DE1054436B - Verfahren zur Herstellung von kompaktem Silicium hohen Reinheitsgrades - Google Patents
Verfahren zur Herstellung von kompaktem Silicium hohen ReinheitsgradesInfo
- Publication number
- DE1054436B DE1054436B DENDAT1054436D DE1054436DA DE1054436B DE 1054436 B DE1054436 B DE 1054436B DE NDAT1054436 D DENDAT1054436 D DE NDAT1054436D DE 1054436D A DE1054436D A DE 1054436DA DE 1054436 B DE1054436 B DE 1054436B
- Authority
- DE
- Germany
- Prior art keywords
- silicon
- trichlorosilane
- hydrogen
- chloroform
- pure
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000010703 silicon Substances 0.000 title claims description 45
- 229910052710 silicon Inorganic materials 0.000 title claims description 45
- 238000000034 method Methods 0.000 title claims description 10
- 238000004519 manufacturing process Methods 0.000 title claims description 7
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 44
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 18
- 239000001257 hydrogen Substances 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 9
- SLLGVCUQYRMELA-UHFFFAOYSA-N chlorosilicon Chemical compound Cl[Si] SLLGVCUQYRMELA-UHFFFAOYSA-N 0.000 claims description 9
- 238000000354 decomposition reaction Methods 0.000 claims description 9
- 239000007789 gas Substances 0.000 claims description 9
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 8
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 8
- ZDHXKXAHOVTTAH-UHFFFAOYSA-N trichlorosilane Chemical compound Cl[SiH](Cl)Cl ZDHXKXAHOVTTAH-UHFFFAOYSA-N 0.000 claims description 8
- 239000005052 trichlorosilane Substances 0.000 claims description 8
- 239000012535 impurity Substances 0.000 claims description 7
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 claims description 6
- 239000013078 crystal Substances 0.000 claims description 6
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 4
- 229910052796 boron Inorganic materials 0.000 claims description 4
- 238000004821 distillation Methods 0.000 claims description 4
- 239000011521 glass Substances 0.000 claims description 4
- 239000011261 inert gas Substances 0.000 claims description 4
- 229910000077 silane Inorganic materials 0.000 claims description 3
- 235000011121 sodium hydroxide Nutrition 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- 239000000956 alloy Substances 0.000 claims description 2
- 229910045601 alloy Inorganic materials 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 238000003776 cleavage reaction Methods 0.000 claims 2
- 230000007017 scission Effects 0.000 claims 2
- 229910018594 Si-Cu Inorganic materials 0.000 claims 1
- 229910008465 Si—Cu Inorganic materials 0.000 claims 1
- 238000010438 heat treatment Methods 0.000 claims 1
- -1 silane compound Chemical class 0.000 claims 1
- RTCGUJFWSLMVSH-UHFFFAOYSA-N chloroform;silicon Chemical compound [Si].ClC(Cl)Cl RTCGUJFWSLMVSH-UHFFFAOYSA-N 0.000 description 31
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- 239000010453 quartz Substances 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 239000000203 mixture Substances 0.000 description 9
- 229910003902 SiCl 4 Inorganic materials 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- 229910052802 copper Inorganic materials 0.000 description 4
- 239000010949 copper Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000005049 silicon tetrachloride Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical group [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 230000008021 deposition Effects 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000004065 semiconductor Substances 0.000 description 2
- FDNAPBUWERUEDA-UHFFFAOYSA-N silicon tetrachloride Chemical class Cl[Si](Cl)(Cl)Cl FDNAPBUWERUEDA-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- MPCRDALPQLDDFX-UHFFFAOYSA-L Magnesium perchlorate Chemical compound [Mg+2].[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O MPCRDALPQLDDFX-UHFFFAOYSA-L 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- DKOQGJHPHLTOJR-WHRDSVKCSA-N cefpirome Chemical compound N([C@@H]1C(N2C(=C(C[N+]=3C=4CCCC=4C=CC=3)CS[C@@H]21)C([O-])=O)=O)C(=O)\C(=N/OC)C1=CSC(N)=N1 DKOQGJHPHLTOJR-WHRDSVKCSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical compound Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- MROCJMGDEKINLD-UHFFFAOYSA-N dichlorosilane Chemical compound Cl[SiH2]Cl MROCJMGDEKINLD-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000004870 electrical engineering Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910000103 lithium hydride Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B33/00—Silicon; Compounds thereof
- C01B33/02—Silicon
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B33/00—Silicon; Compounds thereof
- C01B33/04—Hydrides of silicon
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B33/00—Silicon; Compounds thereof
- C01B33/08—Compounds containing halogen
- C01B33/107—Halogenated silanes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Silicon Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR708286A FR1252005A (fr) | 1956-02-11 | 1956-02-11 | Procédé de fabrication de silicium compact extra pur |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1054436B true DE1054436B (de) | 1959-04-09 |
Family
ID=8702482
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT1054436D Pending DE1054436B (de) | 1956-02-11 | Verfahren zur Herstellung von kompaktem Silicium hohen Reinheitsgrades |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2943918A (show.php) |
| BE (1) | BE554836A (show.php) |
| DE (1) | DE1054436B (show.php) |
| ES (1) | ES233465A1 (show.php) |
| FR (1) | FR1252005A (show.php) |
| GB (1) | GB855913A (show.php) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3419656A1 (de) * | 1983-05-27 | 1985-01-10 | United States Department Of Energy, Washington, D.C. | Verfahren und vorrichtung zur herstellung von hochreinem silicium |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL131048C (show.php) * | 1960-01-15 | |||
| DE1147567B (de) * | 1960-01-15 | 1963-04-25 | Siemens Ag | Verfahren zum Gewinnen von insbesondere einkristallinem, halbleitendem Silicium |
| DE1185150B (de) * | 1960-02-23 | 1965-01-14 | Siemens Ag | Verfahren zur Gewinnung von reinstem Halbleitermaterial, insbesondere Silicium |
| NL265948A (show.php) * | 1960-06-14 | 1900-01-01 | ||
| GB1015604A (en) * | 1961-10-11 | 1966-01-05 | Texas Instruments Ltd | A treatment process for silicon compounds |
| DE1202616B (de) * | 1962-02-23 | 1965-10-07 | Siemens Ag | Verfahren zum Entfernen der bei der Epitaxie auf dem Heizer abgeschiedenen Halbleiterschicht |
| BE632835A (show.php) * | 1962-06-04 | |||
| US3297501A (en) * | 1963-12-31 | 1967-01-10 | Ibm | Process for epitaxial growth of semiconductor single crystals |
| US3933985A (en) * | 1971-09-24 | 1976-01-20 | Motorola, Inc. | Process for production of polycrystalline silicon |
| US4092446A (en) * | 1974-07-31 | 1978-05-30 | Texas Instruments Incorporated | Process of refining impure silicon to produce purified electronic grade silicon |
| US4102764A (en) * | 1976-12-29 | 1978-07-25 | Westinghouse Electric Corp. | High purity silicon production by arc heater reduction of silicon intermediates |
| US4102765A (en) * | 1977-01-06 | 1978-07-25 | Westinghouse Electric Corp. | Arc heater production of silicon involving alkali or alkaline-earth metals |
| US4102767A (en) * | 1977-04-14 | 1978-07-25 | Westinghouse Electric Corp. | Arc heater method for the production of single crystal silicon |
| US4176166A (en) * | 1977-05-25 | 1979-11-27 | John S. Pennish | Process for producing liquid silicon |
| GB2028289B (en) * | 1978-08-18 | 1982-09-02 | Schumacher Co J C | Producing silicon |
| US4390510A (en) * | 1982-02-16 | 1983-06-28 | General Electric Company | Process for treating spent silicon-containing reaction masses to produce halosilanes |
| DE3828344C1 (show.php) * | 1988-08-20 | 1989-07-06 | Huels Ag, 4370 Marl, De | |
| DE102005005044A1 (de) * | 2005-02-03 | 2006-08-10 | Consortium für elektrochemische Industrie GmbH | Verfahren zur Herstellung von Trichlorsilan mittels thermischer Hydrierung von Siliciumtetrachlorid |
| DE102006050329B3 (de) * | 2006-10-25 | 2007-12-13 | Wacker Chemie Ag | Verfahren zur Herstellung von Trichlorsilan |
| US20100001236A1 (en) * | 2008-07-01 | 2010-01-07 | Yongchae Chee | Method of producing trichlorosilane (TCS) rich product stably from a fluidized gas phase reactor (FBR) and the structure of the reactor |
| US20100264362A1 (en) * | 2008-07-01 | 2010-10-21 | Yongchae Chee | Method of producing trichlorosilane (TCS) rich Chlorosilane product stably from a fluidized gas phase reactor (FBR) and the structure of the reactor |
| US8029756B1 (en) | 2010-03-30 | 2011-10-04 | Peak Sun Sillcon Corporation | Closed-loop silicon production |
| DE102012103755A1 (de) | 2012-04-27 | 2013-10-31 | Centrotherm Sitec Gmbh | Verfahren zur Synthese von Trichlorsilan und Vorrichtung zur Durchführung dieses Verfahrens |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2499009A (en) * | 1947-02-15 | 1950-02-28 | Linde Air Prod Co | Chlorosilanes |
| DE900340C (de) * | 1950-08-22 | 1953-12-21 | Siemens Ag | Verfahren zur Herstellung sehr reiner Germanium- oder Siliziumhalogenide |
| FR1108543A (fr) * | 1953-09-25 | 1956-01-13 | Int Standard Electric Corp | Méthode de production du silicium à haute pureté |
| DE955415C (de) * | 1955-04-19 | 1957-01-03 | Siemens Ag | Verfahre zum Reinigen von Siliciumhalogenid |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2406605A (en) * | 1945-03-15 | 1946-08-27 | Gen Electric | Hydrogenation of halogenosilanes |
| US2458703A (en) * | 1947-06-11 | 1949-01-11 | Libbey Owens Ford Glass Co | Reduction of compounds of silicon and halogen |
| US2547874A (en) * | 1948-05-24 | 1951-04-03 | Ernest D Klema | Hydrogen purification method |
| US2766112A (en) * | 1952-11-17 | 1956-10-09 | Heraeus Gmbh W C | Production of metallic tantalum and metallic niobium from mixtures of compounds thereof |
| GB745698A (en) * | 1953-09-25 | 1956-02-29 | Standard Telephones Cables Ltd | Improvements in or relating to methods of producing silicon of high purity |
-
0
- DE DENDAT1054436D patent/DE1054436B/de active Pending
- BE BE554836D patent/BE554836A/xx unknown
-
1956
- 1956-02-11 FR FR708286A patent/FR1252005A/fr not_active Expired
-
1957
- 1957-02-01 US US637645A patent/US2943918A/en not_active Expired - Lifetime
- 1957-02-06 GB GB4127/57A patent/GB855913A/en not_active Expired
- 1957-02-07 ES ES0233465A patent/ES233465A1/es not_active Expired
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2499009A (en) * | 1947-02-15 | 1950-02-28 | Linde Air Prod Co | Chlorosilanes |
| DE900340C (de) * | 1950-08-22 | 1953-12-21 | Siemens Ag | Verfahren zur Herstellung sehr reiner Germanium- oder Siliziumhalogenide |
| FR1108543A (fr) * | 1953-09-25 | 1956-01-13 | Int Standard Electric Corp | Méthode de production du silicium à haute pureté |
| DE955415C (de) * | 1955-04-19 | 1957-01-03 | Siemens Ag | Verfahre zum Reinigen von Siliciumhalogenid |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3419656A1 (de) * | 1983-05-27 | 1985-01-10 | United States Department Of Energy, Washington, D.C. | Verfahren und vorrichtung zur herstellung von hochreinem silicium |
Also Published As
| Publication number | Publication date |
|---|---|
| BE554836A (show.php) | |
| US2943918A (en) | 1960-07-05 |
| FR1252005A (fr) | 1961-01-27 |
| ES233465A1 (es) | 1957-06-01 |
| GB855913A (en) | 1960-12-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1054436B (de) | Verfahren zur Herstellung von kompaktem Silicium hohen Reinheitsgrades | |
| EP2620411B1 (de) | Dotierstoffarmes polykristallines Siliciumstück | |
| EP1896362B1 (de) | Verfahren zur herstellung von silicium aus halogensilanen | |
| EP2078695B1 (de) | Verfahren zur Abscheidung von polykristallinem Silicium | |
| DE2954368C2 (de) | Verfahren zur kontinuierlichen Herstellung von hochreinem Silizium durch thermische Zersetzung von Tribromsilan | |
| EP1341721B1 (de) | Verfahren zur herstellung von silan | |
| DE102015210762A1 (de) | Verfahren zur Aufarbeitung von mit Kohlenstoffverbindungen verunreinigten Chlorsilanen oder Chlorsilangemischen | |
| DE1290529B (de) | Verfahren zur Entfernung von Arsen- und Phosphorverunreinigungen aus Fluorwasserstoffsaeure | |
| DE3635064A1 (de) | Verfahren zur raffination von silicium und derart gereinigtes silicium | |
| DE102011003453A1 (de) | Verfahren zur destillativen Reinigung von Chlorsilanen | |
| DE2825415A1 (de) | Verfahren und vorrichtung zur herstellung von silicium | |
| DE1167320B (de) | Verfahren zur Gewinnung von reinem Silicium | |
| DE2912238C2 (de) | Verfahren zur Herstellung von Borazin | |
| DE2217971A1 (de) | Verfahren zur kontinuierlichen herstellung von schwefeltetrafluorid | |
| DE2918066A1 (de) | Verfahren zur siliciumherstellung durch gasphasenabscheidung unter wiederverwendung der restgase | |
| DE1291324B (de) | Verfahren zur Reinigung von Halogensilanen | |
| AT207362B (de) | Verfahren zur Gewinnung von Silicium | |
| DE3938161A1 (de) | Verfahren zur herstellung von siliciumcarbid-whiskern | |
| DE1129145B (de) | Verfahren zur Herstellung von hochreinem Silicium | |
| WO2018108199A1 (de) | Verfahren zur erhöhung der reinheit von oligosilanen und oligosilanverbindungen durch fraktionierte crystallisation | |
| DE3503262A1 (de) | Verfahren zum aufarbeiten von bei der siliciumherstellung anfallenden halogensilangemischen | |
| DE2520774A1 (de) | Verfahren zur herstellung von hochreinem elementarem silicium | |
| DD240729A1 (de) | Verfahren zur gewinnung von hochreinem siliziumpulver | |
| DE1028543B (de) | Verfahren zum Reinigen von mit Wasser Gel bildenden Halogeniden, insbesondere des Germaniums oder Siliciums, vorzugsweise fuer die Herstellung von Halbleiterstoffen | |
| WO2020114609A1 (de) | Verfahren zur verminderung des gehalts an borverbindungen in halogensilan enthaltenden zusammensetzung |