DE1173762B - Saures galvanisches Nickelbad - Google Patents
Saures galvanisches NickelbadInfo
- Publication number
- DE1173762B DE1173762B DESCH29218A DESC029218A DE1173762B DE 1173762 B DE1173762 B DE 1173762B DE SCH29218 A DESCH29218 A DE SCH29218A DE SC029218 A DESC029218 A DE SC029218A DE 1173762 B DE1173762 B DE 1173762B
- Authority
- DE
- Germany
- Prior art keywords
- nickel
- chloride
- pyridinium
- compounds
- quinolinium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 title claims description 30
- 229910052759 nickel Inorganic materials 0.000 title claims description 15
- 239000002253 acid Substances 0.000 title claims description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 8
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 claims description 6
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 claims description 4
- -1 heterocyclic nitrogen compounds Chemical class 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 229910017464 nitrogen compound Inorganic materials 0.000 claims description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 4
- 150000001450 anions Chemical class 0.000 claims description 3
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 claims description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 238000000576 coating method Methods 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 150000002830 nitrogen compounds Chemical class 0.000 claims description 2
- 239000011148 porous material Substances 0.000 claims description 2
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 claims description 2
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 claims description 2
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 claims description 2
- 239000000080 wetting agent Substances 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 238000000151 deposition Methods 0.000 claims 1
- 238000009713 electroplating Methods 0.000 claims 1
- 125000002183 isoquinolinyl group Chemical class C1(=NC=CC2=CC=CC=C12)* 0.000 claims 1
- 239000003792 electrolyte Substances 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 7
- 239000000126 substance Substances 0.000 description 6
- 230000000694 effects Effects 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 4
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 3
- 239000004327 boric acid Substances 0.000 description 3
- SMWDFEZZVXVKRB-UHFFFAOYSA-O hydron;quinoline Chemical compound [NH+]1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-O 0.000 description 3
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000008021 deposition Effects 0.000 description 2
- WCBBLESOBVCMFC-UHFFFAOYSA-N ethenesulfonic acid;sodium Chemical compound [Na].OS(=O)(=O)C=C WCBBLESOBVCMFC-UHFFFAOYSA-N 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- LGQLOGILCSXPEA-UHFFFAOYSA-L nickel sulfate Chemical compound [Ni+2].[O-]S([O-])(=O)=O LGQLOGILCSXPEA-UHFFFAOYSA-L 0.000 description 2
- KERTUBUCQCSNJU-UHFFFAOYSA-L nickel(2+);disulfamate Chemical compound [Ni+2].NS([O-])(=O)=O.NS([O-])(=O)=O KERTUBUCQCSNJU-UHFFFAOYSA-L 0.000 description 2
- 229910000363 nickel(II) sulfate Inorganic materials 0.000 description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 2
- KCXFHTAICRTXLI-UHFFFAOYSA-M propane-1-sulfonate Chemical compound CCCS([O-])(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-M 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- DEVUYWTZRXOMSI-UHFFFAOYSA-N (sulfamoylamino)benzene Chemical compound NS(=O)(=O)NC1=CC=CC=C1 DEVUYWTZRXOMSI-UHFFFAOYSA-N 0.000 description 1
- SHHKMWMIKILKQW-UHFFFAOYSA-N 2-formylbenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1C=O SHHKMWMIKILKQW-UHFFFAOYSA-N 0.000 description 1
- PQYVGRGYAZDHFY-UHFFFAOYSA-N 4-formylbenzene-1,3-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(C=O)C(S(O)(=O)=O)=C1 PQYVGRGYAZDHFY-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- CULWTPQTPMEUMN-UHFFFAOYSA-J [Ni](Cl)Cl.S(=O)(=O)([O-])[O-].[Ni+2] Chemical compound [Ni](Cl)Cl.S(=O)(=O)([O-])[O-].[Ni+2] CULWTPQTPMEUMN-UHFFFAOYSA-J 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 150000008107 benzenesulfonic acids Chemical class 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000005868 electrolysis reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-O hydron;pyrimidine Chemical compound C1=CN=C[NH+]=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-O 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- AWJUIBRHMBBTKR-UHFFFAOYSA-O isoquinolin-2-ium Chemical compound C1=[NH+]C=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-O 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 150000002815 nickel Chemical class 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 238000005498 polishing Methods 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- UIIIBRHUICCMAI-UHFFFAOYSA-N prop-2-ene-1-sulfonic acid Chemical compound OS(=O)(=O)CC=C UIIIBRHUICCMAI-UHFFFAOYSA-N 0.000 description 1
- GPHQHTOMRSGBNZ-UHFFFAOYSA-O pyridin-1-ium-4-carbonitrile Chemical compound N#CC1=CC=[NH+]C=C1 GPHQHTOMRSGBNZ-UHFFFAOYSA-O 0.000 description 1
- 150000003248 quinolines Chemical class 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- LMYRWZFENFIFIT-UHFFFAOYSA-N toluene-4-sulfonamide Chemical compound CC1=CC=C(S(N)(=O)=O)C=C1 LMYRWZFENFIFIT-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- NLVXSWCKKBEXTG-UHFFFAOYSA-N vinylsulfonic acid Chemical compound OS(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/06—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom
- C07D213/16—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom containing only one pyridine ring
- C07D213/20—Quaternary compounds thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/04—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to the ring carbon atoms
- C07D215/10—Quaternary compounds
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25D—PROCESSES FOR THE ELECTROLYTIC OR ELECTROPHORETIC PRODUCTION OF COATINGS; ELECTROFORMING; APPARATUS THEREFOR
- C25D3/00—Electroplating: Baths therefor
- C25D3/02—Electroplating: Baths therefor from solutions
- C25D3/12—Electroplating: Baths therefor from solutions of nickel or cobalt
- C25D3/14—Electroplating: Baths therefor from solutions of nickel or cobalt from baths containing acetylenic or heterocyclic compounds
- C25D3/18—Heterocyclic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Electroplating And Plating Baths Therefor (AREA)
- Pyridine Compounds (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL274123D NL274123A (forum.php) | 1961-02-10 | ||
| NL132763D NL132763C (forum.php) | 1961-02-10 | ||
| DESCH29218A DE1173762B (de) | 1961-02-10 | 1961-02-10 | Saures galvanisches Nickelbad |
| GB1616/62A GB921560A (en) | 1961-02-10 | 1962-01-16 | Improvements in and relating to electrolytic nickel plating |
| US168229A US3190821A (en) | 1961-02-10 | 1962-01-23 | Nickel plating brightener |
| FR887346A FR1315356A (fr) | 1961-02-10 | 1962-02-08 | électrolyte pour le dépôt de nickel très brillant |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DESCH29218A DE1173762B (de) | 1961-02-10 | 1961-02-10 | Saures galvanisches Nickelbad |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1173762B true DE1173762B (de) | 1964-07-09 |
Family
ID=7431357
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DESCH29218A Pending DE1173762B (de) | 1961-02-10 | 1961-02-10 | Saures galvanisches Nickelbad |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3190821A (forum.php) |
| DE (1) | DE1173762B (forum.php) |
| GB (1) | GB921560A (forum.php) |
| NL (2) | NL132763C (forum.php) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1217170B (de) * | 1962-09-05 | 1966-05-18 | Dehydag Gmbh | Galvanische Nickelbaeder |
| US3953304A (en) * | 1975-06-23 | 1976-04-27 | Dart Industries Inc. | Electroplating baths for nickel and brightener-leveler compositions therefor |
| US8338591B2 (en) * | 2004-05-08 | 2012-12-25 | Novartis International Pharmaceutical Ltd. | 3-aryl-5,6-disubstituted pyridazines |
| EP3456870A1 (en) * | 2017-09-13 | 2019-03-20 | ATOTECH Deutschland GmbH | A bath and method for filling a vertical interconnect access or trench of a work piece with nickel or a nickel alloy |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2644788A (en) * | 1951-03-31 | 1953-07-07 | Harshaw Chem Corp | Electrodeposition of nickel |
| US2644789A (en) * | 1951-08-02 | 1953-07-07 | Harshaw Chem Corp | Electrodeposition of nickel |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE511322A (forum.php) * | 1946-04-20 | |||
| NL205377A (forum.php) * | 1955-03-16 | |||
| US2839460A (en) * | 1956-11-16 | 1958-06-17 | Hanson Van Winkle Munning Co | Electrolating |
| DE1092744B (de) * | 1958-12-17 | 1960-11-10 | Dehydag Gmbh | Saures galvanisches Nickelbad |
| US3008883A (en) * | 1958-12-18 | 1961-11-14 | Metal & Thermit Corp | Electrodeposition of bright nickel |
-
0
- NL NL274123D patent/NL274123A/xx unknown
- NL NL132763D patent/NL132763C/xx active
-
1961
- 1961-02-10 DE DESCH29218A patent/DE1173762B/de active Pending
-
1962
- 1962-01-16 GB GB1616/62A patent/GB921560A/en not_active Expired
- 1962-01-23 US US168229A patent/US3190821A/en not_active Expired - Lifetime
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2644788A (en) * | 1951-03-31 | 1953-07-07 | Harshaw Chem Corp | Electrodeposition of nickel |
| US2644789A (en) * | 1951-08-02 | 1953-07-07 | Harshaw Chem Corp | Electrodeposition of nickel |
Also Published As
| Publication number | Publication date |
|---|---|
| NL132763C (forum.php) | |
| US3190821A (en) | 1965-06-22 |
| GB921560A (en) | 1963-03-20 |
| NL274123A (forum.php) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1007592B (de) | Bad zur Herstellung von galvanischen Metallueberzuegen | |
| DE2256845A1 (de) | Verfahren und zusammensetzung zur galvanischen abscheidung einer zinn/bleilegierung | |
| DE2318985C2 (de) | Wäßriges alkalisches Bad zur galvanischen Abscheidung von glänzenden Zinkschichten | |
| DE1098781B (de) | Bad zur Herstellung hochglaenzender galvanischer Metallueberzuege | |
| DE3001879C2 (de) | Wäßriges saures Bad und Verfahren zur galvanischen Abscheidung von glänzenden und eingeebneten Nickel-Eisen-Schichten | |
| DE1004011B (de) | Saures galvanisches Nickelbad | |
| DE2506467C2 (de) | Bad und Verfahren zur galvanischen Abscheidung von Palladium-Nickel-Legierungen | |
| DE1246347B (de) | Saures galvanisches Kupferbad | |
| DE1173762B (de) | Saures galvanisches Nickelbad | |
| DE1180140B (de) | Verfahren zur Abscheidung feinkoerniger Niederschlaege bei der Raffinations- und Reduktionselektrolyse von Nickel, Zink, Silber, Zinn, Blei und insbesondere Kupfer | |
| DE1670376A1 (de) | Elektrolytisches Nickelbad | |
| DE2914866C2 (de) | Glanzmittel für wäßrige galvanische Zinkbäder | |
| DE2905177A1 (de) | Galvanisches zinkbad zum elektrolytischen abscheiden von glaenzenden zinkueberzuegen | |
| DE1237870B (de) | Saures galvanisches Nickelbad | |
| DE2352970A1 (de) | Korrosionsbestaendige metallueberzuege, die galvanisch abgeschiedenes nickel und mikroporoeses chrom enthalten | |
| DE2741347A1 (de) | Bad und verfahren zur elektrolytischen abscheidung von legierungen auf der basis von palladium | |
| DE3143225C2 (de) | "Stabiles wäßriges galvanisches Bad und Verfahren zur Schnellabscheidung von Silberüberzügen mit Spiegelglanz" | |
| DE1208593B (de) | Saures galvanisches Nickelbad zum Abscheiden halbglaenzender UEberzuege | |
| DE1621157A1 (de) | Saures galvanisches Nickelbad | |
| DE1086508B (de) | Saures galvanisches Kupferbad | |
| DE1140425B (de) | Alkalisch reagierende Komplexbaeder zum galvanischen Abscheiden von Silberueberzuegen | |
| DE1264919B (de) | Saures, galvanisches Zinnbad | |
| DE1228886C2 (de) | Saures galvanisches Bad | |
| DE2607306C2 (de) | Wäßriges, elektrolytisches Palladium-Plattierungsbad | |
| DE1302891B (forum.php) |