DE1081540B - Leistungstrennschalter - Google Patents
LeistungstrennschalterInfo
- Publication number
- DE1081540B DE1081540B DEM21069A DEM0021069A DE1081540B DE 1081540 B DE1081540 B DE 1081540B DE M21069 A DEM21069 A DE M21069A DE M0021069 A DEM0021069 A DE M0021069A DE 1081540 B DE1081540 B DE 1081540B
- Authority
- DE
- Germany
- Prior art keywords
- arc
- plates
- knife
- distance
- auxiliary contact
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000011810 insulating material Substances 0.000 claims description 8
- 238000010791 quenching Methods 0.000 claims 1
- 230000000171 quenching effect Effects 0.000 claims 1
- 239000007789 gas Substances 0.000 description 6
- 239000004020 conductor Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 206010003497 Asphyxia Diseases 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical group [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 239000012212 insulator Substances 0.000 description 2
- 241000272186 Falco columbarius Species 0.000 description 1
- GJAARPKBDFKHFS-UHFFFAOYSA-N Gerin Natural products COC(=O)C(=C)C1CC2C(=C)C(=O)C=CC2(C)CC1OC(=O)C GJAARPKBDFKHFS-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 229910010293 ceramic material Inorganic materials 0.000 description 1
- 238000012217 deletion Methods 0.000 description 1
- 230000037430 deletion Effects 0.000 description 1
- 230000005684 electric field Effects 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- -1 polyethylene Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H33/00—High-tension or heavy-current switches with arc-extinguishing or arc-preventing means
- H01H33/02—Details
- H01H33/04—Means for extinguishing or preventing arc between current-carrying parts
- H01H33/12—Auxiliary contacts on to which the arc is transferred from the main contacts
- H01H33/121—Load break switches
- H01H33/123—Load break switches in which the auxiliary contact pivots on the main contact-arm and performs a delayed and accelerated movement
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H33/00—High-tension or heavy-current switches with arc-extinguishing or arc-preventing means
- H01H33/02—Details
- H01H33/04—Means for extinguishing or preventing arc between current-carrying parts
- H01H33/12—Auxiliary contacts on to which the arc is transferred from the main contacts
- H01H33/121—Load break switches
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H9/00—Details of switching devices, not covered by groups H01H1/00 - H01H7/00
- H01H9/30—Means for extinguishing or preventing arc between current-carrying parts
- H01H9/44—Means for extinguishing or preventing arc between current-carrying parts using blow-out magnet
Landscapes
- Arc-Extinguishing Devices That Are Switches (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE516461X | 1952-12-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1081540B true DE1081540B (de) | 1960-05-12 |
Family
ID=3880073
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEM21069A Pending DE1081540B (de) | 1952-12-22 | 1953-12-03 | Leistungstrennschalter |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2761933A (enExample) |
| BE (2) | BE517653A (enExample) |
| DE (1) | DE1081540B (enExample) |
| FR (1) | FR1093056A (enExample) |
| GB (1) | GB766655A (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2916588A (en) * | 1958-04-29 | 1959-12-08 | Ite Circuit Breaker Ltd | Multiple break air magnetic breaker |
| DE1260613B (de) * | 1960-04-14 | 1968-02-08 | Liebknecht Transformat | Lastumschalter fuer Stufentransformatoren |
| US3133175A (en) * | 1960-10-05 | 1964-05-12 | Cutler Hammer Inc | Shockproof electromagnetic contactor having arc chute and blowout assembly and pivoted contact carriage means |
| US3268699A (en) * | 1965-04-23 | 1966-08-23 | Ite Circuit Breaker Ltd | Magnetic type circuit breaker having air gap in face of face wound core structure for producing non-uniform magnetic field |
| CN107833785B (zh) * | 2017-11-30 | 2020-04-03 | 浙江紫光电器有限公司 | 一种真空隔离负荷开关 |
Citations (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE556778A (enExample) | ||||
| DE256517C (enExample) * | 1910-09-15 | |||
| DE401970C (de) * | 1924-01-31 | 1924-09-16 | Siemens Schuckertwerke G M B H | UEberstromschalter |
| DE408129C (de) * | 1920-03-11 | 1925-01-10 | Aeg | Funkenloeschvorrichtung fuer elektrische Stromunterbrecher |
| DE411815C (de) * | 1923-07-17 | 1925-04-06 | Alfred Henry Jacks | Elektrischer Schalter mit Blasmagnet |
| DE540927C (de) * | 1928-07-14 | 1932-01-07 | Siemens Schuckertwerke Akt Ges | Schalter zum Unterbrechen von Stroemen von sehr verschiedener Stromstaerke mit magnetischer Serienblasung |
| DE576932C (de) * | 1927-04-06 | 1933-05-20 | Siemens Schuckertwerke Akt Ges | Entionisierungseinrichtung zur Loeschung von Wechselstromlichtboegen |
| DE672502C (de) * | 1936-12-09 | 1939-03-03 | Voigt & Haeffner Akt Ges | Anordnung zum Befestigen elektrischer Apparate, Instrumente o. dgl. auf Schalttafeln |
| DE702431C (de) * | 1939-03-19 | 1941-02-07 | Aeg | Einrichtung zur Lichtbogenloeschung an elektrischen Schaltern |
| DE710229C (de) * | 1940-04-20 | 1941-09-08 | Aeg | Lichtbogenloeschvorrichtung fuer Schalter |
| DE728612C (de) * | 1934-10-20 | 1942-11-30 | Siemens Ag | Schalter mit Lichtbogenkammer |
| US2308026A (en) * | 1940-02-20 | 1943-01-12 | Westinghouse Electric & Mfg Co | Load break disconnect |
| DE735829C (de) * | 1938-07-01 | 1943-05-31 | Siemens Ag | Stromunterbrecher |
| DE741695C (de) * | 1939-03-22 | 1943-11-15 | Siemens Ag | Stromunterbrecher |
| US2571864A (en) * | 1947-08-21 | 1951-10-16 | Westinghouse Electric Corp | Arc extinguishing circuit interrupter |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB590970A (en) * | 1945-04-26 | 1947-08-01 | Reyrolle A & Co Ltd | Improvements in or relating to electric air-break circuit-breakers |
| US1623851A (en) * | 1926-07-23 | 1927-04-05 | Gen Electric | Circuit interrupter |
| US1914143A (en) * | 1928-02-01 | 1933-06-13 | Westinghouse Electric & Mfg Co | Circuit interrupter |
| US1933175A (en) * | 1931-02-27 | 1933-10-31 | Condit Electrical Mfg Company | Electric switch having magnetic arc extinguishing means |
| BE430770A (enExample) * | 1934-10-20 | |||
| US2293487A (en) * | 1939-10-11 | 1942-08-18 | Gen Electric | Electric circuit breaker |
| US2349681A (en) * | 1941-05-24 | 1944-05-23 | Westinghouse Electric & Mfg Co | Circuit interrupter |
| US2381637A (en) * | 1942-04-09 | 1945-08-07 | Ite Circuit Breaker Ltd | Arc quencher |
| US2337949A (en) * | 1942-05-29 | 1943-12-28 | Gen Electric | Circuit breaker |
| US2393164A (en) * | 1943-02-27 | 1946-01-15 | Gen Electric | Electric circuit breaker |
| US2428254A (en) * | 1944-03-21 | 1947-09-30 | Gen Electric | Circuit breaker |
| FR962869A (enExample) * | 1944-04-13 | 1950-06-22 | ||
| US2446859A (en) * | 1944-10-14 | 1948-08-10 | Gen Electric | Switch |
-
0
- BE BE516461D patent/BE516461A/xx unknown
- BE BE517653D patent/BE517653A/xx unknown
-
1953
- 1953-11-20 US US393463A patent/US2761933A/en not_active Expired - Lifetime
- 1953-12-02 FR FR1093056D patent/FR1093056A/fr not_active Expired
- 1953-12-03 DE DEM21069A patent/DE1081540B/de active Pending
- 1953-12-18 GB GB35321/53A patent/GB766655A/en not_active Expired
Patent Citations (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE556778A (enExample) | ||||
| DE256517C (enExample) * | 1910-09-15 | |||
| DE408129C (de) * | 1920-03-11 | 1925-01-10 | Aeg | Funkenloeschvorrichtung fuer elektrische Stromunterbrecher |
| DE411815C (de) * | 1923-07-17 | 1925-04-06 | Alfred Henry Jacks | Elektrischer Schalter mit Blasmagnet |
| DE401970C (de) * | 1924-01-31 | 1924-09-16 | Siemens Schuckertwerke G M B H | UEberstromschalter |
| DE576932C (de) * | 1927-04-06 | 1933-05-20 | Siemens Schuckertwerke Akt Ges | Entionisierungseinrichtung zur Loeschung von Wechselstromlichtboegen |
| DE540927C (de) * | 1928-07-14 | 1932-01-07 | Siemens Schuckertwerke Akt Ges | Schalter zum Unterbrechen von Stroemen von sehr verschiedener Stromstaerke mit magnetischer Serienblasung |
| DE728612C (de) * | 1934-10-20 | 1942-11-30 | Siemens Ag | Schalter mit Lichtbogenkammer |
| DE745541C (de) * | 1934-10-20 | 1944-03-31 | Siemens Ag | Luftschalter mit Lichtbogenkammer |
| DE672502C (de) * | 1936-12-09 | 1939-03-03 | Voigt & Haeffner Akt Ges | Anordnung zum Befestigen elektrischer Apparate, Instrumente o. dgl. auf Schalttafeln |
| DE735829C (de) * | 1938-07-01 | 1943-05-31 | Siemens Ag | Stromunterbrecher |
| DE702431C (de) * | 1939-03-19 | 1941-02-07 | Aeg | Einrichtung zur Lichtbogenloeschung an elektrischen Schaltern |
| DE741695C (de) * | 1939-03-22 | 1943-11-15 | Siemens Ag | Stromunterbrecher |
| US2308026A (en) * | 1940-02-20 | 1943-01-12 | Westinghouse Electric & Mfg Co | Load break disconnect |
| DE710229C (de) * | 1940-04-20 | 1941-09-08 | Aeg | Lichtbogenloeschvorrichtung fuer Schalter |
| US2571864A (en) * | 1947-08-21 | 1951-10-16 | Westinghouse Electric Corp | Arc extinguishing circuit interrupter |
Also Published As
| Publication number | Publication date |
|---|---|
| US2761933A (en) | 1956-09-04 |
| GB766655A (en) | 1957-01-23 |
| FR1093056A (fr) | 1955-04-29 |
| BE516461A (enExample) | |
| BE517653A (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE735829C (de) | Stromunterbrecher | |
| EP2786385B1 (de) | Schaltgeraet fuer gleichstromanwendungen | |
| DE2809499C2 (enExample) | ||
| DE741695C (de) | Stromunterbrecher | |
| EP0695458B1 (de) | Schaltvorrichtung | |
| DE1081540B (de) | Leistungstrennschalter | |
| DE1079717B (de) | Elektrischer Leistungsschalter | |
| DE68913403T2 (de) | Strombegrenzer. | |
| DE2734395A1 (de) | Einrichtung zur strombegrenzung | |
| DE1182323B (de) | Elektrischer Schalter mit einem zur Lichtbogenloeschung dienenden Kamin | |
| DE69009070T2 (de) | Hoch- oder Mittelspannungslastschalter. | |
| AT399065B (de) | Kontaktsystem zur begrenzung der lichtbogenlänge in einem fehlerstromschutzschalter | |
| DE3412566C2 (enExample) | ||
| DE3120129C2 (enExample) | ||
| EP2385537A1 (de) | Doppelunterbrechendes Schutzschaltgerät zum Überwachen eines Stromkreises | |
| DE69309174T2 (de) | Leistungsschalter mit zwei konzentrischen Trennkammern | |
| DE3810977C2 (de) | Strombegrenzende Schalteinrichtung mit elektrodynamisch öffnenden Schaltstücken | |
| DE1149428B (de) | Elektrischer Leistungsschalter | |
| DE4424560A1 (de) | Elektrischer Schalter | |
| DE102010019429B4 (de) | Lichtbogenlöscheinrichtung für ein Schutzschaltgerät sowie Schutzschaltgerät | |
| AT402583B (de) | Leitungsschutzschalter mit einem thermisch und magnetisch geschützten aussenleiterpol und einem ungeschützten nulleiterpol | |
| DE587374C (de) | Elektrischer Schalter | |
| DE834709C (de) | Druckgasschalter fuer Gleichstrom | |
| DE1540144C (de) | Symmetrisch aufgebaute Doppellöschkammer für Wechselstromschaltgeräte | |
| DE2161507C3 (de) | Leistungsschalter |