DE1247348B - Sensibilisiertes Aufzeichnungsmaterial zur Verwendung mit normalerweise farblosem Markierungsstoff - Google Patents
Sensibilisiertes Aufzeichnungsmaterial zur Verwendung mit normalerweise farblosem MarkierungsstoffInfo
- Publication number
- DE1247348B DE1247348B DEN27784A DEN0027784A DE1247348B DE 1247348 B DE1247348 B DE 1247348B DE N27784 A DEN27784 A DE N27784A DE N0027784 A DEN0027784 A DE N0027784A DE 1247348 B DE1247348 B DE 1247348B
- Authority
- DE
- Germany
- Prior art keywords
- oil
- particles
- color
- recording material
- acidic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000463 material Substances 0.000 title claims description 26
- 239000000126 substance Substances 0.000 claims description 39
- 239000002245 particle Substances 0.000 claims description 31
- 229920000642 polymer Polymers 0.000 claims description 27
- 230000002378 acidificating effect Effects 0.000 claims description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 22
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 claims description 21
- 239000005995 Aluminium silicate Substances 0.000 claims description 20
- 235000012211 aluminium silicate Nutrition 0.000 claims description 20
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 20
- 239000011707 mineral Substances 0.000 claims description 20
- 229960000892 attapulgite Drugs 0.000 claims description 16
- 229910052625 palygorskite Inorganic materials 0.000 claims description 16
- 229920001568 phenolic resin Polymers 0.000 claims description 9
- 239000005011 phenolic resin Substances 0.000 claims description 9
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical group [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 claims description 7
- 238000004040 coloring Methods 0.000 claims description 6
- 239000012876 carrier material Substances 0.000 claims description 5
- 238000006479 redox reaction Methods 0.000 claims description 4
- 239000011872 intimate mixture Substances 0.000 claims description 3
- 239000003550 marker Substances 0.000 claims description 3
- 238000010669 acid-base reaction Methods 0.000 claims description 2
- 239000000835 fiber Substances 0.000 claims description 2
- 239000000440 bentonite Substances 0.000 claims 1
- 229910000278 bentonite Inorganic materials 0.000 claims 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 claims 1
- 229920013730 reactive polymer Polymers 0.000 claims 1
- 238000000576 coating method Methods 0.000 description 24
- 239000011248 coating agent Substances 0.000 description 19
- 238000006243 chemical reaction Methods 0.000 description 18
- 239000007787 solid Substances 0.000 description 17
- 239000011230 binding agent Substances 0.000 description 11
- 239000002904 solvent Substances 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 8
- 229910002027 silica gel Inorganic materials 0.000 description 8
- LIZLYZVAYZQVPG-UHFFFAOYSA-N (3-bromo-2-fluorophenyl)methanol Chemical compound OCC1=CC=CC(Br)=C1F LIZLYZVAYZQVPG-UHFFFAOYSA-N 0.000 description 7
- 238000010521 absorption reaction Methods 0.000 description 6
- -1 phenol aldehydes Chemical class 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical class OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 5
- 239000004744 fabric Substances 0.000 description 5
- 239000000976 ink Substances 0.000 description 5
- 239000004372 Polyvinyl alcohol Substances 0.000 description 4
- 239000004115 Sodium Silicate Substances 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 229920002451 polyvinyl alcohol Polymers 0.000 description 4
- 238000006722 reduction reaction Methods 0.000 description 4
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 4
- 229910052911 sodium silicate Inorganic materials 0.000 description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZKURGBYDCVNWKH-UHFFFAOYSA-N [3,7-bis(dimethylamino)phenothiazin-10-yl]-phenylmethanone Chemical compound C12=CC=C(N(C)C)C=C2SC2=CC(N(C)C)=CC=C2N1C(=O)C1=CC=CC=C1 ZKURGBYDCVNWKH-UHFFFAOYSA-N 0.000 description 3
- 239000000853 adhesive Substances 0.000 description 3
- 230000001070 adhesive effect Effects 0.000 description 3
- 230000008859 change Effects 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000000975 dye Substances 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 150000002596 lactones Chemical class 0.000 description 3
- 239000006193 liquid solution Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- QPQKUYVSJWQSDY-CCEZHUSRSA-N 4-(phenylazo)aniline Chemical compound C1=CC(N)=CC=C1\N=N\C1=CC=CC=C1 QPQKUYVSJWQSDY-CCEZHUSRSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 206010070834 Sensitisation Diseases 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 239000008199 coating composition Substances 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 239000003431 cross linking reagent Substances 0.000 description 2
- 230000008034 disappearance Effects 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 210000003608 fece Anatomy 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000010871 livestock manure Substances 0.000 description 2
- 229940107698 malachite green Drugs 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229920000620 organic polymer Polymers 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 238000001179 sorption measurement Methods 0.000 description 2
- 239000010457 zeolite Substances 0.000 description 2
- WRRZKDVBPZBNJN-ONEGZZNKSA-N (e)-4-(4-methoxyphenyl)but-3-en-2-one Chemical compound COC1=CC=C(\C=C\C(C)=O)C=C1 WRRZKDVBPZBNJN-ONEGZZNKSA-N 0.000 description 1
- FAQVDANXTSFXGA-UHFFFAOYSA-N 2,3-dihydro-1h-benzo[g]indole Chemical compound C1=CC=CC2=C(NCC3)C3=CC=C21 FAQVDANXTSFXGA-UHFFFAOYSA-N 0.000 description 1
- CEQFOVLGLXCDCX-UHFFFAOYSA-N 2-[[4-(dimethylamino)phenyl]diazenyl]benzoic acid Chemical compound C1=CC(N(C)C)=CC=C1N=NC1=CC=CC=C1C(O)=O CEQFOVLGLXCDCX-UHFFFAOYSA-N 0.000 description 1
- QUINKWASVQHVID-UHFFFAOYSA-N 3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one Chemical compound C1=CC(N(C)C)=CC=C1C1(C=2C=CC(=CC=2)N(C)C)C2=CC=CC=C2C(=O)O1 QUINKWASVQHVID-UHFFFAOYSA-N 0.000 description 1
- RBTBFTRPCNLSDE-UHFFFAOYSA-N 3,7-bis(dimethylamino)phenothiazin-5-ium Chemical compound C1=CC(N(C)C)=CC2=[S+]C3=CC(N(C)C)=CC=C3N=C21 RBTBFTRPCNLSDE-UHFFFAOYSA-N 0.000 description 1
- PYSRRFNXTXNWCD-UHFFFAOYSA-N 3-(2-phenylethenyl)furan-2,5-dione Chemical compound O=C1OC(=O)C(C=CC=2C=CC=CC=2)=C1 PYSRRFNXTXNWCD-UHFFFAOYSA-N 0.000 description 1
- IICHURGZQPGTRD-UHFFFAOYSA-N 4-phenyldiazenylnaphthalen-1-amine Chemical compound C12=CC=CC=C2C(N)=CC=C1N=NC1=CC=CC=C1 IICHURGZQPGTRD-UHFFFAOYSA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical group OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 241000726103 Atta Species 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229920000147 Styrene maleic anhydride Polymers 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- YIOQCYXPSWJYHB-UHFFFAOYSA-N acetylene;phenol Chemical group C#C.OC1=CC=CC=C1 YIOQCYXPSWJYHB-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 238000003915 air pollution Methods 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000000981 basic dye Substances 0.000 description 1
- 235000012216 bentonite Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- YLZSIUVOIFJGQZ-UHFFFAOYSA-N bis[4-(dimethylamino)phenyl]methanol Chemical compound C1=CC(N(C)C)=CC=C1C(O)C1=CC=C(N(C)C)C=C1 YLZSIUVOIFJGQZ-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229940096529 carboxypolymethylene Drugs 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000003593 chromogenic compound Substances 0.000 description 1
- 230000001427 coherent effect Effects 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000003795 desorption Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- WMKGGPCROCCUDY-PHEQNACWSA-N dibenzylideneacetone Chemical compound C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 WMKGGPCROCCUDY-PHEQNACWSA-N 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 230000000763 evoking effect Effects 0.000 description 1
- 238000005562 fading Methods 0.000 description 1
- 230000005283 ground state Effects 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- FDZZZRQASAIRJF-UHFFFAOYSA-M malachite green Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1C(C=1C=CC=CC=1)=C1C=CC(=[N+](C)C)C=C1 FDZZZRQASAIRJF-UHFFFAOYSA-M 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- CEQFOVLGLXCDCX-WUKNDPDISA-N methyl red Chemical compound C1=CC(N(C)C)=CC=C1\N=N\C1=CC=CC=C1C(O)=O CEQFOVLGLXCDCX-WUKNDPDISA-N 0.000 description 1
- QFVDKARCPMTZCS-UHFFFAOYSA-N methylrosaniline Chemical compound C1=CC(N(C)C)=CC=C1C(O)(C=1C=CC(=CC=1)N(C)C)C1=CC=C(N(C)C)C=C1 QFVDKARCPMTZCS-UHFFFAOYSA-N 0.000 description 1
- 229960003926 methylrosaniline Drugs 0.000 description 1
- 229960000907 methylthioninium chloride Drugs 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229920003986 novolac Polymers 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 230000002688 persistence Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- 235000021395 porridge Nutrition 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000011802 pulverized particle Substances 0.000 description 1
- 229920003987 resole Polymers 0.000 description 1
- 230000008313 sensitization Effects 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 230000007480 spreading Effects 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- RLGKSXCGHMXELQ-ZRDIBKRKSA-N trans-2-styrylquinoline Chemical compound C=1C=C2C=CC=CC2=NC=1\C=C\C1=CC=CC=C1 RLGKSXCGHMXELQ-ZRDIBKRKSA-N 0.000 description 1
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 1
- 238000001429 visible spectrum Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/124—Duplicating or marking methods; Sheet materials for use therein using pressure to make a masked colour visible, e.g. to make a coloured support visible, to create an opaque or transparent pattern, or to form colour by uniting colour-forming components
- B41M5/132—Chemical colour-forming components; Additives or binders therefor
- B41M5/155—Colour-developing components, e.g. acidic compounds; Additives or binders therefor; Layers containing such colour-developing components, additives or binders
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Color Printing (AREA)
- Paper (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US42019364A | 1964-12-21 | 1964-12-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1247348B true DE1247348B (de) | 1967-08-17 |
Family
ID=23665456
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEN27784A Pending DE1247348B (de) | 1964-12-21 | 1965-12-18 | Sensibilisiertes Aufzeichnungsmaterial zur Verwendung mit normalerweise farblosem Markierungsstoff |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3455721A (enExample) |
| JP (1) | JPS5017888B1 (enExample) |
| AT (1) | AT264553B (enExample) |
| BE (1) | BE673762A (enExample) |
| BR (1) | BR6575750D0 (enExample) |
| CH (1) | CH450463A (enExample) |
| DE (1) | DE1247348B (enExample) |
| DK (1) | DK114067B (enExample) |
| ES (1) | ES320777A1 (enExample) |
| FR (1) | FR1470333A (enExample) |
| GB (1) | GB1065587A (enExample) |
| NL (1) | NL149439B (enExample) |
| NO (1) | NO124524B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2303825A1 (de) * | 1972-01-28 | 1973-08-02 | Mizusawa Industrial Chem | Einen farbbildner fuer druckempfindliches registrierpapier enthaltende waessrige zusammensetzung und verfahren zu ihrer herstellung |
| DE2409112A1 (de) * | 1973-03-05 | 1974-09-12 | Ciba Geigy Ag | Waermeempfindliches registriermaterial |
Families Citing this family (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1053935A (enExample) * | 1964-08-27 | 1900-01-01 | ||
| US3535139A (en) * | 1966-11-17 | 1970-10-20 | Pilot Pen Co Ltd | Pressure-sensitive copying papers |
| US3509174A (en) * | 1967-01-30 | 1970-04-28 | Ncr Co | 3-(indol-3-yl)-phthalides |
| US3491112A (en) * | 1967-01-30 | 1970-01-20 | Ncr Co | 3-(phenyl)-3-(heterocyclic-substituted)-phthalides |
| US3491117A (en) * | 1967-01-30 | 1970-01-20 | Ncr Co | Indole substituted pyromellitides |
| GB1174719A (en) * | 1967-12-06 | 1969-12-17 | Ncr Co | Chromogenic Printing Ink |
| JPS4635361Y1 (enExample) * | 1968-11-13 | 1971-12-06 | ||
| GB1272232A (en) * | 1968-12-24 | 1972-04-26 | Wiggins Teape Res Dev | Improvements relating to copying papers |
| US3634121A (en) * | 1969-03-17 | 1972-01-11 | Ncr Co | Acid-sensitized record sheet |
| US3617410A (en) * | 1969-05-01 | 1971-11-02 | Mead Corp | Pressure-sensitive recording sheet and method of making |
| JPS4833212B1 (enExample) * | 1970-07-08 | 1973-10-12 | ||
| US3715226A (en) * | 1971-03-01 | 1973-02-06 | Ncr | Mark-forming record materials |
| US3773542A (en) * | 1971-04-28 | 1973-11-20 | Fuji Photo Film Co Ltd | Sensitizing sheet for pressure- or heat-sensitive copying paper |
| US3793075A (en) * | 1971-12-20 | 1974-02-19 | Moore Business Forms Inc | Dialkyl tartrate-heteropolyacid developing system for dye precursor compounds |
| JPS5817036B2 (ja) * | 1974-04-23 | 1983-04-04 | 富士写真フイルム株式会社 | キロクザイリヨウ |
| US3989278A (en) * | 1974-07-01 | 1976-11-02 | Georgia Kaolin Company | Reactive color developing substrates for manifold copy systems and process for producing same |
| US4000087A (en) * | 1974-07-29 | 1976-12-28 | Moore Business Forms, Inc. | Microcapsules useful in carbonless copying systems and process for their preparation |
| US3981523A (en) * | 1975-03-24 | 1976-09-21 | Moore Business Forms, Inc. | Carbonless manifold business forms |
| US4034128A (en) * | 1975-05-05 | 1977-07-05 | The Mead Corporation | Production of a color developing record sheet containing metal-modified novolak resin particles |
| JPS6012954B2 (ja) * | 1978-07-18 | 1985-04-04 | 三菱製紙株式会社 | ノ−カ−ボン複写用呈色紙 |
| US4372582A (en) * | 1981-03-30 | 1983-02-08 | Minnesota Mining And Manufacturing Company | Stabilizer for electron doner-acceptor carbonless copying systems |
| US4859561A (en) * | 1986-09-09 | 1989-08-22 | The Mead Corporation | Developer sheet useful in providing transparencies or reproductions having a controlled gloss finish |
| US4772532A (en) * | 1987-03-18 | 1988-09-20 | The Mead Corporation | Glossable developer sheet with reduced tack |
| US4927802A (en) * | 1988-12-09 | 1990-05-22 | Ppg Industries, Inc. | Pressure-sensitive multi-part record unit |
| US5350729A (en) * | 1993-03-02 | 1994-09-27 | The Mead Corporation | Developer sheet with structured clays and process thereof |
| US5709738A (en) * | 1996-06-06 | 1998-01-20 | Moore Business Forms Inc | Coating composition for ink jet printing |
| US7108190B2 (en) * | 2003-02-28 | 2006-09-19 | Appleton Papers Inc. | Token array and method employing authentication tokens bearing scent formulation information |
| US20060063125A1 (en) * | 2003-04-22 | 2006-03-23 | Hamilton Timothy F | Method and device for enhanced dental articulation |
| US6932602B2 (en) * | 2003-04-22 | 2005-08-23 | Appleton Papers Inc. | Dental articulation kit and method |
| US20040251309A1 (en) * | 2003-06-10 | 2004-12-16 | Appleton Papers Inc. | Token bearing magnetc image information in registration with visible image information |
-
1964
- 1964-12-21 US US420193A patent/US3455721A/en not_active Expired - Lifetime
-
1965
- 1965-10-01 GB GB41769/65A patent/GB1065587A/en not_active Expired
- 1965-10-20 NO NO160151A patent/NO124524B/no unknown
- 1965-12-15 BE BE673762A patent/BE673762A/xx unknown
- 1965-12-15 ES ES0320777A patent/ES320777A1/es not_active Expired
- 1965-12-16 BR BR175750/65A patent/BR6575750D0/pt unknown
- 1965-12-18 FR FR42880A patent/FR1470333A/fr not_active Expired
- 1965-12-18 DE DEN27784A patent/DE1247348B/de active Pending
- 1965-12-20 AT AT1140965A patent/AT264553B/de active
- 1965-12-20 DK DK650665AA patent/DK114067B/da unknown
- 1965-12-20 CH CH1754965A patent/CH450463A/fr unknown
- 1965-12-21 JP JP40078270A patent/JPS5017888B1/ja active Pending
- 1965-12-21 NL NL656516621A patent/NL149439B/xx not_active IP Right Cessation
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2303825A1 (de) * | 1972-01-28 | 1973-08-02 | Mizusawa Industrial Chem | Einen farbbildner fuer druckempfindliches registrierpapier enthaltende waessrige zusammensetzung und verfahren zu ihrer herstellung |
| DE2409112A1 (de) * | 1973-03-05 | 1974-09-12 | Ciba Geigy Ag | Waermeempfindliches registriermaterial |
Also Published As
| Publication number | Publication date |
|---|---|
| DK114067B (da) | 1969-05-27 |
| AT264553B (de) | 1968-09-10 |
| NL149439B (nl) | 1976-05-17 |
| ES320777A1 (es) | 1966-05-01 |
| NL6516621A (enExample) | 1966-06-22 |
| NO124524B (enExample) | 1972-05-02 |
| CH450463A (fr) | 1968-01-31 |
| GB1065587A (en) | 1967-04-19 |
| US3455721A (en) | 1969-07-15 |
| JPS5017888B1 (enExample) | 1975-06-25 |
| BE673762A (enExample) | 1966-04-01 |
| BR6575750D0 (pt) | 1973-05-17 |
| FR1470333A (fr) | 1967-02-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1247348B (de) | Sensibilisiertes Aufzeichnungsmaterial zur Verwendung mit normalerweise farblosem Markierungsstoff | |
| DE2228431C3 (de) | Aufzeichnungsmaterial | |
| DE2612036C3 (de) | Durchschreibsatz | |
| DE1275550B (de) | Druckempfindliches Aufzeichnungsmaterial | |
| DE1571855B1 (de) | Druckempfindliches Kopiersystem | |
| DE2822961C2 (de) | Druckempfindliches Kopiermaterial | |
| DE1955542B2 (de) | Druckempfindliches Blattmaterial | |
| DE2228430B2 (de) | Aufzeichnungsmaterial | |
| DE69020475T2 (de) | Entwicklungstinte mit hohem Feststoffgehalt. | |
| DE3330679A1 (de) | Aufzeichnungsmaterial | |
| EP0037477B1 (de) | Durchschreibesysteme und Verfahren zu deren Herstellung, sowie geeignete Offsetdruck- bzw. Buchdruckfarben | |
| CH644551A5 (de) | Chromogene zusammensetzung. | |
| DE69321765T3 (de) | Druckempfindliches Aufzeichnungsmaterial | |
| DE2165857A1 (de) | Druckempfindliches Aufzeichnungsmaterial | |
| DE2219556C3 (de) | Mit einem chromogenen Material beschichtetes Aufzeichnungsmedium | |
| DE2919521C2 (de) | Aufzeichnungsmaterial zur Anwendung in einem druckempfindlichen Kopiersystem | |
| DE2854318C2 (enExample) | ||
| DE1805844C3 (de) | Druckempfindliches Aufzeichnungsblatt | |
| DE1937856A1 (de) | Formularsatz aus Farbreaktionspapieren | |
| DE3706491A1 (de) | Teilweise druckempfindliches aufzeichnungspapier | |
| DE2502142A1 (de) | Druckempfindliches aufzeichnungsmaterial | |
| DE2142173A1 (de) | Selbstklebendes Aufzeichnungspapier | |
| DE1915504C2 (de) | Druckempfindliches Aufzeichnungspapier | |
| DE2518096A1 (de) | Aufzeichnungsverfahren und aufzeichnungsmaterial | |
| EP0285832B1 (de) | Durchschreibeformularsatz |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| E77 | Valid patent as to the heymanns-index 1977 | ||
| EGA | New person/name/address of the applicant |