DD204251A5 - Verfahren zur herstellung von aminosulfenylchloridderivaten - Google Patents
Verfahren zur herstellung von aminosulfenylchloridderivaten Download PDFInfo
- Publication number
- DD204251A5 DD204251A5 DD82238568A DD23856882A DD204251A5 DD 204251 A5 DD204251 A5 DD 204251A5 DD 82238568 A DD82238568 A DD 82238568A DD 23856882 A DD23856882 A DD 23856882A DD 204251 A5 DD204251 A5 DD 204251A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- carbon atoms
- formula
- reaction
- group
- ppm
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims abstract description 30
- 238000000034 method Methods 0.000 title claims description 28
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 title description 12
- 238000006243 chemical reaction Methods 0.000 claims description 63
- 125000004432 carbon atom Chemical group C* 0.000 claims description 34
- -1 amine compound Chemical class 0.000 claims description 29
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 150000007514 bases Chemical class 0.000 claims description 19
- PXJJSXABGXMUSU-UHFFFAOYSA-N disulfur dichloride Chemical compound ClSSCl PXJJSXABGXMUSU-UHFFFAOYSA-N 0.000 claims description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 18
- 239000002904 solvent Substances 0.000 claims description 14
- 125000003545 alkoxy group Chemical group 0.000 claims description 11
- 125000005843 halogen group Chemical group 0.000 claims description 8
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 claims description 8
- ZBVZOMFYISPWMD-UHFFFAOYSA-N amino thiohypochlorite Chemical class NSCl ZBVZOMFYISPWMD-UHFFFAOYSA-N 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- 239000012320 chlorinating reagent Substances 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 238000005660 chlorination reaction Methods 0.000 claims description 4
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 3
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims 2
- 230000000749 insecticidal effect Effects 0.000 abstract description 8
- AKZWRTCWNXHHFR-PDIZUQLASA-N [(3S)-oxolan-3-yl] N-[(2S,3S)-4-[(5S)-5-benzyl-3-[(2R)-2-carbamoyloxy-2,3-dihydro-1H-inden-1-yl]-4-oxo-3H-pyrrol-5-yl]-3-hydroxy-1-phenylbutan-2-yl]carbamate Chemical compound NC(=O)O[C@@H]1Cc2ccccc2C1C1C=N[C@](C[C@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCOC2)(Cc2ccccc2)C1=O AKZWRTCWNXHHFR-PDIZUQLASA-N 0.000 abstract description 3
- 239000000543 intermediate Substances 0.000 abstract description 3
- 230000001069 nematicidal effect Effects 0.000 abstract description 3
- 230000002297 mitogenic effect Effects 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 description 38
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 36
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- 238000005481 NMR spectroscopy Methods 0.000 description 24
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 22
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 19
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- 241000238631 Hexapoda Species 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 238000000921 elemental analysis Methods 0.000 description 7
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 6
- 238000010898 silica gel chromatography Methods 0.000 description 6
- YOSCIBHNIINXGQ-UHFFFAOYSA-N (2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate Chemical compound CNC(=O)OC1=CC=CC2=C1OC(C)(C)C2.CNC(=O)OC1=CC=CC2=C1OC(C)(C)C2 YOSCIBHNIINXGQ-UHFFFAOYSA-N 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 239000012535 impurity Substances 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 239000012452 mother liquor Substances 0.000 description 5
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 239000002917 insecticide Substances 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 231100000419 toxicity Toxicity 0.000 description 4
- 230000001988 toxicity Effects 0.000 description 4
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 3
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 3
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 3
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 3
- 241000238876 Acari Species 0.000 description 3
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 3
- DUEPRVBVGDRKAG-UHFFFAOYSA-N carbofuran Chemical compound CNC(=O)OC1=CC=CC2=C1OC(C)(C)C2 DUEPRVBVGDRKAG-UHFFFAOYSA-N 0.000 description 3
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 3
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 125000004494 ethyl ester group Chemical group 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 150000008282 halocarbons Chemical class 0.000 description 3
- 150000003222 pyridines Chemical class 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 3
- 150000003512 tertiary amines Chemical class 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 3
- PNCLCMCDRWQJSM-UHFFFAOYSA-N 2-[carboxymethyl(cyclohexyl)amino]acetic acid Chemical compound OC(=O)CN(CC(O)=O)C1CCCCC1 PNCLCMCDRWQJSM-UHFFFAOYSA-N 0.000 description 2
- QHHFAXFIUXRVSI-UHFFFAOYSA-N 2-[carboxymethyl(ethyl)amino]acetic acid Chemical compound OC(=O)CN(CC)CC(O)=O QHHFAXFIUXRVSI-UHFFFAOYSA-N 0.000 description 2
- XWSGEVNYFYKXCP-UHFFFAOYSA-N 2-[carboxymethyl(methyl)amino]acetic acid Chemical compound OC(=O)CN(C)CC(O)=O XWSGEVNYFYKXCP-UHFFFAOYSA-N 0.000 description 2
- IWJJXDLQNGBAOG-UHFFFAOYSA-N 2-[carboxymethyl(propan-2-yl)amino]acetic acid Chemical compound OC(=O)CN(C(C)C)CC(O)=O IWJJXDLQNGBAOG-UHFFFAOYSA-N 0.000 description 2
- 241000251468 Actinopterygii Species 0.000 description 2
- 102100024479 Cell division cycle-associated protein 3 Human genes 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- 101000980907 Homo sapiens Cell division cycle-associated protein 3 Proteins 0.000 description 2
- 241000244206 Nematoda Species 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- VFTCEPBUNAKJHC-UHFFFAOYSA-N [acetyloxy(ethyl)amino] acetate Chemical compound CC(=O)ON(CC)OC(C)=O VFTCEPBUNAKJHC-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 2
- 239000012156 elution solvent Substances 0.000 description 2
- OZCPYLRDULGVFK-UHFFFAOYSA-N ethyl 2-[chlorosulfanyl-(2-ethoxy-2-oxoethyl)amino]acetate Chemical compound CCOC(=O)CN(SCl)CC(=O)OCC OZCPYLRDULGVFK-UHFFFAOYSA-N 0.000 description 2
- AMBDTBHJFINMSE-UHFFFAOYSA-N ethyl 2-acetamidoacetate Chemical compound CCOC(=O)CNC(C)=O AMBDTBHJFINMSE-UHFFFAOYSA-N 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- VXGABWCSZZWXPC-UHFFFAOYSA-N methyl 2-(methylamino)acetate Chemical compound CNCC(=O)OC VXGABWCSZZWXPC-UHFFFAOYSA-N 0.000 description 2
- XTFWRKOFYMGGRB-UHFFFAOYSA-N methyl 2-[chlorosulfanyl-(2-methoxy-2-oxoethyl)amino]acetate Chemical compound COC(=O)CN(SCl)CC(=O)OC XTFWRKOFYMGGRB-UHFFFAOYSA-N 0.000 description 2
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical compound COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- UQWKIKPVXHDOEI-UHFFFAOYSA-N (2,2-dimethyl-3h-1-benzofuran-7-yl) n-[2-cyanoethyl(propan-2-yl)amino]sulfanyl-n-methylcarbamate Chemical compound N#CCCN(C(C)C)SN(C)C(=O)OC1=CC=CC2=C1OC(C)(C)C2 UQWKIKPVXHDOEI-UHFFFAOYSA-N 0.000 description 1
- RDJUHLUBPADHNP-UHFFFAOYSA-N 1,2,3,5-tetrahydroxybenzene Chemical compound OC1=CC(O)=C(O)C(O)=C1 RDJUHLUBPADHNP-UHFFFAOYSA-N 0.000 description 1
- OJUIRUMDLUMSTN-UHFFFAOYSA-N 2-(benzylamino)acetonitrile;hydrochloride Chemical compound Cl.N#CCNCC1=CC=CC=C1 OJUIRUMDLUMSTN-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- VXAOLDZFARINGE-UHFFFAOYSA-N 2-(ethylamino)acetonitrile Chemical compound CCNCC#N VXAOLDZFARINGE-UHFFFAOYSA-N 0.000 description 1
- PVVRRUUMHFWFQV-UHFFFAOYSA-N 2-(methylamino)acetonitrile Chemical compound CNCC#N PVVRRUUMHFWFQV-UHFFFAOYSA-N 0.000 description 1
- QHRHSDCXMKAXDH-UHFFFAOYSA-N 2-(pentylamino)propanoic acid Chemical compound CCCCCNC(C)C(O)=O QHRHSDCXMKAXDH-UHFFFAOYSA-N 0.000 description 1
- AEUCLXJGFMJQMP-UHFFFAOYSA-N 2-[(4-chlorophenyl)methylamino]acetic acid Chemical compound OC(=O)CNCC1=CC=C(Cl)C=C1 AEUCLXJGFMJQMP-UHFFFAOYSA-N 0.000 description 1
- LZBYHWQHNZFDSR-UHFFFAOYSA-N 2-[(4-methylphenyl)methylazaniumyl]acetate Chemical compound CC1=CC=C(CNCC(O)=O)C=C1 LZBYHWQHNZFDSR-UHFFFAOYSA-N 0.000 description 1
- WWVBXWRCQNSAKA-UHFFFAOYSA-N 2-[butyl(carboxymethyl)amino]acetic acid Chemical compound CCCCN(CC(O)=O)CC(O)=O WWVBXWRCQNSAKA-UHFFFAOYSA-N 0.000 description 1
- CRKTWRPVUYIFQS-UHFFFAOYSA-N 2-[carboxymethyl(cyclopentyl)amino]acetic acid Chemical compound OC(=O)CN(CC(O)=O)C1CCCC1 CRKTWRPVUYIFQS-UHFFFAOYSA-N 0.000 description 1
- BINXNLXZUPMXKZ-UHFFFAOYSA-N 2-[carboxymethyl(cyclopropyl)amino]acetic acid Chemical compound OC(=O)CN(CC(O)=O)C1CC1 BINXNLXZUPMXKZ-UHFFFAOYSA-N 0.000 description 1
- SGKUSVMVHGBAGR-UHFFFAOYSA-N 2-[carboxymethyl(hexyl)amino]acetic acid Chemical compound CCCCCCN(CC(O)=O)CC(O)=O SGKUSVMVHGBAGR-UHFFFAOYSA-N 0.000 description 1
- QHJRLGUSMFAKLD-UHFFFAOYSA-N 2-[carboxymethyl(pentyl)amino]acetic acid Chemical compound CCCCCN(CC(O)=O)CC(O)=O QHJRLGUSMFAKLD-UHFFFAOYSA-N 0.000 description 1
- BGCRFGMFNUMUQY-UHFFFAOYSA-N 2-methyl-2-(propan-2-ylamino)butanoic acid Chemical compound CCC(C)(C(O)=O)NC(C)C BGCRFGMFNUMUQY-UHFFFAOYSA-N 0.000 description 1
- GDBDUWIKWPUZQJ-UHFFFAOYSA-N 2-methyl-2-(propan-2-ylamino)hexanoic acid Chemical compound CCCCC(C)(C(=O)O)NC(C)C GDBDUWIKWPUZQJ-UHFFFAOYSA-N 0.000 description 1
- HTBUUCYXKDEKCT-UHFFFAOYSA-N 2-methyl-2-(propylamino)butanoic acid Chemical compound CCCNC(C)(CC)C(O)=O HTBUUCYXKDEKCT-UHFFFAOYSA-N 0.000 description 1
- SBAJRGRUGUQKAF-UHFFFAOYSA-N 3-(2-cyanoethylamino)propanenitrile Chemical compound N#CCCNCCC#N SBAJRGRUGUQKAF-UHFFFAOYSA-N 0.000 description 1
- ZIUZDRMIXJKUNY-UHFFFAOYSA-N 3-[2-carboxyethyl(ethyl)amino]propanoic acid Chemical compound OC(=O)CCN(CC)CCC(O)=O ZIUZDRMIXJKUNY-UHFFFAOYSA-N 0.000 description 1
- CKEIQUPFORBNCK-UHFFFAOYSA-N 4-(3-cyanopropylamino)butanenitrile Chemical compound N#CCCCNCCCC#N CKEIQUPFORBNCK-UHFFFAOYSA-N 0.000 description 1
- SEXSQXSZCUQVBD-UHFFFAOYSA-N 4-ethyl-2-methyl-2-(propan-2-ylamino)octanoic acid Chemical compound CCCCC(CC)CC(C)(C(=O)O)NC(C)C SEXSQXSZCUQVBD-UHFFFAOYSA-N 0.000 description 1
- 101100178313 Aedes aegypti HP-I gene Proteins 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 241000254173 Coleoptera Species 0.000 description 1
- 241000255925 Diptera Species 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 241001149911 Isopoda Species 0.000 description 1
- 241000255777 Lepidoptera Species 0.000 description 1
- 241000238814 Orthoptera Species 0.000 description 1
- 235000010678 Paulownia tomentosa Nutrition 0.000 description 1
- 240000002834 Paulownia tomentosa Species 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 241001414989 Thysanoptera Species 0.000 description 1
- 241000243782 Tylenchida Species 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- HVNPFQOMBNYVMB-UHFFFAOYSA-N butyl 2-(methylamino)acetate Chemical compound CCCCOC(=O)CNC HVNPFQOMBNYVMB-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- YXAAPRUUUWQFGV-UHFFFAOYSA-N cyclohexyl 2-[chlorosulfanyl-(2-cyclohexyloxy-2-oxoethyl)amino]acetate Chemical compound C1CCCCC1OC(=O)CN(SCl)CC(=O)OC1CCCCC1 YXAAPRUUUWQFGV-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- SBPUJTNHAUBDKF-UHFFFAOYSA-N ethyl 2-(2-cyanoethylamino)acetate Chemical compound CCOC(=O)CNCCC#N SBPUJTNHAUBDKF-UHFFFAOYSA-N 0.000 description 1
- QJERSMYDZNFZDK-UHFFFAOYSA-N ethyl 2-(2-cyanoethylamino)propanoate Chemical compound CCOC(=O)C(C)NCCC#N QJERSMYDZNFZDK-UHFFFAOYSA-N 0.000 description 1
- XJBLZCHTARFLLD-UHFFFAOYSA-N ethyl 2-(2-methylpropylamino)acetate Chemical compound CCOC(=O)CNCC(C)C XJBLZCHTARFLLD-UHFFFAOYSA-N 0.000 description 1
- IOTCSUALDHPOTF-UHFFFAOYSA-N ethyl 2-(2-methylpropylamino)propanoate Chemical compound CCOC(=O)C(C)NCC(C)C IOTCSUALDHPOTF-UHFFFAOYSA-N 0.000 description 1
- JZCIUMVCWIEEQX-UHFFFAOYSA-N ethyl 2-(3-methylanilino)acetate Chemical compound CCOC(=O)CNC1=CC=CC(C)=C1 JZCIUMVCWIEEQX-UHFFFAOYSA-N 0.000 description 1
- TZJRPKDPYLAMJZ-UHFFFAOYSA-N ethyl 2-(4-methoxyanilino)acetate Chemical compound CCOC(=O)CNC1=CC=C(OC)C=C1 TZJRPKDPYLAMJZ-UHFFFAOYSA-N 0.000 description 1
- KTRUZIMBKAONKB-UHFFFAOYSA-N ethyl 2-(butan-2-ylamino)acetate Chemical compound CCOC(=O)CNC(C)CC KTRUZIMBKAONKB-UHFFFAOYSA-N 0.000 description 1
- HRFATYXNXXEKNO-UHFFFAOYSA-N ethyl 2-(butan-2-ylamino)propanoate Chemical compound CCOC(=O)C(C)NC(C)CC HRFATYXNXXEKNO-UHFFFAOYSA-N 0.000 description 1
- YZPXDEXTKPFTGC-UHFFFAOYSA-N ethyl 2-(butylamino)propanoate Chemical compound CCCCNC(C)C(=O)OCC YZPXDEXTKPFTGC-UHFFFAOYSA-N 0.000 description 1
- HJHAOMCORINKOB-UHFFFAOYSA-N ethyl 2-(cyanomethylamino)acetate Chemical compound CCOC(=O)CNCC#N HJHAOMCORINKOB-UHFFFAOYSA-N 0.000 description 1
- DITDYMTYUDGGGF-UHFFFAOYSA-N ethyl 2-(cyanomethylamino)propanoate Chemical compound CCOC(=O)C(C)NCC#N DITDYMTYUDGGGF-UHFFFAOYSA-N 0.000 description 1
- NHRFJPKXIYYFMX-UHFFFAOYSA-N ethyl 2-(cyclohexylamino)acetate Chemical compound CCOC(=O)CNC1CCCCC1 NHRFJPKXIYYFMX-UHFFFAOYSA-N 0.000 description 1
- UPPDUARXWJEKFZ-UHFFFAOYSA-N ethyl 2-(cyclohexylamino)propanoate Chemical compound CCOC(=O)C(C)NC1CCCCC1 UPPDUARXWJEKFZ-UHFFFAOYSA-N 0.000 description 1
- ORKAHUKYJCNDDI-UHFFFAOYSA-N ethyl 2-(ethoxycarbonylamino)acetate Chemical compound CCOC(=O)CNC(=O)OCC ORKAHUKYJCNDDI-UHFFFAOYSA-N 0.000 description 1
- OMECLFTURFUIIJ-UHFFFAOYSA-N ethyl 2-(ethoxycarbonylamino)propanoate Chemical compound CCOC(=O)NC(C)C(=O)OCC OMECLFTURFUIIJ-UHFFFAOYSA-N 0.000 description 1
- NRMPJIHWGVBZBB-UHFFFAOYSA-N ethyl 2-(ethylamino)acetate Chemical compound CCNCC(=O)OCC NRMPJIHWGVBZBB-UHFFFAOYSA-N 0.000 description 1
- LCMDFUNTIZKNJK-UHFFFAOYSA-N ethyl 2-(hexylamino)propanoate Chemical compound CCCCCCNC(C)C(=O)OCC LCMDFUNTIZKNJK-UHFFFAOYSA-N 0.000 description 1
- LNYUJLIYAHJNNO-UHFFFAOYSA-N ethyl 2-(methoxycarbonylamino)acetate Chemical compound CCOC(=O)CNC(=O)OC LNYUJLIYAHJNNO-UHFFFAOYSA-N 0.000 description 1
- BTKSUULMJNNXHG-UHFFFAOYSA-N ethyl 2-(methylamino)acetate Chemical compound CCOC(=O)CNC BTKSUULMJNNXHG-UHFFFAOYSA-N 0.000 description 1
- KHRLPZJTPHCMSQ-UHFFFAOYSA-N ethyl 2-(methylamino)propanoate Chemical compound CCOC(=O)C(C)NC KHRLPZJTPHCMSQ-UHFFFAOYSA-N 0.000 description 1
- CWPWNWCAOJRJJT-UHFFFAOYSA-N ethyl 2-(phenoxycarbonylamino)acetate Chemical compound CCOC(=O)CNC(=O)OC1=CC=CC=C1 CWPWNWCAOJRJJT-UHFFFAOYSA-N 0.000 description 1
- ROGQHXXFNVNMSC-UHFFFAOYSA-N ethyl 2-(propan-2-ylamino)acetate Chemical compound CCOC(=O)CNC(C)C ROGQHXXFNVNMSC-UHFFFAOYSA-N 0.000 description 1
- JBIONIMUHCHUOW-UHFFFAOYSA-N ethyl 2-(propan-2-ylamino)propanoate Chemical compound CCOC(=O)C(C)NC(C)C JBIONIMUHCHUOW-UHFFFAOYSA-N 0.000 description 1
- XKFRTCBBCLBPOA-UHFFFAOYSA-N ethyl 2-(propanoylamino)acetate Chemical compound CCOC(=O)CNC(=O)CC XKFRTCBBCLBPOA-UHFFFAOYSA-N 0.000 description 1
- GSHWWBSVIZYONT-UHFFFAOYSA-N ethyl 2-[(2-chloroacetyl)amino]acetate Chemical compound CCOC(=O)CNC(=O)CCl GSHWWBSVIZYONT-UHFFFAOYSA-N 0.000 description 1
- IIBDNCRATXAUMF-UHFFFAOYSA-N ethyl 2-[(2-ethoxy-2-oxoethyl)amino]propanoate Chemical compound CCOC(=O)CNC(C)C(=O)OCC IIBDNCRATXAUMF-UHFFFAOYSA-N 0.000 description 1
- XYVZUPHHGNHQHN-UHFFFAOYSA-N ethyl 2-[(4-chlorobenzoyl)amino]acetate Chemical compound CCOC(=O)CNC(=O)C1=CC=C(Cl)C=C1 XYVZUPHHGNHQHN-UHFFFAOYSA-N 0.000 description 1
- WZLAJHNLDCWPGH-UHFFFAOYSA-N ethyl 2-[(4-methylphenyl)sulfonylamino]acetate Chemical compound CCOC(=O)CNS(=O)(=O)C1=CC=C(C)C=C1 WZLAJHNLDCWPGH-UHFFFAOYSA-N 0.000 description 1
- CXDAFOJQFCKBLP-UHFFFAOYSA-N ethyl 2-[acetyl(chlorosulfanyl)amino]acetate Chemical compound CCOC(=O)CN(SCl)C(C)=O CXDAFOJQFCKBLP-UHFFFAOYSA-N 0.000 description 1
- XRIZQNOCVIQTRX-UHFFFAOYSA-N ethyl 2-[chlorosulfanyl(ethoxycarbonyl)amino]acetate Chemical compound CCOC(=O)CN(SCl)C(=O)OCC XRIZQNOCVIQTRX-UHFFFAOYSA-N 0.000 description 1
- MLSGRWDEDYJNER-UHFFFAOYSA-N ethyl 2-anilinoacetate Chemical compound CCOC(=O)CNC1=CC=CC=C1 MLSGRWDEDYJNER-UHFFFAOYSA-N 0.000 description 1
- PTXRQIPIELXJFH-UHFFFAOYSA-N ethyl 2-benzamidoacetate Chemical compound CCOC(=O)CNC(=O)C1=CC=CC=C1 PTXRQIPIELXJFH-UHFFFAOYSA-N 0.000 description 1
- FTKLDWGDFWLILC-UHFFFAOYSA-N ethyl 3-[butyl(chlorosulfanyl)amino]propanoate Chemical compound CCCCN(SCl)CCC(=O)OCC FTKLDWGDFWLILC-UHFFFAOYSA-N 0.000 description 1
- QQFIULJNMVXXQZ-UHFFFAOYSA-N ethyl 3-[chlorosulfanyl(propan-2-yl)amino]propanoate Chemical compound CCOC(=O)CCN(SCl)C(C)C QQFIULJNMVXXQZ-UHFFFAOYSA-N 0.000 description 1
- LXRRVDLNCROODH-UHFFFAOYSA-N ethyl n-(2-cyanoethyl)carbamate Chemical compound CCOC(=O)NCCC#N LXRRVDLNCROODH-UHFFFAOYSA-N 0.000 description 1
- AHGQESFVDCNOGJ-UHFFFAOYSA-N ethyl n-(cyanomethyl)carbamate Chemical compound CCOC(=O)NCC#N AHGQESFVDCNOGJ-UHFFFAOYSA-N 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000002316 fumigant Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 231100000086 high toxicity Toxicity 0.000 description 1
- BSRDNMMLQYNQQD-UHFFFAOYSA-N iminodiacetonitrile Chemical compound N#CCNCC#N BSRDNMMLQYNQQD-UHFFFAOYSA-N 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- JHESHOHUMIZHMB-UHFFFAOYSA-N methyl 2-(ethoxycarbonylamino)acetate Chemical compound CCOC(=O)NCC(=O)OC JHESHOHUMIZHMB-UHFFFAOYSA-N 0.000 description 1
- IQAVEDGXJROTIJ-UHFFFAOYSA-N methyl 2-iminopropanoate Chemical compound COC(=O)C(C)=N IQAVEDGXJROTIJ-UHFFFAOYSA-N 0.000 description 1
- DRMGMMWXWKLKAI-UHFFFAOYSA-N methyl n-(cyanomethyl)carbamate Chemical compound COC(=O)NCC#N DRMGMMWXWKLKAI-UHFFFAOYSA-N 0.000 description 1
- 239000003094 microcapsule Substances 0.000 description 1
- 230000003129 miticidal effect Effects 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 231100000956 nontoxicity Toxicity 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- RSNAEYGESKXYLJ-UHFFFAOYSA-N propan-2-yl 2-[chlorosulfanyl-(2-oxo-2-propan-2-yloxyethyl)amino]acetate Chemical compound CC(C)OC(=O)CN(SCl)CC(=O)OC(C)C RSNAEYGESKXYLJ-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- QAHVHSLSRLSVGS-UHFFFAOYSA-N sulfamoyl chloride Chemical compound NS(Cl)(=O)=O QAHVHSLSRLSVGS-UHFFFAOYSA-N 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C313/00—Sulfinic acids; Sulfenic acids; Halides, esters or anhydrides thereof; Amides of sulfinic or sulfenic acids, i.e. compounds having singly-bound oxygen atoms of sulfinic or sulfenic groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C313/08—Sulfenic acids; Derivatives thereof
- C07C313/18—Sulfenamides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C381/00—Compounds containing carbon and sulfur and having functional groups not covered by groups C07C301/00 - C07C337/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/86—Benzo [b] furans; Hydrogenated benzo [b] furans with an oxygen atom directly attached in position 7
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Saccharide Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP56047785A JPS57163360A (en) | 1981-03-30 | 1981-03-30 | Bis(alkoxycarbonylmethyl)aminosulphenyl chloride derivative and its preparation |
| JP7852981A JPS57193472A (en) | 1981-05-22 | 1981-05-22 | Preparation of carbamate compound |
| JP17792981A JPS5877860A (ja) | 1981-11-05 | 1981-11-05 | アミノスルフエニルクロリド誘導体及びその製造法 |
| JP17792881A JPS5877878A (ja) | 1981-11-05 | 1981-11-05 | カ−バメイト化合物の製造法 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD204251A5 true DD204251A5 (de) | 1983-11-23 |
Family
ID=27462100
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD82246179A DD208803A5 (de) | 1981-03-30 | 1982-03-30 | Verfahren zur herstellung eines 2,3-dihydro-2,2-dimethylbenzofuran-7-yl-n-(n,n-disubstituierten aminosulfenyl)-n-methyl-carbamats |
| DD82238568A DD204251A5 (de) | 1981-03-30 | 1982-03-30 | Verfahren zur herstellung von aminosulfenylchloridderivaten |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD82246179A DD208803A5 (de) | 1981-03-30 | 1982-03-30 | Verfahren zur herstellung eines 2,3-dihydro-2,2-dimethylbenzofuran-7-yl-n-(n,n-disubstituierten aminosulfenyl)-n-methyl-carbamats |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4421693A (enExample) |
| KR (1) | KR880002299B1 (enExample) |
| AR (1) | AR230833A1 (enExample) |
| AU (1) | AU545481B2 (enExample) |
| CA (1) | CA1188706A (enExample) |
| CH (1) | CH653016A5 (enExample) |
| DD (2) | DD208803A5 (enExample) |
| DE (1) | DE3211087C2 (enExample) |
| ES (2) | ES8308539A1 (enExample) |
| FR (1) | FR2502616B1 (enExample) |
| GB (1) | GB2096994B (enExample) |
| GR (1) | GR75920B (enExample) |
| IL (1) | IL65384A (enExample) |
| IN (1) | IN156106B (enExample) |
| IT (1) | IT1147830B (enExample) |
| MA (1) | MA19424A1 (enExample) |
| MX (1) | MX160562A (enExample) |
| NL (1) | NL8201290A (enExample) |
| NZ (1) | NZ200163A (enExample) |
| SE (1) | SE456578B (enExample) |
| TR (1) | TR21303A (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5988461A (ja) * | 1982-11-11 | 1984-05-22 | Otsuka Chem Co Ltd | カ−バメイト系殺虫剤 |
| US4587353A (en) * | 1983-08-23 | 1986-05-06 | Ciba-Geigy Corporation | Process for producing N-chlorosulfenyl compounds |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2649470A (en) * | 1951-10-10 | 1953-08-18 | Monsanto Chemicals | Cyanoalkyl substituted amine sulfides |
| US2766236A (en) * | 1954-02-25 | 1956-10-09 | Monsanto Chemicals | Preparing n-thioamines |
| US3843689A (en) * | 1970-11-09 | 1974-10-22 | Chevron Res | N-chlorothio carbamates |
-
1982
- 1982-03-24 CA CA000399286A patent/CA1188706A/en not_active Expired
- 1982-03-25 DE DE3211087A patent/DE3211087C2/de not_active Expired - Fee Related
- 1982-03-25 US US06/361,931 patent/US4421693A/en not_active Expired - Lifetime
- 1982-03-26 AR AR288882A patent/AR230833A1/es active
- 1982-03-27 ES ES510885A patent/ES8308539A1/es not_active Expired
- 1982-03-29 GR GR67741A patent/GR75920B/el unknown
- 1982-03-29 IT IT48109/82A patent/IT1147830B/it active
- 1982-03-29 SE SE8202001A patent/SE456578B/sv not_active IP Right Cessation
- 1982-03-29 GB GB8209194A patent/GB2096994B/en not_active Expired
- 1982-03-29 NZ NZ200163A patent/NZ200163A/en unknown
- 1982-03-29 NL NL8201290A patent/NL8201290A/nl not_active Application Discontinuation
- 1982-03-29 MX MX192032A patent/MX160562A/es unknown
- 1982-03-29 CH CH1915/82A patent/CH653016A5/fr not_active IP Right Cessation
- 1982-03-30 KR KR8201384A patent/KR880002299B1/ko not_active Expired
- 1982-03-30 IN IN354/CAL/82A patent/IN156106B/en unknown
- 1982-03-30 AU AU82143/82A patent/AU545481B2/en not_active Ceased
- 1982-03-30 TR TR21303A patent/TR21303A/xx unknown
- 1982-03-30 MA MA19629A patent/MA19424A1/fr unknown
- 1982-03-30 IL IL65384A patent/IL65384A/xx not_active IP Right Cessation
- 1982-03-30 FR FR8205475A patent/FR2502616B1/fr not_active Expired
- 1982-03-30 DD DD82246179A patent/DD208803A5/de not_active IP Right Cessation
- 1982-03-30 DD DD82238568A patent/DD204251A5/de not_active IP Right Cessation
-
1983
- 1983-03-31 ES ES521601A patent/ES521601A0/es active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| FR2502616B1 (fr) | 1986-09-05 |
| IT8248109A0 (it) | 1982-03-29 |
| ES8405781A1 (es) | 1984-07-01 |
| FR2502616A1 (fr) | 1982-10-01 |
| ES521601A0 (es) | 1984-07-01 |
| NZ200163A (en) | 1985-08-16 |
| AU8214382A (en) | 1982-10-07 |
| US4421693A (en) | 1983-12-20 |
| KR880002299B1 (ko) | 1988-10-22 |
| SE8202001L (sv) | 1982-11-09 |
| CH653016A5 (fr) | 1985-12-13 |
| NL8201290A (nl) | 1982-10-18 |
| GR75920B (enExample) | 1984-08-02 |
| AR230833A1 (es) | 1984-07-31 |
| CA1188706A (en) | 1985-06-11 |
| IL65384A (en) | 1985-10-31 |
| MA19424A1 (fr) | 1982-10-01 |
| SE456578B (sv) | 1988-10-17 |
| ES510885A0 (es) | 1983-10-01 |
| KR830009018A (ko) | 1983-12-17 |
| AU545481B2 (en) | 1985-07-18 |
| GB2096994B (en) | 1985-04-24 |
| MX160562A (es) | 1990-03-23 |
| IL65384A0 (en) | 1982-05-31 |
| DE3211087A1 (de) | 1982-11-18 |
| ES8308539A1 (es) | 1983-10-01 |
| DD208803A5 (de) | 1984-04-11 |
| IT1147830B (it) | 1986-11-26 |
| GB2096994A (en) | 1982-10-27 |
| DE3211087C2 (de) | 1994-09-08 |
| TR21303A (tr) | 1984-03-22 |
| IN156106B (enExample) | 1985-05-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2219710C2 (de) | Fungizide Mittel | |
| DE2433680A1 (de) | 2,3-dihydro-2,2-dimethyl-7-benzofuranylmethylcarbamat-n-aminosulfenyl-derivate, verfahren zu deren herstellung und diese verbindungen enthaltende insektizide zusammensetzungen | |
| DE3628082A1 (de) | Carboxamide, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von schaedlingen | |
| DE2812622C2 (de) | (2,3-Dihydro-2,2-dimethyl-benzofuran-7-yl-oxy-N-methyl-carbamoyl)-(N'-alkyl-carbamoyl)-sulfide, Verfahren zu deren Herstellung und diese Verbindungen enthaltende insektizide Mittel | |
| DE2843291A1 (de) | Phenylisothiocyanate und deren salze, verfahren zu ihrer herstellung und ihre verwendung als fungizide | |
| DD149890A5 (de) | Schimmelbekaempfungsmittel und-verfahren | |
| DE2743633A1 (de) | Neue bicarbamoylsulfide, ihre herstellung und die sie enthaltenden mittel | |
| DE1667979A1 (de) | Schaedlingsbekaempfungsmittel,die bestimmte Benzodioxole enthalten,sowie Verfahren zu deren Herstellung | |
| DD204251A5 (de) | Verfahren zur herstellung von aminosulfenylchloridderivaten | |
| DE3206453C2 (de) | S-Methyl-N-[(N-methyl-N-(N,N-disubstituierte amino-sulfenyl)-carbamoyl)-oxy]-thioacetimidat-derivate, Verfahren zu deren Herstellung und diese enthaltende insektizide, mitizide oder nematozide Zusammensetzungen | |
| DE2902832A1 (de) | Mikrobizide mittel | |
| DE2510936A1 (de) | Thienylharnstoffe | |
| DE3134596C2 (enExample) | ||
| EP0113317B1 (de) | Carbamate | |
| US3402245A (en) | Insecticidal 2-halo- and 2, 4-dihaloalkylphenyl carbamate compositions and method for controlling insects | |
| DD149895A5 (de) | Insektizide mittel | |
| CH625209A5 (en) | Process for the preparation of novel aminothiocarbamates and their use as active ingredient in pesticides | |
| DE2856974B1 (de) | 1-[N-(4-Chlor-2-trifluormethylphenyl)-phenylacetimidoyl]-imidazol und seine Metallkomplexe,Verfahren zur Herstellung dieser Verbindungen sowie deren Verwendung in Fungiziden | |
| AT367967B (de) | Fungizides mittel | |
| DE2403165A1 (de) | Pesticide | |
| DE2548898A1 (de) | Benzothiazolderivate, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| DE3006154A1 (de) | Fungizide 3-(n-acyl-n-arylamino)- und 3-(n-thionoacyl-n-arylamino)- gamma -butyrolactone und - gamma -thiobutyrolactone | |
| DE2052331C3 (de) | Thiocarbamate, ihre Herstellung und ihre Verwendung zur Bekämpfung von unerwünschtem Pflanzenwuchs in Reiskulturen | |
| CH629652A5 (en) | Method of controlling undesired plant growth | |
| CH632741A5 (de) | Zubereitungen, enthaltend neue substituierte cyclopropanthiolcarboxylate und die verwendung der neuen verbindungen als akarizide. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ENJ | Ceased due to non-payment of renewal fee |