DE10326097A1 - Verfahren zur Herstellung von Dimethyl-(3-aryl-butyl)-aminverbindungen - Google Patents
Verfahren zur Herstellung von Dimethyl-(3-aryl-butyl)-aminverbindungen Download PDFInfo
- Publication number
- DE10326097A1 DE10326097A1 DE10326097A DE10326097A DE10326097A1 DE 10326097 A1 DE10326097 A1 DE 10326097A1 DE 10326097 A DE10326097 A DE 10326097A DE 10326097 A DE10326097 A DE 10326097A DE 10326097 A1 DE10326097 A1 DE 10326097A1
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- phenyl
- dimethylamine
- dimethylamino
- methoxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims abstract description 209
- 230000008569 process Effects 0.000 title claims abstract description 77
- 238000002360 preparation method Methods 0.000 title claims abstract description 10
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 125
- 229910052739 hydrogen Inorganic materials 0.000 claims description 118
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 111
- 229920006395 saturated elastomer Polymers 0.000 claims description 90
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 82
- 125000000217 alkyl group Chemical group 0.000 claims description 58
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 55
- -1 p-isopropyl-phenyl-carbamoyl Chemical group 0.000 claims description 55
- 229910052801 chlorine Inorganic materials 0.000 claims description 54
- 229910052731 fluorine Inorganic materials 0.000 claims description 54
- 239000001257 hydrogen Substances 0.000 claims description 42
- 229910052757 nitrogen Inorganic materials 0.000 claims description 42
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 40
- 239000000203 mixture Substances 0.000 claims description 40
- 238000006243 chemical reaction Methods 0.000 claims description 38
- FKTFYPCLRBUSDX-UHFFFAOYSA-N 3-(3-methoxyphenyl)-2-methylpentan-3-ol Chemical compound CCC(O)(C(C)C)C1=CC=CC(OC)=C1 FKTFYPCLRBUSDX-UHFFFAOYSA-N 0.000 claims description 36
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 36
- 239000000243 solution Substances 0.000 claims description 36
- 238000005984 hydrogenation reaction Methods 0.000 claims description 34
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 30
- 239000007789 gas Substances 0.000 claims description 30
- 239000003054 catalyst Substances 0.000 claims description 29
- 229910052763 palladium Inorganic materials 0.000 claims description 27
- 229910052799 carbon Inorganic materials 0.000 claims description 26
- 150000003839 salts Chemical class 0.000 claims description 24
- 239000002904 solvent Substances 0.000 claims description 24
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 claims description 20
- 239000002253 acid Substances 0.000 claims description 19
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 16
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 13
- 239000007858 starting material Substances 0.000 claims description 13
- 239000003929 acidic solution Substances 0.000 claims description 10
- 239000012458 free base Substances 0.000 claims description 10
- 238000002156 mixing Methods 0.000 claims description 10
- 239000012453 solvate Substances 0.000 claims description 10
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 claims description 9
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 9
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 9
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 9
- PZNRRUTVGXCKFC-WFASDCNBSA-N (2s,3s)-1-(dimethylamino)-3-(3-methoxyphenyl)-2-methylpentan-3-ol Chemical compound CN(C)C[C@H](C)[C@@](O)(CC)C1=CC=CC(OC)=C1 PZNRRUTVGXCKFC-WFASDCNBSA-N 0.000 claims description 8
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 8
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims description 8
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 8
- 239000011260 aqueous acid Substances 0.000 claims description 8
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 8
- 235000019253 formic acid Nutrition 0.000 claims description 8
- 229910052740 iodine Inorganic materials 0.000 claims description 7
- 230000001681 protective effect Effects 0.000 claims description 7
- 230000001476 alcoholic effect Effects 0.000 claims description 6
- 239000003960 organic solvent Substances 0.000 claims description 6
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 claims description 6
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 6
- JHKJGWJFBYPMCY-FCGPPKDQSA-N (e,2r)-3-(3-methoxyphenyl)-n,n,2-trimethylpent-3-en-1-amine Chemical compound COC1=CC=CC(C(=C\C)\[C@@H](C)CN(C)C)=C1 JHKJGWJFBYPMCY-FCGPPKDQSA-N 0.000 claims description 5
- JKVBTSJLQLSTHJ-UHFFFAOYSA-N 3-(3-methoxyphenyl)-n,n,2-trimethylpentan-1-amine Chemical compound CN(C)CC(C)C(CC)C1=CC=CC(OC)=C1 JKVBTSJLQLSTHJ-UHFFFAOYSA-N 0.000 claims description 5
- NJSYYJGNHXRFAW-UHFFFAOYSA-N 3-[5-(dimethylamino)-4-methylpent-1-en-3-yl]phenol Chemical compound CN(C)CC(C)C(C=C)C1=CC=CC(O)=C1 NJSYYJGNHXRFAW-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 5
- PZNRRUTVGXCKFC-IUODEOHRSA-N (2r,3r)-1-(dimethylamino)-3-(3-methoxyphenyl)-2-methylpentan-3-ol Chemical compound CN(C)C[C@@H](C)[C@](O)(CC)C1=CC=CC(OC)=C1 PZNRRUTVGXCKFC-IUODEOHRSA-N 0.000 claims description 4
- JHKJGWJFBYPMCY-CJTQKWKHSA-N (z,2r)-3-(3-methoxyphenyl)-n,n,2-trimethylpent-3-en-1-amine Chemical compound COC1=CC=CC(C(=C/C)\[C@@H](C)CN(C)C)=C1 JHKJGWJFBYPMCY-CJTQKWKHSA-N 0.000 claims description 4
- JHKJGWJFBYPMCY-FVTUNSQFSA-N (z,2s)-3-(3-methoxyphenyl)-n,n,2-trimethylpent-3-en-1-amine Chemical compound COC1=CC=CC(C(=C/C)\[C@H](C)CN(C)C)=C1 JHKJGWJFBYPMCY-FVTUNSQFSA-N 0.000 claims description 4
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052737 gold Inorganic materials 0.000 claims description 4
- 239000010931 gold Substances 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 229910000510 noble metal Inorganic materials 0.000 claims description 4
- 150000007524 organic acids Chemical class 0.000 claims description 4
- 235000005985 organic acids Nutrition 0.000 claims description 4
- 229910052697 platinum Inorganic materials 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- 230000035484 reaction time Effects 0.000 claims description 4
- 125000000335 thiazolyl group Chemical group 0.000 claims description 4
- 125000001544 thienyl group Chemical group 0.000 claims description 4
- JHKJGWJFBYPMCY-BYQGBLLGSA-N (e,2s)-3-(3-methoxyphenyl)-n,n,2-trimethylpent-3-en-1-amine Chemical compound COC1=CC=CC(C(=C\C)\[C@H](C)CN(C)C)=C1 JHKJGWJFBYPMCY-BYQGBLLGSA-N 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- JKVBTSJLQLSTHJ-DOMZBBRYSA-N (2s,3s)-3-(3-methoxyphenyl)-n,n,2-trimethylpentan-1-amine Chemical compound CN(C)C[C@@H](C)[C@H](CC)C1=CC=CC(OC)=C1 JKVBTSJLQLSTHJ-DOMZBBRYSA-N 0.000 claims description 2
- 230000009471 action Effects 0.000 claims description 2
- BJOLNGAHHMLWCF-UHFFFAOYSA-N C(C)(C)C1=CC=C(C=C1)NC(=O)OC=1C=C(C=CC1)CN(C)CC(C=CC)C Chemical compound C(C)(C)C1=CC=C(C=C1)NC(=O)OC=1C=C(C=CC1)CN(C)CC(C=CC)C BJOLNGAHHMLWCF-UHFFFAOYSA-N 0.000 claims 1
- 230000018044 dehydration Effects 0.000 abstract description 3
- 238000006297 dehydration reaction Methods 0.000 abstract description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 51
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 42
- 125000003118 aryl group Chemical group 0.000 description 15
- 238000001816 cooling Methods 0.000 description 15
- 125000000753 cycloalkyl group Chemical group 0.000 description 15
- 239000000725 suspension Substances 0.000 description 15
- KWTWDQCKEHXFFR-UHFFFAOYSA-N 3-[1-(dimethylamino)-2-methylpentan-3-yl]phenol Chemical compound CN(C)CC(C)C(CC)C1=CC=CC(O)=C1 KWTWDQCKEHXFFR-UHFFFAOYSA-N 0.000 description 12
- 230000008030 elimination Effects 0.000 description 12
- 238000003379 elimination reaction Methods 0.000 description 12
- 238000010438 heat treatment Methods 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- JKVBTSJLQLSTHJ-SWLSCSKDSA-N (2r,3r)-3-(3-methoxyphenyl)-n,n,2-trimethylpentan-1-amine Chemical compound CN(C)C[C@H](C)[C@@H](CC)C1=CC=CC(OC)=C1 JKVBTSJLQLSTHJ-SWLSCSKDSA-N 0.000 description 10
- 239000012074 organic phase Substances 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 150000003254 radicals Chemical class 0.000 description 10
- JKVBTSJLQLSTHJ-WFASDCNBSA-N (2r,3s)-3-(3-methoxyphenyl)-n,n,2-trimethylpentan-1-amine Chemical compound CN(C)C[C@H](C)[C@H](CC)C1=CC=CC(OC)=C1 JKVBTSJLQLSTHJ-WFASDCNBSA-N 0.000 description 9
- 239000002585 base Substances 0.000 description 9
- 239000000706 filtrate Substances 0.000 description 9
- 239000011521 glass Substances 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 239000002356 single layer Substances 0.000 description 9
- 238000005191 phase separation Methods 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- PZNRRUTVGXCKFC-SWLSCSKDSA-N (2s,3r)-1-(dimethylamino)-3-(3-methoxyphenyl)-2-methylpentan-3-ol Chemical compound CN(C)C[C@H](C)[C@](O)(CC)C1=CC=CC(OC)=C1 PZNRRUTVGXCKFC-SWLSCSKDSA-N 0.000 description 6
- JHKJGWJFBYPMCY-UHFFFAOYSA-N 3-(3-methoxyphenyl)-n,n,2-trimethylpent-3-en-1-amine Chemical compound COC1=CC=CC(C(=CC)C(C)CN(C)C)=C1 JHKJGWJFBYPMCY-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 239000008346 aqueous phase Substances 0.000 description 6
- 238000002955 isolation Methods 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 0 *C(*)(CN(*)*)C(c1c(*)c(*)c(*)c(*)c1*)=C(*)* Chemical compound *C(*)(CN(*)*)C(c1c(*)c(*)c(*)c(*)c1*)=C(*)* 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 125000001072 heteroaryl group Chemical group 0.000 description 5
- KWTWDQCKEHXFFR-RISCZKNCSA-N 3-[(2s,3s)-1-(dimethylamino)-2-methylpentan-3-yl]phenol Chemical compound CN(C)C[C@@H](C)[C@H](CC)C1=CC=CC(O)=C1 KWTWDQCKEHXFFR-RISCZKNCSA-N 0.000 description 4
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 4
- 150000001450 anions Chemical class 0.000 description 4
- 150000001768 cations Chemical class 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- 125000005842 heteroatom Chemical group 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 238000011835 investigation Methods 0.000 description 4
- 238000001556 precipitation Methods 0.000 description 4
- 238000006467 substitution reaction Methods 0.000 description 4
- 241000124008 Mammalia Species 0.000 description 3
- 238000009529 body temperature measurement Methods 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 238000010790 dilution Methods 0.000 description 3
- 239000012895 dilution Substances 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- PZNRRUTVGXCKFC-DOMZBBRYSA-N (2r,3s)-1-(dimethylamino)-3-(3-methoxyphenyl)-2-methylpentan-3-ol Chemical compound CN(C)C[C@@H](C)[C@@](O)(CC)C1=CC=CC(OC)=C1 PZNRRUTVGXCKFC-DOMZBBRYSA-N 0.000 description 2
- JWPQTVRDQHIIHD-NXCSSKFKSA-N (2s,3s)-1-(dimethylamino)-3-(3-methoxyphenyl)-2-methylpentan-3-ol;hydrochloride Chemical compound Cl.CN(C)C[C@H](C)[C@@](O)(CC)C1=CC=CC(OC)=C1 JWPQTVRDQHIIHD-NXCSSKFKSA-N 0.000 description 2
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 description 2
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 2
- CXBDYQVECUFKRK-UHFFFAOYSA-N 1-methoxybutane Chemical compound CCCCOC CXBDYQVECUFKRK-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- INCYIBYTUZLVLV-RISCZKNCSA-N 3-[(2r,3s)-1-(dimethylamino)-3-hydroxy-2-methylpentan-3-yl]phenol Chemical compound CN(C)C[C@@H](C)[C@@](O)(CC)C1=CC=CC(O)=C1 INCYIBYTUZLVLV-RISCZKNCSA-N 0.000 description 2
- INCYIBYTUZLVLV-UHFFFAOYSA-N 3-[1-(dimethylamino)-3-hydroxy-2-methylpentan-3-yl]phenol Chemical compound CN(C)CC(C)C(O)(CC)C1=CC=CC(O)=C1 INCYIBYTUZLVLV-UHFFFAOYSA-N 0.000 description 2
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- QIAFMBKCNZACKA-UHFFFAOYSA-N N-benzoylglycine Chemical compound OC(=O)CNC(=O)C1=CC=CC=C1 QIAFMBKCNZACKA-UHFFFAOYSA-N 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- 208000002193 Pain Diseases 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- ZKUNFWZUWXFMBW-UHFFFAOYSA-N [3-[1-(dimethylamino)-2-methylpentyl]phenyl] N-(4-propan-2-ylphenyl)carbamate Chemical compound C(C)(C)C1=CC=C(C=C1)NC(=O)OC=1C=C(C=CC=1)C(C(CCC)C)N(C)C ZKUNFWZUWXFMBW-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 150000005840 aryl radicals Chemical class 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 2
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 238000013094 purity test Methods 0.000 description 2
- 230000006340 racemization Effects 0.000 description 2
- 239000000523 sample Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 150000003509 tertiary alcohols Chemical class 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- JWPQTVRDQHIIHD-XRZFDKQNSA-N (2r,3r)-1-(dimethylamino)-3-(3-methoxyphenyl)-2-methylpentan-3-ol;hydrochloride Chemical compound Cl.CN(C)C[C@@H](C)[C@](O)(CC)C1=CC=CC(OC)=C1 JWPQTVRDQHIIHD-XRZFDKQNSA-N 0.000 description 1
- JWPQTVRDQHIIHD-SBKWZQTDSA-N (2s,3r)-1-(dimethylamino)-3-(3-methoxyphenyl)-2-methylpentan-3-ol;hydrochloride Chemical compound Cl.CN(C)C[C@H](C)[C@](O)(CC)C1=CC=CC(OC)=C1 JWPQTVRDQHIIHD-SBKWZQTDSA-N 0.000 description 1
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 description 1
- 125000006645 (C3-C4) cycloalkyl group Chemical group 0.000 description 1
- 125000006555 (C3-C5) cycloalkyl group Chemical group 0.000 description 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 1
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 description 1
- 125000006704 (C5-C6) cycloalkyl group Chemical group 0.000 description 1
- 125000006705 (C5-C7) cycloalkyl group Chemical group 0.000 description 1
- AGBQKNBQESQNJD-SSDOTTSWSA-N (R)-lipoic acid Chemical compound OC(=O)CCCC[C@@H]1CCSS1 AGBQKNBQESQNJD-SSDOTTSWSA-N 0.000 description 1
- XBYRMPXUBGMOJC-UHFFFAOYSA-N 1,2-dihydropyrazol-3-one Chemical compound OC=1C=CNN=1 XBYRMPXUBGMOJC-UHFFFAOYSA-N 0.000 description 1
- NAOLWIGVYRIGTP-UHFFFAOYSA-N 1,3,5-trihydroxyanthracene-9,10-dione Chemical compound C1=CC(O)=C2C(=O)C3=CC(O)=CC(O)=C3C(=O)C2=C1 NAOLWIGVYRIGTP-UHFFFAOYSA-N 0.000 description 1
- FTNJQNQLEGKTGD-UHFFFAOYSA-N 1,3-benzodioxole Chemical compound C1=CC=C2OCOC2=C1 FTNJQNQLEGKTGD-UHFFFAOYSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- PDQRQJVPEFGVRK-UHFFFAOYSA-N 2,1,3-benzothiadiazole Chemical compound C1=CC=CC2=NSN=C21 PDQRQJVPEFGVRK-UHFFFAOYSA-N 0.000 description 1
- FFFIRKXTFQCCKJ-UHFFFAOYSA-N 2,4,6-trimethylbenzoic acid Chemical compound CC1=CC(C)=C(C(O)=O)C(C)=C1 FFFIRKXTFQCCKJ-UHFFFAOYSA-N 0.000 description 1
- VIKBNMWOLLIQPG-UHFFFAOYSA-N 2-methyldecanedioic acid Chemical compound OC(=O)C(C)CCCCCCCC(O)=O VIKBNMWOLLIQPG-UHFFFAOYSA-N 0.000 description 1
- AJHPGXZOIAYYDW-UHFFFAOYSA-N 3-(2-cyanophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)NC(C(O)=O)CC1=CC=CC=C1C#N AJHPGXZOIAYYDW-UHFFFAOYSA-N 0.000 description 1
- LMRNCVNWJNBQNO-UHFFFAOYSA-N 3-fluorobutan-1-amine Chemical class CC(F)CCN LMRNCVNWJNBQNO-UHFFFAOYSA-N 0.000 description 1
- 125000003542 3-methylbutan-2-yl group Chemical group [H]C([H])([H])C([H])(*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- ALYNCZNDIQEVRV-PZFLKRBQSA-N 4-amino-3,5-ditritiobenzoic acid Chemical compound [3H]c1cc(cc([3H])c1N)C(O)=O ALYNCZNDIQEVRV-PZFLKRBQSA-N 0.000 description 1
- ODHCTXKNWHHXJC-VKHMYHEASA-N 5-oxo-L-proline Chemical compound OC(=O)[C@@H]1CCC(=O)N1 ODHCTXKNWHHXJC-VKHMYHEASA-N 0.000 description 1
- BSYNRYMUTXBXSQ-FOQJRBATSA-N 59096-14-9 Chemical compound CC(=O)OC1=CC=CC=C1[14C](O)=O BSYNRYMUTXBXSQ-FOQJRBATSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- 208000000094 Chronic Pain Diseases 0.000 description 1
- ZDQWESQEGGJUCH-UHFFFAOYSA-N Diisopropyl adipate Chemical compound CC(C)OC(=O)CCCCC(=O)OC(C)C ZDQWESQEGGJUCH-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 1
- OKJIRPAQVSHGFK-UHFFFAOYSA-N N-acetylglycine Chemical compound CC(=O)NCC(O)=O OKJIRPAQVSHGFK-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical compound [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- YGCFIWIQZPHFLU-UHFFFAOYSA-N acesulfame Chemical compound CC1=CC(=O)NS(=O)(=O)O1 YGCFIWIQZPHFLU-UHFFFAOYSA-N 0.000 description 1
- 229960005164 acesulfame Drugs 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- ODHCTXKNWHHXJC-UHFFFAOYSA-N acide pyroglutamique Natural products OC(=O)C1CCC(=O)N1 ODHCTXKNWHHXJC-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- AGBQKNBQESQNJD-UHFFFAOYSA-N alpha-Lipoic acid Natural products OC(=O)CCCCC1CCSS1 AGBQKNBQESQNJD-UHFFFAOYSA-N 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- RFRXIWQYSOIBDI-UHFFFAOYSA-N benzarone Chemical compound CCC=1OC2=CC=CC=C2C=1C(=O)C1=CC=C(O)C=C1 RFRXIWQYSOIBDI-UHFFFAOYSA-N 0.000 description 1
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 235000014121 butter Nutrition 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000012159 carrier gas Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 229940109275 cyclamate Drugs 0.000 description 1
- WZHCOOQXZCIUNC-UHFFFAOYSA-N cyclandelate Chemical compound C1C(C)(C)CC(C)CC1OC(=O)C(O)C1=CC=CC=C1 WZHCOOQXZCIUNC-UHFFFAOYSA-N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000004205 dimethyl polysiloxane Substances 0.000 description 1
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000003914 fluoranthenyl group Chemical group C1(=CC=C2C=CC=C3C4=CC=CC=C4C1=C23)* 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- FYAQQULBLMNGAH-UHFFFAOYSA-N hexane-1-sulfonic acid Chemical compound CCCCCCS(O)(=O)=O FYAQQULBLMNGAH-UHFFFAOYSA-N 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 235000019136 lipoic acid Nutrition 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical compound C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 description 1
- LYKMMUBOEFYJQG-UHFFFAOYSA-N piperoxan Chemical compound C1OC2=CC=CC=C2OC1CN1CCCCC1 LYKMMUBOEFYJQG-UHFFFAOYSA-N 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 1
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 235000021092 sugar substitutes Nutrition 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005329 tetralinyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 229960002663 thioctic acid Drugs 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/54—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
- C07C217/64—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains further substituted by singly-bound oxygen atoms
- C07C217/66—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains further substituted by singly-bound oxygen atoms with singly-bound oxygen atoms and six-membered aromatic rings bound to the same carbon atom of the carbon chain
- C07C217/72—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains further substituted by singly-bound oxygen atoms with singly-bound oxygen atoms and six-membered aromatic rings bound to the same carbon atom of the carbon chain linked by carbon chains having at least three carbon atoms between the amino groups and the six-membered aromatic ring or the condensed ring system containing that ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/68—Preparation of compounds containing amino groups bound to a carbon skeleton from amines, by reactions not involving amino groups, e.g. reduction of unsaturated amines, aromatisation, or substitution of the carbon skeleton
- C07C209/70—Preparation of compounds containing amino groups bound to a carbon skeleton from amines, by reactions not involving amino groups, e.g. reduction of unsaturated amines, aromatisation, or substitution of the carbon skeleton by reduction of unsaturated amines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/01—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms
- C07C211/26—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring
- C07C211/27—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring having amino groups linked to the six-membered aromatic ring by saturated carbon chains
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/01—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms
- C07C211/26—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring
- C07C211/28—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring having amino groups linked to the six-membered aromatic ring by unsaturated carbon chains
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C213/00—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton
- C07C213/08—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton by reactions not involving the formation of amino groups, hydroxy groups or etherified or esterified hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/46—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
- C07C215/56—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains further substituted by hydroxy groups
- C07C215/58—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains further substituted by hydroxy groups with hydroxy groups and the six-membered aromatic ring, or the condensed ring system containing that ring, bound to the same carbon atom of the carbon chain
- C07C215/62—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains further substituted by hydroxy groups with hydroxy groups and the six-membered aromatic ring, or the condensed ring system containing that ring, bound to the same carbon atom of the carbon chain the chain having at least three carbon atoms between the amino groups and the six-membered aromatic ring or the condensed ring system containing that ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Priority Applications (27)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE10326097A DE10326097A1 (de) | 2003-06-06 | 2003-06-06 | Verfahren zur Herstellung von Dimethyl-(3-aryl-butyl)-aminverbindungen |
| AU2004245223A AU2004245223C1 (en) | 2003-06-06 | 2004-06-04 | Method for the production of substituted 3-aryl-butyl amine compounds |
| PL04739583T PL1633697T3 (pl) | 2003-06-06 | 2004-06-04 | Sposób wytwarzania podstawionych związków 3-arylo-butylo-aminowych |
| ES04739583T ES2323870T3 (es) | 2003-06-06 | 2004-06-04 | Procedimiento para la produccion de compuestos de 3-aril-butil-amina sustituidos. |
| PT04739583T PT1633697E (pt) | 2003-06-06 | 2004-06-04 | Processo para a produção de compostos substituídos de 3-arilbutilamina |
| RU2005141518/04A RU2380355C2 (ru) | 2003-06-06 | 2004-06-04 | Способ получения замещенных 3-арилбутиламиновых соединений |
| MXPA05013193A MXPA05013193A (es) | 2003-06-06 | 2004-06-04 | Metodo para la produccion de compuestos sustituidos de 3-aril-butil-amina. |
| KR1020057023464A KR101146205B1 (ko) | 2003-06-06 | 2004-06-04 | 치환된 3-아릴-부틸-아민 화합물의 제조방법 |
| DE502004009142T DE502004009142D1 (de) | 2003-06-06 | 2004-06-04 | Verfahren zur herstellung substituierter 3-aryl-butyl-aminverbindungen |
| NZ544231A NZ544231A (en) | 2003-06-06 | 2004-06-04 | Process for the preparation of substituted 3-aryl-butyl-amine compounds |
| PCT/EP2004/006027 WO2004108658A1 (de) | 2003-06-06 | 2004-06-04 | Verfahren zur herstellung substituierter 3-aryl-butyl-aminverbindungen |
| SI200431114T SI1633697T1 (sl) | 2003-06-06 | 2004-06-04 | Postopek za pripravo substituiranih 3-aril-butilaminskih spojin |
| EP04739583A EP1633697B1 (de) | 2003-06-06 | 2004-06-04 | Verfahren zur herstellung substituierter 3-aryl-butyl-aminverbindungen |
| DK04739583T DK1633697T3 (da) | 2003-06-06 | 2004-06-04 | Fremgangsmåde til fremstilling af substituerede 3-aryl-butyl-aminforbindelser |
| CN2004800218627A CN1829681B (zh) | 2003-06-06 | 2004-06-04 | 取代的3-芳基-丁基-胺化合物的制备方法 |
| HR20090333T HRP20090333T1 (hr) | 2003-06-06 | 2004-06-04 | Postupak za proizvodnju supstituiranih spojeva 3-aril-butil-amina |
| AT04739583T ATE425136T1 (de) | 2003-06-06 | 2004-06-04 | Verfahren zur herstellung substituierter 3-aryl- butyl-aminverbindungen |
| JP2006508271A JP4848268B2 (ja) | 2003-06-06 | 2004-06-04 | 置換された3−アリールブチル−アミン−化合物の製造方法 |
| HK06110185.8A HK1088597B (en) | 2003-06-06 | 2004-06-04 | Method for the production of substituted 3-aryl-butyl amine compounds |
| BRPI0411268A BRPI0411268C8 (pt) | 2003-06-06 | 2004-06-04 | Processo para a preparação de compostos 3-aril butil-amina substituído |
| CA2528087A CA2528087C (en) | 2003-06-06 | 2004-06-04 | Process for the preparation of substituted 3-aryl-butyl-amine compounds |
| IL172357A IL172357A (en) | 2003-06-06 | 2005-12-05 | METHOD FOR PRODUCING AMINO-BUTYL CONCENTRATED AMINO COMPOUNDS |
| US11/294,449 US7417170B2 (en) | 2003-06-06 | 2005-12-06 | Process for the preparation of substituted 3-aryl-butylamine compounds |
| EC2005006218A ECSP056218A (es) | 2003-06-06 | 2005-12-13 | Metodo para la produccion de compuestos de 3-aryl-butil-amina substituidos. |
| NO20060044A NO335587B1 (no) | 2003-06-06 | 2006-01-04 | Fremgangsmåte for fremstilling av substituerte 3-aryl-butyl-aminforbindelser |
| ZA200600109A ZA200600109B (en) | 2003-06-06 | 2006-01-05 | Method for the producting of substituted 3-aryl-butyl amine compounds |
| CY20091100536T CY1109088T1 (el) | 2003-06-06 | 2009-05-21 | Μεθοδος για την παρασκευη υποκατεστημενων ενωσεων 3-αρυλο-βουτυλ-αμινης |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE10326097A DE10326097A1 (de) | 2003-06-06 | 2003-06-06 | Verfahren zur Herstellung von Dimethyl-(3-aryl-butyl)-aminverbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE10326097A1 true DE10326097A1 (de) | 2005-01-05 |
Family
ID=33494923
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE10326097A Withdrawn DE10326097A1 (de) | 2003-06-06 | 2003-06-06 | Verfahren zur Herstellung von Dimethyl-(3-aryl-butyl)-aminverbindungen |
| DE502004009142T Expired - Lifetime DE502004009142D1 (de) | 2003-06-06 | 2004-06-04 | Verfahren zur herstellung substituierter 3-aryl-butyl-aminverbindungen |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE502004009142T Expired - Lifetime DE502004009142D1 (de) | 2003-06-06 | 2004-06-04 | Verfahren zur herstellung substituierter 3-aryl-butyl-aminverbindungen |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US7417170B2 (OSRAM) |
| EP (1) | EP1633697B1 (OSRAM) |
| JP (1) | JP4848268B2 (OSRAM) |
| KR (1) | KR101146205B1 (OSRAM) |
| CN (1) | CN1829681B (OSRAM) |
| AT (1) | ATE425136T1 (OSRAM) |
| AU (1) | AU2004245223C1 (OSRAM) |
| BR (1) | BRPI0411268C8 (OSRAM) |
| CA (1) | CA2528087C (OSRAM) |
| CY (1) | CY1109088T1 (OSRAM) |
| DE (2) | DE10326097A1 (OSRAM) |
| DK (1) | DK1633697T3 (OSRAM) |
| EC (1) | ECSP056218A (OSRAM) |
| ES (1) | ES2323870T3 (OSRAM) |
| HR (1) | HRP20090333T1 (OSRAM) |
| IL (1) | IL172357A (OSRAM) |
| MX (1) | MXPA05013193A (OSRAM) |
| NO (1) | NO335587B1 (OSRAM) |
| NZ (1) | NZ544231A (OSRAM) |
| PL (1) | PL1633697T3 (OSRAM) |
| PT (1) | PT1633697E (OSRAM) |
| RU (1) | RU2380355C2 (OSRAM) |
| SI (1) | SI1633697T1 (OSRAM) |
| WO (1) | WO2004108658A1 (OSRAM) |
| ZA (1) | ZA200600109B (OSRAM) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102005052588A1 (de) * | 2005-11-02 | 2007-05-10 | Grünenthal GmbH | Verfahren zur Herstellung substituierter Dimethyl-(3-aryl-butyl)-amin-Verbindungen mittels homogener Katalyse |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10328316A1 (de) | 2003-06-23 | 2005-01-20 | Grünenthal GmbH | Verfahren zur Herstellung von Dimethyl-(3-aryl-buthyl)-aminverbindungen als pharmazeutische Wirkstoffe |
| MX2009000911A (es) * | 2006-07-24 | 2009-02-04 | Janssen Pharmaceutica Nv | Preparacion de (2r,3r)-3-(3-metoxifenil)-n,n,2-trimetilpentanamina . |
| TWI496762B (zh) * | 2006-07-24 | 2015-08-21 | 歌林達股份有限公司 | 製備(1r,2r)-3-(3-二甲胺基-1-乙基-2-甲基-丙基)-酚之方法 |
| TWI401237B (zh) | 2006-07-24 | 2013-07-11 | 3-〔(1r,2r)-3-(二甲基氨基)-1-乙基-2-甲基丙基〕酚之製備 | |
| CN101939287B (zh) * | 2007-12-07 | 2014-10-22 | 格吕伦塔尔有限公司 | (1r,2r)-3-(3-二甲基氨基-1-乙基-2-甲基-丙基)-苯酚的结晶变体 |
| US20100227921A1 (en) * | 2009-03-03 | 2010-09-09 | Shire Llc | Amino acid and peptide carbamate prodrugs of tapentadol and uses thereof |
| CN102002065B (zh) * | 2009-09-02 | 2014-09-10 | 上海特化医药科技有限公司 | 他喷他多的制备方法及其中间体 |
| US8288592B2 (en) | 2009-09-22 | 2012-10-16 | Actavis Group Ptc Ehf | Solid state forms of tapentadol salts |
| IT1397189B1 (it) * | 2009-12-01 | 2013-01-04 | Archimica Srl | Nuovo processo per la preparazione di tapentadol e suoi intermedi. |
| WO2011080736A1 (en) | 2009-12-29 | 2011-07-07 | Mapi Pharma Hk Limited | Intermediate compounds and processes for the preparation of tapentadol and related compounds |
| WO2011092719A2 (en) * | 2010-02-01 | 2011-08-04 | Ind-Swift Laboratories Limited | Process for the preparation of l-phenyl-3-dimethylaminopropane derivatives |
| US20130096346A1 (en) | 2010-03-05 | 2013-04-18 | Actavis Group Ptc Ehf | Resolution methods for isolating desired enantiomers of tapentadol intermediates and use thereof for the preparation of tapentadol |
| WO2011128784A2 (en) | 2010-04-05 | 2011-10-20 | Actavis Group Ptc Ehf | Novel process for preparing highly pure tapentadol or a pharmaceutically acceptable salt thereof |
| ITMI20100924A1 (it) * | 2010-05-21 | 2011-11-22 | Fidia Farmaceutici | Nuovo metodo di sintesi delle due forme enantiomeriche del tapentadol |
| CN103168025B (zh) * | 2010-06-15 | 2015-02-25 | 格吕伦塔尔有限公司 | 用于制备取代的3-(1-氨基-2-甲基戊烷-3-基)苯基化合物的方法 |
| IT1401109B1 (it) | 2010-07-02 | 2013-07-12 | Archimica Srl | Nuovo processo per la preparazione di tapentadol e suoi intermedi. |
| ES2860676T3 (es) * | 2010-07-23 | 2021-10-05 | Gruenenthal Gmbh | Sales o cocristales de 3- (3-dimetilamino-1-etil-2-metil-propil) -fenol |
| EP2606030B1 (en) | 2010-08-16 | 2016-05-18 | Indoco Remedies Limited | Process for the preparation of tapentadol |
| US8552219B2 (en) | 2010-09-20 | 2013-10-08 | Ind-Swift Laboratories Limited | Process for preparing L-phenyl-3-dimethylaminopropane derivative |
| CN102477016B (zh) * | 2010-11-26 | 2014-12-17 | 中国医学科学院药物研究所 | 他喷他多的中间体的合成与应用 |
| HUP1300623A2 (en) * | 2010-12-30 | 2014-03-28 | Zentiva Ks | O-substituted (2r,3r)-3-(3-hidroxiphenil)-2-metyil-4-pentenoic acids and a method of obtaining the same |
| CZ2010998A3 (cs) * | 2010-12-30 | 2012-02-08 | Zentiva, K.S. | Zpusob výroby (2R,3R)-N,N-dimethyl-3-(3-hydroxyfenyl)-2-methylpentylaminu (tapentadolu) |
| CZ2010997A3 (cs) * | 2010-12-30 | 2012-02-08 | Zentiva, K.S. | Zpusob výroby (2R,3R)-N,N-dimethyl-3-(3-hydroxyfenyl)-2-methylpentylaminu (tapentadolu) |
| WO2012146978A2 (en) | 2011-04-28 | 2012-11-01 | Actavis Group Ptc Ehf | A novel process for the preparation of tapentadol or a pharmaceutically acceptable salt thereof |
| EP2530072A1 (en) | 2011-06-03 | 2012-12-05 | Lacer, S.A. | New compounds, synthesis and use thereof in the treatment of pain |
| WO2013016840A1 (zh) | 2011-07-29 | 2013-02-07 | 安徽省新星药物开发有限责任公司 | 用于合成他喷他多或其类似物的新中间体 |
| WO2013105109A1 (en) | 2011-11-09 | 2013-07-18 | Indoco Remedies Limited | Process for the preparation of tapentadol |
| US20130150622A1 (en) | 2011-12-12 | 2013-06-13 | Boehringer Ingelheim International Gmbh | Stereoselective synthesis of tapentadol and its salts |
| WO2013120466A1 (en) | 2012-02-17 | 2013-08-22 | Zentiva, K.S. | A new solid form of tapentadol and a method of its preparation |
| EP2674414A1 (en) | 2012-06-15 | 2013-12-18 | Siegfried AG | Method for the preparation of 1-aryl-1-alkyl-3-dialkylaminopropane compounds |
| CN103159633B (zh) * | 2012-07-06 | 2015-08-12 | 江苏恩华药业股份有限公司 | 他喷他多的制备方法及用于制备他喷他多的化合物 |
| IN2013MU03670A (OSRAM) | 2013-11-21 | 2015-07-31 | Unimark Remedies Ltd | |
| SI3083551T1 (en) | 2013-12-16 | 2018-04-30 | Farma Grs, D.O.O. | CRYSTAL FORM INTERMEDIATE TAPENTADOL |
| CZ307492B6 (cs) | 2014-02-04 | 2018-10-17 | Zentiva, K.S. | Pevná forma maleátu tapentadolu a způsob její přípravy |
| CA2991421C (en) | 2015-07-10 | 2019-04-30 | Mallinckrodt Llc | A two-step process for preparing 3-substituted phenylalkylamines |
| EP4269384A1 (en) | 2022-04-26 | 2023-11-01 | KRKA, d.d., Novo mesto | Method for crystallizing tapentadol intermediate, tapentadol intermediate of high purity, method of making tapentadol and tapentadol of high purity |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3978129A (en) * | 1972-01-28 | 1976-08-31 | A. H. Robins Company, Incorporated | Alkenyl- and alkanylamines |
| DE4426245A1 (de) | 1994-07-23 | 1996-02-22 | Gruenenthal Gmbh | 1-Phenyl-3-dimethylamino-propanverbindungen mit pharmakologischer Wirkung |
| DE19609847A1 (de) * | 1996-03-13 | 1997-09-18 | Gruenenthal Gmbh | Dimethyl-(3-aryl-but-3-enyl)-aminverbindungen als pharmazeutische Wirkstoffe |
| DE19857475A1 (de) * | 1998-12-14 | 2000-06-15 | Gruenenthal Gmbh | Substituierte Cycloheptene, deren Herstellung und Verwendung |
| DE19933421A1 (de) | 1999-07-16 | 2001-01-25 | Gruenenthal Gmbh | 2-Benzyl-3-dimethylamino-1-phenyl-propanderi- vate |
| DE10000311A1 (de) * | 2000-01-05 | 2001-07-12 | Gruenenthal Gmbh | Aminomethyl-Phonyl-Cyclohexanonderivate |
-
2003
- 2003-06-06 DE DE10326097A patent/DE10326097A1/de not_active Withdrawn
-
2004
- 2004-06-04 CN CN2004800218627A patent/CN1829681B/zh not_active Expired - Lifetime
- 2004-06-04 JP JP2006508271A patent/JP4848268B2/ja not_active Expired - Lifetime
- 2004-06-04 KR KR1020057023464A patent/KR101146205B1/ko not_active Expired - Lifetime
- 2004-06-04 HR HR20090333T patent/HRP20090333T1/xx unknown
- 2004-06-04 DK DK04739583T patent/DK1633697T3/da active
- 2004-06-04 PL PL04739583T patent/PL1633697T3/pl unknown
- 2004-06-04 MX MXPA05013193A patent/MXPA05013193A/es active IP Right Grant
- 2004-06-04 WO PCT/EP2004/006027 patent/WO2004108658A1/de not_active Ceased
- 2004-06-04 AU AU2004245223A patent/AU2004245223C1/en not_active Expired
- 2004-06-04 BR BRPI0411268A patent/BRPI0411268C8/pt not_active IP Right Cessation
- 2004-06-04 SI SI200431114T patent/SI1633697T1/sl unknown
- 2004-06-04 EP EP04739583A patent/EP1633697B1/de not_active Expired - Lifetime
- 2004-06-04 NZ NZ544231A patent/NZ544231A/en not_active IP Right Cessation
- 2004-06-04 CA CA2528087A patent/CA2528087C/en not_active Expired - Lifetime
- 2004-06-04 DE DE502004009142T patent/DE502004009142D1/de not_active Expired - Lifetime
- 2004-06-04 PT PT04739583T patent/PT1633697E/pt unknown
- 2004-06-04 AT AT04739583T patent/ATE425136T1/de active
- 2004-06-04 RU RU2005141518/04A patent/RU2380355C2/ru active
- 2004-06-04 ES ES04739583T patent/ES2323870T3/es not_active Expired - Lifetime
-
2005
- 2005-12-05 IL IL172357A patent/IL172357A/en not_active IP Right Cessation
- 2005-12-06 US US11/294,449 patent/US7417170B2/en not_active Expired - Lifetime
- 2005-12-13 EC EC2005006218A patent/ECSP056218A/es unknown
-
2006
- 2006-01-04 NO NO20060044A patent/NO335587B1/no unknown
- 2006-01-05 ZA ZA200600109A patent/ZA200600109B/en unknown
-
2009
- 2009-05-21 CY CY20091100536T patent/CY1109088T1/el unknown
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102005052588A1 (de) * | 2005-11-02 | 2007-05-10 | Grünenthal GmbH | Verfahren zur Herstellung substituierter Dimethyl-(3-aryl-butyl)-amin-Verbindungen mittels homogener Katalyse |
| US8791300B2 (en) | 2005-11-02 | 2014-07-29 | Gruenenthal Gmbh | Process for preparing a substituted dimethyl-(3-arylbutyl)amine compound by homogeneous catalysis |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1633697B1 (de) | Verfahren zur herstellung substituierter 3-aryl-butyl-aminverbindungen | |
| EP0753506A1 (de) | 6-dimethylaminomethyl-1-phenyl-cyclo-hexanverbindungen als pharmazeutische Wirkstoffe | |
| DE60205769T2 (de) | Verfahren zur herstellung von amphetaminen aus phenylpropanolaminen | |
| WO2002030870A2 (de) | Substituierte c-cyclohexylmethylamin-derivate | |
| EP1322593B1 (de) | O-substituierte 6-methyl-tramadol-derivate | |
| DE68905171T2 (de) | Benzol-derivate, ihre herstellung und pharmazeutische zusammensetzungen, die diese enthalten. | |
| EP1322590B1 (de) | Substituierte 5-amino-1-penten-3-ol-derivate | |
| EP1317427B1 (de) | Verfahren zur herstellung chiraler verbindungen | |
| DE2354931C2 (de) | trans-2-Phenylbicyclooctan-Verbindungen, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Zubereitungen | |
| DE2619617A1 (de) | Amine, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische mittel | |
| DE2749214C2 (OSRAM) | ||
| DE1518436C (de) | Phenylalkanolamine und deren Saure= additionssalze, Verfahren zu deren Her stellung und Arzneimittel | |
| DE1768505B2 (de) | Phenathylaminverbindungen und Ver fahren zu ihrer Herstellung | |
| AT338793B (de) | Verfahren zur herstellung von neuen benzazocinderivaten | |
| EP0322391A1 (en) | New phenylalkylamine derivatives | |
| DE10206404A1 (de) | Synthese von substituierten Sulfonylaminen | |
| EP0292820B1 (de) | 3-Phenyl-2-styryl-pyrrolidine, ihre Herstellung und Verwendung | |
| DE1518436B (de) | Phenylalkanolamine und deren Säure= additionssalze, Verfahren zu deren Herstellung und Arzneimittel | |
| WO2003068734A1 (de) | Carbamidestern zur behandlung von schmerz | |
| DE10206403A1 (de) | Synthese von Beta-Aminoketonen | |
| DD202148A5 (de) | Verfahren zur herstellung von phenylperhydroazepinen | |
| DE2513220A1 (de) | Chromanole, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OR8 | Request for search as to paragraph 43 lit. 1 sentence 1 patent law | ||
| 8105 | Search report available | ||
| 8141 | Disposal/no request for examination |