DE1068888B - - Google Patents
Info
- Publication number
- DE1068888B DE1068888B DENDAT1068888D DE1068888DA DE1068888B DE 1068888 B DE1068888 B DE 1068888B DE NDAT1068888 D DENDAT1068888 D DE NDAT1068888D DE 1068888D A DE1068888D A DE 1068888DA DE 1068888 B DE1068888 B DE 1068888B
- Authority
- DE
- Germany
- Prior art keywords
- polyvinyl
- polymerizable
- viscosity
- vinyl
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920001225 Polyester resin Polymers 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 14
- 229920002554 vinyl polymer Polymers 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 10
- -1 vinyl lactams Chemical class 0.000 claims description 8
- 238000006116 polymerization reaction Methods 0.000 claims description 7
- 239000007788 liquid Substances 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 12
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N Caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 10
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 5
- 239000004793 Polystyrene Substances 0.000 description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 4
- 229920002223 polystyrene Polymers 0.000 description 4
- DNIAPMSPPWPWGF-UHFFFAOYSA-N propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 4
- 229920002367 Polyisobutene Polymers 0.000 description 3
- 239000004645 polyester resin Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinylpyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N Phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- UIWXSTHGICQLQT-UHFFFAOYSA-N ethenyl propanoate Chemical compound CCC(=O)OC=C UIWXSTHGICQLQT-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N fumaric acid Chemical compound OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 150000003951 lactams Chemical class 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- XTXRWKRVRITETP-UHFFFAOYSA-N vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 2
- SZNYYWIUQFZLLT-UHFFFAOYSA-N 2-methyl-1-(2-methylpropoxy)propane Chemical compound CC(C)COCC(C)C SZNYYWIUQFZLLT-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N 2-methyl-2-propenoic acid methyl ester Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- MXRGSJAOLKBZLU-UHFFFAOYSA-N 3-ethenylazepan-2-one Chemical compound C=CC1CCCCNC1=O MXRGSJAOLKBZLU-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- 239000004641 Diallyl-phthalate Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Incidol Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 229920001567 Vinyl ester Polymers 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- QUDWYFHPNIMBFC-UHFFFAOYSA-N bis(prop-2-enyl) benzene-1,2-dicarboxylate Chemical compound C=CCOC(=O)C1=CC=CC=C1C(=O)OCC=C QUDWYFHPNIMBFC-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- IFSWBZCGMGEHLE-UHFFFAOYSA-L cobalt(2+);naphthalene-2-carboxylate Chemical compound [Co+2].C1=CC=CC2=CC(C(=O)[O-])=CC=C21.C1=CC=CC2=CC(C(=O)[O-])=CC=C21 IFSWBZCGMGEHLE-UHFFFAOYSA-L 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 239000011256 inorganic filler Substances 0.000 description 1
- 229910003475 inorganic filler Inorganic materials 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N methyl ethyl ketone Substances CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920001289 polyvinyl ether Polymers 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- HETCEOQFVDFGSY-UHFFFAOYSA-N prop-1-en-2-yl acetate Chemical compound CC(=C)OC(C)=O HETCEOQFVDFGSY-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000005204 segregation Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N vinyl ether Chemical class C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L67/00—Compositions of polyesters obtained by reactions forming a carboxylic ester link in the main chain; Compositions of derivatives of such polymers
- C08L67/06—Unsaturated polyesters
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Macromonomer-Based Addition Polymer (AREA)
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1068888B true DE1068888B (zh) | 1959-11-12 |
Family
ID=594133
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT1068888D Pending DE1068888B (zh) |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE1068888B (zh) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1182816B (de) * | 1962-02-02 | 1964-12-03 | Basf Ag | Amide als Thixotropie verleihende Stoffe in Polyester-Form- oder -UEberzugsmassen |
| DE1220128B (de) * | 1962-10-24 | 1966-06-30 | Eastman Kodak Co | Thermoplastische Polyesterformmassen |
| DE2551144A1 (de) * | 1975-11-14 | 1977-05-26 | Bayer Ag | Verfahren zur herstellung stabiler aethylenpolymerisatdispersionen in ungesaettigten polyesterharzen |
| US20190292288A1 (en) * | 2016-08-05 | 2019-09-26 | Toray Industries, Inc. | Copolymer, separation membrane, medical device, and blood purifier using the copolymer |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1008487B (de) * | 1954-10-21 | 1957-05-16 | Steuler Industriewerke Gmbh | Verfahren zur Herstellung von Formkoerpern |
-
0
- DE DENDAT1068888D patent/DE1068888B/de active Pending
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1008487B (de) * | 1954-10-21 | 1957-05-16 | Steuler Industriewerke Gmbh | Verfahren zur Herstellung von Formkoerpern |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1182816B (de) * | 1962-02-02 | 1964-12-03 | Basf Ag | Amide als Thixotropie verleihende Stoffe in Polyester-Form- oder -UEberzugsmassen |
| DE1220128B (de) * | 1962-10-24 | 1966-06-30 | Eastman Kodak Co | Thermoplastische Polyesterformmassen |
| DE2551144A1 (de) * | 1975-11-14 | 1977-05-26 | Bayer Ag | Verfahren zur herstellung stabiler aethylenpolymerisatdispersionen in ungesaettigten polyesterharzen |
| US20190292288A1 (en) * | 2016-08-05 | 2019-09-26 | Toray Industries, Inc. | Copolymer, separation membrane, medical device, and blood purifier using the copolymer |
| AU2017305070B2 (en) * | 2016-08-05 | 2022-03-10 | Toray Industries, Inc. | Copolymer, and separation membrane, medical device, and blood purifier using the copolymer |
| TWI769171B (zh) * | 2016-08-05 | 2022-07-01 | 日商東麗股份有限公司 | 醫療裝置 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1047436B (de) | Verfahren zur Polymerisation oder Mischpolymerisation von Estern der Acryl- und Methacrylsaeure | |
| DE974268C (de) | Verfahren zur Blockpolymerisation von Styrol | |
| DE1068888B (zh) | ||
| DE1939544A1 (de) | Verfahren zur Oberflaechenmodifizierung anorganischer Fuellstoffe fuer Thermoplaste | |
| DE3803036A1 (de) | Verfahren zur herstellung eines elastomerhaltigen vinylchloridpfropfcopolymerisats | |
| DE2349939A1 (de) | Waermehaertbare formmasse | |
| DE1150814B (de) | Verfahren zur Beschleunigung der Polymerisation von aethylenisch ungesaettigten Monomeren und/oder teilweise polymerisierten ungesaettigten Harzen | |
| DE1029147B (de) | Verfahren zur Herstellung von waermestandfesten, fuellstofffreien Formkoerpern | |
| DE2044168C3 (de) | Kolloide Gemische | |
| DE2213927C3 (de) | Stabilisierte Polyvinylchloridmassen | |
| DE1020183B (de) | Verfahren zum Auspolymerisieren von ungesaettigten Polyestern | |
| DE68917449T2 (de) | Rohstoffmaterial für die Gelierung, Verfahren für die Herstellung von vorgeliertem Stoff, Verfahren für die Herstellung von Formmaterial und Formmaterial. | |
| DE942297C (de) | Verfahren zur Herstellung von Mischpolymerisaten | |
| DE1132722B (de) | Verfahren zur Herstellung von Eupolyoxymethylenen | |
| DE2136493C3 (de) | Polymerisationinitiatorsystem | |
| DE959589C (de) | Beschleunigungsmittel fuer kalthaertende, mit Benzoylperoxyd katalysierte Giessharzgemische aus ungesaettigten Polyestern und monomeren polymerisierbaren Verbindungen | |
| DE2044655C3 (de) | Verfahren zur Herstellung von Copolymerisaten des Äthylens | |
| DE666866C (de) | Verfahren zur Herstellung von Polymerisationsprodukten organischer Vinylester | |
| DE1181420B (de) | Verfahren zur Herstellung von Misch-polymerisaten aus AEthylen und Vinylestern | |
| DE1595672C3 (de) | Verfahren zur Herstellung von mit Monoolefinen modifizierten Pfropfpolymerisaten des Vinylchlorids auf Äthylen-Vinylacetat-Copolymerisate | |
| DE1938911C (de) | Verfahren zur Herstellung eines Vinyl chloridpfropfpolymeren | |
| AT147795B (de) | Glasersatz, insbesondere für optische Linsen. | |
| DE1150805B (de) | Herstellen von Formteilen aus Polyester-Formmassen, die Verbindungen mit Carbonylgruppen enthalten | |
| DE1064716B (de) | Verfahren zur Herstellung von Formkoerpern durch Auspolymerisieren eines Gemisches aus ungesaettigten Polyesterharzen und daran anpolymerisierbaren monomeren Verbindungen | |
| AT220822B (de) | Thermoplastische Harzmischung, welche zu einem thermogehärteten Harz polymerisiert werden kann |