DE1098125B - Verfahren zur Herstellung von fluoreszierenden Verbindungen - Google Patents
Verfahren zur Herstellung von fluoreszierenden VerbindungenInfo
- Publication number
- DE1098125B DE1098125B DEG27315A DEG0027315A DE1098125B DE 1098125 B DE1098125 B DE 1098125B DE G27315 A DEG27315 A DE G27315A DE G0027315 A DEG0027315 A DE G0027315A DE 1098125 B DE1098125 B DE 1098125B
- Authority
- DE
- Germany
- Prior art keywords
- parts
- yellow
- ring
- radical
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 title claims description 26
- 238000000034 method Methods 0.000 title claims description 20
- 238000002360 preparation method Methods 0.000 title claims description 6
- 150000003839 salts Chemical group 0.000 claims description 43
- -1 2-pyrone compound Chemical class 0.000 claims description 30
- 230000002378 acidificating effect Effects 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical group C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 6
- 150000007513 acids Chemical class 0.000 claims description 5
- 238000006798 ring closing metathesis reaction Methods 0.000 claims description 5
- 239000002168 alkylating agent Substances 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 150000001298 alcohols Chemical class 0.000 claims description 3
- 125000003172 aldehyde group Chemical group 0.000 claims description 3
- 238000005882 aldol condensation reaction Methods 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 230000002152 alkylating effect Effects 0.000 claims description 3
- 239000012435 aralkylating agent Substances 0.000 claims description 3
- 150000004982 aromatic amines Chemical class 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 125000002843 carboxylic acid group Chemical group 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 3
- 150000003934 aromatic aldehydes Chemical class 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 230000004048 modification Effects 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims 1
- 235000002639 sodium chloride Nutrition 0.000 description 49
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 44
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 42
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 42
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 36
- 239000000047 product Substances 0.000 description 32
- 239000000243 solution Substances 0.000 description 30
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 28
- 235000019441 ethanol Nutrition 0.000 description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- 239000000203 mixture Substances 0.000 description 23
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 22
- 239000000835 fiber Substances 0.000 description 22
- 238000002844 melting Methods 0.000 description 17
- 230000008018 melting Effects 0.000 description 17
- 238000009835 boiling Methods 0.000 description 16
- 239000000975 dye Substances 0.000 description 16
- 239000002244 precipitate Substances 0.000 description 16
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 16
- 229960000583 acetic acid Drugs 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- 238000000921 elemental analysis Methods 0.000 description 14
- 229920002239 polyacrylonitrile Polymers 0.000 description 14
- 239000000843 powder Substances 0.000 description 13
- 238000003756 stirring Methods 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 11
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- 239000004305 biphenyl Substances 0.000 description 10
- 239000013078 crystal Substances 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Natural products OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 10
- 239000003960 organic solvent Substances 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- 235000010290 biphenyl Nutrition 0.000 description 9
- 125000006267 biphenyl group Chemical group 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 9
- 150000003254 radicals Chemical class 0.000 description 9
- 239000004753 textile Substances 0.000 description 9
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 8
- 239000011592 zinc chloride Substances 0.000 description 8
- 235000005074 zinc chloride Nutrition 0.000 description 8
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 7
- 239000004327 boric acid Substances 0.000 description 7
- 238000009833 condensation Methods 0.000 description 7
- 230000005494 condensation Effects 0.000 description 7
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 7
- 238000004043 dyeing Methods 0.000 description 7
- 239000011780 sodium chloride Substances 0.000 description 7
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 6
- 239000004793 Polystyrene Substances 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 229920001577 copolymer Polymers 0.000 description 6
- 229920003023 plastic Polymers 0.000 description 6
- 239000004033 plastic Substances 0.000 description 6
- 229920002223 polystyrene Polymers 0.000 description 6
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 5
- 150000001299 aldehydes Chemical class 0.000 description 5
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 5
- 150000004775 coumarins Chemical class 0.000 description 5
- 125000000623 heterocyclic group Chemical group 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 239000001632 sodium acetate Substances 0.000 description 5
- 235000017281 sodium acetate Nutrition 0.000 description 5
- BWOVACANEIVHST-UHFFFAOYSA-N 2-(1h-benzimidazol-2-yl)acetonitrile Chemical compound C1=CC=C2NC(CC#N)=NC2=C1 BWOVACANEIVHST-UHFFFAOYSA-N 0.000 description 4
- WZUODJNEIXSNEU-UHFFFAOYSA-N 2-Hydroxy-4-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C(O)=C1 WZUODJNEIXSNEU-UHFFFAOYSA-N 0.000 description 4
- VRVRGVPWCUEOGV-UHFFFAOYSA-N 2-aminothiophenol Chemical compound NC1=CC=CC=C1S VRVRGVPWCUEOGV-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N benzo-alpha-pyrone Natural products C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 description 4
- 239000003086 colorant Substances 0.000 description 4
- 238000004040 coloring Methods 0.000 description 4
- 235000001671 coumarin Nutrition 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 239000004800 polyvinyl chloride Substances 0.000 description 4
- 229920000915 polyvinyl chloride Polymers 0.000 description 4
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- RGHHSNMVTDWUBI-UHFFFAOYSA-N 4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1 RGHHSNMVTDWUBI-UHFFFAOYSA-N 0.000 description 3
- CFNMUZCFSDMZPQ-GHXNOFRVSA-N 7-[(z)-3-methyl-4-(4-methyl-5-oxo-2h-furan-2-yl)but-2-enoxy]chromen-2-one Chemical compound C=1C=C2C=CC(=O)OC2=CC=1OC/C=C(/C)CC1OC(=O)C(C)=C1 CFNMUZCFSDMZPQ-GHXNOFRVSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 150000001450 anions Chemical class 0.000 description 3
- 150000003851 azoles Chemical class 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 2
- IUNJCFABHJZSKB-UHFFFAOYSA-N 2,4-dihydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C(O)=C1 IUNJCFABHJZSKB-UHFFFAOYSA-N 0.000 description 2
- PKZJLOCLABXVMC-UHFFFAOYSA-N 2-Methoxybenzaldehyde Chemical compound COC1=CC=CC=C1C=O PKZJLOCLABXVMC-UHFFFAOYSA-N 0.000 description 2
- NTCCNERMXRIPTR-UHFFFAOYSA-N 2-hydroxy-1-naphthaldehyde Chemical compound C1=CC=CC2=C(C=O)C(O)=CC=C21 NTCCNERMXRIPTR-UHFFFAOYSA-N 0.000 description 2
- XFVZSRRZZNLWBW-UHFFFAOYSA-N 4-(Diethylamino)salicylaldehyde Chemical compound CCN(CC)C1=CC=C(C=O)C(O)=C1 XFVZSRRZZNLWBW-UHFFFAOYSA-N 0.000 description 2
- DGRGLKZMKWPMOH-UHFFFAOYSA-N 4-methylbenzene-1,2-diamine Chemical compound CC1=CC=C(N)C(N)=C1 DGRGLKZMKWPMOH-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- 108010043121 Green Fluorescent Proteins Proteins 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical group N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 229960000956 coumarin Drugs 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical compound OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 2
- 229940008406 diethyl sulfate Drugs 0.000 description 2
- QKIUAMUSENSFQQ-UHFFFAOYSA-N dimethylazanide Chemical compound C[N-]C QKIUAMUSENSFQQ-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- VRZVPALEJCLXPR-UHFFFAOYSA-N ethyl 4-methylbenzenesulfonate Chemical compound CCOS(=O)(=O)C1=CC=C(C)C=C1 VRZVPALEJCLXPR-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- RBTKNAXYKSUFRK-UHFFFAOYSA-N heliogen blue Chemical compound [Cu].[N-]1C2=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=NC([N-]1)=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=N2 RBTKNAXYKSUFRK-UHFFFAOYSA-N 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- VOLGAXAGEUPBDM-UHFFFAOYSA-N $l^{1}-oxidanylethane Chemical compound CC[O] VOLGAXAGEUPBDM-UHFFFAOYSA-N 0.000 description 1
- QITAKWXEKISUSF-UHFFFAOYSA-N (4-chloro-2-sulfanylphenyl)azanium;chloride Chemical compound Cl.NC1=CC=C(Cl)C=C1S QITAKWXEKISUSF-UHFFFAOYSA-N 0.000 description 1
- UGUHFDPGDQDVGX-UHFFFAOYSA-N 1,2,3-thiadiazole Chemical group C1=CSN=N1 UGUHFDPGDQDVGX-UHFFFAOYSA-N 0.000 description 1
- FKASFBLJDCHBNZ-UHFFFAOYSA-N 1,3,4-oxadiazole Chemical compound C1=NN=CO1 FKASFBLJDCHBNZ-UHFFFAOYSA-N 0.000 description 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical class C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- 125000000355 1,3-benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- SVDAJTZKOJZQFC-UHFFFAOYSA-N 2,4-dichlorobenzenediazonium Chemical compound ClC1=CC=C([N+]#N)C(Cl)=C1 SVDAJTZKOJZQFC-UHFFFAOYSA-N 0.000 description 1
- MFYFZAYWFVCZES-UHFFFAOYSA-N 2,4-dihydroxynaphthalene-1-carbaldehyde Chemical compound C1=CC=CC2=C(C=O)C(O)=CC(O)=C21 MFYFZAYWFVCZES-UHFFFAOYSA-N 0.000 description 1
- WGHPWLUYIPUQOJ-UHFFFAOYSA-N 2-(2-hydroxyethoxy)benzaldehyde Chemical compound OCCOC1=CC=CC=C1C=O WGHPWLUYIPUQOJ-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- QCLMTLDABHUUBC-UHFFFAOYSA-N 2-amino-4-methylbenzenethiol Chemical compound CC1=CC=C(S)C(N)=C1 QCLMTLDABHUUBC-UHFFFAOYSA-N 0.000 description 1
- WTHUWXPBPNTSHJ-UHFFFAOYSA-N 2-hydroxy-3,6-dimethylbenzaldehyde Chemical compound CC1=CC=C(C)C(C=O)=C1O WTHUWXPBPNTSHJ-UHFFFAOYSA-N 0.000 description 1
- HHDPXULKSZZACU-UHFFFAOYSA-N 2-hydroxy-4-nitrobenzaldehyde Chemical compound OC1=CC([N+]([O-])=O)=CC=C1C=O HHDPXULKSZZACU-UHFFFAOYSA-N 0.000 description 1
- ILEIUTCVWLYZOM-UHFFFAOYSA-N 2-hydroxy-5-methylbenzaldehyde Chemical compound CC1=CC=C(O)C(C=O)=C1 ILEIUTCVWLYZOM-UHFFFAOYSA-N 0.000 description 1
- FRPAGJPHUNNVLJ-UHFFFAOYSA-N 2-n-ethylbenzene-1,2-diamine Chemical compound CCNC1=CC=CC=C1N FRPAGJPHUNNVLJ-UHFFFAOYSA-N 0.000 description 1
- XMQOBGDXGQSRID-UHFFFAOYSA-N 2-oxochromene-3-carboxamide Chemical class C1=CC=C2OC(=O)C(C(=O)N)=CC2=C1 XMQOBGDXGQSRID-UHFFFAOYSA-N 0.000 description 1
- ZPSJGADGUYYRKE-UHFFFAOYSA-N 2H-pyran-2-one Chemical group O=C1C=CC=CO1 ZPSJGADGUYYRKE-UHFFFAOYSA-N 0.000 description 1
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- IPPQNXSAJZOTJZ-UHFFFAOYSA-N 3-methylsalicylaldehyde Chemical compound CC1=CC=CC(C=O)=C1O IPPQNXSAJZOTJZ-UHFFFAOYSA-N 0.000 description 1
- KURCTZNCAHYQOV-UHFFFAOYSA-N 4-(dimethylamino)-2-hydroxybenzaldehyde Chemical compound CN(C)C1=CC=C(C=O)C(O)=C1 KURCTZNCAHYQOV-UHFFFAOYSA-N 0.000 description 1
- FTCRRHMDEKNDHP-UHFFFAOYSA-N 4-chloro-1-hydroxynaphthalene-2-carbaldehyde Chemical compound C1=CC=C2C(O)=C(C=O)C=C(Cl)C2=C1 FTCRRHMDEKNDHP-UHFFFAOYSA-N 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- IETDBZQIWIJQJG-UHFFFAOYSA-N 7-hydroxy-2-oxo-chromene-3-carboxylic acid ethyl ester Chemical compound C1=C(O)C=C2OC(=O)C(C(=O)OCC)=CC2=C1 IETDBZQIWIJQJG-UHFFFAOYSA-N 0.000 description 1
- CJIJXIFQYOPWTF-UHFFFAOYSA-N 7-hydroxycoumarin Natural products O1C(=O)C=CC2=CC(O)=CC=C21 CJIJXIFQYOPWTF-UHFFFAOYSA-N 0.000 description 1
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical group NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 1
- 241000974482 Aricia saepiolus Species 0.000 description 1
- 101000623895 Bos taurus Mucin-15 Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical group [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 1
- KIWBPDUYBMNFTB-UHFFFAOYSA-N Ethyl hydrogen sulfate Chemical compound CCOS(O)(=O)=O KIWBPDUYBMNFTB-UHFFFAOYSA-N 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000003943 azolyl group Chemical group 0.000 description 1
- YXGWBKCOOBHTPT-UHFFFAOYSA-N benzene;chlorobenzene Chemical compound C1=CC=CC=C1.ClC1=CC=CC=C1 YXGWBKCOOBHTPT-UHFFFAOYSA-N 0.000 description 1
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzenecarboxaldehyde Natural products O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 1
- 150000001556 benzimidazoles Chemical class 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 1
- 238000005282 brightening Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229940045348 brown mixture Drugs 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- WUVFAMRFBRHSQW-UHFFFAOYSA-N chromen-2-imine Chemical class C1=CC=C2OC(=N)C=CC2=C1 WUVFAMRFBRHSQW-UHFFFAOYSA-N 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 125000000332 coumarinyl group Chemical group O1C(=O)C(=CC2=CC=CC=C12)* 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000000378 dietary effect Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 150000002085 enols Chemical class 0.000 description 1
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- FATAVLOOLIRUNA-UHFFFAOYSA-N formylmethyl Chemical compound [CH2]C=O FATAVLOOLIRUNA-UHFFFAOYSA-N 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- BGMIRDHBNWQSGE-UHFFFAOYSA-N hypochlorous acid;pyridine Chemical compound ClO.C1=CC=NC=C1 BGMIRDHBNWQSGE-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- IOPLHGOSNCJOOO-UHFFFAOYSA-N methyl 3,4-diaminobenzoate Chemical compound COC(=O)C1=CC=C(N)C(N)=C1 IOPLHGOSNCJOOO-UHFFFAOYSA-N 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical group COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000010446 mirabilite Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- WOHMODZLSWIUCL-UHFFFAOYSA-N n-(4-formyl-3-methoxyphenyl)acetamide Chemical compound COC1=CC(NC(C)=O)=CC=C1C=O WOHMODZLSWIUCL-UHFFFAOYSA-N 0.000 description 1
- NTNWKDHZTDQSST-UHFFFAOYSA-N naphthalene-1,2-diamine Chemical compound C1=CC=CC2=C(N)C(N)=CC=C21 NTNWKDHZTDQSST-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- ROVPGRDMDASARO-UHFFFAOYSA-N phenyl 3,4-diaminobenzenesulfonate Chemical compound C1=C(N)C(N)=CC=C1S(=O)(=O)OC1=CC=CC=C1 ROVPGRDMDASARO-UHFFFAOYSA-N 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000005033 polyvinylidene chloride Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- OENLEHTYJXMVBG-UHFFFAOYSA-N pyridine;hydrate Chemical compound [OH-].C1=CC=[NH+]C=C1 OENLEHTYJXMVBG-UHFFFAOYSA-N 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 239000001044 red dye Substances 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- RSIJVJUOQBWMIM-UHFFFAOYSA-L sodium sulfate decahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[O-]S([O-])(=O)=O RSIJVJUOQBWMIM-UHFFFAOYSA-L 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 230000001502 supplementing effect Effects 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 125000003396 thiol group Chemical class [H]S* 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D407/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00
- C07D407/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings
- C07D407/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B23/00—Methine or polymethine dyes, e.g. cyanine dyes
- C09B23/10—The polymethine chain containing an even number of >CH- groups
- C09B23/102—The polymethine chain containing an even number of >CH- groups two heterocyclic rings linked carbon-to-carbon
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B57/00—Other synthetic dyes of known constitution
- C09B57/02—Coumarine dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH6078458A CH372307A (de) | 1958-06-19 | 1958-06-19 | Verfahren zur Herstellung von fluoreszierenden Verbindungen |
| CH7417559A CH390250A (de) | 1958-06-19 | 1959-06-09 | Verfahren zur Herstellung von fluoreszierenden Farbstoffen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1098125B true DE1098125B (de) | 1961-01-26 |
Family
ID=25737707
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEG27315A Pending DE1098125B (de) | 1958-06-19 | 1959-06-18 | Verfahren zur Herstellung von fluoreszierenden Verbindungen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3014041A (OSRAM) |
| BE (1) | BE579814A (OSRAM) |
| CH (1) | CH390250A (OSRAM) |
| DE (1) | DE1098125B (OSRAM) |
| GB (1) | GB914347A (OSRAM) |
| MY (1) | MY6400131A (OSRAM) |
Cited By (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1296121B (de) * | 1961-08-19 | 1969-05-29 | Bayer Ag | Optische Aufhellungsmittel |
| DE1802863B1 (de) * | 1968-10-12 | 1970-07-30 | Basf Ag | Verwendung von sulfonsaeuregruppenhaltigen Farbstoffen zum Faerben von Textilmaterial aus Polyamiden |
| US3533730A (en) * | 1966-02-17 | 1970-10-13 | Geigy Ag J R | 2-imido-coumarin dyestuff preparations and methods of dyeing and printing synthetic fibers therewith |
| DE2005933C (de) | 1969-04-18 | 1973-07-26 | Sumitomo Chemical Co Ltd , Osaka (Japan) | Wasserunlösliche Cumannfarb stoffe und deren Verwendung |
| FR2189412A1 (OSRAM) * | 1972-06-21 | 1974-01-25 | Ciba Geigy Ag | |
| DE2413281A1 (de) * | 1974-03-20 | 1975-10-16 | Bayer Ag | Cumarinverbindungen |
| DE2625967A1 (de) * | 1975-06-19 | 1977-04-07 | Ciba Geigy Ag | Neue lichtschutzmittel |
| DE2710285A1 (de) * | 1976-03-11 | 1977-09-15 | Ciba Geigy Ag | Verfahren zur herstellung von cumarinfarbstoffen |
| DE2844299A1 (de) * | 1977-10-13 | 1979-04-19 | Ciba Geigy Ag | Neue farbstoffe, deren herstellung und verwendung |
| DE2803104A1 (de) * | 1978-01-25 | 1979-07-26 | Bayer Ag | Heterocyclische farbstoffe |
| EP0042090A3 (en) * | 1980-06-12 | 1981-12-30 | Bayer Ag | Dyestuff preparation and its use to obtain warning and signalling colours |
| EP0046250A1 (de) * | 1980-08-20 | 1982-02-24 | Bayer Ag | Farbstoffpräparation sowie deren Verwendung als Warn- und Signalfarbe |
| EP0065743A1 (de) * | 1981-05-22 | 1982-12-01 | Hoechst Aktiengesellschaft | Neue Cumarinverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe |
| WO2002080163A1 (de) * | 2001-03-28 | 2002-10-10 | Bayer Aktiengesellschaft | Optischer datenträger enthaltend in der informationsschicht eine cyclisierbare verbindung |
| EP1992672A1 (en) | 1996-08-19 | 2008-11-19 | TDK Corporation | Organic electroluminescent device |
Families Citing this family (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3338784A (en) * | 1964-09-01 | 1967-08-29 | Merck & Co Inc | Benzimidazole anthelmintic compositions andmethods |
| US3254094A (en) * | 1964-10-20 | 1966-05-31 | Smith Kline French Lab | 3-imino-2, 1-benzisothiazoles |
| CH465551A (de) * | 1964-11-13 | 1969-01-15 | Geigy Ag J R | Verfahren zum Färben oder Bedrucken von Textilfasern aus linearen Polyestern, Celluloseestern oder synthetischen Polyamiden mit Dispersionsfarbstoffen |
| FR1498700A (OSRAM) * | 1965-10-04 | 1968-01-10 | ||
| CH473197A (de) * | 1966-07-22 | 1969-05-31 | Geigy Ag J R | Verfahren zur Herstellung von kationischen Cumarinimidfarbstoffen |
| CH560747A5 (OSRAM) * | 1970-08-26 | 1975-04-15 | Ciba Geigy Ag | |
| JPS5529110B2 (OSRAM) | 1972-12-25 | 1980-08-01 | ||
| DE2925546A1 (de) * | 1979-06-25 | 1981-01-15 | Bayer Ag | Cumarinverbindungen sowie deren herstellung und verwendung als farbstoffe |
| US4892923A (en) * | 1988-02-22 | 1990-01-09 | Eastman Kodak Company | Polyester compositions containing the residue of a naphthopyran compound and shaped articles produced therefrom |
| CA2187614C (en) * | 1995-10-10 | 2002-11-26 | Jonathan Erland | Traveling mat backing |
| US5830912A (en) * | 1996-11-15 | 1998-11-03 | Molecular Probes, Inc. | Derivatives of 6,8-difluoro-7-hydroxycoumarin |
| FR2830189B1 (fr) | 2001-09-28 | 2004-10-01 | Oreal | Composition de teinture a effet eclaircissant pour fibres keratiniques humaines |
| GB0205281D0 (en) * | 2002-03-06 | 2002-04-17 | Novartis Ag | Organic compounds |
| US7261744B2 (en) | 2002-12-24 | 2007-08-28 | L'oreal S.A. | Method for dyeing or coloring human keratin materials with lightening effect using a composition comprising at least one fluorescent compound and at least one optical brightener |
| US7195651B2 (en) | 2003-04-01 | 2007-03-27 | L'oreal S.A. | Cosmetic composition for dyeing human keratin materials, comprising at least one fluorescent dye and at least one cationic polymer, and a dyeing process therefor |
| FR2853233B1 (fr) * | 2003-04-01 | 2007-10-05 | Oreal | Composition de coloration pour matieres keratiniques humaines comprenant un colorant fluorescent et une silicone aminee, procede et utilisation |
| US7150764B2 (en) | 2003-04-01 | 2006-12-19 | L'oreal S.A. | Composition for dyeing a human keratin material, comprising at least one fluorescent dye and at least one insoluble conditioning agent, process thereof, use thereof, and devices thereof |
| US7250064B2 (en) | 2003-04-01 | 2007-07-31 | L'oreal S.A. | Dye composition comprising at least one fluorescent dye and a non-associative thickening polymer for human keratin materials, process therefor, and method thereof |
| US7147673B2 (en) | 2003-04-01 | 2006-12-12 | L'oreal S.A. | Composition for dyeing human keratin materials, comprising at least one fluorescent dye and at least one insoluble polyorganosiloxane conditioning polymer, process therefor and use thereof |
| US7204860B2 (en) | 2003-04-01 | 2007-04-17 | L'oreal | Composition for dyeing human keratin materials, comprising at least one fluorescent dye and at least one polyol, process therefor and use thereof |
| FR2853239B1 (fr) * | 2003-04-01 | 2010-01-29 | Oreal | Utilisation de compositions comprenant un colorant fluorescent et un tensioactif amphotere ou non ionique particuliers pour colorer avec un effet eclaircissant des matieres keratiniques humaines |
| FR2853237B1 (fr) * | 2003-04-01 | 2006-07-14 | Oreal | Procede de coloration avec effet eclaircissant de fibres keratiniques humaines ayant subi une deformation permanente, au moyen d'une composition comprenant un colorant fluorescent |
| US7198650B2 (en) | 2003-04-01 | 2007-04-03 | L'oreal S.A. | Method of dyeing human keratin materials with a lightening effect with compositions comprising at least one fluorescent dye and at least one amphoteric or nonionic surfactant, composition thereof, process thereof, and device therefor |
| US7303589B2 (en) | 2003-04-01 | 2007-12-04 | L'oreal S.A. | Process for dyeing human keratin fibers, having a lightening effect, comprising at least one fluorescent compound and compositions of the same |
| FR2853238A1 (fr) * | 2003-04-01 | 2004-10-08 | Oreal | Cmposition de coloration pour matieres keratiniques humaines comprenant un colorant fluorescent et un polymere conditionneur polyorganosiloxane insoluble, procede et utilisation |
| US7186278B2 (en) | 2003-04-01 | 2007-03-06 | L'oreal S.A. | Composition for dyeing human keratin materials, comprising at least one fluorescent dye and at least one compound comprising an acid functional group and processes therefor |
| US7736631B2 (en) | 2003-04-01 | 2010-06-15 | L'oreal S.A. | Cosmetic dye composition with a lightening effect for human keratin materials, comprising at least one fluorescent dye and at least one aminosilicone, and process of dyeing |
| US7208018B2 (en) | 2003-04-01 | 2007-04-24 | L'oreal | Composition for dyeing human keratin materials, comprising at least one fluorescent dye and at least one associative polymer, process therefor and use thereof |
| US7195650B2 (en) | 2003-04-01 | 2007-03-27 | L'oreal S.A. | Process for dyeing, with a lightening effect, human keratin fibers that have been permanently reshaped, using at least one composition comprising at least one fluorescent dye |
| FR2853228B1 (fr) * | 2003-04-01 | 2006-07-14 | Oreal | Composition de coloration pour matieres keratiniques humaines comprenant un colorant fluorescent et un agent conditionneur insoluble, procede et utilisation |
| FR2853235B1 (fr) * | 2003-04-01 | 2008-10-03 | Oreal | Composition de coloration pour matieres keratiniques humaines comprenant un colorant fluorescent et un compose particulier a fonction acide, procede et utilisation |
| US7192454B2 (en) | 2003-04-01 | 2007-03-20 | L'oreal S.A. | Composition for dyeing human keratin materials, comprising a fluorescent dye and a particular sequestering agent, process therefor and use thereof |
| EP1651958B1 (en) | 2003-07-30 | 2010-06-16 | Roche Diagnostics GmbH | Novel chemiluminescent compounds and their use |
| JP5221859B2 (ja) * | 2006-03-09 | 2013-06-26 | 株式会社Adeka | クマリン化合物を含有してなるフィルム、クマリン化合物とマトリクスを含む色変換層、該色変換層を含む色変換フィルタ、補色層、補色フィルタならびに多色発光デバイス |
| KR102021024B1 (ko) * | 2011-12-26 | 2019-09-11 | 스미또모 가가꾸 가부시키가이샤 | 염료용 화합물 |
| JP5972640B2 (ja) * | 2012-03-30 | 2016-08-17 | 出光興産株式会社 | 冷凍機用潤滑油組成物 |
| CN104046054A (zh) * | 2014-06-02 | 2014-09-17 | 盐城纺织职业技术学院 | 一种交联染色型荧光染料、制备及应用 |
| TWI778975B (zh) * | 2016-09-06 | 2022-10-01 | 日商住友化學股份有限公司 | 著色組成物 |
| CN107793407B (zh) * | 2016-09-06 | 2022-07-08 | 住友化学株式会社 | 作为着色剂有用的化合物 |
| JP2019167488A (ja) * | 2018-03-26 | 2019-10-03 | 保土谷化学工業株式会社 | 造塩化合物、その造塩化合物を含有する着色組成物、カラーフィルター用着色剤 |
| EP3931190A1 (en) * | 2019-03-01 | 2022-01-05 | Illumina Cambridge Limited | Tertiary amine substituted coumarin compounds and their uses as fluorescent labels |
-
1959
- 1959-06-09 CH CH7417559A patent/CH390250A/de unknown
- 1959-06-15 US US820106A patent/US3014041A/en not_active Expired - Lifetime
- 1959-06-18 BE BE579814A patent/BE579814A/fr unknown
- 1959-06-18 GB GB20954/59A patent/GB914347A/en not_active Expired
- 1959-06-18 DE DEG27315A patent/DE1098125B/de active Pending
-
1964
- 1964-12-31 MY MY1964131A patent/MY6400131A/xx unknown
Cited By (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1296121B (de) * | 1961-08-19 | 1969-05-29 | Bayer Ag | Optische Aufhellungsmittel |
| US3533730A (en) * | 1966-02-17 | 1970-10-13 | Geigy Ag J R | 2-imido-coumarin dyestuff preparations and methods of dyeing and printing synthetic fibers therewith |
| DE1802863B1 (de) * | 1968-10-12 | 1970-07-30 | Basf Ag | Verwendung von sulfonsaeuregruppenhaltigen Farbstoffen zum Faerben von Textilmaterial aus Polyamiden |
| DE1802863C2 (de) * | 1968-10-12 | 1971-03-18 | Basf Ag | Verwendung von sulfonsaeuregruppenhaltigen Farbstoffen zum Faerben von Textilmaterial aus Polyamiden |
| DE2005933C (de) | 1969-04-18 | 1973-07-26 | Sumitomo Chemical Co Ltd , Osaka (Japan) | Wasserunlösliche Cumannfarb stoffe und deren Verwendung |
| FR2189412A1 (OSRAM) * | 1972-06-21 | 1974-01-25 | Ciba Geigy Ag | |
| DE2413281A1 (de) * | 1974-03-20 | 1975-10-16 | Bayer Ag | Cumarinverbindungen |
| DE2625967A1 (de) * | 1975-06-19 | 1977-04-07 | Ciba Geigy Ag | Neue lichtschutzmittel |
| DE2710285A1 (de) * | 1976-03-11 | 1977-09-15 | Ciba Geigy Ag | Verfahren zur herstellung von cumarinfarbstoffen |
| DE2844299A1 (de) * | 1977-10-13 | 1979-04-19 | Ciba Geigy Ag | Neue farbstoffe, deren herstellung und verwendung |
| DE2803104A1 (de) * | 1978-01-25 | 1979-07-26 | Bayer Ag | Heterocyclische farbstoffe |
| EP0042090A3 (en) * | 1980-06-12 | 1981-12-30 | Bayer Ag | Dyestuff preparation and its use to obtain warning and signalling colours |
| EP0046250A1 (de) * | 1980-08-20 | 1982-02-24 | Bayer Ag | Farbstoffpräparation sowie deren Verwendung als Warn- und Signalfarbe |
| EP0065743A1 (de) * | 1981-05-22 | 1982-12-01 | Hoechst Aktiengesellschaft | Neue Cumarinverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe |
| EP1992672A1 (en) | 1996-08-19 | 2008-11-19 | TDK Corporation | Organic electroluminescent device |
| WO2002080163A1 (de) * | 2001-03-28 | 2002-10-10 | Bayer Aktiengesellschaft | Optischer datenträger enthaltend in der informationsschicht eine cyclisierbare verbindung |
Also Published As
| Publication number | Publication date |
|---|---|
| CH7417559A4 (OSRAM) | 1965-07-30 |
| BE579814A (fr) | 1959-12-18 |
| US3014041A (en) | 1961-12-19 |
| MY6400131A (en) | 1964-12-31 |
| CH390250A (de) | 1965-07-30 |
| GB914347A (en) | 1963-01-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1098125B (de) | Verfahren zur Herstellung von fluoreszierenden Verbindungen | |
| DE944577C (de) | Verfahren zur Herstellung kupfer- oder nickelhaltiger Disazofarbstoffe | |
| DE68920393T2 (de) | Polycyclische Farbstoffe. | |
| EP0014344A1 (de) | Cumarinverbindungen, Verfahren zu ihrer Herstellung und deren Verwendung als Weisstöner und Laserfarbstoffe | |
| EP3489228A1 (de) | Neue methinfarbstoffe | |
| DE2157547C3 (OSRAM) | ||
| DE2238378B2 (de) | Perinonfarbstoffe und Verfahren zu ihrer Herstellung | |
| DE2428198C3 (de) | Naphtholactamfarbstoffe, deren Herstellung und diese Farbstoffe enthaltende Farbstoffzubereitungen | |
| DE2912428A1 (de) | Neue dispersionsfarbstoffe, deren herstellung und verwendung | |
| EP0021304B1 (de) | Cumarinverbindungen sowie deren Herstellung und Verwendung als Farbstoffe | |
| DE1569777A1 (de) | Verfahren zur Herstellung fluoreszierender kationischer Farbstoffe | |
| DE2025291B2 (de) | Benzoxanthen- und benzothioxanthenfarbstoffe und verfahren zu ihrer herstellung | |
| DE1805371A1 (de) | Optische Bleichmittel,Verfahren zu deren Herstellung sowie deren Anwendung | |
| EP0081125B1 (de) | Kationische Farbstoffe, Verfahren zu ihrer Herstellung sowie ihre Verwendung zum Färben und Massefärben | |
| DE2608020A1 (de) | Naphthostyrilfarbstoffe | |
| EP0005172B1 (de) | Cumarin-Verbindungen und ihre Verwendung als Aufheller für organische hochmolekulare Materialien | |
| EP0198206A1 (de) | Azofarbstoffe | |
| DE2262794A1 (de) | Styrylfarbstoffe und verfahren zu ihrer herstellung | |
| DE1291316B (de) | Verfahren zur optischen Aufhellung von organischem Fasermaterial | |
| DE2237372A1 (de) | Neue farbstoffe | |
| DE1594835A1 (de) | Neue Tolanderivate und deren Verwendung als optische Aufhellmittel | |
| DE2010492C3 (de) | Verfahren zur Färbung von Fasern auf Acrylnitrilpolymerisat- oder -mischpolymerisatbasis | |
| DE1795092C3 (de) | Neue Methin-Farbstoffe, Verfahren zu ihrer Herstellung und deren Verwendung | |
| CH624980A5 (OSRAM) | ||
| DE2114634A1 (de) | Dispersionsfarbstoffe der Thioxanthenreihe |