DD239200A5 - Verfahren zur herstellung von n-acyl-l-prolin-derivaten - Google Patents
Verfahren zur herstellung von n-acyl-l-prolin-derivaten Download PDFInfo
- Publication number
- DD239200A5 DD239200A5 DD85281836A DD28183685A DD239200A5 DD 239200 A5 DD239200 A5 DD 239200A5 DD 85281836 A DD85281836 A DD 85281836A DD 28183685 A DD28183685 A DD 28183685A DD 239200 A5 DD239200 A5 DD 239200A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- proline
- carboxylic acid
- general formula
- bromo
- pyrrolidine
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 27
- 238000002360 preparation method Methods 0.000 title claims abstract description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 23
- 150000001875 compounds Chemical class 0.000 claims abstract description 20
- 239000011541 reaction mixture Substances 0.000 claims abstract description 18
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims abstract description 11
- 239000002253 acid Substances 0.000 claims abstract description 8
- 239000011230 binding agent Substances 0.000 claims abstract description 6
- 125000005843 halogen group Chemical group 0.000 claims abstract description 5
- 239000012442 inert solvent Substances 0.000 claims abstract description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims abstract 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 27
- 229960002429 proline Drugs 0.000 claims description 19
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 claims description 18
- 229930182821 L-proline Natural products 0.000 claims description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 12
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 claims description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 6
- 239000003960 organic solvent Substances 0.000 claims description 5
- ZHHOUXSQMHJPRA-ZETCQYMHSA-N trimethylsilyl (2s)-pyrrolidine-2-carboxylate Chemical compound C[Si](C)(C)OC(=O)[C@@H]1CCCN1 ZHHOUXSQMHJPRA-ZETCQYMHSA-N 0.000 claims description 5
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 claims description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 3
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 2
- 150000007529 inorganic bases Chemical group 0.000 claims description 2
- 150000007530 organic bases Chemical group 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 239000003513 alkali Substances 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract description 6
- 239000000543 intermediate Substances 0.000 abstract description 3
- 230000001077 hypotensive effect Effects 0.000 abstract description 2
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 50
- 239000000203 mixture Substances 0.000 description 25
- 239000013078 crystal Substances 0.000 description 10
- 238000005917 acylation reaction Methods 0.000 description 9
- 230000010933 acylation Effects 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 125000000217 alkyl group Chemical group 0.000 description 7
- 239000012043 crude product Substances 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 239000012159 carrier gas Substances 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- 150000004682 monohydrates Chemical class 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- -1 trimethylsilyl halide Chemical class 0.000 description 2
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- UUUHXMGGBIUAPW-UHFFFAOYSA-N 1-[1-[2-[[5-amino-2-[[1-[5-(diaminomethylideneamino)-2-[[1-[3-(1h-indol-3-yl)-2-[(5-oxopyrrolidine-2-carbonyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carbon Chemical compound C1CCC(C(=O)N2C(CCC2)C(O)=O)N1C(=O)C(C(C)CC)NC(=O)C(CCC(N)=O)NC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C(CC=1C2=CC=CC=C2NC=1)NC(=O)C1CCC(=O)N1 UUUHXMGGBIUAPW-UHFFFAOYSA-N 0.000 description 1
- ZVDKTPOXSAEUQU-UHFFFAOYSA-N 3-bromo-2-methylpropanoyl chloride Chemical compound BrCC(C)C(Cl)=O ZVDKTPOXSAEUQU-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- KQMSTUBQCCIYNK-FJXQXJEOSA-N Cl.C[Si](C)(C)OC(=O)[C@@H]1CCCN1 Chemical compound Cl.C[Si](C)(C)OC(=O)[C@@H]1CCCN1 KQMSTUBQCCIYNK-FJXQXJEOSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 102000004270 Peptidyl-Dipeptidase A Human genes 0.000 description 1
- 108090000882 Peptidyl-Dipeptidase A Proteins 0.000 description 1
- 238000003436 Schotten-Baumann reaction Methods 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000002019 disulfides Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 230000010534 mechanism of action Effects 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- AAPLIUHOKVUFCC-UHFFFAOYSA-N trimethylsilanol Chemical compound C[Si](C)(C)O AAPLIUHOKVUFCC-UHFFFAOYSA-N 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/16—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Peptides Or Proteins (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU843901A HU196369B (en) | 1984-10-18 | 1984-10-18 | New process for producing n-acylized l-prolin derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD239200A5 true DD239200A5 (de) | 1986-09-17 |
Family
ID=10965983
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD85281836A DD239200A5 (de) | 1984-10-18 | 1985-10-17 | Verfahren zur herstellung von n-acyl-l-prolin-derivaten |
Country Status (16)
| Country | Link |
|---|---|
| AT (1) | AT383345B (enExample) |
| BG (1) | BG45852A3 (enExample) |
| CH (1) | CH666263A5 (enExample) |
| CS (1) | CS250250B2 (enExample) |
| DD (1) | DD239200A5 (enExample) |
| DK (1) | DK477285A (enExample) |
| ES (1) | ES8704151A1 (enExample) |
| FI (1) | FI85264C (enExample) |
| GR (1) | GR852533B (enExample) |
| HU (1) | HU196369B (enExample) |
| NO (1) | NO166786C (enExample) |
| PL (1) | PL145341B1 (enExample) |
| PT (1) | PT81323B (enExample) |
| SE (1) | SE466852B (enExample) |
| SU (1) | SU1470180A3 (enExample) |
| YU (1) | YU44526B (enExample) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU509899B2 (en) * | 1976-02-13 | 1980-05-29 | E.R. Squibb & Sons, Inc. | Proline derivatives and related compounds |
-
1984
- 1984-10-18 HU HU843901A patent/HU196369B/hu unknown
-
1985
- 1985-10-14 CH CH4416/85A patent/CH666263A5/de not_active IP Right Cessation
- 1985-10-16 SE SE8504824A patent/SE466852B/sv not_active IP Right Cessation
- 1985-10-17 YU YU1655/85A patent/YU44526B/xx unknown
- 1985-10-17 AT AT0300585A patent/AT383345B/de not_active IP Right Cessation
- 1985-10-17 FI FI854055A patent/FI85264C/fi not_active IP Right Cessation
- 1985-10-17 PT PT81323A patent/PT81323B/pt not_active IP Right Cessation
- 1985-10-17 PL PL1985255810A patent/PL145341B1/pl unknown
- 1985-10-17 BG BG072072A patent/BG45852A3/xx unknown
- 1985-10-17 ES ES547960A patent/ES8704151A1/es not_active Expired
- 1985-10-17 DD DD85281836A patent/DD239200A5/de not_active IP Right Cessation
- 1985-10-17 NO NO854136A patent/NO166786C/no unknown
- 1985-10-17 DK DK477285A patent/DK477285A/da not_active Application Discontinuation
- 1985-10-17 SU SU853964102A patent/SU1470180A3/ru active
- 1985-10-18 GR GR852533A patent/GR852533B/el unknown
- 1985-10-18 CS CS857466A patent/CS250250B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES547960A0 (es) | 1987-04-01 |
| DK477285D0 (da) | 1985-10-17 |
| FI854055A0 (fi) | 1985-10-17 |
| PL145341B1 (en) | 1988-09-30 |
| NO854136L (no) | 1986-04-21 |
| SE8504824L (sv) | 1986-04-19 |
| NO166786B (no) | 1991-05-27 |
| FI85264C (fi) | 1992-03-25 |
| SU1470180A3 (ru) | 1989-03-30 |
| BG45852A3 (en) | 1989-08-15 |
| DK477285A (da) | 1986-04-19 |
| SE466852B (sv) | 1992-04-13 |
| FI854055L (fi) | 1986-04-19 |
| HU196369B (en) | 1988-11-28 |
| SE8504824D0 (sv) | 1985-10-16 |
| PT81323B (pt) | 1987-10-20 |
| YU44526B (en) | 1990-08-31 |
| HUT38903A (en) | 1986-07-28 |
| PT81323A (en) | 1985-11-01 |
| YU165585A (en) | 1987-12-31 |
| CS250250B2 (en) | 1987-04-16 |
| AT383345B (de) | 1987-06-25 |
| CH666263A5 (de) | 1988-07-15 |
| NO166786C (no) | 1991-09-04 |
| GR852533B (enExample) | 1986-02-19 |
| FI85264B (fi) | 1991-12-13 |
| ES8704151A1 (es) | 1987-04-01 |
| PL255810A1 (en) | 1986-09-23 |
| ATA300585A (de) | 1986-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DD141670A5 (de) | Verfahren zur herstellung von aminosaeurederivaten | |
| DD129442B3 (de) | Verfahren zur herstellung von captopril und vertraeglichen salzen | |
| DE60020753T2 (de) | 4-Nitroxybutylester von Naproxen | |
| AT392781B (de) | Verfahren zur herstellung von (s)-alpha-ethyl-2- oxo-1-pyrrolidinacetamid | |
| EP0151282A1 (de) | Optisch aktive 3,4-Bis(diphenylphosphino)-pyrrolidine, diese als chirale Liganden enthaltende Rhodiumkomplexe und deren Verwendung | |
| EP0206993A1 (de) | Neue Sulfonsäureester | |
| EP0270982A2 (de) | Derivate bicyclischer Aminocarbonsäuren, Verfahren und Zwischenprodukte zu deren Herstellung sowie deren Verwendung | |
| US4708825A (en) | Process for the production of penicillins | |
| DE69410222T2 (de) | Verfahren zur Herstellung von optisch aktiven Erythro-3-amino-1,2-epoxy-Verbindungen | |
| DE4117507A1 (de) | Verfahren zur herstellung von n(pfeil hoch)6(pfeil hoch)-substituierten lysin-derivaten | |
| EP0543343A2 (de) | Verfahren zur Herstellung von alpha-Hydroxy-beta-aminocarbonsäuren | |
| EP0608693A2 (de) | Verfahren zur Herstellung von Folsäure | |
| DD239200A5 (de) | Verfahren zur herstellung von n-acyl-l-prolin-derivaten | |
| US4870207A (en) | Synthesis of arphamenine A | |
| CH619468A5 (enExample) | ||
| CH610330A5 (en) | Process for the preparation of novel ergopeptins | |
| DE60114641T2 (de) | Herstellung von n-geschützten-3-pyrrolidin-lactam substituierten phosphonium salzen | |
| CH673279A5 (enExample) | ||
| DD248584A5 (de) | Verfahren zur herstellung von (3s)-3-amino-2-oxo-4,4-dimethyl-1-azetidinylsulfat und seinen salzen mit basen | |
| DE2747573A1 (de) | 4-(3-amino-3-carboxypropoxy)phenylglyoxylsaeuren und verfahren zu ihrer herstellung | |
| AT395148B (de) | Verfahren zur herstellung von 1-(3-mercapto-(2s)methyl-1-oxo-propyl)-l-prolin | |
| DE60024540T2 (de) | Synthese von alpha-amino-alpha',alpha'-dihaloketonen und verfahren zur herstellung von beta)-aminosäurederivaten durch verwendung derselben | |
| DE4123214A1 (de) | 2-methyl)-3-(rhodanido)-propionsaeure und verfahren zu ihrer herstellung | |
| DE69327092T2 (de) | Optisch aktives 1-phenylpyrrolidonderivat und dessen herstellung | |
| DE2813287A1 (de) | Verfahren zur herstellung von 2-benzoyl- 3,3-dimethyl-7-oxo-alpha-(4-benzyloxyphenyl) -4-thia-2,6-diazabicyclo-eckige klammer auf 3.2.0 eckige klammer zu heptan-6-essigsaeurebenzylester |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ENJ | Ceased due to non-payment of renewal fee |