DE1112080B - Verfahren zur Herstellung von festen, haltbaren Diazoniumverbindungen - Google Patents
Verfahren zur Herstellung von festen, haltbaren DiazoniumverbindungenInfo
- Publication number
- DE1112080B DE1112080B DEF29568A DEF0029568A DE1112080B DE 1112080 B DE1112080 B DE 1112080B DE F29568 A DEF29568 A DE F29568A DE F0029568 A DEF0029568 A DE F0029568A DE 1112080 B DE1112080 B DE 1112080B
- Authority
- DE
- Germany
- Prior art keywords
- diazonium
- parts
- amino
- compounds
- solid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001989 diazonium salts Chemical class 0.000 title claims description 14
- 239000007787 solid Substances 0.000 title claims description 7
- 238000000034 method Methods 0.000 title claims description 4
- 238000004519 manufacturing process Methods 0.000 title description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 9
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 239000012954 diazonium Substances 0.000 description 22
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 17
- 235000002639 sodium chloride Nutrition 0.000 description 15
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 13
- -1 diazonium chlorides Chemical class 0.000 description 12
- 239000000243 solution Substances 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- 150000003839 salts Chemical class 0.000 description 8
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 8
- 239000011780 sodium chloride Substances 0.000 description 7
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- GRBYKZHJTAIZSB-UHFFFAOYSA-N 5-methoxy-4-methyl-2-(1-oxidobenzotriazol-1-ium-2-yl)aniline Chemical compound NC1=C(C=C(C(=C1)OC)C)N1N=C2C(=[N+]1[O-])C=CC=C2 GRBYKZHJTAIZSB-UHFFFAOYSA-N 0.000 description 5
- 229910000365 copper sulfate Inorganic materials 0.000 description 5
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 235000010288 sodium nitrite Nutrition 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- PLACXTFOLQFFHR-UHFFFAOYSA-N COC(C(NC(C1=CC=CC=C1)=O)=C1)=CC(N)=C1N1[N+]([O-])=C(C=CC=C2)C2=N1 Chemical compound COC(C(NC(C1=CC=CC=C1)=O)=C1)=CC(N)=C1N1[N+]([O-])=C(C=CC=C2)C2=N1 PLACXTFOLQFFHR-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000008021 deposition Effects 0.000 description 2
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- VSKBOWHNLWDMTD-UHFFFAOYSA-N 2-[5-(6-chloro-1-oxidobenzotriazol-1-ium-2-yl)-2-ethoxyphenoxy]ethanamine Chemical compound NCCOC=1C(=CC=C(C1)N1N=C2C(=[N+]1[O-])C=C(C=C2)Cl)OCC VSKBOWHNLWDMTD-UHFFFAOYSA-N 0.000 description 1
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- KSNHHMIOZKOOTP-UHFFFAOYSA-N NCCOC=1C(=CC=C(C=1)N1N=C2C(=[N+]1[O-])C=C(C=C2)C)OCC Chemical compound NCCOC=1C(=CC=C(C=1)N1N=C2C(=[N+]1[O-])C=C(C=C2)C)OCC KSNHHMIOZKOOTP-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000005362 aryl sulfone group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- YDVJBLJCSLVMSY-UHFFFAOYSA-N carbamoyl cyanide Chemical compound NC(=O)C#N YDVJBLJCSLVMSY-UHFFFAOYSA-N 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 229910001510 metal chloride Inorganic materials 0.000 description 1
- XTEGVFVZDVNBPF-UHFFFAOYSA-L naphthalene-1,5-disulfonate(2-) Chemical compound C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1S([O-])(=O)=O XTEGVFVZDVNBPF-UHFFFAOYSA-L 0.000 description 1
- TZULFQJPQZXEQZ-UHFFFAOYSA-N naphthalene-1,5-disulfonic acid;sodium Chemical compound [Na].C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1S(O)(=O)=O TZULFQJPQZXEQZ-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 125000004385 trihaloalkyl group Chemical group 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/16—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms condensed with carbocyclic rings or ring systems
- C07D249/18—Benzotriazoles
- C07D249/20—Benzotriazoles with aryl radicals directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/04—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles
- C07D249/06—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles with aryl radicals directly attached to ring atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL256641D NL256641A (cg-RX-API-DMAC10.html) | 1959-10-09 | ||
| DEF29568A DE1112080B (de) | 1959-10-09 | 1959-10-09 | Verfahren zur Herstellung von festen, haltbaren Diazoniumverbindungen |
| US60290A US3133049A (en) | 1959-10-09 | 1960-10-04 | Solid, stable diazonium compounds |
| CH1117960A CH393343A (de) | 1959-10-09 | 1960-10-05 | Verfahren zur Herstellung von festen, haltbaren Diazoniumverbindungen |
| GB34702/60A GB944844A (en) | 1959-10-09 | 1960-10-10 | Solid, stable diazonium compounds and process for their manufacture from 2-(2-aminoaryl)-4:5-arylene 1:2:3-triazole-1-oxides |
| BE595877A BE595877A (fr) | 1959-10-09 | 1960-10-10 | Nouveaux composés diazoïques, solides et stables, et leur préparation. |
| FR840760A FR1270212A (fr) | 1959-10-09 | 1960-10-10 | Nouveaux composés diazoïques, solides et stables, et leur préparation |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF29568A DE1112080B (de) | 1959-10-09 | 1959-10-09 | Verfahren zur Herstellung von festen, haltbaren Diazoniumverbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1112080B true DE1112080B (de) | 1961-08-03 |
Family
ID=7093370
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF29568A Pending DE1112080B (de) | 1959-10-09 | 1959-10-09 | Verfahren zur Herstellung von festen, haltbaren Diazoniumverbindungen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3133049A (cg-RX-API-DMAC10.html) |
| BE (1) | BE595877A (cg-RX-API-DMAC10.html) |
| CH (1) | CH393343A (cg-RX-API-DMAC10.html) |
| DE (1) | DE1112080B (cg-RX-API-DMAC10.html) |
| GB (1) | GB944844A (cg-RX-API-DMAC10.html) |
| NL (1) | NL256641A (cg-RX-API-DMAC10.html) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2120838A1 (en) * | 1993-08-05 | 1995-02-06 | Ronald Sinclair Nohr | Solid colored composition mutable by ultraviolet radiation |
| US5700850A (en) * | 1993-08-05 | 1997-12-23 | Kimberly-Clark Worldwide | Colorant compositions and colorant stabilizers |
| US5681380A (en) * | 1995-06-05 | 1997-10-28 | Kimberly-Clark Worldwide, Inc. | Ink for ink jet printers |
| US5865471A (en) * | 1993-08-05 | 1999-02-02 | Kimberly-Clark Worldwide, Inc. | Photo-erasable data processing forms |
| US5645964A (en) * | 1993-08-05 | 1997-07-08 | Kimberly-Clark Corporation | Digital information recording media and method of using same |
| US6017661A (en) * | 1994-11-09 | 2000-01-25 | Kimberly-Clark Corporation | Temporary marking using photoerasable colorants |
| US6211383B1 (en) | 1993-08-05 | 2001-04-03 | Kimberly-Clark Worldwide, Inc. | Nohr-McDonald elimination reaction |
| US5643356A (en) * | 1993-08-05 | 1997-07-01 | Kimberly-Clark Corporation | Ink for ink jet printers |
| US5733693A (en) * | 1993-08-05 | 1998-03-31 | Kimberly-Clark Worldwide, Inc. | Method for improving the readability of data processing forms |
| US6017471A (en) * | 1993-08-05 | 2000-01-25 | Kimberly-Clark Worldwide, Inc. | Colorants and colorant modifiers |
| US5721287A (en) * | 1993-08-05 | 1998-02-24 | Kimberly-Clark Worldwide, Inc. | Method of mutating a colorant by irradiation |
| US5773182A (en) * | 1993-08-05 | 1998-06-30 | Kimberly-Clark Worldwide, Inc. | Method of light stabilizing a colorant |
| WO1997001605A1 (en) | 1995-06-28 | 1997-01-16 | Kimberly-Clark Worldwide, Inc. | Novel colorants and colorant modifiers |
| US5685754A (en) * | 1994-06-30 | 1997-11-11 | Kimberly-Clark Corporation | Method of generating a reactive species and polymer coating applications therefor |
| US5739175A (en) * | 1995-06-05 | 1998-04-14 | Kimberly-Clark Worldwide, Inc. | Photoreactor composition containing an arylketoalkene wavelength-specific sensitizer |
| US6071979A (en) * | 1994-06-30 | 2000-06-06 | Kimberly-Clark Worldwide, Inc. | Photoreactor composition method of generating a reactive species and applications therefor |
| US6242057B1 (en) | 1994-06-30 | 2001-06-05 | Kimberly-Clark Worldwide, Inc. | Photoreactor composition and applications therefor |
| US6008268A (en) * | 1994-10-21 | 1999-12-28 | Kimberly-Clark Worldwide, Inc. | Photoreactor composition, method of generating a reactive species, and applications therefor |
| AU6378696A (en) * | 1995-06-05 | 1996-12-24 | Kimberly-Clark Worldwide, Inc. | Novel pre-dyes |
| US5811199A (en) * | 1995-06-05 | 1998-09-22 | Kimberly-Clark Worldwide, Inc. | Adhesive compositions containing a photoreactor composition |
| US5849411A (en) * | 1995-06-05 | 1998-12-15 | Kimberly-Clark Worldwide, Inc. | Polymer film, nonwoven web and fibers containing a photoreactor composition |
| US5798015A (en) * | 1995-06-05 | 1998-08-25 | Kimberly-Clark Worldwide, Inc. | Method of laminating a structure with adhesive containing a photoreactor composition |
| US5747550A (en) * | 1995-06-05 | 1998-05-05 | Kimberly-Clark Worldwide, Inc. | Method of generating a reactive species and polymerizing an unsaturated polymerizable material |
| US5786132A (en) * | 1995-06-05 | 1998-07-28 | Kimberly-Clark Corporation | Pre-dyes, mutable dye compositions, and methods of developing a color |
| US5855655A (en) * | 1996-03-29 | 1999-01-05 | Kimberly-Clark Worldwide, Inc. | Colorant stabilizers |
| KR19980701718A (ko) * | 1995-11-28 | 1998-06-25 | 바바라 에이취. 폴 | 개량된 착색제 안정화제 |
| US6099628A (en) * | 1996-03-29 | 2000-08-08 | Kimberly-Clark Worldwide, Inc. | Colorant stabilizers |
| US5782963A (en) * | 1996-03-29 | 1998-07-21 | Kimberly-Clark Worldwide, Inc. | Colorant stabilizers |
| US5891229A (en) * | 1996-03-29 | 1999-04-06 | Kimberly-Clark Worldwide, Inc. | Colorant stabilizers |
| US6524379B2 (en) | 1997-08-15 | 2003-02-25 | Kimberly-Clark Worldwide, Inc. | Colorants, colorant stabilizers, ink compositions, and improved methods of making the same |
| KR100591999B1 (ko) | 1998-06-03 | 2006-06-22 | 킴벌리-클라크 월드와이드, 인크. | 마이크로에멀젼 기술에 의해 제조된 네오나노플라스트 및잉크젯 프린팅용 잉크 |
| EP1000090A1 (en) | 1998-06-03 | 2000-05-17 | Kimberly-Clark Worldwide, Inc. | Novel photoinitiators and applications therefor |
| BR9912003A (pt) | 1998-07-20 | 2001-04-10 | Kimberly Clark Co | Composições de tinta para jato de tinta aperfeiçoadas |
| ES2263291T3 (es) | 1998-09-28 | 2006-12-01 | Kimberly-Clark Worldwide, Inc. | Quelatos que comprenden grupos quinoides como fotoiniciadores. |
| EP1144512B1 (en) | 1999-01-19 | 2003-04-23 | Kimberly-Clark Worldwide, Inc. | Novel colorants, colorant stabilizers, ink compositions, and improved methods of making the same |
| US6331056B1 (en) | 1999-02-25 | 2001-12-18 | Kimberly-Clark Worldwide, Inc. | Printing apparatus and applications therefor |
| US6294698B1 (en) | 1999-04-16 | 2001-09-25 | Kimberly-Clark Worldwide, Inc. | Photoinitiators and applications therefor |
| US6368395B1 (en) | 1999-05-24 | 2002-04-09 | Kimberly-Clark Worldwide, Inc. | Subphthalocyanine colorants, ink compositions, and method of making the same |
| JP2006512428A (ja) * | 2002-05-13 | 2006-04-13 | ポリフューエル・インコーポレイテッド | イオン伝導性ブロックコポリマー |
| MX2015012138A (es) * | 2013-03-12 | 2016-06-02 | Anellotech Inc | Regeneracion de catalizador de pirolisis rapida catalitica. |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1342134A (en) * | 1919-12-27 | 1920-06-01 | Chem Ind Basel | Dyestuffs capable of being diazotized and process of making same |
| US2501188A (en) * | 1947-10-22 | 1950-03-21 | American Cyanamid Co | 2-(2'-methyl-4'-amino-5'-methoxyphenyl)-2, 1, 3 benzotriazole |
-
0
- NL NL256641D patent/NL256641A/xx unknown
-
1959
- 1959-10-09 DE DEF29568A patent/DE1112080B/de active Pending
-
1960
- 1960-10-04 US US60290A patent/US3133049A/en not_active Expired - Lifetime
- 1960-10-05 CH CH1117960A patent/CH393343A/de unknown
- 1960-10-10 BE BE595877A patent/BE595877A/fr unknown
- 1960-10-10 GB GB34702/60A patent/GB944844A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL256641A (cg-RX-API-DMAC10.html) | |
| US3133049A (en) | 1964-05-12 |
| CH393343A (de) | 1965-06-15 |
| GB944844A (en) | 1963-12-18 |
| BE595877A (fr) | 1961-04-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1112080B (de) | Verfahren zur Herstellung von festen, haltbaren Diazoniumverbindungen | |
| DE1047787B (de) | Verfahren zur Herstellung von festen, haltbaren Diazoniumverbindungen | |
| DE1045414B (de) | Verfahren zur Herstellung von festen, haltbaren Diazoniumverbindungen | |
| DE1040562B (de) | Verfahren zur Herstellung von festen, haltbaren Diazoniumverbindungen | |
| DE2340569C2 (de) | Azofarbstoffe | |
| DE2353987A1 (de) | Verfahren zur isolierung leichtloeslicher basischer oxazin- und phenazinfarbstoffe | |
| DE2134518B2 (de) | Verfahren zur Herstellung von Verbindungen der Benzothioxanthenreihe | |
| DE870418C (de) | Verfahren zur Herstellung von Pyrazolinverbindungen | |
| DE3123157A1 (de) | Verfahren zur herstellung von s-aryl-thioglycolsaeuren | |
| DE1644192A1 (de) | Chrom-Mischkomplex-Azofarbstoffe | |
| DE1001783C2 (de) | Verfahren zur Herstellung kupferhaltiger Azofarbstoffe | |
| DE1519471A1 (de) | 3-Phenyl-7-benzotriazolyl-cumarine | |
| DE2130027C3 (de) | Monoazofarbstoffe | |
| DE4202527A1 (de) | Farbstoffmischungen | |
| AT221517B (de) | Verfahren zur Herstellung von neuen, festen, haltbaren Diazoniumverbindungen | |
| DE1008310B (de) | Verfahren zur Herstellung von festen, haltbaren Diazoniumverbindungen | |
| DE881711C (de) | Verfahren zur Herstellung von kupferhaltigen Disazofarbstoffen der Stilbenreihe | |
| AT231032B (de) | Verfahren zur Herstellung von neuen Aminoazoverbindungen der Benzimidazolreihe | |
| EP0169459B1 (de) | Azofarbstoffe | |
| DE904451C (de) | Verfahren zur Herstellung von Farbstoffen der Anthrachinonreihe | |
| CH502413A (de) | Verfahren zur Herstellung von wasserlöslichen Azofarbstoffen | |
| DE843448C (de) | Verfahren zur Darstellung von Monoazofarbstoffen | |
| AT162592B (de) | Verfahren zur Herstellung von neuen Disazofarbstoffen | |
| DE633084C (de) | Verfahren zur Herstellung von Azoverbindungen | |
| DE957150C (de) | Verfahren zur Herstellung von Disazofarbstoffen |