DE1142605B - Verfahren zur Herstellung von Alkyl- bzw. Cycloalkylthiophosphonsaeureesteramiden - Google Patents
Verfahren zur Herstellung von Alkyl- bzw. CycloalkylthiophosphonsaeureesteramidenInfo
- Publication number
- DE1142605B DE1142605B DEF28228A DEF0028228A DE1142605B DE 1142605 B DE1142605 B DE 1142605B DE F28228 A DEF28228 A DE F28228A DE F0028228 A DEF0028228 A DE F0028228A DE 1142605 B DE1142605 B DE 1142605B
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- lower alkyl
- mol
- methyl
- yield
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 ester amides Chemical class 0.000 title claims description 18
- 238000000034 method Methods 0.000 title claims description 11
- 125000000217 alkyl group Chemical group 0.000 title claims description 9
- 238000002360 preparation method Methods 0.000 title claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 150000002989 phenols Chemical class 0.000 claims description 4
- 229910052717 sulfur Chemical group 0.000 claims description 4
- 239000011593 sulfur Chemical group 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 3
- 150000001447 alkali salts Chemical class 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 239000011230 binding agent Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 2
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 33
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 150000002148 esters Chemical class 0.000 description 18
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 15
- 239000000460 chlorine Substances 0.000 description 14
- 239000000203 mixture Substances 0.000 description 14
- 238000003756 stirring Methods 0.000 description 12
- 241000700159 Rattus Species 0.000 description 11
- 239000003921 oil Substances 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- WXJXBKBJAKPJRN-UHFFFAOYSA-N Methanephosphonothioic acid Chemical compound CP(O)(O)=S WXJXBKBJAKPJRN-UHFFFAOYSA-N 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 231100000419 toxicity Toxicity 0.000 description 5
- 230000001988 toxicity Effects 0.000 description 5
- 241001454295 Tetranychidae Species 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 241000255925 Diptera Species 0.000 description 3
- 230000000749 insecticidal effect Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- VKALYYFVKBXHTF-UHFFFAOYSA-N 4-(methylsulfanyl)-m-cresol Chemical compound CSC1=CC=C(O)C=C1C VKALYYFVKBXHTF-UHFFFAOYSA-N 0.000 description 2
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 2
- PRLINSMUYJWPBL-UHFFFAOYSA-N 4-tert-butyl-2-chlorophenol Chemical compound CC(C)(C)C1=CC=C(O)C(Cl)=C1 PRLINSMUYJWPBL-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 241001124076 Aphididae Species 0.000 description 2
- IYOKMWZMWXXUJG-UHFFFAOYSA-N N-[hydroxy(methyl)phosphinothioyl]-N-methylmethanamine hydrochloride Chemical compound Cl.CN(C)P(C)(O)=S IYOKMWZMWXXUJG-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- HGELWZQRZUOEOJ-UHFFFAOYSA-N ethyl-dihydroxy-sulfanylidene-$l^{5}-phosphane Chemical compound CCP(O)(O)=S HGELWZQRZUOEOJ-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 230000003151 ovacidal effect Effects 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- CURNJKLCYZZBNJ-UHFFFAOYSA-M sodium;4-nitrophenolate Chemical compound [Na+].[O-]C1=CC=C([N+]([O-])=O)C=C1 CURNJKLCYZZBNJ-UHFFFAOYSA-M 0.000 description 2
- PTTPXKJBFFKCEK-UHFFFAOYSA-N 2-Methyl-4-heptanone Chemical compound CC(C)CC(=O)CC(C)C PTTPXKJBFFKCEK-UHFFFAOYSA-N 0.000 description 1
- VZXOZSQDJJNBRC-UHFFFAOYSA-N 4-chlorobenzenethiol Chemical compound SC1=CC=C(Cl)C=C1 VZXOZSQDJJNBRC-UHFFFAOYSA-N 0.000 description 1
- GWMWXFGQYATKBA-UHFFFAOYSA-N 4-methyl-2-sulfanylphenol Chemical compound CC1=CC=C(O)C(S)=C1 GWMWXFGQYATKBA-UHFFFAOYSA-N 0.000 description 1
- 241000256113 Culicidae Species 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 206010058667 Oral toxicity Diseases 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 231100000517 death Toxicity 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 231100000418 oral toxicity Toxicity 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000003388 sodium compounds Chemical class 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/44—Amides thereof
- C07F9/4434—Amides thereof the ester moiety containing a substituent or a structure which is considered as characteristic
- C07F9/4449—Esters with hydroxyaryl compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL128817D NL128817C (enrdf_load_stackoverflow) | 1959-04-16 | ||
| NL250581D NL250581A (enrdf_load_stackoverflow) | 1959-04-16 | ||
| BE589734D BE589734A (enrdf_load_stackoverflow) | 1959-04-16 | ||
| DEF28228A DE1142605B (de) | 1959-04-16 | 1959-04-16 | Verfahren zur Herstellung von Alkyl- bzw. Cycloalkylthiophosphonsaeureesteramiden |
| CH424860A CH394197A (de) | 1959-04-16 | 1960-04-13 | Verfahren zur Herstellung von Phosphonsäure-esteramiden |
| GB13467/60A GB903429A (en) | 1959-04-16 | 1960-04-14 | Phosphonic and thiophosphonic acid amides |
| FR824538A FR1268479A (fr) | 1959-04-16 | 1960-04-15 | Amides de l'acide phosphonique et procédé pour les préparer |
| BE603253A BE603253R (fr) | 1959-04-16 | 1961-05-02 | Amides de l'acide phosphonique et procédé pour les préparer |
| US124378A US3260712A (en) | 1959-04-16 | 1961-07-17 | Alkyl phosphonic and thiophosphonic aryl ester amides |
| DK494362AA DK114457B (da) | 1959-04-16 | 1962-11-16 | Middel til bekæmpelse af skadelige organismer. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF28228A DE1142605B (de) | 1959-04-16 | 1959-04-16 | Verfahren zur Herstellung von Alkyl- bzw. Cycloalkylthiophosphonsaeureesteramiden |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1142605B true DE1142605B (de) | 1963-01-24 |
Family
ID=7092787
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF28228A Pending DE1142605B (de) | 1959-04-16 | 1959-04-16 | Verfahren zur Herstellung von Alkyl- bzw. Cycloalkylthiophosphonsaeureesteramiden |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3260712A (enrdf_load_stackoverflow) |
| BE (2) | BE603253R (enrdf_load_stackoverflow) |
| CH (1) | CH394197A (enrdf_load_stackoverflow) |
| DE (1) | DE1142605B (enrdf_load_stackoverflow) |
| DK (1) | DK114457B (enrdf_load_stackoverflow) |
| FR (1) | FR1268479A (enrdf_load_stackoverflow) |
| GB (1) | GB903429A (enrdf_load_stackoverflow) |
| NL (2) | NL128817C (enrdf_load_stackoverflow) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE589734A (enrdf_load_stackoverflow) * | 1959-04-16 | |||
| DE1193036B (de) * | 1962-12-22 | 1965-05-20 | Bayer Ag | Verfahren zur Herstellung von Phosphor-, Phosphon-, Phosphin- bzw. Thiophosphor-, -phosphon-, -phosphinsaeureestern |
| DE2202528A1 (de) * | 1972-01-20 | 1973-07-26 | Bayer Ag | Jodphenyl(thiono)-phosphor(phosphon)saeureester, -esteramide und -esterdiamide, verfahren zu ihrer herstellung sowie ihre verwendung als insektizide und akarizide |
| DE2246104A1 (de) * | 1972-09-20 | 1974-03-28 | Bayer Ag | 0-phenyl-n-alkyl-(alkenyl)-aethanphosphonsaeureesteramide, verfahren zu ihrer herstellung sowie ihre verwendung als nematizide |
| US3923733A (en) * | 1973-04-13 | 1975-12-02 | American Cyanamid Co | Polyolefin light stabilizers |
| US3984348A (en) * | 1973-11-05 | 1976-10-05 | American Cyanamid Company | Polyolefin light stabilizers |
| US5205852A (en) * | 1991-11-12 | 1993-04-27 | Imperial Chemical Industries Plc | Alkylphosphonamidate herbicides |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2668839A (en) * | 1953-04-21 | 1954-02-09 | Dow Chemical Co | O-(2, 4, 5-trichlorophenyl) n, n-diethylamidoalkanephosphonates |
| US2668840A (en) * | 1953-04-21 | 1954-02-09 | Dow Chemical Co | O-(4-nitrophenyl) n, n-diethylamidoalkanephosphonates |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3113005A (en) * | 1953-11-05 | 1963-12-03 | Ethyl Corp | Gasoline fuels |
| US2765276A (en) * | 1955-05-19 | 1956-10-02 | Shell Dev | Lubricating compositions |
| AT194859B (de) * | 1956-08-14 | 1958-01-25 | Bayer Ag | Verfahren zur Herstellung von neuen Mono-α, β-alkylenimidophosphorverbindungen |
| CH350962A (de) * | 1957-02-15 | 1960-12-31 | Ciba Geigy | Verfahren zur Herstellung von neuen organischen Phosphorverbindungen |
| US2910402A (en) * | 1958-02-21 | 1959-10-27 | Du Pont | Compositions and methods for destroying insects |
| BE576063A (enrdf_load_stackoverflow) * | 1958-02-24 | |||
| US2967884A (en) * | 1958-04-01 | 1961-01-10 | Union Carbide Corp | Preparation of acrylic acid esters |
| US3010986A (en) * | 1958-11-10 | 1961-11-28 | Monsanto Chemicals | Alkyl substituted phosphonate biocidal compounds |
| BE589734A (enrdf_load_stackoverflow) * | 1959-04-16 | |||
| BE589735A (enrdf_load_stackoverflow) * | 1959-04-16 | |||
| NL250582A (enrdf_load_stackoverflow) * | 1959-04-16 |
-
0
- BE BE589734D patent/BE589734A/xx unknown
- NL NL250581D patent/NL250581A/xx unknown
- NL NL128817D patent/NL128817C/xx active
-
1959
- 1959-04-16 DE DEF28228A patent/DE1142605B/de active Pending
-
1960
- 1960-04-13 CH CH424860A patent/CH394197A/de unknown
- 1960-04-14 GB GB13467/60A patent/GB903429A/en not_active Expired
- 1960-04-15 FR FR824538A patent/FR1268479A/fr not_active Expired
-
1961
- 1961-05-02 BE BE603253A patent/BE603253R/fr active
- 1961-07-17 US US124378A patent/US3260712A/en not_active Expired - Lifetime
-
1962
- 1962-11-16 DK DK494362AA patent/DK114457B/da unknown
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2668839A (en) * | 1953-04-21 | 1954-02-09 | Dow Chemical Co | O-(2, 4, 5-trichlorophenyl) n, n-diethylamidoalkanephosphonates |
| US2668840A (en) * | 1953-04-21 | 1954-02-09 | Dow Chemical Co | O-(4-nitrophenyl) n, n-diethylamidoalkanephosphonates |
Also Published As
| Publication number | Publication date |
|---|---|
| NL250581A (enrdf_load_stackoverflow) | |
| US3260712A (en) | 1966-07-12 |
| FR1268479A (fr) | 1961-08-04 |
| BE603253R (fr) | 1961-09-01 |
| DK114457B (da) | 1969-06-30 |
| NL128817C (enrdf_load_stackoverflow) | |
| BE589734A (enrdf_load_stackoverflow) | |
| CH394197A (de) | 1965-06-30 |
| GB903429A (en) | 1962-08-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1445746A1 (de) | Verfahren zur Herstellung von unsymmetrischen Thiol- bzw. Thionothiolphosphorsaeureestern | |
| DE1134372B (de) | Verfahren zur Herstellung von Phosphin-bzw. Thionophosphinsaeureestern | |
| DE1142605B (de) | Verfahren zur Herstellung von Alkyl- bzw. Cycloalkylthiophosphonsaeureesteramiden | |
| DE1078124B (de) | Verfahren zur Herstellung von Thionophosphonsaeureestern | |
| DE1195758B (de) | Verfahren zur Herstellung von Phosphor-, Phosphon- bzw. Thiono-phosphor- oder -phosphonsaeureestern | |
| DE1138049B (de) | Verfahren zur Herstellung von Dithiophosphonsaeureestern | |
| DE1099533B (de) | Verfahren zur Herstellung von Dithio- oder Thiolphosphor-, -phosphon- oder -phosphinsaeureestern | |
| DE1138048B (de) | Verfahren zur Herstellung von (Thiono)Phosphon- bzw. (Thiono)Phosphinsaeureestern der ª- und ª-Naphthole | |
| DE1153747B (de) | Verfahren zur Herstellung von Phosphor-, Phosphon-, Phosphin- bzw. Thiophosphor-, -phosphon-, -phosphinsaeureestern | |
| DE1083811B (de) | Verfahren zur Herstellung von Benzylthiomethylaetherthiophosphor-verbindungen | |
| DE1136328B (de) | Verfahren zur Herstellung von Dithiolphosphorsaeureestern | |
| DE1193036B (de) | Verfahren zur Herstellung von Phosphor-, Phosphon-, Phosphin- bzw. Thiophosphor-, -phosphon-, -phosphinsaeureestern | |
| DE1062239B (de) | Verfahren zur Herstellung von Thiophosphorsaeureestern | |
| CH421136A (de) | Verfahren zur Herstellung von Verbindungen zur Bekämpfung von Schädlingen | |
| DE1206903B (de) | Verfahren zur Herstellung von Thiol- bzw. Thionothiolphosphor-(-phosphon)saeureestern | |
| DE1445029C (de) | Thiol- bzw. Thionothiolphosphorsäureester | |
| DE1795453C2 (de) | 0,0-Dimethyl- bzw. 0,0-Diäthylthiol- bzw. -thionothiolphosphorsäure-(2-oxobenzthiazolino) -methylester und Verfahren zu ihrer Herstellung | |
| DE1117110B (de) | Verfahren zur Herstellung von Thionophosphorsaeureestern | |
| DE1136333B (de) | Verfahren zur Herstellung von Thio- bzw. Dithiophosphonsaeureesteramiden | |
| DE1795453B1 (de) | 0,0-Dimethyl- bzw. 0,0-Diaethylthiol- bzw. -thionothiolphosphorsaeure-(2-oxobenzthiazolino)-methylester und Verfahren zu ihrer Herstellung | |
| AT257268B (de) | Mischungen zur Schädlingsbekämpfung | |
| DE1132131B (de) | Verfahren zur Herstellung von Thiolphosphonsaeureestern | |
| DE1145615B (de) | Verfahren zur Herstellung von Trithiophosphonsaeureestern | |
| DE1198350B (de) | Verfahren zur Herstellung von als Schaedlings-bekaempfungsmittel wirksamen Dialkylenol-phosphaten von alpha-Alkoxalyllaktonen | |
| DE1051851B (de) | Verfahren zur Herstellung von ª‰-Alkoxyvinyldithiophosphonsaeureestern |