SE456578B - Aminosulfenylkloridderivat, forfarande for framstellning derav samt forfarande for framstellning av karbamatderivat, som er anvendbara sasom insekticida, miticida eller nematocida foreningar - Google Patents
Aminosulfenylkloridderivat, forfarande for framstellning derav samt forfarande for framstellning av karbamatderivat, som er anvendbara sasom insekticida, miticida eller nematocida foreningarInfo
- Publication number
- SE456578B SE456578B SE8202001A SE8202001A SE456578B SE 456578 B SE456578 B SE 456578B SE 8202001 A SE8202001 A SE 8202001A SE 8202001 A SE8202001 A SE 8202001A SE 456578 B SE456578 B SE 456578B
- Authority
- SE
- Sweden
- Prior art keywords
- formula
- group
- reaction
- process according
- carried out
- Prior art date
Links
- ZBVZOMFYISPWMD-UHFFFAOYSA-N amino thiohypochlorite Chemical class NSCl ZBVZOMFYISPWMD-UHFFFAOYSA-N 0.000 title claims abstract description 11
- 150000001875 compounds Chemical class 0.000 title claims description 37
- 238000000034 method Methods 0.000 title claims description 29
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical class NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 title 1
- 241001631844 Nematocida Species 0.000 title 1
- 238000002360 preparation method Methods 0.000 claims abstract description 21
- 238000006243 chemical reaction Methods 0.000 claims description 58
- -1 amine compound Chemical class 0.000 claims description 26
- 150000007514 bases Chemical class 0.000 claims description 20
- 239000002904 solvent Substances 0.000 claims description 19
- PXJJSXABGXMUSU-UHFFFAOYSA-N disulfur dichloride Chemical compound ClSSCl PXJJSXABGXMUSU-UHFFFAOYSA-N 0.000 claims description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 16
- 229910001868 water Inorganic materials 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 9
- YOSCIBHNIINXGQ-UHFFFAOYSA-N (2,2-dimethyl-3H-1-benzofuran-7-yl) N-methylcarbamate Chemical compound CNC(=O)OC1=CC=CC2=C1OC(C)(C)C2.CNC(=O)OC1=CC=CC2=C1OC(C)(C)C2 YOSCIBHNIINXGQ-UHFFFAOYSA-N 0.000 claims description 7
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 239000012320 chlorinating reagent Substances 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 3
- 238000005660 chlorination reaction Methods 0.000 claims description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 4
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims 2
- WHALSQRTWNBBCV-UHFFFAOYSA-N s-aminosulfanylthiohydroxylamine Chemical class NSSN WHALSQRTWNBBCV-UHFFFAOYSA-N 0.000 claims 1
- 230000000749 insecticidal effect Effects 0.000 abstract description 6
- AKZWRTCWNXHHFR-PDIZUQLASA-N [(3S)-oxolan-3-yl] N-[(2S,3S)-4-[(5S)-5-benzyl-3-[(2R)-2-carbamoyloxy-2,3-dihydro-1H-inden-1-yl]-4-oxo-3H-pyrrol-5-yl]-3-hydroxy-1-phenylbutan-2-yl]carbamate Chemical compound NC(=O)O[C@@H]1Cc2ccccc2C1C1C=N[C@](C[C@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCOC2)(Cc2ccccc2)C1=O AKZWRTCWNXHHFR-PDIZUQLASA-N 0.000 abstract 3
- 238000004519 manufacturing process Methods 0.000 abstract 2
- 230000003129 miticidal effect Effects 0.000 abstract 1
- 230000001069 nematicidal effect Effects 0.000 abstract 1
- 239000000047 product Substances 0.000 description 44
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 33
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- 238000005481 NMR spectroscopy Methods 0.000 description 17
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 16
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 238000000921 elemental analysis Methods 0.000 description 7
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 6
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- DUEPRVBVGDRKAG-UHFFFAOYSA-N carbofuran Chemical compound CNC(=O)OC1=CC=CC2=C1OC(C)(C)C2 DUEPRVBVGDRKAG-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- VFTCEPBUNAKJHC-UHFFFAOYSA-N [acetyloxy(ethyl)amino] acetate Chemical compound CC(=O)ON(CC)OC(C)=O VFTCEPBUNAKJHC-UHFFFAOYSA-N 0.000 description 5
- 239000003480 eluent Substances 0.000 description 5
- OZCPYLRDULGVFK-UHFFFAOYSA-N ethyl 2-[chlorosulfanyl-(2-ethoxy-2-oxoethyl)amino]acetate Chemical compound CCOC(=O)CN(SCl)CC(=O)OCC OZCPYLRDULGVFK-UHFFFAOYSA-N 0.000 description 5
- 238000010898 silica gel chromatography Methods 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 239000012535 impurity Substances 0.000 description 4
- 231100000419 toxicity Toxicity 0.000 description 4
- 230000001988 toxicity Effects 0.000 description 4
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 3
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 3
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 3
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 3
- 241000238631 Hexapoda Species 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 3
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 3
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 150000008282 halocarbons Chemical class 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- 150000003222 pyridines Chemical class 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 230000001105 regulatory effect Effects 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 3
- PNCLCMCDRWQJSM-UHFFFAOYSA-N 2-[carboxymethyl(cyclohexyl)amino]acetic acid Chemical compound OC(=O)CN(CC(O)=O)C1CCCCC1 PNCLCMCDRWQJSM-UHFFFAOYSA-N 0.000 description 2
- XWSGEVNYFYKXCP-UHFFFAOYSA-N 2-[carboxymethyl(methyl)amino]acetic acid Chemical compound OC(=O)CN(C)CC(O)=O XWSGEVNYFYKXCP-UHFFFAOYSA-N 0.000 description 2
- IWJJXDLQNGBAOG-UHFFFAOYSA-N 2-[carboxymethyl(propan-2-yl)amino]acetic acid Chemical compound OC(=O)CN(C(C)C)CC(O)=O IWJJXDLQNGBAOG-UHFFFAOYSA-N 0.000 description 2
- 241000238876 Acari Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 238000000862 absorption spectrum Methods 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- JHESHOHUMIZHMB-UHFFFAOYSA-N methyl 2-(ethoxycarbonylamino)acetate Chemical compound CCOC(=O)NCC(=O)OC JHESHOHUMIZHMB-UHFFFAOYSA-N 0.000 description 2
- VXGABWCSZZWXPC-UHFFFAOYSA-N methyl 2-(methylamino)acetate Chemical compound CNCC(=O)OC VXGABWCSZZWXPC-UHFFFAOYSA-N 0.000 description 2
- XTFWRKOFYMGGRB-UHFFFAOYSA-N methyl 2-[chlorosulfanyl-(2-methoxy-2-oxoethyl)amino]acetate Chemical compound COC(=O)CN(SCl)CC(=O)OC XTFWRKOFYMGGRB-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- RSNAEYGESKXYLJ-UHFFFAOYSA-N propan-2-yl 2-[chlorosulfanyl-(2-oxo-2-propan-2-yloxyethyl)amino]acetate Chemical compound CC(C)OC(=O)CN(SCl)CC(=O)OC(C)C RSNAEYGESKXYLJ-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- RDJUHLUBPADHNP-UHFFFAOYSA-N 1,2,3,5-tetrahydroxybenzene Chemical compound OC1=CC(O)=C(O)C(O)=C1 RDJUHLUBPADHNP-UHFFFAOYSA-N 0.000 description 1
- CTQVAKLHSROWRN-UHFFFAOYSA-N 2-(3-methylbutylazaniumyl)propanoate Chemical compound CC(C)CCNC(C)C(O)=O CTQVAKLHSROWRN-UHFFFAOYSA-N 0.000 description 1
- DFHOMHMJYXSIRC-UHFFFAOYSA-N 2-(butan-2-ylamino)-2-methylbutanoic acid Chemical compound CCC(C)NC(C)(CC)C(O)=O DFHOMHMJYXSIRC-UHFFFAOYSA-N 0.000 description 1
- IVCQRTJVLJXKKJ-UHFFFAOYSA-N 2-(butan-2-ylazaniumyl)acetate Chemical compound CCC(C)NCC(O)=O IVCQRTJVLJXKKJ-UHFFFAOYSA-N 0.000 description 1
- DRPITQSPIKPMTH-UHFFFAOYSA-N 2-(butylamino)-2-methylbutanoic acid Chemical compound CCCCNC(C)(CC)C(O)=O DRPITQSPIKPMTH-UHFFFAOYSA-N 0.000 description 1
- VXAOLDZFARINGE-UHFFFAOYSA-N 2-(ethylamino)acetonitrile Chemical compound CCNCC#N VXAOLDZFARINGE-UHFFFAOYSA-N 0.000 description 1
- PVVRRUUMHFWFQV-UHFFFAOYSA-N 2-(methylamino)acetonitrile Chemical compound CNCC#N PVVRRUUMHFWFQV-UHFFFAOYSA-N 0.000 description 1
- AEUCLXJGFMJQMP-UHFFFAOYSA-N 2-[(4-chlorophenyl)methylamino]acetic acid Chemical compound OC(=O)CNCC1=CC=C(Cl)C=C1 AEUCLXJGFMJQMP-UHFFFAOYSA-N 0.000 description 1
- WWVBXWRCQNSAKA-UHFFFAOYSA-N 2-[butyl(carboxymethyl)amino]acetic acid Chemical compound CCCCN(CC(O)=O)CC(O)=O WWVBXWRCQNSAKA-UHFFFAOYSA-N 0.000 description 1
- JBPGQESINKVYLD-UHFFFAOYSA-N 2-amino-2-(4-methylphenyl)acetonitrile Chemical compound CC1=CC=C(C(N)C#N)C=C1 JBPGQESINKVYLD-UHFFFAOYSA-N 0.000 description 1
- MZNHGIICBOOWBS-UHFFFAOYSA-N 2-methyl-2-(2-methylpropylamino)butanoic acid Chemical compound CCC(C)(C(O)=O)NCC(C)C MZNHGIICBOOWBS-UHFFFAOYSA-N 0.000 description 1
- RLSXYPXVDGQGTN-UHFFFAOYSA-N 2-methyl-2-(methylamino)butanoic acid Chemical compound CCC(C)(NC)C(O)=O RLSXYPXVDGQGTN-UHFFFAOYSA-N 0.000 description 1
- SBAJRGRUGUQKAF-UHFFFAOYSA-N 3-(2-cyanoethylamino)propanenitrile Chemical compound N#CCCNCCC#N SBAJRGRUGUQKAF-UHFFFAOYSA-N 0.000 description 1
- ZIUZDRMIXJKUNY-UHFFFAOYSA-N 3-[2-carboxyethyl(ethyl)amino]propanoic acid Chemical compound OC(=O)CCN(CC)CCC(O)=O ZIUZDRMIXJKUNY-UHFFFAOYSA-N 0.000 description 1
- IPQKIOGNAKWLSO-UHFFFAOYSA-N 3-[2-carboxyethyl(methyl)amino]propanoic acid Chemical compound OC(=O)CCN(C)CCC(O)=O IPQKIOGNAKWLSO-UHFFFAOYSA-N 0.000 description 1
- CKEIQUPFORBNCK-UHFFFAOYSA-N 4-(3-cyanopropylamino)butanenitrile Chemical compound N#CCCCNCCCC#N CKEIQUPFORBNCK-UHFFFAOYSA-N 0.000 description 1
- ZNYZTDWQEIMACC-UHFFFAOYSA-N CCOC(=O)CN(CC(=O)OCC)SN(C(O)=O)CC1=CC=CC2=C1OC(C)(C)C2 Chemical compound CCOC(=O)CN(CC(=O)OCC)SN(C(O)=O)CC1=CC=CC2=C1OC(C)(C)C2 ZNYZTDWQEIMACC-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000254173 Coleoptera Species 0.000 description 1
- 241000255925 Diptera Species 0.000 description 1
- 241000258937 Hemiptera Species 0.000 description 1
- 241001149911 Isopoda Species 0.000 description 1
- 241000255777 Lepidoptera Species 0.000 description 1
- MUVSKNYYLVXICY-UHFFFAOYSA-N N#CCCN(C(C)C)SN(C(O)=O)CC1=CC=CC2=C1OC(C)(C)C2 Chemical compound N#CCCN(C(C)C)SN(C(O)=O)CC1=CC=CC2=C1OC(C)(C)C2 MUVSKNYYLVXICY-UHFFFAOYSA-N 0.000 description 1
- 241000244206 Nematoda Species 0.000 description 1
- 241000238814 Orthoptera Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 241001414989 Thysanoptera Species 0.000 description 1
- 241000243782 Tylenchida Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- BUUGCEHIDSIHJB-UHFFFAOYSA-N [2-cyanoethyl(propan-2-yl)amino] thiohypochlorite Chemical compound CC(C)N(SCl)CCC#N BUUGCEHIDSIHJB-UHFFFAOYSA-N 0.000 description 1
- UXLYEJGCYZAZDX-UHFFFAOYSA-N [bis(2-cyanoethyl)amino] thiohypochlorite Chemical compound N#CCCN(SCl)CCC#N UXLYEJGCYZAZDX-UHFFFAOYSA-N 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 230000002051 biphasic effect Effects 0.000 description 1
- HVNPFQOMBNYVMB-UHFFFAOYSA-N butyl 2-(methylamino)acetate Chemical compound CCCCOC(=O)CNC HVNPFQOMBNYVMB-UHFFFAOYSA-N 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- IUDUQYZKURPHGL-UHFFFAOYSA-N cyanomethyl carbamate Chemical compound NC(=O)OCC#N IUDUQYZKURPHGL-UHFFFAOYSA-N 0.000 description 1
- YXAAPRUUUWQFGV-UHFFFAOYSA-N cyclohexyl 2-[chlorosulfanyl-(2-cyclohexyloxy-2-oxoethyl)amino]acetate Chemical compound C1CCCCC1OC(=O)CN(SCl)CC(=O)OC1CCCCC1 YXAAPRUUUWQFGV-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- SBPUJTNHAUBDKF-UHFFFAOYSA-N ethyl 2-(2-cyanoethylamino)acetate Chemical compound CCOC(=O)CNCCC#N SBPUJTNHAUBDKF-UHFFFAOYSA-N 0.000 description 1
- QJERSMYDZNFZDK-UHFFFAOYSA-N ethyl 2-(2-cyanoethylamino)propanoate Chemical compound CCOC(=O)C(C)NCCC#N QJERSMYDZNFZDK-UHFFFAOYSA-N 0.000 description 1
- HJHAOMCORINKOB-UHFFFAOYSA-N ethyl 2-(cyanomethylamino)acetate Chemical compound CCOC(=O)CNCC#N HJHAOMCORINKOB-UHFFFAOYSA-N 0.000 description 1
- DITDYMTYUDGGGF-UHFFFAOYSA-N ethyl 2-(cyanomethylamino)propanoate Chemical compound CCOC(=O)C(C)NCC#N DITDYMTYUDGGGF-UHFFFAOYSA-N 0.000 description 1
- NHRFJPKXIYYFMX-UHFFFAOYSA-N ethyl 2-(cyclohexylamino)acetate Chemical compound CCOC(=O)CNC1CCCCC1 NHRFJPKXIYYFMX-UHFFFAOYSA-N 0.000 description 1
- UPPDUARXWJEKFZ-UHFFFAOYSA-N ethyl 2-(cyclohexylamino)propanoate Chemical compound CCOC(=O)C(C)NC1CCCCC1 UPPDUARXWJEKFZ-UHFFFAOYSA-N 0.000 description 1
- OMECLFTURFUIIJ-UHFFFAOYSA-N ethyl 2-(ethoxycarbonylamino)propanoate Chemical compound CCOC(=O)NC(C)C(=O)OCC OMECLFTURFUIIJ-UHFFFAOYSA-N 0.000 description 1
- NRMPJIHWGVBZBB-UHFFFAOYSA-N ethyl 2-(ethylamino)acetate Chemical compound CCNCC(=O)OCC NRMPJIHWGVBZBB-UHFFFAOYSA-N 0.000 description 1
- LCMDFUNTIZKNJK-UHFFFAOYSA-N ethyl 2-(hexylamino)propanoate Chemical compound CCCCCCNC(C)C(=O)OCC LCMDFUNTIZKNJK-UHFFFAOYSA-N 0.000 description 1
- BTKSUULMJNNXHG-UHFFFAOYSA-N ethyl 2-(methylamino)acetate Chemical compound CCOC(=O)CNC BTKSUULMJNNXHG-UHFFFAOYSA-N 0.000 description 1
- CWPWNWCAOJRJJT-UHFFFAOYSA-N ethyl 2-(phenoxycarbonylamino)acetate Chemical compound CCOC(=O)CNC(=O)OC1=CC=CC=C1 CWPWNWCAOJRJJT-UHFFFAOYSA-N 0.000 description 1
- ROGQHXXFNVNMSC-UHFFFAOYSA-N ethyl 2-(propan-2-ylamino)acetate Chemical compound CCOC(=O)CNC(C)C ROGQHXXFNVNMSC-UHFFFAOYSA-N 0.000 description 1
- JBIONIMUHCHUOW-UHFFFAOYSA-N ethyl 2-(propan-2-ylamino)propanoate Chemical compound CCOC(=O)C(C)NC(C)C JBIONIMUHCHUOW-UHFFFAOYSA-N 0.000 description 1
- MLSGRWDEDYJNER-UHFFFAOYSA-N ethyl 2-anilinoacetate Chemical compound CCOC(=O)CNC1=CC=CC=C1 MLSGRWDEDYJNER-UHFFFAOYSA-N 0.000 description 1
- LXRRVDLNCROODH-UHFFFAOYSA-N ethyl n-(2-cyanoethyl)carbamate Chemical compound CCOC(=O)NCCC#N LXRRVDLNCROODH-UHFFFAOYSA-N 0.000 description 1
- AHGQESFVDCNOGJ-UHFFFAOYSA-N ethyl n-(cyanomethyl)carbamate Chemical compound CCOC(=O)NCC#N AHGQESFVDCNOGJ-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000002316 fumigant Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 231100000086 high toxicity Toxicity 0.000 description 1
- BSRDNMMLQYNQQD-UHFFFAOYSA-N iminodiacetonitrile Chemical compound N#CCNCC#N BSRDNMMLQYNQQD-UHFFFAOYSA-N 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000003094 microcapsule Substances 0.000 description 1
- MKZKUODXSFNHMY-UHFFFAOYSA-N phenyl 2-(ethoxycarbonylamino)acetate Chemical compound CCOC(=O)NCC(=O)OC1=CC=CC=C1 MKZKUODXSFNHMY-UHFFFAOYSA-N 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C313/00—Sulfinic acids; Sulfenic acids; Halides, esters or anhydrides thereof; Amides of sulfinic or sulfenic acids, i.e. compounds having singly-bound oxygen atoms of sulfinic or sulfenic groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C313/08—Sulfenic acids; Derivatives thereof
- C07C313/18—Sulfenamides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C381/00—Compounds containing carbon and sulfur and having functional groups not covered by groups C07C301/00 - C07C337/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/86—Benzo [b] furans; Hydrogenated benzo [b] furans with an oxygen atom directly attached in position 7
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Saccharide Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP56047785A JPS57163360A (en) | 1981-03-30 | 1981-03-30 | Bis(alkoxycarbonylmethyl)aminosulphenyl chloride derivative and its preparation |
| JP7852981A JPS57193472A (en) | 1981-05-22 | 1981-05-22 | Preparation of carbamate compound |
| JP17792981A JPS5877860A (ja) | 1981-11-05 | 1981-11-05 | アミノスルフエニルクロリド誘導体及びその製造法 |
| JP17792881A JPS5877878A (ja) | 1981-11-05 | 1981-11-05 | カ−バメイト化合物の製造法 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE8202001L SE8202001L (sv) | 1982-11-09 |
| SE456578B true SE456578B (sv) | 1988-10-17 |
Family
ID=27462100
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8202001A SE456578B (sv) | 1981-03-30 | 1982-03-29 | Aminosulfenylkloridderivat, forfarande for framstellning derav samt forfarande for framstellning av karbamatderivat, som er anvendbara sasom insekticida, miticida eller nematocida foreningar |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4421693A (enExample) |
| KR (1) | KR880002299B1 (enExample) |
| AR (1) | AR230833A1 (enExample) |
| AU (1) | AU545481B2 (enExample) |
| CA (1) | CA1188706A (enExample) |
| CH (1) | CH653016A5 (enExample) |
| DD (2) | DD204251A5 (enExample) |
| DE (1) | DE3211087C2 (enExample) |
| ES (2) | ES8308539A1 (enExample) |
| FR (1) | FR2502616B1 (enExample) |
| GB (1) | GB2096994B (enExample) |
| GR (1) | GR75920B (enExample) |
| IL (1) | IL65384A (enExample) |
| IN (1) | IN156106B (enExample) |
| IT (1) | IT1147830B (enExample) |
| MA (1) | MA19424A1 (enExample) |
| MX (1) | MX160562A (enExample) |
| NL (1) | NL8201290A (enExample) |
| NZ (1) | NZ200163A (enExample) |
| SE (1) | SE456578B (enExample) |
| TR (1) | TR21303A (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5988461A (ja) * | 1982-11-11 | 1984-05-22 | Otsuka Chem Co Ltd | カ−バメイト系殺虫剤 |
| US4587353A (en) * | 1983-08-23 | 1986-05-06 | Ciba-Geigy Corporation | Process for producing N-chlorosulfenyl compounds |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2649470A (en) * | 1951-10-10 | 1953-08-18 | Monsanto Chemicals | Cyanoalkyl substituted amine sulfides |
| US2766236A (en) * | 1954-02-25 | 1956-10-09 | Monsanto Chemicals | Preparing n-thioamines |
| US3843689A (en) * | 1970-11-09 | 1974-10-22 | Chevron Res | N-chlorothio carbamates |
-
1982
- 1982-03-24 CA CA000399286A patent/CA1188706A/en not_active Expired
- 1982-03-25 US US06/361,931 patent/US4421693A/en not_active Expired - Lifetime
- 1982-03-25 DE DE3211087A patent/DE3211087C2/de not_active Expired - Fee Related
- 1982-03-26 AR AR288882A patent/AR230833A1/es active
- 1982-03-27 ES ES510885A patent/ES8308539A1/es not_active Expired
- 1982-03-29 GB GB8209194A patent/GB2096994B/en not_active Expired
- 1982-03-29 NL NL8201290A patent/NL8201290A/nl not_active Application Discontinuation
- 1982-03-29 MX MX192032A patent/MX160562A/es unknown
- 1982-03-29 CH CH1915/82A patent/CH653016A5/fr not_active IP Right Cessation
- 1982-03-29 NZ NZ200163A patent/NZ200163A/en unknown
- 1982-03-29 SE SE8202001A patent/SE456578B/sv not_active IP Right Cessation
- 1982-03-29 IT IT48109/82A patent/IT1147830B/it active
- 1982-03-29 GR GR67741A patent/GR75920B/el unknown
- 1982-03-30 DD DD82238568A patent/DD204251A5/de not_active IP Right Cessation
- 1982-03-30 MA MA19629A patent/MA19424A1/fr unknown
- 1982-03-30 AU AU82143/82A patent/AU545481B2/en not_active Ceased
- 1982-03-30 IL IL65384A patent/IL65384A/xx not_active IP Right Cessation
- 1982-03-30 IN IN354/CAL/82A patent/IN156106B/en unknown
- 1982-03-30 KR KR8201384A patent/KR880002299B1/ko not_active Expired
- 1982-03-30 FR FR8205475A patent/FR2502616B1/fr not_active Expired
- 1982-03-30 TR TR21303A patent/TR21303A/xx unknown
- 1982-03-30 DD DD82246179A patent/DD208803A5/de not_active IP Right Cessation
-
1983
- 1983-03-31 ES ES521601A patent/ES521601A0/es active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| IN156106B (enExample) | 1985-05-18 |
| IL65384A0 (en) | 1982-05-31 |
| TR21303A (tr) | 1984-03-22 |
| DE3211087A1 (de) | 1982-11-18 |
| KR880002299B1 (ko) | 1988-10-22 |
| ES8405781A1 (es) | 1984-07-01 |
| ES521601A0 (es) | 1984-07-01 |
| GB2096994B (en) | 1985-04-24 |
| MA19424A1 (fr) | 1982-10-01 |
| GB2096994A (en) | 1982-10-27 |
| FR2502616A1 (fr) | 1982-10-01 |
| AU545481B2 (en) | 1985-07-18 |
| DE3211087C2 (de) | 1994-09-08 |
| IL65384A (en) | 1985-10-31 |
| NZ200163A (en) | 1985-08-16 |
| AU8214382A (en) | 1982-10-07 |
| KR830009018A (ko) | 1983-12-17 |
| SE8202001L (sv) | 1982-11-09 |
| CA1188706A (en) | 1985-06-11 |
| IT8248109A0 (it) | 1982-03-29 |
| IT1147830B (it) | 1986-11-26 |
| AR230833A1 (es) | 1984-07-31 |
| ES510885A0 (es) | 1983-10-01 |
| FR2502616B1 (fr) | 1986-09-05 |
| DD208803A5 (de) | 1984-04-11 |
| DD204251A5 (de) | 1983-11-23 |
| CH653016A5 (fr) | 1985-12-13 |
| US4421693A (en) | 1983-12-20 |
| NL8201290A (nl) | 1982-10-18 |
| ES8308539A1 (es) | 1983-10-01 |
| MX160562A (es) | 1990-03-23 |
| GR75920B (enExample) | 1984-08-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR0167336B1 (ko) | 살진균제, 및 치환된 아미노산 아미드 유도체 및 이의 제조방법 | |
| JPS6049638B2 (ja) | カ−バメイト系殺虫剤 | |
| PL126774B1 (en) | Herbicide | |
| SE456578B (sv) | Aminosulfenylkloridderivat, forfarande for framstellning derav samt forfarande for framstellning av karbamatderivat, som er anvendbara sasom insekticida, miticida eller nematocida foreningar | |
| US4444786A (en) | Carbamate derivatives, insecticidal, miticidal or nematocidal compositions containing the same, and process for preparing the same | |
| US4413005A (en) | Carbamate derivatives and insecticidal, miticidal or nematocidal compositions containing the same | |
| CA1110656A (en) | N-[[arylformimidoyl]methylamino]thio]-n- substituted sulfonamides] | |
| US4382954A (en) | Fungicidal N-1-substituted cyclopropyl-N-acyl-2,6-dialkylaniline | |
| CA1170662A (en) | Carbamate derivatives, process for preparing same and carbamate insecticides | |
| US4315846A (en) | Metal salt of N-substituted alkylenebisdithiocarbamic acid | |
| US4608082A (en) | Herbicidal cycloalkenyl acetamides | |
| GB2084134A (en) | Insecticidal, miticidal and nematocidal dihydrobenzofuran aminosulphenyl carbabates | |
| CA1253517A (en) | N-(CARBAMYLMETHYL)-.alpha.-HALOACETANILIDE COMPOUNDS | |
| US4427667A (en) | 2,2-Bis(haloalkenyl)-1-substituted-1-dialkoxyphosphoroethylene fungicides | |
| JP2553335B2 (ja) | 光学活性シクロプロパンカルボキサミド類及び該活性体とその鏡像異性体との鏡像異性体対、並びに農業用殺菌剤 | |
| US3824281A (en) | 1-carboxamidothio-3-aryl ureas | |
| US4260624A (en) | Fungicidal 2-substituted-3-oxa-3a lambda4,4-dithia-6-chloro-1,5-diazapentalene | |
| US4230711A (en) | Fungicidal n-substituted 4,4-dialkyl homophthalimides | |
| KR850000743B1 (ko) | 카바메이트유도체의 제조방법 | |
| US3891424A (en) | Herbicidal 1-carbonamidothio-3-aryl ureas | |
| US4540708A (en) | Sulfenyl carbamate derivatives and insecticidal compositions containing the same | |
| JPS5826804A (ja) | カ−バメイト系殺虫剤 | |
| KR0119964B1 (ko) | 신규한 헤테로시클릭 비닐 술파이드 및 술폰계 화합물과 그의 제조방법 | |
| US3826644A (en) | Herbicidal n'-aryl-n-chlorocycloalkylthio ureas | |
| US4255451A (en) | Algicidal and fungicidal 1-halo-2-substituted-thioethyl sulfones, 2-substituted-thiovinyl sulfones, and 1,2-dihalothioethyl sulfones |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 8202001-7 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 8202001-7 Format of ref document f/p: F |