DE1185180B - Verfahren zur Herstellung von Benzolsulfonylharnstoffen - Google Patents
Verfahren zur Herstellung von BenzolsulfonylharnstoffenInfo
- Publication number
- DE1185180B DE1185180B DEF41042A DEF0041042A DE1185180B DE 1185180 B DE1185180 B DE 1185180B DE F41042 A DEF41042 A DE F41042A DE F0041042 A DEF0041042 A DE F0041042A DE 1185180 B DE1185180 B DE 1185180B
- Authority
- DE
- Germany
- Prior art keywords
- benzenesulfonyl
- melting point
- ethyl
- urea
- methanol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title claims description 5
- -1 alkyl radical Chemical class 0.000 claims description 56
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 33
- 239000004202 carbamide Substances 0.000 claims description 24
- 235000013877 carbamide Nutrition 0.000 claims description 17
- 150000001875 compounds Chemical class 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 11
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical class NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 claims description 9
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- UJYAZVSPFMJCLW-UHFFFAOYSA-N n-(oxomethylidene)benzenesulfonamide Chemical class O=C=NS(=O)(=O)C1=CC=CC=C1 UJYAZVSPFMJCLW-UHFFFAOYSA-N 0.000 claims description 8
- 239000012948 isocyanate Substances 0.000 claims description 7
- 150000002513 isocyanates Chemical class 0.000 claims description 7
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 7
- 150000003672 ureas Chemical class 0.000 claims description 7
- 150000001412 amines Chemical class 0.000 claims description 6
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims description 4
- 239000004215 Carbon black (E152) Substances 0.000 claims description 3
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- ALZKZGUTVJXYEF-UHFFFAOYSA-N benzenesulfonylcarbamic acid Chemical class OC(=O)NS(=O)(=O)C1=CC=CC=C1 ALZKZGUTVJXYEF-UHFFFAOYSA-N 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 3
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- JOMVGRRCEIJQFK-UHFFFAOYSA-N benzenesulfonylcarbamothioic s-acid Chemical class OC(=S)NS(=O)(=O)C1=CC=CC=C1 JOMVGRRCEIJQFK-UHFFFAOYSA-N 0.000 claims description 2
- 230000015572 biosynthetic process Effects 0.000 claims description 2
- 150000001714 carbamic acid halides Chemical class 0.000 claims description 2
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 claims description 2
- NQOJWOIPQBVKKX-UHFFFAOYSA-N cyclooctane Chemical compound [CH]1CCCCCCC1 NQOJWOIPQBVKKX-UHFFFAOYSA-N 0.000 claims description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical group 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims 1
- 150000003254 radicals Chemical class 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 210
- 238000002844 melting Methods 0.000 description 180
- 230000008018 melting Effects 0.000 description 180
- WHQSYGRFZMUQGQ-UHFFFAOYSA-N n,n-dimethylformamide;hydrate Chemical compound O.CN(C)C=O WHQSYGRFZMUQGQ-UHFFFAOYSA-N 0.000 description 32
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- 239000000243 solution Substances 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 235000019441 ethanol Nutrition 0.000 description 13
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 13
- 238000003756 stirring Methods 0.000 description 12
- 239000008280 blood Substances 0.000 description 11
- 210000004369 blood Anatomy 0.000 description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- 238000001816 cooling Methods 0.000 description 10
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- WWECJGLXBSQKRF-UHFFFAOYSA-N n,n-dimethylformamide;methanol Chemical compound OC.CN(C)C=O WWECJGLXBSQKRF-UHFFFAOYSA-N 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- 239000000155 melt Substances 0.000 description 7
- 239000003610 charcoal Substances 0.000 description 6
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 6
- 210000002700 urine Anatomy 0.000 description 6
- 150000001408 amides Chemical class 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 5
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 4
- HSOHBWMXECKEKV-UHFFFAOYSA-N cyclooctanamine Chemical compound NC1CCCCCCC1 HSOHBWMXECKEKV-UHFFFAOYSA-N 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 4
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical class OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 description 4
- YPFHWRDYUCUQBV-UHFFFAOYSA-N N-[[4-(cyclohexylcarbamoylsulfamoyl)phenyl]methyl]benzamide Chemical compound O=C(NC1CCCCC1)NS(=O)(=O)C1=CC=C(CNC(=O)C2=CC=CC=C2)C=C1 YPFHWRDYUCUQBV-UHFFFAOYSA-N 0.000 description 3
- GMEFOPJZNHXLPW-UHFFFAOYSA-N N-[[4-(cyclooctylcarbamoylsulfamoyl)phenyl]methyl]benzamide Chemical compound C(C1=CC=CC=C1)(=O)NCC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC1CCCCCCC1 GMEFOPJZNHXLPW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 229940100389 Sulfonylurea Drugs 0.000 description 3
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- WUESWDIHTKHGQA-UHFFFAOYSA-N cyclohexylurea Chemical compound NC(=O)NC1CCCCC1 WUESWDIHTKHGQA-UHFFFAOYSA-N 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229940072033 potash Drugs 0.000 description 3
- 235000015320 potassium carbonate Nutrition 0.000 description 3
- 229940124530 sulfonamide Drugs 0.000 description 3
- 150000003456 sulfonamides Chemical class 0.000 description 3
- WOVKHESNZTTXME-UHFFFAOYSA-N (4-methylcyclohexyl)urea Chemical compound CC1CCC(NC(N)=O)CC1 WOVKHESNZTTXME-UHFFFAOYSA-N 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- SVYOXGBINYWSDQ-UHFFFAOYSA-N 1,4-dioxane;ethanol Chemical compound CCO.C1COCCO1 SVYOXGBINYWSDQ-UHFFFAOYSA-N 0.000 description 2
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241000283973 Oryctolagus cuniculus Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- GHDLZGOOOLEJKI-UHFFFAOYSA-N benzenesulfonylurea Chemical class NC(=O)NS(=O)(=O)C1=CC=CC=C1 GHDLZGOOOLEJKI-UHFFFAOYSA-N 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- AOCYHPQXGJBAQQ-UHFFFAOYSA-N ethyl n-sulfonylcarbamate Chemical class CCOC(=O)N=S(=O)=O AOCYHPQXGJBAQQ-UHFFFAOYSA-N 0.000 description 2
- 235000021190 leftovers Nutrition 0.000 description 2
- 230000005923 long-lasting effect Effects 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- RGKZBZGSRPRAEO-UHFFFAOYSA-N (4-propan-2-ylcyclohexyl)urea Chemical compound CC(C)C1CCC(NC(N)=O)CC1 RGKZBZGSRPRAEO-UHFFFAOYSA-N 0.000 description 1
- SWSXEZOUBBVKCO-UHFFFAOYSA-N 1-isocyanato-4-methylcyclohexane Chemical compound CC1CCC(N=C=O)CC1 SWSXEZOUBBVKCO-UHFFFAOYSA-N 0.000 description 1
- MOIQCUSEEYCGON-UHFFFAOYSA-N 1-sulfonylethyl N-methylcarbamate Chemical compound S(=O)(=O)=C(OC(NC)=O)C MOIQCUSEEYCGON-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- LZULGYKMZVTUJA-UHFFFAOYSA-N 3-(4-methylcyclohexyl)-1,1-diphenylurea Chemical compound C1(=CC=CC=C1)N(C(=O)NC1CCC(CC1)C)C1=CC=CC=C1 LZULGYKMZVTUJA-UHFFFAOYSA-N 0.000 description 1
- TUFJSIICUYTTHH-UHFFFAOYSA-N 4-chloro-n-[(4-sulfamoylphenyl)methyl]benzamide Chemical compound C1=CC(S(=O)(=O)N)=CC=C1CNC(=O)C1=CC=C(Cl)C=C1 TUFJSIICUYTTHH-UHFFFAOYSA-N 0.000 description 1
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 1
- IKQCKANHUYSABG-UHFFFAOYSA-N 4-ethylcyclohexan-1-amine Chemical compound CCC1CCC(N)CC1 IKQCKANHUYSABG-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- JBTFWVHPAMQBSG-UHFFFAOYSA-N CC(=O)NC(=O)NS(=O)(=O)C1=CC=C(C=C1)CNC(=O)C2=CC=CC=C2 Chemical compound CC(=O)NC(=O)NS(=O)(=O)C1=CC=C(C=C1)CNC(=O)C2=CC=CC=C2 JBTFWVHPAMQBSG-UHFFFAOYSA-N 0.000 description 1
- VTSPTVAHPMQKCY-UHFFFAOYSA-N CCCCNC(=O)NS(=O)(=O)C1=CC=C(C=C1)CNC(=O)C2=CC=CC=C2 Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C=C1)CNC(=O)C2=CC=CC=C2 VTSPTVAHPMQKCY-UHFFFAOYSA-N 0.000 description 1
- 244000265913 Crataegus laevigata Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- KVTNAXVBIWZCFW-UHFFFAOYSA-N N-[3-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]propyl]-4-methylbenzamide Chemical compound CC1=CC=C(C(=O)NCCCC2=CC=C(C=C2)S(=O)(=O)NC(=O)NC2CCCCC2)C=C1 KVTNAXVBIWZCFW-UHFFFAOYSA-N 0.000 description 1
- DQNHNVJSWPPXFY-UHFFFAOYSA-N N-cyclooctylurea Chemical compound NC(=O)NC1CCCCCCC1 DQNHNVJSWPPXFY-UHFFFAOYSA-N 0.000 description 1
- XDUILTRQGGJUAL-UHFFFAOYSA-N NS(=O)(=O)C1=CC=C(CCCNC(=O)C2=CC=CC=C2)C=C1 Chemical compound NS(=O)(=O)C1=CC=C(CCCNC(=O)C2=CC=CC=C2)C=C1 XDUILTRQGGJUAL-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229940125708 antidiabetic agent Drugs 0.000 description 1
- 239000003472 antidiabetic agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical group OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- CNWSQCLBDWYLAN-UHFFFAOYSA-N butylurea Chemical compound CCCCNC(N)=O CNWSQCLBDWYLAN-UHFFFAOYSA-N 0.000 description 1
- 150000001716 carbazoles Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- XDMMMGGRRNTWML-UHFFFAOYSA-N cyclohexylazanium;acetate Chemical compound CC(O)=O.NC1CCCCC1 XDMMMGGRRNTWML-UHFFFAOYSA-N 0.000 description 1
- 238000006477 desulfuration reaction Methods 0.000 description 1
- 230000023556 desulfurization Effects 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- KQRWMAQZSHMONP-UHFFFAOYSA-N ethyl N-(4-benzamido-2-methylphenyl)sulfonyl-N-methylcarbamate Chemical compound C(C1=CC=CC=C1)(=O)NC1=CC(=C(C=C1)S(=O)(=O)N(C(=O)OCC)C)C KQRWMAQZSHMONP-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical compound COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- 229940127017 oral antidiabetic Drugs 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- PFUVRDFDKPNGAV-UHFFFAOYSA-N sodium peroxide Chemical compound [Na+].[Na+].[O-][O-] PFUVRDFDKPNGAV-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical compound NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 description 1
- QXKXDIKCIPXUPL-UHFFFAOYSA-N sulfanylidenemercury Chemical compound [Hg]=S QXKXDIKCIPXUPL-UHFFFAOYSA-N 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/20—Radicals substituted by singly bound hetero atoms other than halogen by nitrogen atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/64—Sulfonylureas, e.g. glibenclamide, tolbutamide, chlorpropamide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/50—Compounds containing any of the groups, X being a hetero atom, Y being any atom
- C07C311/52—Y being a hetero atom
- C07C311/54—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea
- C07C311/57—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea having sulfur atoms of the sulfonylurea groups bound to carbon atoms of six-membered aromatic rings
- C07C311/59—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea having sulfur atoms of the sulfonylurea groups bound to carbon atoms of six-membered aromatic rings having nitrogen atoms of the sulfonylurea groups bound to carbon atoms of rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/18—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/22—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/04—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/62—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to atoms of the carbocyclic ring
- C07D317/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Priority Applications (64)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF41042A DE1185180B (de) | 1963-10-19 | 1963-10-19 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| DE19641443878 DE1443878C (de) | 1964-02-20 | 1964-02-20 | Verfahren zur Herstellung von Benzol= sulfonylharnstoffen |
| DE19641443890 DE1443890C (de) | 1964-05-21 | 1964-05-21 | Benzolsulfonyl Harnstoffe und Verfahren zu ihrer Herstellung |
| DE19641443894 DE1443894C (de) | 1964-06-26 | 1964-06-26 | Benzolsulfonylharnstoffe, Verfahren zu deren Herstellung und diese enthaltende pharmazeutische Präparate |
| LU47099A LU47099A1 (enExample) | 1963-10-19 | 1964-10-07 | |
| US403641A US3426067A (en) | 1963-10-19 | 1964-10-13 | Benzenesulfonyl ureas and process for their manufacture |
| DK506164AA DK119052B (da) | 1963-10-19 | 1964-10-14 | Analogifremgangsmåde til fremstilling af benzensulfonylurinstoffer eller salte deraf. |
| IL22259A IL22259A (en) | 1963-10-19 | 1964-10-14 | Benzenesulfonyl-ureas and process for their manufacture |
| AT01149/67A AT278027B (de) | 1963-10-19 | 1964-10-16 | Verfahren zur herstellung von neuen benzolsulfonylharnstoffen und ihren salzen |
| CH1774467A CH521953A (de) | 1963-10-19 | 1964-10-16 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen |
| CH1774767A CH513138A (de) | 1963-10-19 | 1964-10-16 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen |
| AT881464A AT261627B (de) | 1963-10-19 | 1964-10-16 | Verfahren zur Herstellung neuen Benzolsulfonylharnstoffen und ihren Salzen |
| CH1774867A CH513139A (de) | 1963-10-19 | 1964-10-16 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen |
| SE12459/64A SE311151B (enExample) | 1963-10-19 | 1964-10-16 | |
| AT114867A AT267541B (de) | 1963-10-19 | 1964-10-16 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen und deren Salzen |
| CH1774667A CH512449A (de) | 1963-10-19 | 1964-10-16 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen |
| IS1424A IS765B6 (is) | 1963-10-19 | 1964-10-16 | Aðferð til að framleiða benzenesulfonyl-þurrefni. |
| AT115167A AT262309B (de) | 1963-10-19 | 1964-10-16 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen und ihren Salzen |
| AT115067A AT262308B (de) | 1963-10-19 | 1964-10-16 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen und ihren Salzen |
| CH1347664A CH529115A (de) | 1963-10-19 | 1964-10-16 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen |
| CH1774567A CH513137A (de) | 1963-10-19 | 1964-10-16 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| CH1774367A CH521952A (de) | 1963-10-19 | 1964-10-16 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen |
| NO155188A NO118548B (enExample) | 1963-10-19 | 1964-10-17 | |
| GB42547/64A GB1080705A (en) | 1963-10-19 | 1964-10-19 | Benzenesulphonyl-ureas and process for their manufacture |
| MC515A MC488A1 (fr) | 1963-10-19 | 1964-10-19 | Nouvelles benzènes-sulfonylurées et leur préparation |
| FI2196/64A FI44597B (enExample) | 1963-10-19 | 1964-10-19 | |
| BE654561A BE654561A (enExample) | 1963-10-19 | 1964-10-19 | |
| IT22418/64A IT1061504B (it) | 1963-10-19 | 1964-10-19 | Benzolsolfoniluree e metodo per la loro preparazione |
| NL6412137A NL6412137A (enExample) | 1963-10-19 | 1964-10-19 | |
| FR991866A FR1473834A (fr) | 1963-10-19 | 1964-10-19 | Nouvelles benzène-sulfonylurées et leur préparation |
| OA51813A OA01367A (fr) | 1963-10-19 | 1964-12-31 | Nouvelles benzène-sulfonylurées et leur préparation. |
| FR2351A FR4316M (enExample) | 1963-10-19 | 1965-01-18 | |
| ES0312472A ES312472A1 (es) | 1963-10-19 | 1965-04-30 | Procedimiento para la preparacion de n-4-(beta-benzamidoetil) - bencenosulfonil - n,-(4 - metil-ciclohexil)-urea |
| DK541965AA DK120534B (da) | 1963-10-19 | 1965-10-22 | Analogifremgangsmåde til fremstilling af benzen sulfonylurinstoffer eller salte deraf. |
| DK542065AA DK120588B (da) | 1963-10-19 | 1965-10-22 | Analogifremgangsmåde til fremstilling af benzensulfonylurinstoffer eller salte deraf. |
| DK541665AA DK119455B (da) | 1963-10-19 | 1965-10-22 | Analogifremgangsmåde til fremstilling af benzensulfonylurinstoffer eller salte deraf. |
| DK541865AA DK119105B (da) | 1963-10-19 | 1965-10-22 | Analogifremgangsmåde til fremstilling af benzensulfonylurinstoffer eller salte deraf. |
| DK541765AA DK120742B (da) | 1963-10-19 | 1965-10-22 | Analogifremgangsmåde til fremstilling af benzensulfonylurinstoffer eller salte deraf. |
| DK541565AA DK120741B (da) | 1963-10-19 | 1965-10-22 | Analogifremgangsmåde til fremstilling af benzensulfonyluringstoffer eller salte deraf. |
| NO16030765A NO118556B (enExample) | 1963-10-19 | 1965-11-02 | |
| NO16030365A NO118552B (enExample) | 1963-10-19 | 1965-11-02 | |
| NO16030565A NO118554B (enExample) | 1963-10-19 | 1965-11-02 | |
| NO16030665A NO118555B (enExample) | 1963-10-19 | 1965-11-02 | |
| NO16030265A NO118551B (enExample) | 1963-10-19 | 1965-11-02 | |
| NO16030465A NO118553B (enExample) | 1963-10-19 | 1965-11-02 | |
| NO16030165A NO118550B (enExample) | 1963-10-19 | 1965-11-02 | |
| SE16076/66A SE334605B (enExample) | 1963-10-19 | 1966-11-24 | |
| SE16075/66A SE334604B (enExample) | 1963-10-19 | 1966-11-24 | |
| SE16077/66A SE334606B (enExample) | 1963-10-19 | 1966-11-24 | |
| SE16074/66A SE334603B (enExample) | 1963-10-19 | 1966-11-24 | |
| SE16078/66A SE334607B (enExample) | 1963-10-19 | 1966-11-24 | |
| SE16079/66A SE334608B (enExample) | 1963-10-19 | 1966-11-24 | |
| SE02494/68A SE334621B (enExample) | 1963-10-19 | 1968-02-27 | |
| CY43668A CY436A (en) | 1963-10-19 | 1968-03-22 | Benzenesulphonyl-ureas and process for their manufacture |
| US766008*A US3507961A (en) | 1963-10-19 | 1968-08-09 | Benzenesulfonyl ureas as anti-diabetic agents |
| MY1968113A MY6800113A (en) | 1963-10-19 | 1968-12-31 | Benzenesulphonyl-ureas and process for their manufacture |
| NL7304109A NL7304109A (en) | 1963-10-19 | 1973-03-23 | Benzenesulphonylureas hypoglycaemics |
| NL737304108A NL151698B (nl) | 1963-10-19 | 1973-03-23 | Werkwijze voor het bereiden van een geneesmiddel met een bloedsuikerspiegelverlagende werking, gevormd geneesmiddel verkregen door toepassing van deze werkwijze, alsmede werkwijze voor het bereiden van voor opnemen in zo'n geneesmiddel geschikte 4-(acylaminoalkyl)benzeensulfonylurea. |
| NL7304104A NL7304104A (en) | 1963-10-19 | 1973-03-23 | Benzenesulphonylureas hypoglycaemics |
| NL7304105A NL7304105A (en) | 1963-10-19 | 1973-03-23 | Benzenesulphonylureas hypoglycaemics |
| NL7304103A NL7304103A (en) | 1963-10-19 | 1973-03-23 | Benzenesulphonylureas hypoglycaemics |
| NL7304106A NL7304106A (en) | 1963-10-19 | 1973-03-23 | Benzenesulphonylureas hypoglycaemics |
| NL7304107A NL7304107A (en) | 1963-10-19 | 1973-03-23 | Benzenesulphonylureas hypoglycaemics |
| NL737304110A NL151363B (nl) | 1963-10-19 | 1973-03-23 | Werkwijze voor het bereiden van een geneesmiddel met een bloedsuikerspiegelverlagende werking, gevormd geneesmiddel verkregen door toepassing van deze werkwijze, alsmede werkwijze voor het bereiden van voor opnemen in zo'n geneesmiddel geschikte 4-(acylaminoalkyl) benzeensulfonylurea. |
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF41042A DE1185180B (de) | 1963-10-19 | 1963-10-19 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| DEF0042062 | 1964-02-20 | ||
| DEF0042933 | 1964-05-21 | ||
| DEF0043268 | 1964-06-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1185180B true DE1185180B (de) | 1965-01-14 |
Family
ID=27436911
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF41042A Pending DE1185180B (de) | 1963-10-19 | 1963-10-19 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
Country Status (21)
| Country | Link |
|---|---|
| US (2) | US3426067A (enExample) |
| AT (5) | AT261627B (enExample) |
| BE (1) | BE654561A (enExample) |
| CH (1) | CH529115A (enExample) |
| CY (1) | CY436A (enExample) |
| DE (1) | DE1185180B (enExample) |
| DK (7) | DK119052B (enExample) |
| ES (1) | ES312472A1 (enExample) |
| FI (1) | FI44597B (enExample) |
| FR (2) | FR1473834A (enExample) |
| GB (1) | GB1080705A (enExample) |
| IL (1) | IL22259A (enExample) |
| IS (1) | IS765B6 (enExample) |
| IT (1) | IT1061504B (enExample) |
| LU (1) | LU47099A1 (enExample) |
| MC (1) | MC488A1 (enExample) |
| MY (1) | MY6800113A (enExample) |
| NL (1) | NL6412137A (enExample) |
| NO (1) | NO118548B (enExample) |
| OA (1) | OA01367A (enExample) |
| SE (8) | SE311151B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3448149A (en) * | 1964-10-30 | 1969-06-03 | Hoechst Ag | Benzenesulfonyl ureas |
| US3454636A (en) * | 1965-03-24 | 1969-07-08 | Hoechst Ag | Benzenesulfonyl-ureas and process for their manufacture |
| US3454635A (en) * | 1965-07-27 | 1969-07-08 | Hoechst Ag | Benzenesulfonyl-ureas and process for their manufacture |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1185180B (de) * | 1963-10-19 | 1965-01-14 | Hoechst Ag | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| DE1493672C3 (de) * | 1964-08-01 | 1974-05-02 | Farbwerke Hoechst Ag, Vormals Meister Lucius & Bruening, 6000 Frankfurt | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| US4066639A (en) * | 1965-05-06 | 1978-01-03 | Hoechst Aktiengesellschaft | Benzene-sulfonyl semicarbazides and process for preparing them |
| DE1518895C3 (de) * | 1965-12-02 | 1978-12-07 | Hoechst Ag, 6000 Frankfurt | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und deren Verwendung |
| DE1244174C2 (de) * | 1965-09-10 | 1968-01-18 | Hoechst Ag | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| US3932503A (en) * | 1966-05-28 | 1976-01-13 | Hoechst Aktiengesellschaft | Benzenesulfonyl ureas |
| US3932658A (en) * | 1969-02-25 | 1976-01-13 | Hoechst Aktiengesellschaft | Composition and method for lower blood sugar containing N-[4-(β-<2-methoxy-5-chloro-benzamido>-ethyl)-benzenesulfonyl]-N'-cyclopentyl-urea |
| NL138933B (nl) * | 1969-03-26 | 1973-05-15 | Erba Carlo Spa | Werkwijze voor het bereiden van benzeensulfonylureumderivaten met bloedsuikerspiegelverlagende werking. |
| BE754454A (fr) * | 1969-08-06 | 1971-02-05 | Bayer Ag | Nouveaux composes hypoglycemiques du type d'arylsulfonylurees et d'arylsulfonylsemicarbazides contenant des groupes carbonamide |
| US4072758A (en) * | 1970-09-23 | 1978-02-07 | J. Uriach Y Cia, S.A. | Compositions and methods for effecting glucoreduction |
| US3957866A (en) * | 1970-09-23 | 1976-05-18 | J. Uriach & Cia S.A. | Cyclopentyl carbamide derivative and process for its production |
| ES384463A1 (es) * | 1970-09-23 | 1973-10-01 | Uriach & Cia Sa J | Procedimiento para la obtencion de n-4 - (beta-o-anisamido etil) - bencenosulfonil - n'ciclopentilcarbamida. |
| BE791638A (fr) * | 1971-11-20 | 1973-05-21 | Hoechst Ag | Sulfonyl-urees, leur procede de preparation et leurs applications |
| DE2230543A1 (de) * | 1972-06-22 | 1974-01-17 | Hoechst Ag | Benzolsulfonylharnstoffe und verfahren zu ihrer herstellung |
| US4067998A (en) * | 1974-02-11 | 1978-01-10 | The Dow Chemical Company | 2-((3,5-Di-tert-butylphenyl)thio) alkanoic acids and derivatives |
| DE2413514C3 (de) * | 1974-03-21 | 1982-03-04 | Hoechst Ag, 6000 Frankfurt | N-Acylaminoathylbenzolsulfonyl-N'-methylharnstoffe, Verfahren zu ihrer Herstellung und deren Verwendung |
| AU528362B2 (en) * | 1978-06-22 | 1983-04-28 | Societe D:Etudes De Produits Chimiques | Phenoxy isobutyramides |
| DE3211934A1 (de) * | 1982-03-31 | 1983-10-13 | Hoechst Ag, 6230 Frankfurt | Salicylsaeurederivate, verfahren zu ihrer herstellung, pharmazeutische praeparate auf basis dieser verbindungen und ihre verwendung |
| US4916163A (en) * | 1985-06-04 | 1990-04-10 | The Upjohn Company | Spray-dried lactose formulation of micronized glyburide |
| ATE146775T1 (de) * | 1993-02-23 | 1997-01-15 | Hoechst Ag | Substituierte benzolsulfonylharnstoffe und - thioharnstoffe- verfahren zu ihrer herstellung und ihre verwendung als pharmazeutika |
| HU226462B1 (en) * | 1995-02-17 | 2008-12-29 | Hoechst Ag | Substituted benzol-sulfonyl-ureas and -thioureas, process for producing them, pharmaceutical compositions containing them, and their use |
| NZ510424A (en) * | 1998-09-10 | 2003-06-30 | Aventis Pharma Gmbh | Use of benzenesulfonyl(thio)ureas for the treatment and prophylaxis of dysfunctions of the autonomous nervous system and use of benzenesulfonyl(thio)ureas in combination with beta-receptor blockers |
| DE19923086A1 (de) | 1999-05-20 | 2000-11-23 | Aventis Pharma Gmbh | Cinnamoylaminoalkyl-substituierte Benzolsulfonamidderivate, Verfahren zu ihrer Herstellung, ihre Verwendung und sie enthaltende pharmazeutische Präparate |
| US20010036479A1 (en) | 2000-01-14 | 2001-11-01 | Gillian Cave | Glyburide composition |
| DE10054482A1 (de) | 2000-11-03 | 2002-05-08 | Aventis Pharma Gmbh | Heteroarylacryloylaminoalkyl-substituierte Benzolsulfonamidderivate, ihre Herstellung, ihre Verwendung und sie enthaltende pharmazeutische Präparate |
| DE10054481A1 (de) | 2000-11-03 | 2002-05-08 | Aventis Pharma Gmbh | Acylaminoalkyl-substituierte Benzolsulfonamidderivate, ihre Herstellung, ihre Verwendung und sie enthaltende pharmazeutische Präparate |
| AU2003224917A1 (en) * | 2002-04-11 | 2003-10-27 | Carbomer | Diabetes imaging probes |
| US20060201981A1 (en) * | 2003-06-30 | 2006-09-14 | Meyer Dean E | Clip support member for golf bag |
| WO2006071960A2 (en) * | 2004-12-28 | 2006-07-06 | Kinex Pharmaceuticals, Llc | Compositions and methods of treating cell proliferation disorders |
| AU2006258842B2 (en) * | 2005-06-13 | 2011-09-15 | Merck Sharp & Dohme Limited | Therapeutic agents |
| US8883852B2 (en) | 2008-10-22 | 2014-11-11 | University of Pittburgh—Of the Commonwealth System of Higher Education | Radioprotective agents |
| WO2012079164A1 (en) * | 2010-12-16 | 2012-06-21 | The Governing Council Of The University Of Toronto | Activators of cylindrical proteases |
| US11840543B2 (en) | 2017-05-24 | 2023-12-12 | The University Of Queensland | Compounds and uses |
| CN112979571B (zh) * | 2021-02-24 | 2023-01-31 | 中国药科大学 | 一类akr1c3选择性抑制剂及其制备方法与用途 |
| EP4341246A1 (en) * | 2021-05-17 | 2024-03-27 | The United States of America, as represented by The Secretary, Department of Health and Human Services | A facile and odor-free approach to convert sulfonyl urea derivatives to chalcogenide sulfonyl urea derivatives |
| WO2025097000A1 (en) | 2023-11-01 | 2025-05-08 | Yale University | Antibody-based methods for treating polycystic kidney disease |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL218580A (enExample) * | 1960-04-28 | |||
| DE1185180B (de) * | 1963-10-19 | 1965-01-14 | Hoechst Ag | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
-
1963
- 1963-10-19 DE DEF41042A patent/DE1185180B/de active Pending
-
1964
- 1964-10-07 LU LU47099A patent/LU47099A1/xx unknown
- 1964-10-13 US US403641A patent/US3426067A/en not_active Expired - Lifetime
- 1964-10-14 DK DK506164AA patent/DK119052B/da unknown
- 1964-10-14 IL IL22259A patent/IL22259A/xx unknown
- 1964-10-16 IS IS1424A patent/IS765B6/is unknown
- 1964-10-16 AT AT881464A patent/AT261627B/de active
- 1964-10-16 AT AT115167A patent/AT262309B/de active
- 1964-10-16 AT AT115067A patent/AT262308B/de active
- 1964-10-16 AT AT114867A patent/AT267541B/de active
- 1964-10-16 CH CH1347664A patent/CH529115A/de not_active IP Right Cessation
- 1964-10-16 SE SE12459/64A patent/SE311151B/xx unknown
- 1964-10-16 AT AT01149/67A patent/AT278027B/de not_active IP Right Cessation
- 1964-10-17 NO NO155188A patent/NO118548B/no unknown
- 1964-10-19 GB GB42547/64A patent/GB1080705A/en not_active Expired
- 1964-10-19 MC MC515A patent/MC488A1/fr unknown
- 1964-10-19 NL NL6412137A patent/NL6412137A/xx unknown
- 1964-10-19 IT IT22418/64A patent/IT1061504B/it active
- 1964-10-19 BE BE654561A patent/BE654561A/xx unknown
- 1964-10-19 FI FI2196/64A patent/FI44597B/fi active
- 1964-10-19 FR FR991866A patent/FR1473834A/fr not_active Expired
- 1964-12-31 OA OA51813A patent/OA01367A/xx unknown
-
1965
- 1965-01-18 FR FR2351A patent/FR4316M/fr not_active Expired
- 1965-04-30 ES ES0312472A patent/ES312472A1/es not_active Expired
- 1965-10-22 DK DK541965AA patent/DK120534B/da unknown
- 1965-10-22 DK DK542065AA patent/DK120588B/da unknown
- 1965-10-22 DK DK541765AA patent/DK120742B/da unknown
- 1965-10-22 DK DK541565AA patent/DK120741B/da unknown
- 1965-10-22 DK DK541665AA patent/DK119455B/da unknown
- 1965-10-22 DK DK541865AA patent/DK119105B/da unknown
-
1966
- 1966-11-24 SE SE16074/66A patent/SE334603B/xx unknown
- 1966-11-24 SE SE16079/66A patent/SE334608B/xx unknown
- 1966-11-24 SE SE16077/66A patent/SE334606B/xx unknown
- 1966-11-24 SE SE16078/66A patent/SE334607B/xx unknown
- 1966-11-24 SE SE16076/66A patent/SE334605B/xx unknown
- 1966-11-24 SE SE16075/66A patent/SE334604B/xx unknown
-
1968
- 1968-02-27 SE SE02494/68A patent/SE334621B/xx unknown
- 1968-03-22 CY CY43668A patent/CY436A/xx unknown
- 1968-08-09 US US766008*A patent/US3507961A/en not_active Expired - Lifetime
- 1968-12-31 MY MY1968113A patent/MY6800113A/xx unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3448149A (en) * | 1964-10-30 | 1969-06-03 | Hoechst Ag | Benzenesulfonyl ureas |
| US3454636A (en) * | 1965-03-24 | 1969-07-08 | Hoechst Ag | Benzenesulfonyl-ureas and process for their manufacture |
| US3454635A (en) * | 1965-07-27 | 1969-07-08 | Hoechst Ag | Benzenesulfonyl-ureas and process for their manufacture |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1185180B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE2951135A1 (de) | Sulfonylharnstoffe, verfahren zu ihrer herstellung, pharmazeutische praeparate auf basis dieser verbindungen und ihre verwendung | |
| DE1518874C3 (de) | Benzolsulfonylharnstoffe und Verfahren zu ihrer Herstellung | |
| DE1493672C3 (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1443911A1 (de) | Benzolsulfonylharnstoffe und Verfahren zu ihrer Herstellung | |
| DE1198354B (de) | Verfahren zur Herstellung von Benzol-sulfonylharnstoffen | |
| DE1244174B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE2238870B2 (de) | Benzolsulfonylharnstoffe | |
| DE1181208B (de) | Verfahren zur Herstellung von N-Benzolsulfonyl-N'-cyclohexyl-harnstoffen | |
| DE2256979C3 (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1545810A1 (de) | Verfahren zur Herstellung von Benzolsulfonylsemicarbaziden | |
| DE1518895C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und deren Verwendung | |
| CH375706A (de) | Verfahren zur Herstellung von oral wirksamen Antidiabetika | |
| DE1443878C (de) | Verfahren zur Herstellung von Benzol= sulfonylharnstoffen | |
| DE1188078B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1793111C3 (de) | Acylaminoäthylbenzolsulfonyl-delta hoch 2-cyclohexenyl-harnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1251753B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1443890C (de) | Benzolsulfonyl Harnstoffe und Verfahren zu ihrer Herstellung | |
| DE2034986A1 (de) | 4 Sulfamoyl m toluidin Derivate | |
| DE1153357B (de) | Verfahren zur Herstellung von Azidobenzolsulfonylharnstoffen | |
| DE1443908C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Mittel | |
| DE1188589B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1135891B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE2157607A1 (de) | Sulfonylharnstoffe und verfahren zu ihrer herstellung | |
| CH353348A (de) | Verfahren zur Herstellung von oral wirksamen Antidiabetika |