DE1061923B - Verfahren zur Herstellung von wasserloeslichen Farbsalzen - Google Patents
Verfahren zur Herstellung von wasserloeslichen FarbsalzenInfo
- Publication number
- DE1061923B DE1061923B DEG18866A DEG0018866A DE1061923B DE 1061923 B DE1061923 B DE 1061923B DE G18866 A DEG18866 A DE G18866A DE G0018866 A DEG0018866 A DE G0018866A DE 1061923 B DE1061923 B DE 1061923B
- Authority
- DE
- Germany
- Prior art keywords
- parts
- salt
- dye
- water
- general formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000003839 salts Chemical class 0.000 title claims description 29
- 238000000034 method Methods 0.000 title claims description 9
- 239000000975 dye Substances 0.000 claims description 41
- 239000000987 azo dye Substances 0.000 claims description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 9
- 239000002168 alkylating agent Substances 0.000 claims description 9
- 229940100198 alkylating agent Drugs 0.000 claims description 9
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 claims description 8
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 claims description 7
- 150000001768 cations Chemical class 0.000 claims description 7
- 230000002378 acidificating effect Effects 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 238000004040 coloring Methods 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 235000002639 sodium chloride Nutrition 0.000 description 29
- 239000000243 solution Substances 0.000 description 20
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 229920000742 Cotton Polymers 0.000 description 11
- -1 p-aminophenylazopyridine Chemical compound 0.000 description 10
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 10
- 150000001450 anions Chemical class 0.000 description 9
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 8
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 8
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 8
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 6
- CUYKNJBYIJFRCU-UHFFFAOYSA-N 3-aminopyridine Chemical compound NC1=CC=CN=C1 CUYKNJBYIJFRCU-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 235000018553 tannin Nutrition 0.000 description 6
- 229920001864 tannin Polymers 0.000 description 6
- 239000001648 tannin Substances 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 150000002832 nitroso derivatives Chemical class 0.000 description 5
- 235000005074 zinc chloride Nutrition 0.000 description 5
- 239000011592 zinc chloride Substances 0.000 description 5
- GCMNJUJAKQGROZ-UHFFFAOYSA-N 1,2-Dihydroquinolin-2-imine Chemical compound C1=CC=CC2=NC(N)=CC=C21 GCMNJUJAKQGROZ-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000004702 methyl esters Chemical group 0.000 description 3
- WISXXOGOMDYNSN-UHFFFAOYSA-N 2,6-dimethylpyridin-3-amine Chemical compound CC1=CC=C(N)C(C)=N1 WISXXOGOMDYNSN-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 125000004442 acylamino group Chemical group 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000005036 alkoxyphenyl group Chemical group 0.000 description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 2
- 229940008406 diethyl sulfate Drugs 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000005059 halophenyl group Chemical group 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- NLRKCXQQSUWLCH-UHFFFAOYSA-N nitrosobenzene Chemical compound O=NC1=CC=CC=C1 NLRKCXQQSUWLCH-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- FGOJCPKOOGIRPA-UHFFFAOYSA-N 1-o-tert-butyl 4-o-ethyl 5-oxoazepane-1,4-dicarboxylate Chemical compound CCOC(=O)C1CCN(C(=O)OC(C)(C)C)CCC1=O FGOJCPKOOGIRPA-UHFFFAOYSA-N 0.000 description 1
- 150000005013 2-aminoquinolines Chemical class 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- NUKYPUAOHBNCPY-UHFFFAOYSA-N 4-aminopyridine Chemical compound NC1=CC=NC=C1 NUKYPUAOHBNCPY-UHFFFAOYSA-N 0.000 description 1
- ORLGLBZRQYOWNA-UHFFFAOYSA-N 4-methylpyridin-2-amine Chemical compound CC1=CC=NC(N)=C1 ORLGLBZRQYOWNA-UHFFFAOYSA-N 0.000 description 1
- LAKQBTPNPXHTNB-UHFFFAOYSA-N 4-methylquinolin-2-amine Chemical compound C1=CC=C2C(C)=CC(N)=NC2=C1 LAKQBTPNPXHTNB-UHFFFAOYSA-N 0.000 description 1
- QUXLCYFNVNNRBE-UHFFFAOYSA-N 6-methylpyridin-2-amine Chemical compound CC1=CC=CC(N)=N1 QUXLCYFNVNNRBE-UHFFFAOYSA-N 0.000 description 1
- FQSZUOSKHMTGMC-UHFFFAOYSA-N 8-methylquinolin-2-amine Chemical compound C1=C(N)N=C2C(C)=CC=CC2=C1 FQSZUOSKHMTGMC-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 208000006558 Dental Calculus Diseases 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 241000092161 Pithys Species 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 125000006307 alkoxy benzyl group Chemical group 0.000 description 1
- 125000006177 alkyl benzyl group Chemical group 0.000 description 1
- 150000001347 alkyl bromides Chemical class 0.000 description 1
- 150000001348 alkyl chlorides Chemical class 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 235000010357 aspartame Nutrition 0.000 description 1
- 238000006149 azo coupling reaction Methods 0.000 description 1
- 239000000981 basic dye Substances 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 125000003262 carboxylic acid ester group Chemical group [H]C([H])([*:2])OC(=O)C([H])([H])[*:1] 0.000 description 1
- 229910052729 chemical element Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 125000004966 cyanoalkyl group Chemical group 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- 150000004816 dichlorobenzenes Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000002895 emetic Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 229960004979 fampridine Drugs 0.000 description 1
- 235000019233 fast yellow AB Nutrition 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000003709 fluoroalkyl group Chemical group 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 150000005171 halobenzenes Chemical class 0.000 description 1
- 125000006277 halobenzyl group Chemical group 0.000 description 1
- 150000003944 halohydrins Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- JJYPMNFTHPTTDI-UHFFFAOYSA-N meta-toluidine Natural products CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- HSZCJVZRHXPCIA-UHFFFAOYSA-N n-benzyl-n-ethylaniline Chemical compound C=1C=CC=CC=1N(CC)CC1=CC=CC=C1 HSZCJVZRHXPCIA-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 125000005359 phenoxyalkyl group Chemical group 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 235000014101 wine Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B27/00—Preparations in which the azo group is formed in any way other than by diazotising and coupling, e.g. oxidation
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B44/00—Azo dyes containing onium groups
- C09B44/10—Azo dyes containing onium groups containing cyclammonium groups attached to an azo group by a carbon atom of the ring system
- C09B44/12—Azo dyes containing onium groups containing cyclammonium groups attached to an azo group by a carbon atom of the ring system having one nitrogen atom as the only ring hetero atom
- C09B44/126—Azo dyes containing onium groups containing cyclammonium groups attached to an azo group by a carbon atom of the ring system having one nitrogen atom as the only ring hetero atom in a six-membered ring, e.g. pyrridinium, quinolinium
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH793587X | 1955-01-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1061923B true DE1061923B (de) | 1959-07-23 |
Family
ID=4537144
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEG18866A Pending DE1061923B (de) | 1955-01-28 | 1956-01-27 | Verfahren zur Herstellung von wasserloeslichen Farbsalzen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US2864813A (enExample) |
| BE (1) | BE544768A (enExample) |
| CA (1) | CA569011A (enExample) |
| CH (1) | CH340928A (enExample) |
| DE (1) | DE1061923B (enExample) |
| FR (1) | FR1145752A (enExample) |
| GB (1) | GB793587A (enExample) |
| IT (1) | IT555459A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1117233B (de) | 1955-06-14 | 1961-11-16 | Basf Ag | Verfahren zur Herstellung basischer sulfonsaeuregruppenfreier Azofarbstoffe |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE963176C (de) * | 1954-07-05 | 1957-05-02 | Basf Ag | Verfahren zur Herstellung von Azofarbstoffen |
| BE543605A (enExample) * | 1954-12-15 | |||
| US2893816A (en) * | 1957-03-01 | 1959-07-07 | American Cyanamid Co | Polyacrylonitriles dyed with quaternized heterocyclic azo dyes |
| US3151106A (en) * | 1958-09-30 | 1964-09-29 | American Cyanamid Co | Pyridinium azo dyes and process for their production |
| US3051697A (en) * | 1958-10-06 | 1962-08-28 | American Cyanamid Co | Azomonazone n-oxides, production and deoxygenation |
| DE1151612B (de) * | 1959-04-17 | 1963-07-18 | Basf Ag | Verfahren zur Herstellung basischer Farbstoffe |
| US3118871A (en) * | 1960-12-12 | 1964-01-21 | American Cyanamid Co | Monazinium azo compounds |
| US3312681A (en) * | 1961-11-10 | 1967-04-04 | American Cyanamid Co | Cationic 1-alkyl-3-(2-hydroxy-1-naphthylazo) pyridinium dyes |
| US3330617A (en) * | 1961-11-10 | 1967-07-11 | American Cyanamid Co | Polymeric fibers colored with cationic dyestuffs |
| US3192195A (en) * | 1962-10-22 | 1965-06-29 | Du Pont | Azostyryl cationic dyes |
| LU70835A1 (enExample) * | 1974-08-30 | 1976-08-19 | ||
| LU71015A1 (enExample) * | 1974-09-27 | 1976-08-19 | ||
| CH606318A5 (enExample) * | 1974-10-29 | 1978-10-31 | Ciba Geigy Ag | |
| US4138396A (en) * | 1975-01-03 | 1979-02-06 | Ciba-Geigy Corporation | Pyridyl-azo-indolyl cationic dyes |
| CH606300A5 (enExample) * | 1975-01-03 | 1978-10-31 | Ciba Geigy Ag | |
| US4148642A (en) * | 1978-03-07 | 1979-04-10 | Eastman Kodak Company | Photographic products and processes employing nondiffusible 1-arylazo-4-isoquinolinol dye-releasing compounds |
| US4366218A (en) * | 1981-07-13 | 1982-12-28 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible bridged azdaminophenol magenta dye-releasing compounds and precursors thereof |
| US4368153A (en) * | 1981-07-13 | 1983-01-11 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible 2-(2-pyridylazo)-4,5-bis(tertiary amino)phenol black dye-releasing compounds and precursors thereof |
| US4357411A (en) * | 1981-07-13 | 1982-11-02 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible 2-(2-pyridylazo)-4,5-bis(tertiary amino)phenol black dye-releasing compounds and precursors thereof |
| US4368249A (en) * | 1981-07-13 | 1983-01-11 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible pyridylazo(dialkylamino)phenol magenta dye-releasing compounds and precursors thereof |
| US4357410A (en) * | 1981-07-13 | 1982-11-02 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible pyridylazo(dialkylamino) phenol magenta dye-releasing compounds and precursors thereof |
| US4368248A (en) * | 1981-07-13 | 1983-01-11 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible 2-(2-pyridylazo)-4,5-bis(tertiary amino)phenol black dye-releasing compounds and precursors thereof |
| US4368154A (en) * | 1981-07-13 | 1983-01-11 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible bridged azoaminophenol magenta dye-releasing compounds and precursors thereof |
| US4357412A (en) * | 1981-07-13 | 1982-11-02 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible bridged azoaminophenol magenta dye-releasing compounds and precursors thereof |
| US4367174A (en) * | 1981-07-13 | 1983-01-04 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible pyridylazo(dialkylamino)phenol magenta dye-releasing compounds and precursors thereof |
| US4562248A (en) * | 1983-11-25 | 1985-12-31 | Eastman Kodak Company | Azo dyes from unsubstituted or substituted 3-amino-pyridine and aryl or heterocyclic couplers |
| FR2920778B1 (fr) * | 2007-09-11 | 2009-10-30 | Oreal | Composes quinoliniums azoiques a motif disulfure/thiol, compositions les comprenant, procede de coloration de fibres keratiniques et dispositif. |
| FR2921382B1 (fr) | 2007-09-21 | 2009-10-30 | Oreal | Colorant derive de phenyl-pyridol[1,2-a]indolium thiol-disulfure, composition tinctoriale comprenant ce colorant, procede d'eclaircissement des matieres keratiniques a partir de ce colorant |
| FR2921258A1 (fr) * | 2007-09-24 | 2009-03-27 | Oreal | Composition tinctoriale comprenant au moins un precurseur incolore disulfures/thiol, proced de coloration a partir de la composition |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE622596C (de) * | 1932-12-09 | 1935-12-02 | I G Farbenindustrie Akt Ges | Verfahren zur Darstellung basischer Azoverbindungen der Chinolinreihe |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2022921A (en) * | 1931-11-07 | 1935-12-03 | Winthrop Chem Co Inc | Amino azo compound |
| US2135293A (en) * | 1936-08-20 | 1938-11-01 | Pyridium Corp | Medicinal azo dyes |
| US2283220A (en) * | 1939-06-02 | 1942-05-19 | Eastman Kodak Co | Azo compounds and material colored therewith |
| US2294390A (en) * | 1939-09-29 | 1942-09-01 | Pacific Foundry Company Ltd | Cremator |
| US2744105A (en) * | 1952-05-10 | 1956-05-01 | Du Pont | Azonitriles containing quaternary ammonium salt groups |
-
0
- BE BE544768D patent/BE544768A/xx unknown
- CA CA569011A patent/CA569011A/en not_active Expired
- IT IT555459D patent/IT555459A/it unknown
-
1955
- 1955-01-28 CH CH340928D patent/CH340928A/de unknown
-
1956
- 1956-01-23 US US560872A patent/US2864813A/en not_active Expired - Lifetime
- 1956-01-27 FR FR1145752D patent/FR1145752A/fr not_active Expired
- 1956-01-27 DE DEG18866A patent/DE1061923B/de active Pending
- 1956-01-27 GB GB2739/56A patent/GB793587A/en not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE622596C (de) * | 1932-12-09 | 1935-12-02 | I G Farbenindustrie Akt Ges | Verfahren zur Darstellung basischer Azoverbindungen der Chinolinreihe |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1117233B (de) | 1955-06-14 | 1961-11-16 | Basf Ag | Verfahren zur Herstellung basischer sulfonsaeuregruppenfreier Azofarbstoffe |
Also Published As
| Publication number | Publication date |
|---|---|
| IT555459A (enExample) | |
| US2864813A (en) | 1958-12-16 |
| CH340928A (de) | 1959-09-15 |
| CA569011A (en) | 1959-01-13 |
| FR1145752A (fr) | 1957-10-29 |
| BE544768A (enExample) | |
| GB793587A (en) | 1958-04-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1061923B (de) | Verfahren zur Herstellung von wasserloeslichen Farbsalzen | |
| DE1077808B (de) | Verfahren zur Herstellung von wasserloeslichen Farbsalzen | |
| DE944577C (de) | Verfahren zur Herstellung kupfer- oder nickelhaltiger Disazofarbstoffe | |
| DE1050940B (de) | Verfahren zur Herstellung von Farbsalzen | |
| DE2460491A1 (de) | Verfahren zur herstellung von xanthenfarbstoffen | |
| EP0038296A1 (de) | Disazoverbindungen | |
| DE2451219C3 (de) | Verfahren zur Herstellung konzentrierter Lösungen von Farbstoffen und Farbstoffzwischenprodukten und Verwendung der Lösungen | |
| DE1070313B (de) | Verfahren zur Herstellung von 1-Amino-4- phenylamino- anthrachinon- 2- sulfonsäuren | |
| DE714986C (de) | Verfahren zur Herstellung von basischen Farbstoffen der Anthrachinonreihe | |
| DE1069563B (de) | Verfahren zum Färben und Bedrucken von Gebilden aus Acrylnitrilpolymerisaten oder -mischpolymerisaten | |
| DE1210504B (de) | Verfahren zur Herstellung von Anthrachinonfarbstoffen | |
| DE848979C (de) | Verfahren zur Herstellung chromhaltiger Monoazofarbstoffe | |
| DE2013791A1 (en) | Yellow basic hydrazone dyes for polyacry-lonitrile etc | |
| DE1058178B (de) | Verfahren zur Herstellung von Phthalocyaninpigmenten | |
| DE1544469B1 (de) | Verfahren zur Herstellung von Pyridazinazofarbstoffen,neue Pyridazinazofarbstoffe und deren Verwendung | |
| DE2917996A1 (de) | Organische verbindungen, deren herstellung und verwendung | |
| DE1233818B (de) | Verfahren zum Faerben von Textilgut aus Polyestern oder Cellulosealkylcarbonsaeureestern mit Anthrachinonfarbstoffen | |
| DE658780C (de) | Verfahren zur Herstellung von Pyrenabkoemmlingen | |
| DE1544579B1 (de) | Verfahren zur Herstellung kationischer Azofarbstoffe | |
| EP0005172A1 (de) | Cumarin-Verbindungen und ihre Verwendung als Aufheller für organische hochmolekulare Materialien | |
| DE895291C (de) | Verfahren zur Herstellung von Diazoamino-Derivaten | |
| DE955686C (de) | Verfahren zur Herstellung von fluoreszierenden Benztriazolverbindungen | |
| DE1544509C3 (de) | Basische Triazolmonoazofarbstoffe und Verfahren zu deren Herstellung | |
| AT217599B (de) | Verfahren zur Herstellung von neuen wasserlöslichen Farbsalzen | |
| DE1113772B (de) | Verfahren zur Herstellung von Monoazofarbstoffen der Benzothiazolreihe |