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- DWLVWMUCHSLGSU-UHFFFAOYSA-N dimethylcarbamic acid Chemical compound CN(C)C(O)=O DWLVWMUCHSLGSU-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- UXZAJSZFFARTEI-GUMHCPJTSA-N methyl (2R,3S)-3-(methanesulfonamido)-2-[(4-phenylcyclohexyl)oxymethyl]piperidine-1-carboxylate Chemical compound COC(=O)N1CCC[C@H](NS(C)(=O)=O)[C@@H]1COC1CCC(CC1)c1ccccc1 UXZAJSZFFARTEI-GUMHCPJTSA-N 0.000 description 1
- WZHFFMIYUIHVET-UHFFFAOYSA-N n,n-dicyclohexylformamide Chemical compound C1CCCCC1N(C=O)C1CCCCC1 WZHFFMIYUIHVET-UHFFFAOYSA-N 0.000 description 1
- XNBKKRFABABBPM-UHFFFAOYSA-N n,n-diphenylcarbamoyl chloride Chemical compound C=1C=CC=CC=1N(C(=O)Cl)C1=CC=CC=C1 XNBKKRFABABBPM-UHFFFAOYSA-N 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- WFIZEGIEIOHZCP-UHFFFAOYSA-M potassium formate Chemical compound [K+].[O-]C=O WFIZEGIEIOHZCP-UHFFFAOYSA-M 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 1
- 229940080818 propionamide Drugs 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/87—Benzo [c] furans; Hydrogenated benzo [c] furans
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Furan Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB82735A DE1266310B (de) | 1965-07-08 | 1965-07-08 | Verfahren zur Herstellung von 6-Chlor- bzw. 6-Bromphthalid |
| BE683385D BE683385A (enrdf_load_html_response) | 1965-07-08 | 1966-06-29 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB82735A DE1266310B (de) | 1965-07-08 | 1965-07-08 | Verfahren zur Herstellung von 6-Chlor- bzw. 6-Bromphthalid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1266310B true DE1266310B (de) | 1968-04-18 |
Family
ID=6981630
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEB82735A Pending DE1266310B (de) | 1965-07-08 | 1965-07-08 | Verfahren zur Herstellung von 6-Chlor- bzw. 6-Bromphthalid |
Country Status (2)
| Country | Link |
|---|---|
| BE (1) | BE683385A (enrdf_load_html_response) |
| DE (1) | DE1266310B (enrdf_load_html_response) |
-
1965
- 1965-07-08 DE DEB82735A patent/DE1266310B/de active Pending
-
1966
- 1966-06-29 BE BE683385D patent/BE683385A/fr unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE683385A (enrdf_load_html_response) | 1966-12-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2855764C2 (enrdf_load_html_response) | ||
| DE3587304T2 (de) | Herstellung von aromatischen carbonylverbindungen. | |
| DE2216804A1 (de) | Verfahren zur Herstellung von 2 Nitro-4,6 dichlor 5 methylphenol | |
| DE1266310B (de) | Verfahren zur Herstellung von 6-Chlor- bzw. 6-Bromphthalid | |
| DE1593023A1 (de) | Verfahren zur Herstellung organischer fluorierter Verbindungen | |
| DE1642915A1 (de) | Verfahren zur Herstellung von Methylen-bis-anilinen | |
| DE1229663B (de) | Verfahren zur Herstellung von 4-Brom-3-hydroxychinophthalon | |
| DE1173907B (de) | Verfahren zur Herstellung von 1, 4-Diamino-5, 8-dichlor-anthrachinonen | |
| DE1300114B (de) | Verfahren zur Herstellung von 5-Chlor-2-(2'-hydroxylamino-acetamido)-benzophenon | |
| EP0315138B1 (de) | Verfahren zur Herstellung von 6-Chorisatosäureanhydrid | |
| DE1169438B (de) | Verfahren zur Herstellung von Derivaten des ªÏ-Hydroxytiglinaldehyds | |
| AT216511B (de) | Verfahren zur Herstellung von 1,2,4-Benzothiadiazin-1,1-dioxydverbindungen | |
| DE2206863A1 (de) | Verfahren zur herstellung von 6-chlorisatosaeureanhydrid | |
| AT226677B (de) | Verfahren zur Herstellung von Bromderivaten organischer Verbindungen mit mindestens 2 nicht-kondensierten Benzolkernen, insbesondere des Diphenyls, des Diphenyläthers oder deren Homologe, die 4 und mehr Bromatome im Molekül enthalten | |
| AT152838B (de) | Verfahren zur Darstellung von Pyridinderivaten. | |
| DE956260C (de) | Verfahren zur Herstellung von Kuepenfarbstoffen | |
| DE1543781C3 (de) | Verfahren zur Herstellung von Alkylarylaminen | |
| DE1178052B (de) | Verfahren zur Herstellung von heterocyclischen Verbindungne, die mindestens ein einem Ringstickstoffatom benachbartes Chloratom enthalten. | |
| DE1445521C (de) | Verfahren zur Herstellung von In dazol (3) carbonsauren | |
| CH314640A (de) | Verfahren zur Herstellung von Hydrazobenzolen | |
| DE1795102A1 (de) | Verfahren zur Herstellung stickstoffhaltiger aromatischer Verbindungen | |
| DE1568210A1 (de) | Verfahren zur Herstellung von 2,2-Dimethylbernsteinsaeure | |
| AT295855B (de) | Verfahren zur Herstellung von Polyacyloxamidrazonen | |
| DE518406C (de) | Verfahren zur Darstellung von 1-Aroylamino-4-halogenanthrachinonen | |
| DE2302319C3 (de) | Verfahren zur Herstellung von Brommethyl-pentamethylbenzol |