DE1049832B - Verfahren zur Herstellung von Peroxymonoschwefelsäure - Google Patents
Verfahren zur Herstellung von PeroxymonoschwefelsäureInfo
- Publication number
- DE1049832B DE1049832B DENDAT1049832D DE1049832DA DE1049832B DE 1049832 B DE1049832 B DE 1049832B DE NDAT1049832 D DENDAT1049832 D DE NDAT1049832D DE 1049832D A DE1049832D A DE 1049832DA DE 1049832 B DE1049832 B DE 1049832B
- Authority
- DE
- Germany
- Prior art keywords
- sulfuric acid
- acid
- fuming sulfuric
- hydrogen peroxide
- peroxymonosulphuric
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- FHHJDRFHHWUPDG-UHFFFAOYSA-N peroxysulfuric acid Chemical compound OOS(O)(=O)=O FHHJDRFHHWUPDG-UHFFFAOYSA-N 0.000 title claims description 20
- 238000000034 method Methods 0.000 title claims description 10
- 238000004519 manufacturing process Methods 0.000 title description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 38
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 claims description 28
- 239000000376 reactant Substances 0.000 claims description 6
- 238000002156 mixing Methods 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 description 22
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 14
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 11
- 229910052760 oxygen Inorganic materials 0.000 description 11
- 239000001301 oxygen Substances 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000000203 mixture Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 2
- LCPVQAHEFVXVKT-UHFFFAOYSA-N 2-(2,4-difluorophenoxy)pyridin-3-amine Chemical compound NC1=CC=CN=C1OC1=CC=C(F)C=C1F LCPVQAHEFVXVKT-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- KBTJYNAFUYTSNN-UHFFFAOYSA-N [Na].OO Chemical compound [Na].OO KBTJYNAFUYTSNN-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 150000004968 peroxymonosulfuric acids Chemical class 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000000391 smoking effect Effects 0.000 description 1
- CHQMHPLRPQMAMX-UHFFFAOYSA-L sodium persulfate Substances [Na+].[Na+].[O-]S(=O)(=O)OOS([O-])(=O)=O CHQMHPLRPQMAMX-UHFFFAOYSA-L 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000000207 volumetry Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/055—Peroxyhydrates; Peroxyacids or salts thereof
- C01B15/06—Peroxyhydrates; Peroxyacids or salts thereof containing sulfur
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US659212A US2926998A (en) | 1957-05-15 | 1957-05-15 | Production of monopersulfuric acid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1049832B true DE1049832B (de) | 1959-02-05 |
Family
ID=24644519
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT1049832D Pending DE1049832B (de) | 1957-05-15 | Verfahren zur Herstellung von Peroxymonoschwefelsäure |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2926998A (enExample) |
| BE (1) | BE567608A (enExample) |
| CH (1) | CH370394A (enExample) |
| DE (1) | DE1049832B (enExample) |
| FR (1) | FR1193556A (enExample) |
| GB (1) | GB844096A (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4049786A (en) * | 1976-09-13 | 1977-09-20 | Fmc Corporation | Process of preparing peroxymonosulfate |
| GB1595073A (en) * | 1977-05-03 | 1981-08-05 | Interox Chemicals Ltd | Uranium extraction |
| GB9023433D0 (en) * | 1990-10-27 | 1990-12-12 | Interox Chemicals Ltd | Peroxoacid manufacture |
| GB9027960D0 (en) * | 1990-12-22 | 1991-02-13 | Interox Chemicals Ltd | Manufacture of peroxidic compositions |
| US5139763A (en) * | 1991-03-06 | 1992-08-18 | E. I. Du Pont De Nemours And Company | Class of stable potassium monopersulfate compositions |
| US5141731A (en) * | 1991-05-24 | 1992-08-25 | Degussa Aktiengesellschaft | Process for the generation of peroxyacids |
| US5439663A (en) * | 1994-08-01 | 1995-08-08 | Fmc Corporation | Method for producing Caro's acid |
| US5470564A (en) * | 1994-08-01 | 1995-11-28 | Fmc Corporation | Method for producing caro's acid |
| US6090297A (en) * | 1995-06-16 | 2000-07-18 | Fmc Corporation | Method for treating tailing slurries with Caro's acid |
| US5744055A (en) * | 1995-10-27 | 1998-04-28 | Fmc Corporation | Stable monopersulfate triple salt and its method of preparation |
| US6368570B1 (en) * | 1996-01-22 | 2002-04-09 | Fmc Corporation | Process for manufacturing Caro's acid |
| US20050031530A1 (en) * | 2003-08-07 | 2005-02-10 | Martin Perry L. | Method and apparatus for producing a peroxyacid solution |
| US7090820B2 (en) * | 2003-09-23 | 2006-08-15 | Truox, Inc. | Potassium monopersulfate triple salt with increased active oxygen content and substantially no K2S2O8 |
| US20050063895A1 (en) * | 2003-09-23 | 2005-03-24 | Martin Perry L. | Production of potassium monopersulfate triple salt using oleum |
| US20140051812A1 (en) * | 2012-08-15 | 2014-02-20 | Brian Burmaster | Polymeric surface oxidation using peracids |
| CN117105291B (zh) * | 2023-07-18 | 2025-01-14 | 湖州久岳新材料有限公司 | 一种兼具高纯度和高稳定性的无氯无硝硫酸钯的制备方法及装置 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB738407A (en) * | 1953-01-16 | 1955-10-12 | Stevensons Dyers Ltd | A process for the manufacture of permonosulphuric acid |
-
0
- BE BE567608D patent/BE567608A/xx unknown
- DE DENDAT1049832D patent/DE1049832B/de active Pending
-
1957
- 1957-05-15 US US659212A patent/US2926998A/en not_active Expired - Lifetime
-
1958
- 1958-03-24 FR FR1193556D patent/FR1193556A/fr not_active Expired
- 1958-03-25 GB GB9587/58A patent/GB844096A/en not_active Expired
- 1958-05-14 CH CH5950058A patent/CH370394A/de unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US2926998A (en) | 1960-03-01 |
| FR1193556A (fr) | 1959-11-03 |
| BE567608A (enExample) | |
| GB844096A (en) | 1960-08-10 |
| CH370394A (de) | 1963-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1049832B (de) | Verfahren zur Herstellung von Peroxymonoschwefelsäure | |
| DE1221645B (de) | Verfahren zur Herstellung konzentrierter waessriger Loesungen von aliphatischen tertiaeren Aminoxyden | |
| DE2800760C2 (de) | Verfahren zur Herstellung von Natriumpercarbonat aus einer Sodalösung bzw. -suspension | |
| EP0163318B1 (de) | Neue 2-substituierte 3-Sulfopropyl-ammoniumbetaine und Verfahren zu ihrer Herstellung | |
| DE1103309B (de) | Verfahren zur Herstellung von Peroxymonosulfaten | |
| DE2408864C3 (de) | Verfahren zur gleichzeitigen Herstellung von Cyclohexanonoxim und konzentrierter Ammoniumsulfatlösung | |
| DE503898C (de) | Verfahren zur Darstellung von Doppelsalzen des Ammoniumsulfats mit den Sulfaten derAlkalien | |
| DE579909C (de) | Verfahren zur Herstellung magnesiumhaltiger Hefe | |
| AT220589B (de) | Verfahren zur Herstellung von Ammonium-, Alkali- oder Erdalkaliperoxomonosulfaten | |
| AT209864B (de) | Verfahren zur Herstellung von Kaliummonopersulfat (KHSO5) | |
| DE560460C (de) | Herstellung technisch stabiler, aktiven Sauerstoff abgebender Praeparate | |
| DE756961C (de) | Herstellung von Hydroxylammoniumsulfat durch Reduktion von Nitriten mit Hilfe von Bisulfiten und/oder schwefeliger Saeure | |
| DE575747C (de) | Herstellung von Kaliummonophosphat | |
| DE558151C (de) | Herstellung von Alkalinitrat und Salzsaeure aus Alkalichlorid | |
| DE964233C (de) | Verfahren zur Herstellung von Sulfomonopersaeure enthaltenden Loesungen | |
| DE834091C (de) | Verfahren zur Herstellung von Chlordioxyd | |
| DE1096339B (de) | Verfahren zur Herstellung von Peroxymonophosphorsaeure | |
| DE933749C (de) | Verfahren zur kontinuierlichen Herstellung verduennter, waessriger Ammoniumcarbonatloesungen | |
| DE582552C (de) | Verfahren zur Herstellung eines fuer Duengezwecke brauchbaren Doppelsalzes | |
| DE547697C (de) | Verfahren zur Herstellung von Ammonphosphaten | |
| DE2716029A1 (de) | Verfahren zur herstellung von naphthalin-1,3,6-trisulfonsaeure | |
| DE1127878B (de) | Verfahren zur Herstellung von Kalium- oder Ammoniumsalzen der Caroschen Saeure | |
| DE915693C (de) | Verfahren zur Darstellung von Salzen der 3-Oxypropan-1-sulfonsaeure | |
| AT67175B (de) | Verfahren zur Gewinnung von Wasserstoffsuperoxyd. | |
| DE399823C (de) | Verfahren zur Herstellung von Alkalinitraten aus Alkalichloriden und Salpetersaeure |