DE1130951B - Verfahren zur Herstellung blauer Dispersionsfarbstoffe der Anthrachinonreihe - Google Patents
Verfahren zur Herstellung blauer Dispersionsfarbstoffe der AnthrachinonreiheInfo
- Publication number
 - DE1130951B DE1130951B DES66089A DES0066089A DE1130951B DE 1130951 B DE1130951 B DE 1130951B DE S66089 A DES66089 A DE S66089A DE S0066089 A DES0066089 A DE S0066089A DE 1130951 B DE1130951 B DE 1130951B
 - Authority
 - DE
 - Germany
 - Prior art keywords
 - parts
 - anthraquinone
 - water
 - stirred
 - dihydroxy
 - Prior art date
 - Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
 - Pending
 
Links
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 title claims description 8
 - 238000000034 method Methods 0.000 title claims description 8
 - 239000000986 disperse dye Substances 0.000 title claims description 5
 - 150000004056 anthraquinones Chemical class 0.000 title claims description 4
 - 238000004519 manufacturing process Methods 0.000 title description 3
 - -1 anthraquinone compound Chemical class 0.000 claims description 10
 - 238000005658 halogenation reaction Methods 0.000 claims description 7
 - 230000026030 halogenation Effects 0.000 claims description 6
 - QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 5
 - 239000003795 chemical substances by application Substances 0.000 claims description 3
 - 230000002140 halogenating effect Effects 0.000 claims description 3
 - 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
 - 125000000547 substituted alkyl group Chemical group 0.000 claims description 2
 - 239000012320 chlorinating reagent Substances 0.000 claims 1
 - 238000004040 coloring Methods 0.000 claims 1
 - XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 26
 - 239000000975 dye Substances 0.000 description 15
 - WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 12
 - OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
 - GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 12
 - 229910052794 bromium Inorganic materials 0.000 description 12
 - 239000002244 precipitate Substances 0.000 description 10
 - CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
 - 238000006243 chemical reaction Methods 0.000 description 8
 - RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 6
 - KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
 - CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
 - HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
 - KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 6
 - 239000004327 boric acid Substances 0.000 description 6
 - FWFGVMYFCODZRD-UHFFFAOYSA-N oxidanium;hydrogen sulfate Chemical compound O.OS(O)(=O)=O FWFGVMYFCODZRD-UHFFFAOYSA-N 0.000 description 6
 - 238000004043 dyeing Methods 0.000 description 5
 - 229910052736 halogen Inorganic materials 0.000 description 5
 - 239000000203 mixture Substances 0.000 description 5
 - 229920000728 polyester Polymers 0.000 description 5
 - 238000003756 stirring Methods 0.000 description 5
 - MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
 - 239000000835 fiber Substances 0.000 description 4
 - 239000000706 filtrate Substances 0.000 description 4
 - 150000002367 halogens Chemical class 0.000 description 4
 - LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
 - 238000005406 washing Methods 0.000 description 4
 - UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
 - ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
 - ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
 - 229920000297 Rayon Polymers 0.000 description 3
 - 125000003277 amino group Chemical group 0.000 description 3
 - 125000003118 aryl group Chemical group 0.000 description 3
 - 229910052801 chlorine Inorganic materials 0.000 description 3
 - 239000000460 chlorine Substances 0.000 description 3
 - 239000004744 fabric Substances 0.000 description 3
 - 230000007935 neutral effect Effects 0.000 description 3
 - 239000000047 product Substances 0.000 description 3
 - 229910000029 sodium carbonate Inorganic materials 0.000 description 3
 - 239000007858 starting material Substances 0.000 description 3
 - HSYLKWSCFRLSKB-UHFFFAOYSA-N 1,5-diamino-4,8-dihydroxyanthracene-9,10-dione Chemical compound O=C1C2=C(N)C=CC(O)=C2C(=O)C2=C1C(O)=CC=C2N HSYLKWSCFRLSKB-UHFFFAOYSA-N 0.000 description 2
 - ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
 - 229920000742 Cotton Polymers 0.000 description 2
 - LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
 - VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
 - 239000004952 Polyamide Substances 0.000 description 2
 - JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
 - SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 2
 - 229940081735 acetylcellulose Drugs 0.000 description 2
 - 230000029936 alkylation Effects 0.000 description 2
 - 238000005804 alkylation reaction Methods 0.000 description 2
 - 229920002678 cellulose Polymers 0.000 description 2
 - 229920002301 cellulose acetate Polymers 0.000 description 2
 - 238000009998 heat setting Methods 0.000 description 2
 - 229910052740 iodine Inorganic materials 0.000 description 2
 - 239000011630 iodine Substances 0.000 description 2
 - 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
 - 239000003960 organic solvent Substances 0.000 description 2
 - 229920002647 polyamide Polymers 0.000 description 2
 - 239000011541 reaction mixture Substances 0.000 description 2
 - 239000000779 smoke Substances 0.000 description 2
 - 239000002904 solvent Substances 0.000 description 2
 - 239000011877 solvent mixture Substances 0.000 description 2
 - YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
 - ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 2
 - 210000002268 wool Anatomy 0.000 description 2
 - NGNLGMGUWBMKHI-UHFFFAOYSA-N 1-amino-4,8-dihydroxy-5-(methylamino)anthracene-9,10-dione Chemical compound O=C1C2=C(N)C=CC(O)=C2C(=O)C2=C1C(O)=CC=C2NC NGNLGMGUWBMKHI-UHFFFAOYSA-N 0.000 description 1
 - IPJOWXGWQRTFMU-UHFFFAOYSA-N 1-amino-4,8-dihydroxy-5-nitroanthracene-9,10-dione Chemical compound O=C1C(C(=CC=C2O)[N+]([O-])=O)=C2C(=O)C2=C1C(O)=CC=C2N IPJOWXGWQRTFMU-UHFFFAOYSA-N 0.000 description 1
 - WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
 - 229930040373 Paraformaldehyde Natural products 0.000 description 1
 - 239000002202 Polyethylene glycol Substances 0.000 description 1
 - 239000002253 acid Substances 0.000 description 1
 - 125000000217 alkyl group Chemical group 0.000 description 1
 - 230000002152 alkylating effect Effects 0.000 description 1
 - 239000004305 biphenyl Substances 0.000 description 1
 - 238000009835 boiling Methods 0.000 description 1
 - 229920003086 cellulose ether Polymers 0.000 description 1
 - 239000007795 chemical reaction product Substances 0.000 description 1
 - 239000004927 clay Substances 0.000 description 1
 - 150000001875 compounds Chemical class 0.000 description 1
 - 238000001816 cooling Methods 0.000 description 1
 - 125000006310 cycloalkyl amino group Chemical group 0.000 description 1
 - 239000006185 dispersion Substances 0.000 description 1
 - 235000019441 ethanol Nutrition 0.000 description 1
 - VRZVPALEJCLXPR-UHFFFAOYSA-N ethyl 4-methylbenzenesulfonate Chemical compound CCOS(=O)(=O)C1=CC=C(C)C=C1 VRZVPALEJCLXPR-UHFFFAOYSA-N 0.000 description 1
 - 230000002209 hydrophobic effect Effects 0.000 description 1
 - 238000010409 ironing Methods 0.000 description 1
 - 239000000463 material Substances 0.000 description 1
 - 150000004702 methyl esters Chemical class 0.000 description 1
 - JZMJDSHXVKJFKW-UHFFFAOYSA-N methyl sulfate Chemical compound COS(O)(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-N 0.000 description 1
 - 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
 - 229920002866 paraformaldehyde Polymers 0.000 description 1
 - 229920002239 polyacrylonitrile Polymers 0.000 description 1
 - 229920001223 polyethylene glycol Polymers 0.000 description 1
 - 238000001556 precipitation Methods 0.000 description 1
 - UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
 - 239000002964 rayon Substances 0.000 description 1
 - 239000000344 soap Substances 0.000 description 1
 - ORFSSYGWXNGVFB-UHFFFAOYSA-N sodium 4-amino-6-[[4-[4-[(8-amino-1-hydroxy-5,7-disulfonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid Chemical compound COC1=C(C=CC(=C1)C2=CC(=C(C=C2)N=NC3=C(C4=C(C=C3)C(=CC(=C4N)S(=O)(=O)O)S(=O)(=O)O)O)OC)N=NC5=C(C6=C(C=C5)C(=CC(=C6N)S(=O)(=O)O)S(=O)(=O)O)O.[Na+] ORFSSYGWXNGVFB-UHFFFAOYSA-N 0.000 description 1
 - 159000000000 sodium salts Chemical class 0.000 description 1
 - 238000009987 spinning Methods 0.000 description 1
 - HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 1
 - 210000004243 sweat Anatomy 0.000 description 1
 - 229920001187 thermosetting polymer Polymers 0.000 description 1
 - 238000010626 work up procedure Methods 0.000 description 1
 
Classifications
- 
        
- C—CHEMISTRY; METALLURGY
 - C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
 - C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
 - C09B1/00—Dyes with anthracene nucleus not condensed with any other ring
 - C09B1/50—Amino-hydroxy-anthraquinones; Ethers and esters thereof
 - C09B1/51—N-substituted amino-hydroxy anthraquinone
 - C09B1/515—N-alkyl, N-aralkyl or N-cycloalkyl derivatives
 
 
Landscapes
- Chemical & Material Sciences (AREA)
 - Organic Chemistry (AREA)
 - Coloring (AREA)
 - Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
 
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title | 
|---|---|---|---|
| CH6691158A CH372409A (de) | 1958-12-04 | 1958-12-04 | Verfahren zur Herstellung blauer Dispersionsfarbstoffe der Anthrachinonreihe | 
Publications (1)
| Publication Number | Publication Date | 
|---|---|
| DE1130951B true DE1130951B (de) | 1962-06-07 | 
Family
ID=4527528
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date | 
|---|---|---|---|
| DES66089A Pending DE1130951B (de) | 1958-12-04 | 1959-12-02 | Verfahren zur Herstellung blauer Dispersionsfarbstoffe der Anthrachinonreihe | 
Country Status (5)
| Country | Link | 
|---|---|
| US (1) | US3164615A (enEXAMPLES) | 
| BE (1) | BE585015A (enEXAMPLES) | 
| CH (1) | CH372409A (enEXAMPLES) | 
| DE (1) | DE1130951B (enEXAMPLES) | 
| GB (1) | GB933503A (enEXAMPLES) | 
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| GB1000866A (en) * | 1961-03-22 | 1965-08-11 | Mitsubishi Chem Ind | Disperse anthraquinone dyestuffs | 
| BE629938A (enEXAMPLES) * | 1963-02-11 | |||
| US3389152A (en) * | 1964-02-04 | 1968-06-18 | Otto B May Inc | Alkoxyalkoxy-bromo-1, 4, 5, 8-tetrahydroxyanthraquinones | 
| DE2334657C2 (de) * | 1973-07-07 | 1975-03-27 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Brom enthaltenden anthrachinoiden Dispersionsfarbstoffen | 
| DE2714768C3 (de) * | 1977-04-02 | 1979-09-13 | Bayer Ag, 5090 Leverkusen | Transferdruckverfahren | 
| CN103436046A (zh) * | 2013-08-20 | 2013-12-11 | 杭州帝凯化工有限公司 | 一种环保新型分散蓝2bln的制备方法 | 
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| US1078505A (en) * | 1912-12-23 | 1913-11-11 | Agfa Ag | Blue dyes of the anthraquinone series. | 
| US2053277A (en) * | 1933-02-07 | 1936-09-08 | Celanese Corp | Manufacture and use of dyestuffs | 
| US2319043A (en) * | 1940-02-28 | 1943-05-11 | Eastman Kodak Co | Anthraquinone compounds and cellulose derivatives colored therewith | 
| US2604480A (en) * | 1947-08-29 | 1952-07-22 | Celanese Corp | 1-amino-2-bromo-4-hydroxy-anthraquinone by hydrolysis of 1-amino 2,4-dibrom anthraquinone | 
| US2659738A (en) * | 1950-02-28 | 1953-11-17 | Basf Ag | 1-nitroanthraquinone-3-carboxylic acid and a process of producing it | 
| US2659739A (en) * | 1950-04-14 | 1953-11-17 | Eastman Kodak Co | 1-hydroxy-4-beta-cyanopropylamino-anthraquinone and process for preparing same | 
| US2677694A (en) * | 1951-04-17 | 1954-05-04 | Gen Aniline & Film Corp | Condensation products of chloromethylated arylaminoanthraquinones and phenols | 
| US2727045A (en) * | 1952-12-13 | 1955-12-13 | American Cyanamid Co | Preparation of alkylaminoanthraquinones | 
| DE1029506B (de) * | 1955-03-07 | 1958-05-08 | Bayer Ag | Verfahren zur Herstellung von Farbstoffen fuer synthetische Fasern | 
| BE550013A (enEXAMPLES) * | 1955-08-02 | |||
| US2944870A (en) * | 1957-10-04 | 1960-07-12 | Ici Ltd | New colouring process | 
- 
        0
        
- BE BE585015D patent/BE585015A/xx unknown
 
 - 
        1958
        
- 1958-12-04 CH CH6691158A patent/CH372409A/de unknown
 
 - 
        1959
        
- 1959-11-30 US US856021A patent/US3164615A/en not_active Expired - Lifetime
 - 1959-12-02 DE DES66089A patent/DE1130951B/de active Pending
 - 1959-12-02 GB GB40977/59A patent/GB933503A/en not_active Expired
 
 
Also Published As
| Publication number | Publication date | 
|---|---|
| CH372409A (de) | 1963-10-15 | 
| GB933503A (en) | 1963-08-08 | 
| US3164615A (en) | 1965-01-05 | 
| BE585015A (enEXAMPLES) | 
Similar Documents
| Publication | Publication Date | Title | 
|---|---|---|
| DE1183189B (de) | Verfahren zur Herstellung von Anthrachinonfarbstoffen, die frei von sauren wasserloeslichmachenden Gruppen sind | |
| CH402266A (de) | Zusatzverdichter | |
| DE1130951B (de) | Verfahren zur Herstellung blauer Dispersionsfarbstoffe der Anthrachinonreihe | |
| DE1156527B (de) | Verfahren zur Herstellung von Anthrachinonkuepenfarbstoffen | |
| DE1284543B (de) | Verfahren zur Herstellung von Anthrachinonfarbstoffen | |
| DE1279252B (de) | Verfahren zur Herstellung von Anthrachinonfarbstoffen | |
| DE1117243B (de) | Verfahren zur Herstellung blauer Dispersionsfarbstoffe der Anthrachinonreihe | |
| DE1469868C3 (de) | Verwendung von heterocyclischen Farbstoffen zum Färben von Polyamiden in der Masse | |
| DE2237289C3 (de) | Verwendung von 5,8-disubstituierten 1-Nitrobenzoylaminoanthrachinonverbindungen als wasserunlösliche, nicht verküpbare Anthrachinonfarbstoffe zum Färben von Cellulosefasern und Kunstfasern, insbesondere in Wasser quellbaren Cellulosefasern | |
| DE1269266B (de) | Verfahren zur Herstellung von wasserloeslichen Aminoanthrachinonfarbstoffen | |
| DE1928372B2 (de) | Wasserunlösliche Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben und Bedrucken | |
| DE1212657B (de) | Verfahren zur Herstellung von 1, 4-Dihydroxy-2-phenylmercaptoanthrachinonen, die frei von sauren, wasserloeslichmachenden Gruppen sind | |
| DE1953756A1 (de) | Verfahren zur Herstellung blauer Dispersionsfarbstoffe | |
| DE1927310C3 (de) | Verfahren zur Herstellung von Anthrachinonfarbstofien | |
| DE897898C (de) | Verfahren zur Herstellung von Anthrachinonfarbstoffen | |
| DE1100208B (de) | Verfahren zur Herstellung von Anthrachinonfarbstoffen | |
| DE1224425B (de) | Verfahren zur Herstellung von Anthrachinonfarbstoffen | |
| DE1644587C (de) | Anthrachinonfarbstoffe und ihre Verwendung | |
| DE1269267B (de) | Verfahren zur Herstellung von Benz-azolyl-mercapto-anthrachinonen | |
| DE940131C (de) | Verfahren zur Herstellung von Kuepenfarbstoffen | |
| DE692750C (de) | Verfahren zur Herstellung von Kuepenfarbstoffen der Anthrachinonreihe | |
| AT234872B (de) | Verfahren zur Herstellung neuer Küpenfarbstoffe | |
| DE1104644B (de) | Verfahren zur Herstellung von Farbstoffen fuer synthetische Fasern | |
| DE1165789B (de) | Verfahren zur Herstellung von Styrylfarbstoffen | |
| DE2531557A1 (de) | Anthrachinonfarbstoffe |