DE1172040B - Stabilisieren von Polyamiden - Google Patents
Stabilisieren von PolyamidenInfo
- Publication number
- DE1172040B DE1172040B DEJ20891A DEJ0020891A DE1172040B DE 1172040 B DE1172040 B DE 1172040B DE J20891 A DEJ20891 A DE J20891A DE J0020891 A DEJ0020891 A DE J0020891A DE 1172040 B DE1172040 B DE 1172040B
- Authority
- DE
- Germany
- Prior art keywords
- manganese
- stabilizer
- polyamides
- polyamide
- salt
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004952 Polyamide Substances 0.000 title claims description 27
- 229920002647 polyamide Polymers 0.000 title claims description 27
- 230000000087 stabilizing effect Effects 0.000 title claims description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 8
- 150000004820 halides Chemical class 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 7
- 150000007530 organic bases Chemical class 0.000 claims description 6
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 5
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052748 manganese Inorganic materials 0.000 claims description 4
- 239000011572 manganese Substances 0.000 claims description 4
- 150000001868 cobalt Chemical class 0.000 claims description 3
- 150000001768 cations Chemical class 0.000 claims description 2
- 239000012433 hydrogen halide Substances 0.000 claims description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 2
- 239000003381 stabilizer Substances 0.000 description 19
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Substances [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 13
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 8
- -1 aliphatic diamines Chemical class 0.000 description 6
- 239000010941 cobalt Substances 0.000 description 6
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 6
- 229940071125 manganese acetate Drugs 0.000 description 6
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 6
- 235000011007 phosphoric acid Nutrition 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- 229910017052 cobalt Inorganic materials 0.000 description 5
- 229920002302 Nylon 6,6 Polymers 0.000 description 4
- 229940005740 hexametaphosphate Drugs 0.000 description 4
- 239000004408 titanium dioxide Substances 0.000 description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 3
- GFORUURFPDRRRJ-UHFFFAOYSA-N [Na].[Mn] Chemical compound [Na].[Mn] GFORUURFPDRRRJ-UHFFFAOYSA-N 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 238000002845 discoloration Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 229910001502 inorganic halide Inorganic materials 0.000 description 3
- 150000002697 manganese compounds Chemical class 0.000 description 3
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 3
- 235000019799 monosodium phosphate Nutrition 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 239000011574 phosphorus Substances 0.000 description 3
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- 239000005749 Copper compound Substances 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- FCSHMCFRCYZTRQ-UHFFFAOYSA-N N,N'-diphenylthiourea Chemical compound C=1C=CC=CC=1NC(=S)NC1=CC=CC=C1 FCSHMCFRCYZTRQ-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical class C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 150000001880 copper compounds Chemical class 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 150000002696 manganese Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 150000002927 oxygen compounds Chemical class 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 150000003016 phosphoric acids Chemical class 0.000 description 2
- 238000006068 polycondensation reaction Methods 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 150000003235 pyrrolidines Chemical class 0.000 description 2
- GCLGEJMYGQKIIW-UHFFFAOYSA-H sodium hexametaphosphate Chemical compound [Na]OP1(=O)OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])O1 GCLGEJMYGQKIIW-UHFFFAOYSA-H 0.000 description 2
- 229910052724 xenon Inorganic materials 0.000 description 2
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 2
- YHMYGUUIMTVXNW-UHFFFAOYSA-N 1,3-dihydrobenzimidazole-2-thione Chemical compound C1=CC=C2NC(S)=NC2=C1 YHMYGUUIMTVXNW-UHFFFAOYSA-N 0.000 description 1
- WMRCTEPOPAZMMN-UHFFFAOYSA-N 2-undecylpropanedioic acid Chemical compound CCCCCCCCCCCC(C(O)=O)C(O)=O WMRCTEPOPAZMMN-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WAEMQWOKJMHJLA-UHFFFAOYSA-N Manganese(2+) Chemical compound [Mn+2] WAEMQWOKJMHJLA-UHFFFAOYSA-N 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 229920002292 Nylon 6 Polymers 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910001513 alkali metal bromide Inorganic materials 0.000 description 1
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- JLUGKDWGQPNDGX-UHFFFAOYSA-L azanium;manganese(2+);phosphate Chemical compound [NH4+].[Mn+2].[O-]P([O-])([O-])=O JLUGKDWGQPNDGX-UHFFFAOYSA-L 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- 150000003842 bromide salts Chemical class 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 229940011182 cobalt acetate Drugs 0.000 description 1
- 229910001429 cobalt ion Inorganic materials 0.000 description 1
- LHEFLUZWISWYSQ-CVBJKYQLSA-L cobalt(2+);(z)-octadec-9-enoate Chemical compound [Co+2].CCCCCCCC\C=C/CCCCCCCC([O-])=O.CCCCCCCC\C=C/CCCCCCCC([O-])=O LHEFLUZWISWYSQ-CVBJKYQLSA-L 0.000 description 1
- QAHREYKOYSIQPH-UHFFFAOYSA-L cobalt(II) acetate Chemical compound [Co+2].CC([O-])=O.CC([O-])=O QAHREYKOYSIQPH-UHFFFAOYSA-L 0.000 description 1
- 230000000254 damaging effect Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229940005739 hexasodium hexametaphosphate Drugs 0.000 description 1
- CPSYWNLKRDURMG-UHFFFAOYSA-L hydron;manganese(2+);phosphate Chemical compound [Mn+2].OP([O-])([O-])=O CPSYWNLKRDURMG-UHFFFAOYSA-L 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 229940082328 manganese acetate tetrahydrate Drugs 0.000 description 1
- 229910001437 manganese ion Inorganic materials 0.000 description 1
- CESXSDZNZGSWSP-UHFFFAOYSA-L manganese(2+);diacetate;tetrahydrate Chemical compound O.O.O.O.[Mn+2].CC([O-])=O.CC([O-])=O CESXSDZNZGSWSP-UHFFFAOYSA-L 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 150000002780 morpholines Chemical class 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 150000003017 phosphorus Chemical class 0.000 description 1
- 150000003053 piperidines Chemical class 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000019982 sodium hexametaphosphate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 1
- 238000007669 thermal treatment Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K13/00—Use of mixtures of ingredients not covered by one single of the preceding main groups, each of these compounds being essential
- C08K13/02—Organic and inorganic ingredients
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Polyamides (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB40626/60A GB934380A (en) | 1960-11-25 | 1960-11-25 | Polyamides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1172040B true DE1172040B (de) | 1964-06-11 |
Family
ID=10415822
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEJ20891A Pending DE1172040B (de) | 1960-11-25 | 1961-11-24 | Stabilisieren von Polyamiden |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3160597A (h) |
| BE (1) | BE610649A (h) |
| CH (1) | CH416083A (h) |
| DE (1) | DE1172040B (h) |
| ES (1) | ES272311A1 (h) |
| GB (1) | GB934380A (h) |
| NL (1) | NL271803A (h) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE608862A (h) * | 1960-10-06 | 1900-01-01 | ||
| NL297427A (h) * | 1962-09-03 | |||
| US3274151A (en) * | 1962-11-21 | 1966-09-20 | Schweizerische Viscose | Polyamides containing a combination of (1) a phenol, (2) a phosphorus acid salt or ester, (3) a manganese salt, and (4) a dicarboxylic acid as stabilizers |
| AT251883B (de) * | 1963-12-13 | 1967-01-25 | Snia Viscosa | Verfahren zur Herstellung von lichtbeständigen Polymeren |
| US3425986A (en) * | 1965-07-28 | 1969-02-04 | Firestone Tire & Rubber Co | Process and composition of matter |
| GB1141354A (en) * | 1965-10-21 | 1969-01-29 | Ici Ltd | Stabilisers for polymers |
| US3384615A (en) * | 1966-05-16 | 1968-05-21 | Grace W R & Co | Stabilization of polyamides |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB708029A (en) * | 1951-01-24 | 1954-04-28 | Du Pont | Stabilization of polyamides |
| DE1063378B (de) * | 1958-04-25 | 1959-08-13 | Glanzstoff Ag | Verfahren zur Verbesserung der Lichtbestaendigkeit von Gebilden aus Polyamiden |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2705227A (en) * | 1954-03-15 | 1955-03-29 | Du Pont | Heat stabilization of polyamides |
| US2887462A (en) * | 1955-01-26 | 1959-05-19 | Du Pont | Polyester or polyamide-manganous salt composition and process of preparing same |
| NL103099C (h) * | 1957-04-11 | |||
| NL240187A (h) * | 1958-06-14 |
-
0
- BE BE610649D patent/BE610649A/xx unknown
- NL NL271803D patent/NL271803A/xx unknown
-
1960
- 1960-11-25 GB GB40626/60A patent/GB934380A/en not_active Expired
-
1961
- 1961-11-23 CH CH1363761A patent/CH416083A/de unknown
- 1961-11-24 ES ES272311A patent/ES272311A1/es not_active Expired
- 1961-11-24 DE DEJ20891A patent/DE1172040B/de active Pending
- 1961-11-27 US US155183A patent/US3160597A/en not_active Expired - Lifetime
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB708029A (en) * | 1951-01-24 | 1954-04-28 | Du Pont | Stabilization of polyamides |
| DE1063378B (de) * | 1958-04-25 | 1959-08-13 | Glanzstoff Ag | Verfahren zur Verbesserung der Lichtbestaendigkeit von Gebilden aus Polyamiden |
Also Published As
| Publication number | Publication date |
|---|---|
| ES272311A1 (es) | 1962-03-01 |
| US3160597A (en) | 1964-12-08 |
| CH416083A (de) | 1966-06-30 |
| BE610649A (h) | |
| NL271803A (h) | |
| GB934380A (en) | 1963-08-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1417343A1 (de) | Verfahren zur Herstellung einer antibiotechnischen Zusammensetzung | |
| DE1111376B (de) | Verfahren zum Stabilisieren von linearen, Carbonamidgruppen enthaltenden Polykondensaten | |
| DE1172040B (de) | Stabilisieren von Polyamiden | |
| DE1805921A1 (de) | Thermoplastische,transparente Polyamid-Formmassen | |
| DE1442656B2 (de) | Verfahren zur Herstellung einer stabilen Dispersion pyrogen gewonnenen feinteiligen Siliciumdioxids | |
| DE1807255A1 (de) | Praeparat aus hinsichtlich ihrer Anzahl,Form und Volumen stabilisierter Suspensionen von organischen Partikelchen zur Konservierung mikroskopischer Partikelchen und zum Herstellen standardisierter Partikelchen-Suspensionen | |
| DE2308225A1 (de) | Pvc-mischung | |
| DE3788953T2 (de) | Polyamid-Zusammensetzung. | |
| DE964949C (de) | Verfahren zur Herstellung lagerbestaendiger Loesungen zum Flammfestmachen von Fasermaterial auf Cellulosebasis | |
| DE1420530A1 (de) | Verfahren zum Stabilisieren von synthetischen linearen Polyamiden | |
| DE1165846B (de) | Verfahren zum Stabilisieren von Polyamiden | |
| DE1194135B (de) | Verfahren zum Stabilisieren von Polyamiden | |
| CH424241A (de) | Mittel zur Stabilisierung von Vinylpolymerisaten gegen Licht- und Wärmeeinwirkung | |
| DE1645457A1 (de) | Stabilisierung von Polyamiden | |
| DE1694267C3 (de) | Hitzebeständige Polyamid-Formmassen | |
| DE1184945B (de) | Verfahren zum Stabilisieren von Polyamiden | |
| DE940065C (de) | Verfahren zur Stabilisierung von Vinylharz- und von Kautschukerzeugnissen | |
| DE1183682A (de) | Verfahren zur Stabilisierung von synthetischen linearen Polyamiden | |
| DE823791C (de) | Verfahren zur Entfernung von Kobalt aus Zinkelektrolyten | |
| DE1956708A1 (de) | Polyamid-Polyester-Dispersionen | |
| DE1218725B (de) | Licht- und waermebestaendige Formmassen aus Polypropylen | |
| DE589519C (de) | Verfahren zur Herstellung haltbarer Loesungen von Aminobenzoesaeurealkaminestern | |
| DE685542C (de) | Richtsalze zum Schmelzen von Kaese | |
| DE879303C (de) | Verfahren zum Stabilisieren von Kautschukmilch | |
| DE726175C (de) | Verfahren zur Verringerung der Loeslichkeit bzw. Quellbarkeit von Eiweissstoffen |