DE1198354B - Verfahren zur Herstellung von Benzol-sulfonylharnstoffen - Google Patents
Verfahren zur Herstellung von Benzol-sulfonylharnstoffenInfo
- Publication number
- DE1198354B DE1198354B DEF40828A DEF0040828A DE1198354B DE 1198354 B DE1198354 B DE 1198354B DE F40828 A DEF40828 A DE F40828A DE F0040828 A DEF0040828 A DE F0040828A DE 1198354 B DE1198354 B DE 1198354B
- Authority
- DE
- Germany
- Prior art keywords
- radical
- benzenesulfonyl
- formula
- methyl
- urea
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 title claims description 13
- 238000000034 method Methods 0.000 title claims description 11
- 238000002360 preparation method Methods 0.000 title claims description 5
- 229940100389 Sulfonylurea Drugs 0.000 title description 2
- 150000003839 salts Chemical class 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 10
- 235000013877 carbamide Nutrition 0.000 claims description 10
- 150000003672 ureas Chemical class 0.000 claims description 9
- 150000002148 esters Chemical class 0.000 claims description 7
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims description 6
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 claims description 5
- 239000012948 isocyanate Substances 0.000 claims description 5
- 150000002513 isocyanates Chemical class 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- UJYAZVSPFMJCLW-UHFFFAOYSA-N n-(oxomethylidene)benzenesulfonamide Chemical class O=C=NS(=O)(=O)C1=CC=CC=C1 UJYAZVSPFMJCLW-UHFFFAOYSA-N 0.000 claims description 5
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 claims description 4
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- 230000015572 biosynthetic process Effects 0.000 claims description 4
- 150000001714 carbamic acid halides Chemical class 0.000 claims description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 150000008331 benzenesulfonamides Chemical class 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 150000007513 acids Chemical class 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 150000001555 benzenes Chemical class 0.000 claims 1
- 210000002700 urine Anatomy 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 102
- -1 alkyl radical Chemical class 0.000 description 58
- 238000002844 melting Methods 0.000 description 46
- 230000008018 melting Effects 0.000 description 46
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- 239000000155 melt Substances 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 239000008280 blood Substances 0.000 description 9
- 210000004369 blood Anatomy 0.000 description 9
- 239000000706 filtrate Substances 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- SWSXEZOUBBVKCO-UHFFFAOYSA-N 1-isocyanato-4-methylcyclohexane Chemical compound CC1CCC(N=C=O)CC1 SWSXEZOUBBVKCO-UHFFFAOYSA-N 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 7
- QYKPRMWZTPVYJC-UHFFFAOYSA-N isocyanatocyclooctane Chemical compound O=C=NC1CCCCCCC1 QYKPRMWZTPVYJC-UHFFFAOYSA-N 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 6
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 6
- WHQSYGRFZMUQGQ-UHFFFAOYSA-N n,n-dimethylformamide;hydrate Chemical compound O.CN(C)C=O WHQSYGRFZMUQGQ-UHFFFAOYSA-N 0.000 description 6
- 239000004202 carbamide Substances 0.000 description 5
- 238000000354 decomposition reaction Methods 0.000 description 5
- 229920002554 vinyl polymer Polymers 0.000 description 5
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 4
- 239000003610 charcoal Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical compound COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- KSMVBYPXNKCPAJ-UHFFFAOYSA-N 4-Methylcyclohexylamine Chemical compound CC1CCC(N)CC1 KSMVBYPXNKCPAJ-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- HSOHBWMXECKEKV-UHFFFAOYSA-N cyclooctanamine Chemical compound NC1CCCCCCC1 HSOHBWMXECKEKV-UHFFFAOYSA-N 0.000 description 2
- 206010012601 diabetes mellitus Diseases 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- LZULGYKMZVTUJA-UHFFFAOYSA-N 3-(4-methylcyclohexyl)-1,1-diphenylurea Chemical compound C1(=CC=CC=C1)N(C(=O)NC1CCC(CC1)C)C1=CC=CC=C1 LZULGYKMZVTUJA-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 244000265913 Crataegus laevigata Species 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- JSWGFMIENIJRKM-UHFFFAOYSA-N N-cyclohexyl-2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]acetamide Chemical compound C1(CCCCC1)NC(=O)CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC1CCCCC1 JSWGFMIENIJRKM-UHFFFAOYSA-N 0.000 description 1
- DQNHNVJSWPPXFY-UHFFFAOYSA-N N-cyclooctylurea Chemical compound NC(=O)NC1CCCCCCC1 DQNHNVJSWPPXFY-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229940125708 antidiabetic agent Drugs 0.000 description 1
- 239000003472 antidiabetic agent Substances 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- YDPWVAMKZSUTGO-UHFFFAOYSA-N benzenesulfonamide;sodium Chemical compound [Na].NS(=O)(=O)C1=CC=CC=C1 YDPWVAMKZSUTGO-UHFFFAOYSA-N 0.000 description 1
- ALZKZGUTVJXYEF-UHFFFAOYSA-N benzenesulfonylcarbamic acid Chemical class OC(=O)NS(=O)(=O)C1=CC=CC=C1 ALZKZGUTVJXYEF-UHFFFAOYSA-N 0.000 description 1
- GHDLZGOOOLEJKI-UHFFFAOYSA-N benzenesulfonylurea Chemical class NC(=O)NS(=O)(=O)C1=CC=CC=C1 GHDLZGOOOLEJKI-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical group OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- VDTNNGKXZGSZIP-UHFFFAOYSA-N carbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 VDTNNGKXZGSZIP-UHFFFAOYSA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- LAOTUIUQSXGKEW-UHFFFAOYSA-N cyclohexyl(methyl)carbamic acid Chemical compound OC(=O)N(C)C1CCCCC1 LAOTUIUQSXGKEW-UHFFFAOYSA-N 0.000 description 1
- XDMMMGGRRNTWML-UHFFFAOYSA-N cyclohexylazanium;acetate Chemical compound CC(O)=O.NC1CCCCC1 XDMMMGGRRNTWML-UHFFFAOYSA-N 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- WUESWDIHTKHGQA-UHFFFAOYSA-N cyclohexylurea Chemical compound NC(=O)NC1CCCCC1 WUESWDIHTKHGQA-UHFFFAOYSA-N 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 229910000474 mercury oxide Inorganic materials 0.000 description 1
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 1
- 239000008164 mustard oil Substances 0.000 description 1
- WWECJGLXBSQKRF-UHFFFAOYSA-N n,n-dimethylformamide;methanol Chemical compound OC.CN(C)C=O WWECJGLXBSQKRF-UHFFFAOYSA-N 0.000 description 1
- FOZLEFALTUHOLA-UHFFFAOYSA-N n-cyclohexylcarbamoyl chloride Chemical compound ClC(=O)NC1CCCCC1 FOZLEFALTUHOLA-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229940127017 oral antidiabetic Drugs 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- PFUVRDFDKPNGAV-UHFFFAOYSA-N sodium peroxide Chemical compound [Na+].[Na+].[O-][O-] PFUVRDFDKPNGAV-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- QXKXDIKCIPXUPL-UHFFFAOYSA-N sulfanylidenemercury Chemical compound [Hg]=S QXKXDIKCIPXUPL-UHFFFAOYSA-N 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical class OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 230000002485 urinary effect Effects 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Load-Engaging Elements For Cranes (AREA)
- Seats For Vehicles (AREA)
Priority Applications (30)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF40828A DE1198354B (de) | 1963-09-25 | 1963-09-25 | Verfahren zur Herstellung von Benzol-sulfonylharnstoffen |
| GB1316564A GB1054758A (https=) | 1963-09-25 | 1964-03-31 | |
| US398106A US3336322A (en) | 1963-09-25 | 1964-09-21 | Benzenesulfonyl ureas and process for their manufacture |
| NO154850A NO117362B (https=) | 1963-09-25 | 1964-09-22 | |
| CH1235664A CH444840A (de) | 1963-09-25 | 1964-09-23 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| AT813264A AT252934B (de) | 1963-09-25 | 1964-09-23 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen und deren Salzen |
| NL646411087A NL141381B (nl) | 1963-09-25 | 1964-09-23 | Werkwijze voor het bereiden van geneesmiddelen met bloedsuikerspiegel verlagende werkzaamheid. |
| AT813164A AT253523B (de) | 1963-09-25 | 1964-09-23 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen und deren Salzen |
| CH1558367A CH451911A (de) | 1963-09-25 | 1964-09-23 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| AT812964A AT254892B (de) | 1963-09-25 | 1964-09-23 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen und deren Salzen |
| CH1235464A CH451111A (de) | 1963-09-25 | 1964-09-23 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| CH1235364A CH448052A (de) | 1963-09-25 | 1964-09-23 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| AT813064A AT253522B (de) | 1963-09-25 | 1964-09-23 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen sowie deren Salzen |
| CH1235564A CH448053A (de) | 1963-09-25 | 1964-09-23 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| BR162883/64A BR6462883D0 (pt) | 1963-09-25 | 1964-09-24 | Processos para a obtencao de benzenosulfonilureias |
| NO154883A NO117744B (https=) | 1963-09-25 | 1964-09-24 | |
| FI2028/64A FI41023B (https=) | 1963-09-25 | 1964-09-24 | |
| DK470264AA DK119104B (da) | 1963-09-25 | 1964-09-24 | Analogifremgangsmåde til fremstilling af benzensulfonylurinstoffer eller salte deraf. |
| DK470464AA DK106793C (da) | 1963-09-25 | 1964-09-24 | Fremgangsmåde til fremstilling af benzensulfonylurinstoffer eller salte deraf. |
| NO154884A NO118547B (https=) | 1963-09-25 | 1964-09-24 | |
| NO154882A NO117851B (https=) | 1963-09-25 | 1964-09-24 | |
| DK470364AA DK105642C (da) | 1963-09-25 | 1964-09-24 | Fremgangsmåde til fremstilling af benzensulfonylurinstoffer eller salte deraf. |
| IL22148A IL22148A (en) | 1963-09-25 | 1964-09-24 | Benzenesulfonyl ureas |
| DK470564AA DK109675C (da) | 1963-09-25 | 1964-09-24 | Fremgangsmåde til fremstilling af benzensulfonylurinstoffer eller salte deraf. |
| SE11511/64A SE310665B (https=) | 1963-09-25 | 1964-09-25 | |
| FR989291A FR1431690A (fr) | 1963-09-25 | 1964-09-25 | Nouvelles benzène-sulfonyl-urées et leur préparation |
| FR999884A FR3940M (https=) | 1963-09-25 | 1964-12-24 | |
| BE653586A BE653586A (https=) | 1963-09-25 | 1965-03-25 | |
| BE672496A BE672496R (fr) | 1963-09-25 | 1965-11-18 | Nouvelles benzène-sulfonyl-urées et leur préparation |
| US643747A US3435116A (en) | 1963-09-25 | 1967-02-02 | The treatment of diabetes mellitus with benzenesulfonyl ureas |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF40828A DE1198354B (de) | 1963-09-25 | 1963-09-25 | Verfahren zur Herstellung von Benzol-sulfonylharnstoffen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1198354B true DE1198354B (de) | 1965-08-12 |
Family
ID=7098406
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF40828A Pending DE1198354B (de) | 1963-09-25 | 1963-09-25 | Verfahren zur Herstellung von Benzol-sulfonylharnstoffen |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3336322A (https=) |
| AT (4) | AT253523B (https=) |
| BE (2) | BE653586A (https=) |
| BR (1) | BR6462883D0 (https=) |
| CH (5) | CH448052A (https=) |
| DE (1) | DE1198354B (https=) |
| DK (4) | DK106793C (https=) |
| FI (1) | FI41023B (https=) |
| FR (2) | FR1431690A (https=) |
| GB (1) | GB1054758A (https=) |
| IL (1) | IL22148A (https=) |
| NO (4) | NO117362B (https=) |
| SE (1) | SE310665B (https=) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0727417A1 (de) * | 1995-02-17 | 1996-08-21 | Hoechst Aktiengesellschaft | Substituierte Benzolsulfonylharnstoffe und -thioharnstoffe, Verfahren zu ihrer Herstellung und Verwendung pharmazeutischer Präparate auf Basis dieser Verbindungen sowie sie enthaltende Heilmittel |
| EP0728741A1 (de) * | 1995-02-21 | 1996-08-28 | Hoechst Aktiengesellschaft | Substituierte Benzolsulfonylharnstoffe und -thioharnstoffe, Verfahren zu ihrer Herstellung, ihre Verwendung zur Herstellung pharmazeutischer Präparate und sie enthaltende Medikamente |
| AU700793B2 (en) * | 1995-02-17 | 1999-01-14 | Hoechst Aktiengesellschaft | Substituted benzenesulfonylureas and -thioureas, processes for their preparation, their use as a medicament or diagnostic, and medicament containing them |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL141381B (nl) * | 1963-09-25 | 1974-03-15 | Hoechst Ag | Werkwijze voor het bereiden van geneesmiddelen met bloedsuikerspiegel verlagende werkzaamheid. |
| US3424749A (en) * | 1965-06-23 | 1969-01-28 | Heinz A Pfenninger | Certain n-(benzenesulfonyl) pipecolinic acids and lower alkyl esters thereof |
| DE2951135A1 (de) * | 1979-12-19 | 1981-06-25 | Hoechst Ag, 6230 Frankfurt | Sulfonylharnstoffe, verfahren zu ihrer herstellung, pharmazeutische praeparate auf basis dieser verbindungen und ihre verwendung |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR919464A (fr) * | 1944-12-28 | 1947-03-10 | Geigy Ag J R | Urées substituées et procédé de préparation de ces produits |
| US2964560A (en) * | 1955-11-28 | 1960-12-13 | Boehringer & Soehne Gmbh | Orally effective compounds for treating diabetes and a process of making same |
| US3198706A (en) * | 1956-07-31 | 1965-08-03 | Hoechst Ag | Methods of reducing blood sugar and compositions therefor |
| GB831044A (en) * | 1959-03-05 | 1960-03-23 | Boehringer & Soehne Gmbh | Benzene sulphonyl ureas |
-
1963
- 1963-09-25 DE DEF40828A patent/DE1198354B/de active Pending
-
1964
- 1964-03-31 GB GB1316564A patent/GB1054758A/en not_active Expired
- 1964-09-21 US US398106A patent/US3336322A/en not_active Expired - Lifetime
- 1964-09-22 NO NO154850A patent/NO117362B/no unknown
- 1964-09-23 CH CH1235364A patent/CH448052A/de unknown
- 1964-09-23 AT AT813164A patent/AT253523B/de active
- 1964-09-23 AT AT813264A patent/AT252934B/de active
- 1964-09-23 AT AT812964A patent/AT254892B/de active
- 1964-09-23 CH CH1235564A patent/CH448053A/de unknown
- 1964-09-23 CH CH1235664A patent/CH444840A/de unknown
- 1964-09-23 CH CH1235464A patent/CH451111A/de unknown
- 1964-09-23 AT AT813064A patent/AT253522B/de active
- 1964-09-23 CH CH1558367A patent/CH451911A/de unknown
- 1964-09-24 DK DK470464AA patent/DK106793C/da active
- 1964-09-24 FI FI2028/64A patent/FI41023B/fi active
- 1964-09-24 BR BR162883/64A patent/BR6462883D0/pt unknown
- 1964-09-24 DK DK470264AA patent/DK119104B/da unknown
- 1964-09-24 DK DK470564AA patent/DK109675C/da active
- 1964-09-24 NO NO154883A patent/NO117744B/no unknown
- 1964-09-24 NO NO154884A patent/NO118547B/no unknown
- 1964-09-24 DK DK470364AA patent/DK105642C/da active
- 1964-09-24 NO NO154882A patent/NO117851B/no unknown
- 1964-09-24 IL IL22148A patent/IL22148A/en unknown
- 1964-09-25 FR FR989291A patent/FR1431690A/fr not_active Expired
- 1964-09-25 SE SE11511/64A patent/SE310665B/xx unknown
- 1964-12-24 FR FR999884A patent/FR3940M/fr not_active Expired
-
1965
- 1965-03-25 BE BE653586A patent/BE653586A/xx unknown
- 1965-11-18 BE BE672496A patent/BE672496R/fr active
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0727417A1 (de) * | 1995-02-17 | 1996-08-21 | Hoechst Aktiengesellschaft | Substituierte Benzolsulfonylharnstoffe und -thioharnstoffe, Verfahren zu ihrer Herstellung und Verwendung pharmazeutischer Präparate auf Basis dieser Verbindungen sowie sie enthaltende Heilmittel |
| AU700254B2 (en) * | 1995-02-17 | 1998-12-24 | Hoechst Aktiengesellschaft | Substituted benzenesulfonylureas and -thioureas, processes for their preparation and use of pharmaceutical preparations based on these compounds, and medicaments containing them |
| AU700793B2 (en) * | 1995-02-17 | 1999-01-14 | Hoechst Aktiengesellschaft | Substituted benzenesulfonylureas and -thioureas, processes for their preparation, their use as a medicament or diagnostic, and medicament containing them |
| US5880155A (en) * | 1995-02-17 | 1999-03-09 | Hoechst Aktiengesellschaft | Substituted benzenesulfonylureas and-thioureas, processes for their preparation and use of pharmaceutical preparations based on these compounds, and medicaments containing them |
| US5977177A (en) * | 1995-02-17 | 1999-11-02 | Hoechst Aktiengesellschaft | Substituted benzenesulfonylureas and-thioureas, processes for their preparation and use of pharmaceutical preparations based on these compounds, and medicaments containing them |
| EP0728741A1 (de) * | 1995-02-21 | 1996-08-28 | Hoechst Aktiengesellschaft | Substituierte Benzolsulfonylharnstoffe und -thioharnstoffe, Verfahren zu ihrer Herstellung, ihre Verwendung zur Herstellung pharmazeutischer Präparate und sie enthaltende Medikamente |
| US5633239A (en) * | 1995-02-21 | 1997-05-27 | Hoechst Aktiengesellschaft | Substituted benzenesulfonylureas and -thioureas, processes for their preparation, their use for the production of pharmaceutical preparations, and medicaments containing them |
Also Published As
| Publication number | Publication date |
|---|---|
| CH444840A (de) | 1967-10-15 |
| BE672496R (fr) | 1966-03-16 |
| DK109675C (da) | 1968-06-04 |
| AT252934B (de) | 1967-03-10 |
| US3336322A (en) | 1967-08-15 |
| BR6462883D0 (pt) | 1973-08-07 |
| NO118547B (https=) | 1970-01-12 |
| NO117362B (https=) | 1969-08-04 |
| CH448052A (de) | 1967-12-15 |
| GB1054758A (https=) | 1967-01-11 |
| AT254892B (de) | 1967-06-12 |
| NO117851B (https=) | 1969-10-06 |
| AT253523B (de) | 1967-04-10 |
| AT253522B (de) | 1967-04-10 |
| FI41023B (https=) | 1969-04-30 |
| CH451911A (de) | 1968-05-15 |
| FR1431690A (fr) | 1966-03-18 |
| BE653586A (https=) | 1965-03-25 |
| CH448053A (de) | 1967-12-15 |
| DK106793C (da) | 1967-03-20 |
| CH451111A (de) | 1968-05-15 |
| NO117744B (https=) | 1969-09-22 |
| DK105642C (da) | 1966-10-24 |
| DK119104B (da) | 1970-11-16 |
| SE310665B (https=) | 1969-05-12 |
| IL22148A (en) | 1968-04-25 |
| FR3940M (https=) | 1966-03-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1185180B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1518877C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1198354B (de) | Verfahren zur Herstellung von Benzol-sulfonylharnstoffen | |
| DE1543564A1 (de) | Benzolsulfonylharnstoffe und Verfahren zu ihrer Herstellung | |
| DE1443911A1 (de) | Benzolsulfonylharnstoffe und Verfahren zu ihrer Herstellung | |
| DE1181208B (de) | Verfahren zur Herstellung von N-Benzolsulfonyl-N'-cyclohexyl-harnstoffen | |
| DE1545810A1 (de) | Verfahren zur Herstellung von Benzolsulfonylsemicarbaziden | |
| CH474490A (de) | Verfahren zur Herstellung neuer Benzolsulfonylharnstoffe | |
| DE1568606C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1188589B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1003716B (de) | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen | |
| DE1153357B (de) | Verfahren zur Herstellung von Azidobenzolsulfonylharnstoffen | |
| AT228798B (de) | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen | |
| DE1188078B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1443908C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Mittel | |
| AT238215B (de) | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen | |
| DE1443890C (de) | Benzolsulfonyl Harnstoffe und Verfahren zu ihrer Herstellung | |
| DE1493670C (de) | Benzolsulfonylharnstoffe und deren pharmakologisch nicht giftige Salze so wie Verfahren zu deren Herstellung und diese enthaltende blutzucker senkende Mittel | |
| DE1135891B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1443898C (de) | Benzolsulfonylharnstoffe, Verfahren zu deren Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1443878C (de) | Verfahren zur Herstellung von Benzol= sulfonylharnstoffen | |
| AT228797B (de) | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen | |
| DE1443894C (de) | Benzolsulfonylharnstoffe, Verfahren zu deren Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1793111C3 (de) | Acylaminoäthylbenzolsulfonyl-delta hoch 2-cyclohexenyl-harnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| CH419089A (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |