DE1166767B - Verfahren zur Herstellung von als Unkrautbekaempfungsmittel und gegen Eingeweideparasiten wirksamen N-Alkanoyldinitrobenzoesaeureamiden - Google Patents
Verfahren zur Herstellung von als Unkrautbekaempfungsmittel und gegen Eingeweideparasiten wirksamen N-AlkanoyldinitrobenzoesaeureamidenInfo
- Publication number
- DE1166767B DE1166767B DED29440A DED0029440A DE1166767B DE 1166767 B DE1166767 B DE 1166767B DE D29440 A DED29440 A DE D29440A DE D0029440 A DED0029440 A DE D0029440A DE 1166767 B DE1166767 B DE 1166767B
- Authority
- DE
- Germany
- Prior art keywords
- dinitro
- acid amide
- alkanoyl
- dinitrobenzoic acid
- dinitrobenzoic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 21
- 238000002360 preparation method Methods 0.000 title description 8
- 244000045947 parasite Species 0.000 title 1
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 24
- -1 methoxy, methyl Chemical group 0.000 claims description 18
- KIMCGLHTSSZPNS-UHFFFAOYSA-N 2,3-dinitrobenzamide Chemical compound NC(=O)C1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O KIMCGLHTSSZPNS-UHFFFAOYSA-N 0.000 claims description 7
- 239000000126 substance Substances 0.000 claims description 7
- 239000003054 catalyst Substances 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- ZEFNOZRLAWVAQF-UHFFFAOYSA-N Dinitolmide Chemical compound CC1=C(C(N)=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O ZEFNOZRLAWVAQF-UHFFFAOYSA-N 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 230000002378 acidificating effect Effects 0.000 claims description 3
- 239000004009 herbicide Substances 0.000 claims description 3
- 239000012433 hydrogen halide Substances 0.000 claims description 3
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 3
- 150000008064 anhydrides Chemical class 0.000 claims description 2
- 239000011230 binding agent Substances 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 230000000968 intestinal effect Effects 0.000 claims 1
- 150000002927 oxygen compounds Chemical class 0.000 claims 1
- YZHUMGUJCQRKBT-UHFFFAOYSA-M sodium chlorate Chemical compound [Na+].[O-]Cl(=O)=O YZHUMGUJCQRKBT-UHFFFAOYSA-M 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 24
- 150000001875 compounds Chemical class 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 19
- 239000000047 product Substances 0.000 description 16
- 239000011541 reaction mixture Substances 0.000 description 16
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 14
- 238000002844 melting Methods 0.000 description 14
- 230000008018 melting Effects 0.000 description 14
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 12
- 229910052799 carbon Inorganic materials 0.000 description 12
- 238000001914 filtration Methods 0.000 description 12
- 229910052739 hydrogen Inorganic materials 0.000 description 12
- 239000001257 hydrogen Substances 0.000 description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 9
- 241001465754 Metazoa Species 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- XXUNIGZDNWWYED-UHFFFAOYSA-N 2-methylbenzamide Chemical compound CC1=CC=CC=C1C(N)=O XXUNIGZDNWWYED-UHFFFAOYSA-N 0.000 description 7
- 235000008247 Echinochloa frumentacea Nutrition 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 244000058871 Echinochloa crus-galli Species 0.000 description 6
- 241000499563 Eimeria necatrix Species 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 5
- 235000007320 Avena fatua Nutrition 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 244000144977 poultry Species 0.000 description 5
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 5
- UUKWKUSGGZNXGA-UHFFFAOYSA-N 3,5-dinitrobenzamide Chemical compound NC(=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 UUKWKUSGGZNXGA-UHFFFAOYSA-N 0.000 description 4
- 244000075850 Avena orientalis Species 0.000 description 4
- 208000003495 Coccidiosis Diseases 0.000 description 4
- 206010023076 Isosporiasis Diseases 0.000 description 4
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 230000034303 cell budding Effects 0.000 description 4
- 230000006378 damage Effects 0.000 description 4
- 239000002689 soil Substances 0.000 description 4
- OJFCQFOGGULEEI-UHFFFAOYSA-N 3,5-dinitro-N-propanoylbenzamide Chemical compound [N+](=O)([O-])C=1C=C(C(=O)NC(CC)=O)C=C(C1)[N+](=O)[O-] OJFCQFOGGULEEI-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 3
- 241000287828 Gallus gallus Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- DMLZFSSWWLRVHC-UHFFFAOYSA-N N-acetyl-2-methyl-3,5-dinitrobenzamide Chemical compound [N+](=O)([O-])C=1C(=C(C(=O)NC(C)=O)C=C(C1)[N+](=O)[O-])C DMLZFSSWWLRVHC-UHFFFAOYSA-N 0.000 description 3
- JPBGTKCKPYAUHI-UHFFFAOYSA-N [N+](=O)([O-])C=1C(=C(C(=O)NC(CC)=O)C=C(C1)[N+](=O)[O-])C Chemical compound [N+](=O)([O-])C=1C(=C(C(=O)NC(CC)=O)C=C(C1)[N+](=O)[O-])C JPBGTKCKPYAUHI-UHFFFAOYSA-N 0.000 description 3
- XTFXWYUQPUSGIP-UHFFFAOYSA-N [N+](=O)([O-])C=1C(=C(C(=O)NC=O)C=C(C1)[N+](=O)[O-])C Chemical compound [N+](=O)([O-])C=1C(=C(C(=O)NC=O)C=C(C1)[N+](=O)[O-])C XTFXWYUQPUSGIP-UHFFFAOYSA-N 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 3
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 2
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 2
- JIYLSGFLLWXHGN-UHFFFAOYSA-N 2-methoxy-3,5-dinitrobenzamide Chemical compound COC1=C(C(N)=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O JIYLSGFLLWXHGN-UHFFFAOYSA-N 0.000 description 2
- KCXRELBLRPGFSU-UHFFFAOYSA-N 2-methyl-3,5-dinitro-N-pentanoylbenzamide Chemical compound [N+](=O)([O-])C=1C(=C(C(=O)NC(CCCC)=O)C=C(C1)[N+](=O)[O-])C KCXRELBLRPGFSU-UHFFFAOYSA-N 0.000 description 2
- VYWYYJYRVSBHJQ-UHFFFAOYSA-N 3,5-dinitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 VYWYYJYRVSBHJQ-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 125000003047 N-acetyl group Chemical group 0.000 description 2
- NFLIVWBJEDGBLZ-UHFFFAOYSA-N N-acetyl-2-methoxy-3,5-dinitrobenzamide Chemical compound [N+](=O)([O-])C=1C(=C(C(=O)NC(C)=O)C=C(C1)[N+](=O)[O-])OC NFLIVWBJEDGBLZ-UHFFFAOYSA-N 0.000 description 2
- HRMGJMRTYMVUSZ-UHFFFAOYSA-N N-acetyl-3,5-dinitrobenzamide Chemical compound [N+](=O)([O-])C=1C=C(C(=O)NC(C)=O)C=C(C1)[N+](=O)[O-] HRMGJMRTYMVUSZ-UHFFFAOYSA-N 0.000 description 2
- HNPLOEQTHLPNCL-UHFFFAOYSA-N N-acetyl-N,2-dimethyl-3,5-dinitrobenzamide Chemical compound CN(C(C)=O)C(=O)C1=C(C)C(=CC(=C1)[N+]([O-])=O)[N+]([O-])=O HNPLOEQTHLPNCL-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- YHASWHZGWUONAO-UHFFFAOYSA-N butanoyl butanoate Chemical compound CCCC(=O)OC(=O)CCC YHASWHZGWUONAO-UHFFFAOYSA-N 0.000 description 2
- 239000003729 cation exchange resin Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 2
- HTWWKYKIBSHDPC-UHFFFAOYSA-N decanoyl decanoate Chemical compound CCCCCCCCCC(=O)OC(=O)CCCCCCCCC HTWWKYKIBSHDPC-UHFFFAOYSA-N 0.000 description 2
- 239000012954 diazonium Substances 0.000 description 2
- 150000001989 diazonium salts Chemical class 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- NHGVZTMBVDFPHJ-UHFFFAOYSA-N formyl fluoride Chemical compound FC=O NHGVZTMBVDFPHJ-UHFFFAOYSA-N 0.000 description 2
- 230000002363 herbicidal effect Effects 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 244000000053 intestinal parasite Species 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- NLEUXPOVZGDKJI-UHFFFAOYSA-N nickel(2+);dicyanide Chemical compound [Ni+2].N#[C-].N#[C-] NLEUXPOVZGDKJI-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000000590 parasiticidal effect Effects 0.000 description 2
- DUCKXCGALKOSJF-UHFFFAOYSA-N pentanoyl pentanoate Chemical compound CCCCC(=O)OC(=O)CCCC DUCKXCGALKOSJF-UHFFFAOYSA-N 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- LXQOQPGNCGEELI-UHFFFAOYSA-N 2,4-dinitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O LXQOQPGNCGEELI-UHFFFAOYSA-N 0.000 description 1
- UTESHVANCFLTQV-UHFFFAOYSA-N 2,4-dinitrobenzamide Chemical class NC(=O)C1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O UTESHVANCFLTQV-UHFFFAOYSA-N 0.000 description 1
- ADTKEYLCJYYHHH-UHFFFAOYSA-N 2-chloro-3,5-dinitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1Cl ADTKEYLCJYYHHH-UHFFFAOYSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- GKTFLKJXZOYBRW-UHFFFAOYSA-N 2-ethylbenzamide Chemical compound CCC1=CC=CC=C1C(N)=O GKTFLKJXZOYBRW-UHFFFAOYSA-N 0.000 description 1
- XLJMDBOKSZROPC-UHFFFAOYSA-N 2-methoxy-4,6-dinitroaniline Chemical compound COC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1N XLJMDBOKSZROPC-UHFFFAOYSA-N 0.000 description 1
- ZAMOEFQZCCUBBM-UHFFFAOYSA-N 2-methoxy-4,6-dinitrobenzamide Chemical class COC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1C(N)=O ZAMOEFQZCCUBBM-UHFFFAOYSA-N 0.000 description 1
- MNWSGMTUGXNYHJ-UHFFFAOYSA-N 2-methoxybenzamide Chemical compound COC1=CC=CC=C1C(N)=O MNWSGMTUGXNYHJ-UHFFFAOYSA-N 0.000 description 1
- YTUKZWSMRTXUPV-UHFFFAOYSA-N 2-methyl-4,6-dinitrobenzamide Chemical compound CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1C(N)=O YTUKZWSMRTXUPV-UHFFFAOYSA-N 0.000 description 1
- DOQGEYYGGHYOJZ-UHFFFAOYSA-N 2-methyl-6-nitrobenzamide Chemical compound CC1=CC=CC([N+]([O-])=O)=C1C(N)=O DOQGEYYGGHYOJZ-UHFFFAOYSA-N 0.000 description 1
- GGUOCFNAWIODMF-UHFFFAOYSA-N 4-chloroacetanilide Chemical compound CC(=O)NC1=CC=C(Cl)C=C1 GGUOCFNAWIODMF-UHFFFAOYSA-N 0.000 description 1
- FRBOKVYMYKXJAP-UHFFFAOYSA-N 6-methyl-2,3-dinitrobenzamide Chemical compound CC1=CC=C([N+]([O-])=O)C([N+]([O-])=O)=C1C(N)=O FRBOKVYMYKXJAP-UHFFFAOYSA-N 0.000 description 1
- 241000213004 Alternaria solani Species 0.000 description 1
- 241001647031 Avena sterilis Species 0.000 description 1
- 235000004535 Avena sterilis Nutrition 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 235000008116 Echinochloa crusgalli var frumentacea Nutrition 0.000 description 1
- 244000182691 Echinochloa frumentacea Species 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 206010018498 Goitre Diseases 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- JEJVLPITNCKHFS-UHFFFAOYSA-N N-butanoyl-2-methyl-3,5-dinitrobenzamide Chemical compound [N+](=O)([O-])C=1C(=C(C(=O)NC(CCC)=O)C=C(C1)[N+](=O)[O-])C JEJVLPITNCKHFS-UHFFFAOYSA-N 0.000 description 1
- KCQYWHFOBJGXTJ-UHFFFAOYSA-N [N+](=O)([O-])C1(C(C=CC=C1)(C(=O)N)[N+](=O)[O-])C Chemical compound [N+](=O)([O-])C1(C(C=CC=C1)(C(=O)N)[N+](=O)[O-])C KCQYWHFOBJGXTJ-UHFFFAOYSA-N 0.000 description 1
- FXXACINHVKSMDR-UHFFFAOYSA-N acetyl bromide Chemical compound CC(Br)=O FXXACINHVKSMDR-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000007767 bonding agent Substances 0.000 description 1
- 238000009395 breeding Methods 0.000 description 1
- 230000001488 breeding effect Effects 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- IPIVAXLHTVNRBS-UHFFFAOYSA-N decanoyl chloride Chemical compound CCCCCCCCCC(Cl)=O IPIVAXLHTVNRBS-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- NVJBFARDFTXOTO-UHFFFAOYSA-N diethyl sulfite Chemical compound CCOS(=O)OCC NVJBFARDFTXOTO-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000008029 eradication Effects 0.000 description 1
- 230000035611 feeding Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 201000003872 goiter Diseases 0.000 description 1
- 244000144993 groups of animals Species 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- UCVODTZQZHMTPN-UHFFFAOYSA-N heptanoyl chloride Chemical compound CCCCCCC(Cl)=O UCVODTZQZHMTPN-UHFFFAOYSA-N 0.000 description 1
- YWGHUJQYGPDNKT-UHFFFAOYSA-N hexanoyl chloride Chemical compound CCCCCC(Cl)=O YWGHUJQYGPDNKT-UHFFFAOYSA-N 0.000 description 1
- PKHMTIRCAFTBDS-UHFFFAOYSA-N hexanoyl hexanoate Chemical compound CCCCCC(=O)OC(=O)CCCCC PKHMTIRCAFTBDS-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- LSACYLWPPQLVSM-UHFFFAOYSA-N isobutyric acid anhydride Chemical compound CC(C)C(=O)OC(=O)C(C)C LSACYLWPPQLVSM-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- URQALMDQINOOPO-UHFFFAOYSA-N n-(2,3-dichlorophenyl)acetamide Chemical compound CC(=O)NC1=CC=CC(Cl)=C1Cl URQALMDQINOOPO-UHFFFAOYSA-N 0.000 description 1
- SCYGGCAQZFJGRF-UHFFFAOYSA-N n-(3,4-dichlorophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(Cl)C(Cl)=C1 SCYGGCAQZFJGRF-UHFFFAOYSA-N 0.000 description 1
- NTQYXUJLILNTFH-UHFFFAOYSA-N nonanoyl chloride Chemical compound CCCCCCCCC(Cl)=O NTQYXUJLILNTFH-UHFFFAOYSA-N 0.000 description 1
- 235000021049 nutrient content Nutrition 0.000 description 1
- REEZZSHJLXOIHL-UHFFFAOYSA-N octanoyl chloride Chemical compound CCCCCCCC(Cl)=O REEZZSHJLXOIHL-UHFFFAOYSA-N 0.000 description 1
- RAFYDKXYXRZODZ-UHFFFAOYSA-N octanoyl octanoate Chemical compound CCCCCCCC(=O)OC(=O)CCCCCCC RAFYDKXYXRZODZ-UHFFFAOYSA-N 0.000 description 1
- FATBGEAMYMYZAF-KTKRTIGZSA-N oleamide Chemical compound CCCCCCCC\C=C/CCCCCCCC(N)=O FATBGEAMYMYZAF-KTKRTIGZSA-N 0.000 description 1
- 210000003250 oocyst Anatomy 0.000 description 1
- 239000002297 parasiticide Substances 0.000 description 1
- XGISHOFUAFNYQF-UHFFFAOYSA-N pentanoyl chloride Chemical compound CCCCC(Cl)=O XGISHOFUAFNYQF-UHFFFAOYSA-N 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/02—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having nitrogen atoms of carboxamide groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/44—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a nitrogen atom attached to the same carbon skeleton by a single or double bond, this nitrogen atom not being a member of a derivative or of a thio analogue of a carboxylic group, e.g. amino-carboxylic acids
- A01N37/48—Nitro-carboxylic acids; Derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/90—Carboxylic acid amides having nitrogen atoms of carboxamide groups further acylated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US698363A US2937204A (en) | 1957-11-25 | 1957-11-25 | Nu-alkanoyl dinitrobenzamides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1166767B true DE1166767B (de) | 1964-04-02 |
Family
ID=24804921
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DED29440A Pending DE1166767B (de) | 1957-11-25 | 1958-11-24 | Verfahren zur Herstellung von als Unkrautbekaempfungsmittel und gegen Eingeweideparasiten wirksamen N-Alkanoyldinitrobenzoesaeureamiden |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2937204A (enFirst) |
| DE (1) | DE1166767B (enFirst) |
| GB (1) | GB861890A (enFirst) |
| LU (1) | LU38172A1 (enFirst) |
| NL (1) | NL247377A (enFirst) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3231360A (en) * | 1959-09-11 | 1966-01-25 | Monsanto Co | Herbicidal method |
| CH402843A (de) * | 1959-11-12 | 1965-11-30 | Ciba Geigy | Verfahren zur Herstellung neuer Naphthalinverbindungen |
| US3157642A (en) * | 1961-06-28 | 1964-11-17 | Ciba Geigy Corp | 2, 3, 4, 5-tetra-hydro-1h-1, 3-benzo-diazepin-4-ones |
| US3321295A (en) * | 1965-11-04 | 1967-05-23 | Monsanto Co | Method of controlling undesired plants |
| US4015976A (en) * | 1973-07-16 | 1977-04-05 | Texaco Development Corporation | N-acetyl L-polychlorobenzamide herbicides |
| US3959370A (en) * | 1973-07-16 | 1976-05-25 | Jefferson Chemical Company, Inc. | N-acetyl l-polychlorobenzamide compounds |
| US4139389A (en) * | 1977-03-07 | 1979-02-13 | Eastman Kodak Company | Cleavable aromatic nitro compounds |
| US4139379A (en) * | 1977-03-07 | 1979-02-13 | Eastman Kodak Company | Photographic elements containing ballasted electron-accepting nucleophilic displacement compounds |
| US4218368A (en) * | 1977-03-07 | 1980-08-19 | Eastman Kodak Company | Aromatic nitro compounds containing diffusible groups cleavable by intramolecular nucleophilic displacement |
| US5464871A (en) * | 1993-05-12 | 1995-11-07 | Octamer, Inc. | Aromatic nitro and nitroso compounds and their metabolites useful as anti-viral and anti-tumor agents |
| US5659082A (en) * | 1995-04-03 | 1997-08-19 | Centaur Pharmaceuticals, Inc. | Nitro- and aminobenzamide compounds for neurodegenerative disorders |
| US5643965A (en) * | 1995-04-03 | 1997-07-01 | Centaur Pharmaceuticals, Inc. | Aminobenzamide compounds for the treatment of neurodegenerative disorders |
| NZ565654A (en) * | 2005-07-18 | 2010-10-29 | Bipar Sciences Inc | Use of iodonitrobenzamide compounds for the treatment of ovarian cancer |
| CA2655257A1 (en) * | 2006-06-12 | 2008-12-04 | Bipar Sciences, Inc. | Method of treating diseases with parp inhibitors |
| US20100279327A1 (en) * | 2006-06-12 | 2010-11-04 | Bipar Sciences, Inc. | Method of treating diseases with parp inhibitors |
| WO2008030883A2 (en) * | 2006-09-05 | 2008-03-13 | Bipar Sciences, Inc. | Treatment of cancer |
| CA2662337A1 (en) * | 2006-09-05 | 2008-03-13 | Bipar Sciences, Inc. | Inhibition of fatty acid synthesis by parp inhibitors and methods of treatment thereof |
| CN101903025A (zh) * | 2007-10-19 | 2010-12-01 | 彼帕科学公司 | 利用苯并吡喃酮-型parp抑制剂治疗癌症的方法和组合物 |
| JP2011503111A (ja) * | 2007-11-12 | 2011-01-27 | バイパー サイエンシズ,インコーポレイティド | Parp阻害剤単独又は抗腫瘍剤との組み合わせによる乳がんの治療 |
| CA2705417A1 (en) * | 2007-11-12 | 2009-05-22 | Bipar Sciences, Inc. | Treatment of uterine cancer and ovarian cancer with a parp inhibitor alone or in combination with anti-tumor agents |
| AU2008333786A1 (en) * | 2007-12-07 | 2009-06-11 | Bipar Sciences, Inc. | Treatment of cancer with combinations of topoisomerase inhibitors and PARP inhibitors |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB771865A (en) * | 1954-09-03 | 1957-04-03 | Us Rubber Co | Sulphite diesters and insecticides and herbicides containing í¡ í¡ |
| DE1005784B (de) * | 1956-02-03 | 1957-04-04 | Basf Ag | Unkrautbekaempfungsmittel |
| DE1039779B (de) * | 1957-04-20 | 1958-09-25 | Bayer Ag | Unkrautbekaempfungsmittel |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL50693C (enFirst) * | 1934-11-13 | |||
| US2436130A (en) * | 1944-11-25 | 1948-02-17 | Eastman Kodak Co | Acyl substituted reactive methylene color couplers |
| US2439352A (en) * | 1946-03-21 | 1948-04-06 | Eastman Kodak Co | Open chain active methylene color couplers |
| US2477816A (en) * | 1947-09-05 | 1949-08-02 | Hoffmann La Roche | Benzil-acid derivative and process for the manufacture thereof |
| US2619480A (en) * | 1951-09-15 | 1952-11-25 | American Cyanamid Co | Melamine-formaldehyde resinous composition containing acetyl benzamide |
| GB748781A (en) * | 1953-06-03 | 1956-05-09 | Ward Blenkinsop & Co Ltd | Salts of n-substituted amides |
-
0
- LU LU38172D patent/LU38172A1/xx unknown
- NL NL247377D patent/NL247377A/xx unknown
-
1957
- 1957-11-25 US US698363A patent/US2937204A/en not_active Expired - Lifetime
-
1958
- 1958-11-24 GB GB37713/58A patent/GB861890A/en not_active Expired
- 1958-11-24 DE DED29440A patent/DE1166767B/de active Pending
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB771865A (en) * | 1954-09-03 | 1957-04-03 | Us Rubber Co | Sulphite diesters and insecticides and herbicides containing í¡ í¡ |
| DE1005784B (de) * | 1956-02-03 | 1957-04-04 | Basf Ag | Unkrautbekaempfungsmittel |
| DE1039779B (de) * | 1957-04-20 | 1958-09-25 | Bayer Ag | Unkrautbekaempfungsmittel |
Also Published As
| Publication number | Publication date |
|---|---|
| LU38172A1 (enFirst) | |
| NL247377A (enFirst) | |
| US2937204A (en) | 1960-05-17 |
| GB861890A (en) | 1961-03-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1166767B (de) | Verfahren zur Herstellung von als Unkrautbekaempfungsmittel und gegen Eingeweideparasiten wirksamen N-Alkanoyldinitrobenzoesaeureamiden | |
| DE69324552T4 (de) | N'-substituierte-N,N'Diacylhydrazin-Insektizide | |
| DE2609280A1 (de) | Schaedlingsbekaempfungsmittel | |
| DE2819878A1 (de) | Verfahren zur beeinflussung der pollenbildung bei monoezischen oder hermaphroditischen pflanzen | |
| DE1297111B (de) | Thiabicyclo-2-nonenverbindungen | |
| DE1618709B2 (de) | Salicylanilide, Verfahren zu ihrer Herstellung und solche Verbindungen enthaltende ArzneimitteL | |
| DE2815340A1 (de) | Substituierte alkylsulfonanilide | |
| DE3306996A1 (de) | Acrylsaeuremorpholide, ihre herstellung und verwendung | |
| DE2061133A1 (de) | Pestizide Verbindung,Verfahren zu ihrer Herstellung und Verwendung | |
| EP0108908A2 (de) | Neue Benzotriazole, ihre Herstellung und ihre Verwendung als biozide Wirkstoffe | |
| DE2041732A1 (de) | Acylierte Arylhydrazino-2-imidazoline,Verfahren zu ihrer Herstellung und ihre Verwendung als Ektoparasitizide | |
| DE2056606C3 (de) | Alkylhydrazincarbodithioatderivate | |
| DE2242785A1 (de) | 1-alkylsulfonyl-2-trifluormethylbenzimidazole, verfahren zu ihrer herstellung sowie ihre verwendung als ektoparasitenmittel | |
| AT375070B (de) | Verfahren zur herstellung von neuen imidazolinylbenzoaten und den optischen isomeren und isomerengemischen hiervon sowie deren salzen | |
| DE1953357A1 (de) | Cyclopropan-carbonsaeure-benzthiazylamide,Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| DE2041734A1 (de) | Carbamate der 2-Phenylhydrazino-2-imidazoline,Verfahren zu ihrer Herstellung und ihre Verwendung als Ektoparasitizide | |
| AT214433B (de) | Verfahren zur Herstellung der neuen 2,3,6-Trichlorphenylessigsäure und deren Salze, Ester, Amide oder Halogenide | |
| CH639375A5 (de) | Benzimidazol-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als agrochemische mittel. | |
| DE953125C (de) | Mittel zur Bekaempfung von Mikroorganismen, wie Pilzen (Fungi), Bakterien und Protozoen | |
| DE1958180A1 (de) | Substituierte Propargylbenzamide und Verfahren zu ihrer Herstellung | |
| DE2822127A1 (de) | Substituierte benzimidazole, verfahren zu ihrer herstellung, sie enthaltendes herbizides mittel und ihre verwendung zum bekaempfen des wachstums von unkraut | |
| AT211296B (de) | Verfahren zur Herstellung von neuen Sulfamylanthranilsäuren | |
| DE2039666C3 (de) | S-Amino-i^^-trithiacyclohexane, Verfahren zu ihrer Herstellung und diese enthaltende Schädlingsbekämpfungsmittel | |
| DE2431801C3 (de) | Benzothiazolderivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur selektiven Unkrautbekämpfung in Reis- oder Weizenkulturen | |
| AT226710B (de) | Verfahren zur Herstellung von neuen Dihydrochinoxalonen-(2) und von deren Salzen |