DE1249851B - Morel Ariesheim (Schweiz) j Verfahren zur Herstellung neuer Phenoxyessigsäure amide - Google Patents
Morel Ariesheim (Schweiz) j Verfahren zur Herstellung neuer Phenoxyessigsäure amideInfo
- Publication number
- DE1249851B DE1249851B DENDAT1249851D DE1249851DA DE1249851B DE 1249851 B DE1249851 B DE 1249851B DE NDAT1249851 D DENDAT1249851 D DE NDAT1249851D DE 1249851D A DE1249851D A DE 1249851DA DE 1249851 B DE1249851 B DE 1249851B
- Authority
- DE
- Germany
- Prior art keywords
- phenoxyacetic acid
- methoxy
- acid
- general formula
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 7
- AOPRXJXHLWYPQR-UHFFFAOYSA-N 2-phenoxyacetamide Chemical class NC(=O)COC1=CC=CC=C1 AOPRXJXHLWYPQR-UHFFFAOYSA-N 0.000 title claims description 6
- 238000004519 manufacturing process Methods 0.000 title description 3
- 235000002779 Morchella esculenta Nutrition 0.000 title 1
- 240000002769 Morchella esculenta Species 0.000 title 1
- -1 hydroxyl compound Chemical class 0.000 claims description 16
- 238000002360 preparation method Methods 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 2
- 239000005977 Ethylene Substances 0.000 claims description 2
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical group C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 22
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 14
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 9
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- KEHIGJYIUKCJMK-UHFFFAOYSA-N 3-[4-[2-(diethylamino)-2-oxoethoxy]-3-methoxyphenyl]propyl acetate Chemical compound C(C)N(C(COC1=C(C=C(C=C1)CCCOC(C)=O)OC)=O)CC KEHIGJYIUKCJMK-UHFFFAOYSA-N 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- SQPLCDLNGVVVEZ-UHFFFAOYSA-N N,N-diethyl-2-[4-(3-hydroxypropyl)-2-methoxyphenoxy]acetamide Chemical compound C(C)N(C(COC1=C(C=C(C=C1)CCCO)OC)=O)CC SQPLCDLNGVVVEZ-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 238000004508 fractional distillation Methods 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 230000032050 esterification Effects 0.000 description 3
- 238000005886 esterification reaction Methods 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 235000009518 sodium iodide Nutrition 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 2
- CQQUWTMMFMJEFE-UHFFFAOYSA-N 2-chloro-n,n-diethylacetamide Chemical compound CCN(CC)C(=O)CCl CQQUWTMMFMJEFE-UHFFFAOYSA-N 0.000 description 2
- VAJVDSVGBWFCLW-UHFFFAOYSA-N 3-Phenyl-1-propanol Chemical compound OCCCC1=CC=CC=C1 VAJVDSVGBWFCLW-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- ZBYQSKJFXCNMHE-UHFFFAOYSA-N CC(OCCCC(C=C1)=CC(OC)=C1OCC(N1CCCC1)=O)=O Chemical compound CC(OCCCC(C=C1)=CC(OC)=C1OCC(N1CCCC1)=O)=O ZBYQSKJFXCNMHE-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical class C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 230000003444 anaesthetic effect Effects 0.000 description 2
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- UZBQIPPOMKBLAS-UHFFFAOYSA-N diethylazanide Chemical compound CC[N-]CC UZBQIPPOMKBLAS-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- LCPDWSOZIOUXRV-UHFFFAOYSA-N phenoxyacetic acid Chemical compound OC(=O)COC1=CC=CC=C1 LCPDWSOZIOUXRV-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- KEJXLQUPYHWCNM-UHFFFAOYSA-N propanidid Chemical compound CCCOC(=O)CC1=CC=C(OCC(=O)N(CC)CC)C(OC)=C1 KEJXLQUPYHWCNM-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- OOCCDEMITAIZTP-QPJJXVBHSA-N (E)-cinnamyl alcohol Chemical compound OC\C=C\C1=CC=CC=C1 OOCCDEMITAIZTP-QPJJXVBHSA-N 0.000 description 1
- NBORIVYRHRODGZ-UHFFFAOYSA-N 2-[4-(3-acetyloxypropyl)-2-methoxyphenoxy]acetic acid Chemical compound COC1=C(OCC(=O)O)C=CC(=C1)CCCOC(C)=O NBORIVYRHRODGZ-UHFFFAOYSA-N 0.000 description 1
- SUICNMCMERZCDV-UHFFFAOYSA-N 2-[4-(3-hydroxypropyl)-2-methoxyphenoxy]-1-pyrrolidin-1-ylethanone Chemical compound COC1=C(OCC(=O)N2CCCC2)C=CC(=C1)CCCO SUICNMCMERZCDV-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 238000006418 Brown reaction Methods 0.000 description 1
- YNWUMNMTLOZBTG-UHFFFAOYSA-N C(C)N(C(COC1=C(C=C(C=C1)CCCCl)OC)=O)CC Chemical compound C(C)N(C(COC1=C(C=C(C=C1)CCCCl)OC)=O)CC YNWUMNMTLOZBTG-UHFFFAOYSA-N 0.000 description 1
- BNOCZKHBSYNXJY-UHFFFAOYSA-N C(C)N(C(COC1=C(C=C(C=C1)CCCOS(=O)(=O)C1=CC=C(C)C=C1)OC)=O)CC Chemical compound C(C)N(C(COC1=C(C=C(C=C1)CCCOS(=O)(=O)C1=CC=C(C)C=C1)OC)=O)CC BNOCZKHBSYNXJY-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical class [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 229940035674 anesthetics Drugs 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- MWOMNLDJNQWJMK-UHFFFAOYSA-N dihydroconiferyl alcohol Chemical compound COC1=CC(CCCO)=CC=C1O MWOMNLDJNQWJMK-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000003193 general anesthetic agent Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000002497 iodine compounds Chemical class 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 229940011051 isopropyl acetate Drugs 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000011133 lead Chemical class 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N methanesulfonic acid Substances CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 230000003533 narcotic effect Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000011591 potassium Chemical class 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000011477 surgical intervention Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/185—Radicals derived from carboxylic acids from aliphatic carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrrole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH163364A CH435240A (de) | 1964-02-11 | 1964-02-11 | Verfahren zur Herstellung neuer Aryloxyessigsäureamide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1249851B true DE1249851B (de) | 1967-09-14 |
Family
ID=4215000
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT1249851D Pending DE1249851B (de) | 1964-02-11 | Morel Ariesheim (Schweiz) j Verfahren zur Herstellung neuer Phenoxyessigsäure amide |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3484527A (cg-RX-API-DMAC10.html) |
| AT (1) | AT253487B (cg-RX-API-DMAC10.html) |
| BE (1) | BE659531A (cg-RX-API-DMAC10.html) |
| CH (1) | CH435240A (cg-RX-API-DMAC10.html) |
| DE (1) | DE1249851B (cg-RX-API-DMAC10.html) |
| DK (1) | DK109138C (cg-RX-API-DMAC10.html) |
| ES (2) | ES309176A1 (cg-RX-API-DMAC10.html) |
| FR (2) | FR1426481A (cg-RX-API-DMAC10.html) |
| GB (1) | GB1031090A (cg-RX-API-DMAC10.html) |
| IL (1) | IL22958A (cg-RX-API-DMAC10.html) |
| NL (1) | NL6501645A (cg-RX-API-DMAC10.html) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5215649A (en) * | 1990-05-02 | 1993-06-01 | Exxon Chemical Patents Inc. | Method for upgrading steam cracker tars |
| RU2315037C2 (ru) * | 2002-01-25 | 2008-01-20 | Тереванс, Инк. | Замещенные эфиры фенилуксусной кислоты в качестве короткодействующих седативных снотворных агентов для кратковременной анестезии и создания седативного эффекта, промежуточное соединение, фармацевтическая композиция и применение |
| ES2332514T3 (es) * | 2003-07-23 | 2010-02-08 | Theravance, Inc. | Composiciones farmaceuticas de un agente hipnotico sedante de accion corta. |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3012936A (en) * | 1958-07-03 | 1961-12-12 | Geigy Chem Corp | Anaesthetic composition |
-
0
- DE DENDAT1249851D patent/DE1249851B/de active Pending
-
1964
- 1964-02-11 CH CH163364A patent/CH435240A/de unknown
-
1965
- 1965-02-10 ES ES0309176A patent/ES309176A1/es not_active Expired
- 1965-02-10 GB GB5688/65A patent/GB1031090A/en not_active Expired
- 1965-02-10 DK DK443665AA patent/DK109138C/da active
- 1965-02-10 FR FR5057A patent/FR1426481A/fr not_active Expired
- 1965-02-10 IL IL22958A patent/IL22958A/xx unknown
- 1965-02-10 BE BE659531D patent/BE659531A/xx unknown
- 1965-02-10 NL NL6501645A patent/NL6501645A/xx unknown
- 1965-02-10 AT AT118865A patent/AT253487B/de active
- 1965-02-10 ES ES0309175A patent/ES309175A1/es not_active Expired
- 1965-05-07 FR FR16299A patent/FR4400M/fr not_active Expired
-
1967
- 1967-03-20 US US624625A patent/US3484527A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CH435240A (de) | 1967-05-15 |
| ES309175A1 (es) | 1965-12-16 |
| AT253487B (de) | 1967-04-10 |
| ES309176A1 (es) | 1965-12-16 |
| DK109138C (da) | 1968-03-25 |
| GB1031090A (en) | 1966-05-25 |
| US3484527A (en) | 1969-12-16 |
| FR4400M (cg-RX-API-DMAC10.html) | 1966-10-10 |
| IL22958A (en) | 1968-07-25 |
| FR1426481A (fr) | 1966-01-28 |
| NL6501645A (cg-RX-API-DMAC10.html) | 1965-08-12 |
| BE659531A (cg-RX-API-DMAC10.html) | 1965-08-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2129124C3 (cg-RX-API-DMAC10.html) | ||
| CH615431A5 (cg-RX-API-DMAC10.html) | ||
| DE1249851B (de) | Morel Ariesheim (Schweiz) j Verfahren zur Herstellung neuer Phenoxyessigsäure amide | |
| DE2404158B2 (de) | Verfahren zur Herstellung eines 2-(4-Alkylphenyl)-propion-aldehyds | |
| CH417630A (de) | Verfahren zur Herstellung von neuen cyclischen 2,3-O-Acetalen und 2,3-O-Ketalen von Butantetrolestern | |
| DE2207098A1 (de) | Verfahren zur herstellung von 2,5-dimethyl-furan-3-carbon-saeureestern | |
| DE2447053A1 (de) | Verfahren zur herstellung eines schwefelhaltigen pyridinderivats | |
| DE2210650C3 (de) | 2-Amino-6-alkoxy-4,5-dihydropyridin-3,5-dicarbonsäureester, Verfahren zu ihrer Herstellung sowie diese enthaltende Arzneimittel | |
| AT263790B (de) | Verfahren zur Herstellung von neuen 2,3,4,5-Tetrahydro-1,4-benzoxazepinen, von deren Salzen und optisch isomeren Formen | |
| DE881663C (de) | Verfahren zur Herstellung von 1-(p-Oxyphenyl)-2-(ª‡-methyl-ª†-phenyl-propylamino)-propanen | |
| DE1543602C3 (de) | Substituierte Disulfonamide sowie deren Salze mit nichttoxischen Basen und Verfahren zu ihrer Herstellung | |
| AT303025B (de) | Verfahren zur herstellung neuer indolderivate und ihrer saeureadditionssalze | |
| DE1133395B (de) | Verfahren zur Herstellung von herz- und kreislaufwirksamen Phenylalkylaminen | |
| AT228211B (de) | Verfahren zur Herstellung von neuen Phenothiazinderivaten, sowie von Säureadditionssalzen und quartären Salzen dieser Phenothiazinderivate | |
| AT230387B (de) | Verfahren zur Herstellung von spirocyclischen Verbindungen | |
| AT299169B (de) | Verfahren zur Herstellung der neuen α-[p-(1-Cyclohexenyl)-phenyl]-propionsäure | |
| AT226707B (de) | Verfahren zur Herstellung von neuen 11b-Benzo-(a)-chinolizinderivaten | |
| AT237599B (de) | Verfahren zur Herstellung von neuen Aminen, sowie deren Säureadditionssalzen | |
| AT218519B (de) | Verfahren zur Herstellung von neuen Pyrazol-Derivaten | |
| AT258280B (de) | Verfahren zur Herstellung von neuen Benzofuranderivaten und ihren Salzen | |
| AT293362B (de) | Verfahren zur Herstellung von N-substituierten β-Aminopropiophenonen | |
| AT289832B (de) | Verfahren zur Herstellung von neuen substituierten Phenylcarbaminsäureestern von zyklischen Aminoalkoholen und ihren optischen Isomeren sowie ihrer Säureadditionssalze | |
| DE1097999B (de) | Verfahren zur Herstellung von 1, 2, 3, 4, 6, 7, 12, 12b-Octahydroindolo[2, 3-a]chinolizinen | |
| DE1181233B (de) | Verfahren zur Herstellung von herz- und kreislaufwirksamen araliphatischen Aminen | |
| DE2060573A1 (de) | Neue Carbonsaeuren und Verfahren zu ihrer Herstellung |