HU196369B - New process for producing n-acylized l-prolin derivatives - Google Patents
New process for producing n-acylized l-prolin derivatives Download PDFInfo
- Publication number
- HU196369B HU196369B HU843901A HU390184A HU196369B HU 196369 B HU196369 B HU 196369B HU 843901 A HU843901 A HU 843901A HU 390184 A HU390184 A HU 390184A HU 196369 B HU196369 B HU 196369B
- Authority
- HU
- Hungary
- Prior art keywords
- proline
- carboxylic acid
- bromo
- formula
- trimethylsilyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 25
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical class OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 title claims description 22
- 239000011541 reaction mixture Substances 0.000 claims abstract description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 21
- 150000001875 compounds Chemical class 0.000 claims abstract description 14
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims abstract description 11
- 238000002360 preparation method Methods 0.000 claims abstract description 10
- 239000002253 acid Substances 0.000 claims abstract description 8
- 239000011230 binding agent Substances 0.000 claims abstract 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 39
- 229960002429 proline Drugs 0.000 claims description 24
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 12
- 238000005917 acylation reaction Methods 0.000 claims description 11
- 229930182821 L-proline Natural products 0.000 claims description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 9
- 230000010933 acylation Effects 0.000 claims description 9
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 claims description 7
- 239000003960 organic solvent Substances 0.000 claims description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 150000002148 esters Chemical class 0.000 claims description 5
- ZHHOUXSQMHJPRA-ZETCQYMHSA-N trimethylsilyl (2s)-pyrrolidine-2-carboxylate Chemical compound C[Si](C)(C)OC(=O)[C@@H]1CCCN1 ZHHOUXSQMHJPRA-ZETCQYMHSA-N 0.000 claims description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 3
- 125000000174 L-prolyl group Chemical class [H]N1C([H])([H])C([H])([H])C([H])([H])[C@@]1([H])C(*)=O 0.000 claims description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 3
- 239000002516 radical scavenger Substances 0.000 claims description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- 150000007529 inorganic bases Chemical group 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 150000007530 organic bases Chemical group 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- 229930195733 hydrocarbon Natural products 0.000 claims 1
- 150000002430 hydrocarbons Chemical class 0.000 claims 1
- 239000000543 intermediate Substances 0.000 abstract description 3
- 125000005843 halogen group Chemical group 0.000 abstract description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract 1
- 230000001077 hypotensive effect Effects 0.000 abstract 1
- 239000012442 inert solvent Substances 0.000 abstract 1
- -1 VII Chemical class 0.000 description 29
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- LNECWZRZTWAQIB-PKPIPKONSA-N CCC(=O)N1CCC([C@@H]1C)Br Chemical compound CCC(=O)N1CCC([C@@H]1C)Br LNECWZRZTWAQIB-PKPIPKONSA-N 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 125000000217 alkyl group Chemical group 0.000 description 6
- 239000002609 medium Substances 0.000 description 6
- 239000012159 carrier gas Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 238000011081 inoculation Methods 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- SJAYUJDJZUWFDO-ZETCQYMHSA-N (2s)-1-(2-methylprop-2-enoyl)pyrrolidine-2-carboxylic acid Chemical compound CC(=C)C(=O)N1CCC[C@H]1C(O)=O SJAYUJDJZUWFDO-ZETCQYMHSA-N 0.000 description 3
- ZVDKTPOXSAEUQU-UHFFFAOYSA-N 3-bromo-2-methylpropanoyl chloride Chemical compound BrCC(C)C(Cl)=O ZVDKTPOXSAEUQU-UHFFFAOYSA-N 0.000 description 3
- 238000003436 Schotten-Baumann reaction Methods 0.000 description 3
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 3
- 235000012907 honey Nutrition 0.000 description 3
- 230000014759 maintenance of location Effects 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- QEAWNPFOQLJDAY-UHFFFAOYSA-N 1-pyrrolidin-1-ylbutan-1-one Chemical compound CCCC(=O)N1CCCC1 QEAWNPFOQLJDAY-UHFFFAOYSA-N 0.000 description 1
- 102000005862 Angiotensin II Human genes 0.000 description 1
- 101800000734 Angiotensin-1 Proteins 0.000 description 1
- 102400000344 Angiotensin-1 Human genes 0.000 description 1
- 101800000733 Angiotensin-2 Proteins 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- CZGUSIXMZVURDU-JZXHSEFVSA-N Ile(5)-angiotensin II Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C([O-])=O)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=[NH2+])NC(=O)[C@@H]([NH3+])CC([O-])=O)C(C)C)C1=CC=C(O)C=C1 CZGUSIXMZVURDU-JZXHSEFVSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- ORWYRWWVDCYOMK-HBZPZAIKSA-N angiotensin I Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CC(C)C)C(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C1=CC=C(O)C=C1 ORWYRWWVDCYOMK-HBZPZAIKSA-N 0.000 description 1
- 229950006323 angiotensin ii Drugs 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- FAKRSMQSSFJEIM-RQJHMYQMSA-N captopril Chemical compound SC[C@@H](C)C(=O)N1CCC[C@H]1C(O)=O FAKRSMQSSFJEIM-RQJHMYQMSA-N 0.000 description 1
- 229960000830 captopril Drugs 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- VHRYZQNGTZXDNX-UHFFFAOYSA-N methacryloyl chloride Chemical compound CC(=C)C(Cl)=O VHRYZQNGTZXDNX-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 208000006379 syphilis Diseases 0.000 description 1
- XJJBXZIKXFOMLP-ZETCQYMHSA-N tert-butyl (2s)-pyrrolidine-2-carboxylate Chemical compound CC(C)(C)OC(=O)[C@@H]1CCCN1 XJJBXZIKXFOMLP-ZETCQYMHSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- AAPLIUHOKVUFCC-UHFFFAOYSA-N trimethylsilanol Chemical compound C[Si](C)(C)O AAPLIUHOKVUFCC-UHFFFAOYSA-N 0.000 description 1
- SIOVKLKJSOKLIF-HJWRWDBZSA-N trimethylsilyl (1z)-n-trimethylsilylethanimidate Chemical compound C[Si](C)(C)OC(/C)=N\[Si](C)(C)C SIOVKLKJSOKLIF-HJWRWDBZSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/16—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Peptides Or Proteins (AREA)
Priority Applications (16)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU843901A HU196369B (en) | 1984-10-18 | 1984-10-18 | New process for producing n-acylized l-prolin derivatives |
| CH4416/85A CH666263A5 (de) | 1984-10-18 | 1985-10-14 | Verfahren zur herstellung von heterocyclischen verbindungen. |
| SE8504824A SE466852B (sv) | 1984-10-18 | 1985-10-16 | Foerfarande foer framstaellning av n-acyl-l-prolinderivat |
| DK477285A DK477285A (da) | 1984-10-18 | 1985-10-17 | Fremgangsmaade til fremstilling af heterocycliske forbindelser |
| DD85281836A DD239200A5 (de) | 1984-10-18 | 1985-10-17 | Verfahren zur herstellung von n-acyl-l-prolin-derivaten |
| ES547960A ES8704151A1 (es) | 1984-10-18 | 1985-10-17 | Procedimiento para la preparacion de derivados de n-acil-l- prolina |
| BG072072A BG45852A3 (en) | 1984-10-18 | 1985-10-17 | Method for preparing of n- acyl- l- propyline derivatives |
| YU1655/85A YU44526B (en) | 1984-10-18 | 1985-10-17 | Process for producing derivatives of n-acyl-l-proline |
| PL1985255810A PL145341B1 (en) | 1984-10-18 | 1985-10-17 | Method of obtaining derivatives of n-acyl-l-proline |
| AT0300585A AT383345B (de) | 1984-10-18 | 1985-10-17 | Verfahren zur herstellung von n-acyl-l-prolin-derivaten |
| PT81323A PT81323B (pt) | 1984-10-18 | 1985-10-17 | Processo para a preparacao de derivados de n-acil-l-prolina |
| SU853964102A SU1470180A3 (ru) | 1984-10-18 | 1985-10-17 | Способ получени 1-(3-бром/2S/метилпропионил/-пирролидин-(2S)-карбоновой кислоты |
| NO854136A NO166786C (no) | 1984-10-18 | 1985-10-17 | Fremgangsmaate for fremstilling av n-acyl-l-prolinderivater |
| FI854055A FI85264C (fi) | 1984-10-18 | 1985-10-17 | Foerfarande foer framstaellning av n-asyl-l-prolinderivat. |
| CS857466A CS250250B2 (en) | 1984-10-18 | 1985-10-18 | Method of n-acyl-l-proline's derivatives production |
| GR852533A GR852533B (enExample) | 1984-10-18 | 1985-10-18 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU843901A HU196369B (en) | 1984-10-18 | 1984-10-18 | New process for producing n-acylized l-prolin derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT38903A HUT38903A (en) | 1986-07-28 |
| HU196369B true HU196369B (en) | 1988-11-28 |
Family
ID=10965983
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU843901A HU196369B (en) | 1984-10-18 | 1984-10-18 | New process for producing n-acylized l-prolin derivatives |
Country Status (16)
| Country | Link |
|---|---|
| AT (1) | AT383345B (enExample) |
| BG (1) | BG45852A3 (enExample) |
| CH (1) | CH666263A5 (enExample) |
| CS (1) | CS250250B2 (enExample) |
| DD (1) | DD239200A5 (enExample) |
| DK (1) | DK477285A (enExample) |
| ES (1) | ES8704151A1 (enExample) |
| FI (1) | FI85264C (enExample) |
| GR (1) | GR852533B (enExample) |
| HU (1) | HU196369B (enExample) |
| NO (1) | NO166786C (enExample) |
| PL (1) | PL145341B1 (enExample) |
| PT (1) | PT81323B (enExample) |
| SE (1) | SE466852B (enExample) |
| SU (1) | SU1470180A3 (enExample) |
| YU (1) | YU44526B (enExample) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU509899B2 (en) * | 1976-02-13 | 1980-05-29 | E.R. Squibb & Sons, Inc. | Proline derivatives and related compounds |
-
1984
- 1984-10-18 HU HU843901A patent/HU196369B/hu unknown
-
1985
- 1985-10-14 CH CH4416/85A patent/CH666263A5/de not_active IP Right Cessation
- 1985-10-16 SE SE8504824A patent/SE466852B/sv not_active IP Right Cessation
- 1985-10-17 YU YU1655/85A patent/YU44526B/xx unknown
- 1985-10-17 AT AT0300585A patent/AT383345B/de not_active IP Right Cessation
- 1985-10-17 FI FI854055A patent/FI85264C/fi not_active IP Right Cessation
- 1985-10-17 PT PT81323A patent/PT81323B/pt not_active IP Right Cessation
- 1985-10-17 PL PL1985255810A patent/PL145341B1/pl unknown
- 1985-10-17 BG BG072072A patent/BG45852A3/xx unknown
- 1985-10-17 ES ES547960A patent/ES8704151A1/es not_active Expired
- 1985-10-17 DD DD85281836A patent/DD239200A5/de not_active IP Right Cessation
- 1985-10-17 NO NO854136A patent/NO166786C/no unknown
- 1985-10-17 DK DK477285A patent/DK477285A/da not_active Application Discontinuation
- 1985-10-17 SU SU853964102A patent/SU1470180A3/ru active
- 1985-10-18 GR GR852533A patent/GR852533B/el unknown
- 1985-10-18 CS CS857466A patent/CS250250B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES547960A0 (es) | 1987-04-01 |
| DK477285D0 (da) | 1985-10-17 |
| FI854055A0 (fi) | 1985-10-17 |
| PL145341B1 (en) | 1988-09-30 |
| NO854136L (no) | 1986-04-21 |
| SE8504824L (sv) | 1986-04-19 |
| NO166786B (no) | 1991-05-27 |
| DD239200A5 (de) | 1986-09-17 |
| FI85264C (fi) | 1992-03-25 |
| SU1470180A3 (ru) | 1989-03-30 |
| BG45852A3 (en) | 1989-08-15 |
| DK477285A (da) | 1986-04-19 |
| SE466852B (sv) | 1992-04-13 |
| FI854055L (fi) | 1986-04-19 |
| SE8504824D0 (sv) | 1985-10-16 |
| PT81323B (pt) | 1987-10-20 |
| YU44526B (en) | 1990-08-31 |
| HUT38903A (en) | 1986-07-28 |
| PT81323A (en) | 1985-11-01 |
| YU165585A (en) | 1987-12-31 |
| CS250250B2 (en) | 1987-04-16 |
| AT383345B (de) | 1987-06-25 |
| CH666263A5 (de) | 1988-07-15 |
| NO166786C (no) | 1991-09-04 |
| GR852533B (enExample) | 1986-02-19 |
| FI85264B (fi) | 1991-12-13 |
| ES8704151A1 (es) | 1987-04-01 |
| PL255810A1 (en) | 1986-09-23 |
| ATA300585A (de) | 1986-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6059226B2 (ja) | プロリン誘導体および関連化合物 | |
| HU190541B (en) | Process for preparing disubstituted proline derivatives | |
| CN107474107A (zh) | Glyx‑13的制备方法及用于制备glyx‑13的化合物 | |
| US6197998B1 (en) | Process for producing N-glycyltyrosine and its crystal structure | |
| EP0018546B1 (en) | Process for the production of phenylglycyl chloride hydrochlorides | |
| JPH0432063B2 (enExample) | ||
| EP2473492B1 (en) | Process for the preparation of (1s,4r)-2-oxa-3-azabicyclo[2,2.1]hept-5-enes | |
| HU196369B (en) | New process for producing n-acylized l-prolin derivatives | |
| US4014915A (en) | Oxime carbonates | |
| JP3207017B2 (ja) | ベンジルコハク酸誘導体の製造方法およびその製造中間体 | |
| US4022766A (en) | Pharmacologically active pyrrolodiazepines | |
| HU176871B (en) | Process for producing 2-amino-oktahydro-oxasolo-square bracket-3,2-a-square bracket closed-pyrrolo-square bracket-2,1-c-square bracket closed-pyrasine derivatives | |
| GB2363605A (en) | Process for the preparation of alpha-aminoketone derivatives | |
| HU231050B1 (hu) | Eljárás gyógyszerhatóanyag előállítására | |
| WO1998032736A1 (en) | Process for producing benzylsuccinic acid derivatives | |
| HU211101B (en) | Process for preparing 1-[/2s/-methyl-3-mercapto-propionyl]-pyrrolidine-/2s/-carboxylic acid | |
| USRE30752E (en) | Oxime carbonates | |
| JP4202269B2 (ja) | trans−4−アミノシクロヘキサンカルボン酸類の製法 | |
| US4477677A (en) | Process for the preparation of 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-3-indoleacetoxyacetic acid | |
| HU208954B (en) | Process for producing 1-(3-mercapto-(2s)-methyl-1-oxo-propyl)-l-prolyn | |
| HU196368B (en) | Process for production of 1-/3-brom-/25/-methil-prophionil/-pirrolidin-/25/-carbonic acid | |
| KR820001832B1 (ko) | 할로겐 치환 메르캅토아실아미노산류의 제조방법 | |
| PL79142B1 (en) | Novel cephalosporin derivatives, and processes for their preparation [gb1271013a] | |
| JP2898029B2 (ja) | セフェム誘導体ジメチルホルムアミド溶媒和結晶 | |
| JPS63239282A (ja) | 新規ピペラジン誘導体 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 |