DD149060A5 - Verfahren zur herstellung m-chlor-substituierter aniline - Google Patents
Verfahren zur herstellung m-chlor-substituierter aniline Download PDFInfo
- Publication number
- DD149060A5 DD149060A5 DD80219034A DD21903480A DD149060A5 DD 149060 A5 DD149060 A5 DD 149060A5 DD 80219034 A DD80219034 A DD 80219034A DD 21903480 A DD21903480 A DD 21903480A DD 149060 A5 DD149060 A5 DD 149060A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- chlorine
- items
- hydrogen
- formula
- item
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title abstract description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical class NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 title description 10
- 238000000034 method Methods 0.000 claims abstract description 42
- 239000001257 hydrogen Substances 0.000 claims abstract description 20
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 20
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 15
- 239000007791 liquid phase Substances 0.000 claims abstract description 10
- 239000003054 catalyst Substances 0.000 claims description 15
- 239000000460 chlorine Substances 0.000 claims description 14
- 229910052801 chlorine Inorganic materials 0.000 claims description 14
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 13
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 11
- -1 m-chloro-substituted anilines Chemical class 0.000 claims description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 9
- 239000012429 reaction media Substances 0.000 claims description 8
- 150000001555 benzenes Chemical class 0.000 claims description 7
- 229910000510 noble metal Inorganic materials 0.000 claims description 7
- 229910052763 palladium Inorganic materials 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 230000002378 acidificating effect Effects 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 239000002609 medium Substances 0.000 claims description 3
- 239000001301 oxygen Chemical group 0.000 claims description 3
- 229910052760 oxygen Chemical group 0.000 claims description 3
- 230000000737 periodic effect Effects 0.000 claims description 3
- UQRLKWGPEVNVHT-UHFFFAOYSA-N 3,5-dichloroaniline Chemical class NC1=CC(Cl)=CC(Cl)=C1 UQRLKWGPEVNVHT-UHFFFAOYSA-N 0.000 claims description 2
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical class NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 claims description 2
- 239000012736 aqueous medium Substances 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 2
- 150000002500 ions Chemical class 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 125000003580 L-valyl group Chemical group [H]N([H])[C@]([H])(C(=O)[*])C(C([H])([H])[H])(C([H])([H])[H])[H] 0.000 claims 4
- 239000011541 reaction mixture Substances 0.000 claims 4
- 239000010970 precious metal Substances 0.000 claims 1
- 150000001448 anilines Chemical class 0.000 abstract description 7
- 150000005181 nitrobenzenes Chemical class 0.000 abstract description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract description 2
- 238000006298 dechlorination reaction Methods 0.000 abstract 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 235000019270 ammonium chloride Nutrition 0.000 description 4
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000001491 aromatic compounds Chemical class 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 150000003840 hydrochlorides Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- NGQZFSHSIJZJNX-UHFFFAOYSA-N 2,3-dichloro-6-methoxyaniline Chemical compound COC1=CC=C(Cl)C(Cl)=C1N NGQZFSHSIJZJNX-UHFFFAOYSA-N 0.000 description 2
- BRPSAOUFIJSKOT-UHFFFAOYSA-N 2,3-dichloroaniline Chemical class NC1=CC=CC(Cl)=C1Cl BRPSAOUFIJSKOT-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- RWGZRRPLEGKJDN-UHFFFAOYSA-N 1,2,3,4-tetrachloro-5-methoxy-6-nitrobenzene Chemical compound COC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1[N+]([O-])=O RWGZRRPLEGKJDN-UHFFFAOYSA-N 0.000 description 1
- NQEKOOGCLIIIKC-UHFFFAOYSA-N 1,2,3-trichloro-4-methoxy-5-nitrobenzene Chemical compound COC1=C(Cl)C(Cl)=C(Cl)C=C1[N+]([O-])=O NQEKOOGCLIIIKC-UHFFFAOYSA-N 0.000 description 1
- YBCSBMLIXWHLQI-UHFFFAOYSA-N 1,2-dichloro-3-methoxy-4-nitrobenzene Chemical compound COC1=C(Cl)C(Cl)=CC=C1[N+]([O-])=O YBCSBMLIXWHLQI-UHFFFAOYSA-N 0.000 description 1
- LYFAMXRWZNBHLH-UHFFFAOYSA-N 1,2-dichloro-3-methoxy-5-nitrobenzene Chemical compound COC1=CC([N+]([O-])=O)=CC(Cl)=C1Cl LYFAMXRWZNBHLH-UHFFFAOYSA-N 0.000 description 1
- BHJTYLCUHUTYEE-UHFFFAOYSA-N 1,2-dichloro-4-methoxy-3-nitrobenzene Chemical compound COC1=CC=C(Cl)C(Cl)=C1[N+]([O-])=O BHJTYLCUHUTYEE-UHFFFAOYSA-N 0.000 description 1
- QFQSBAMTGUKFKS-UHFFFAOYSA-N 1,2-dichloro-4-methoxy-5-nitrobenzene Chemical compound COC1=CC(Cl)=C(Cl)C=C1[N+]([O-])=O QFQSBAMTGUKFKS-UHFFFAOYSA-N 0.000 description 1
- LBKQVYCKFHARBV-UHFFFAOYSA-N 1,2-dichloro-4-nitro-5-phenoxybenzene Chemical compound [O-][N+](=O)C1=CC(Cl)=C(Cl)C=C1OC1=CC=CC=C1 LBKQVYCKFHARBV-UHFFFAOYSA-N 0.000 description 1
- NTBYINQTYWZXLH-UHFFFAOYSA-N 1,2-dichloro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(Cl)=C1 NTBYINQTYWZXLH-UHFFFAOYSA-N 0.000 description 1
- UKKPUHZRGLNAMS-UHFFFAOYSA-N 1,4-dichloro-2-ethyl-5-nitrobenzene Chemical compound CCC1=CC(Cl)=C([N+]([O-])=O)C=C1Cl UKKPUHZRGLNAMS-UHFFFAOYSA-N 0.000 description 1
- DVGWQGRGSAQPQJ-UHFFFAOYSA-N 1,4-dichloro-2-methoxy-5-nitrobenzene Chemical compound COC1=CC(Cl)=C([N+]([O-])=O)C=C1Cl DVGWQGRGSAQPQJ-UHFFFAOYSA-N 0.000 description 1
- ZZHOGSARBSKHBZ-UHFFFAOYSA-N 1,4-dichloro-2-nitro-5-phenoxybenzene Chemical compound C1=C(Cl)C([N+](=O)[O-])=CC(Cl)=C1OC1=CC=CC=C1 ZZHOGSARBSKHBZ-UHFFFAOYSA-N 0.000 description 1
- YAXBAPKUQSMNNU-UHFFFAOYSA-N 1,5-dichlorocyclohexa-2,4-dien-1-amine Chemical class NC1(Cl)CC(Cl)=CC=C1 YAXBAPKUQSMNNU-UHFFFAOYSA-N 0.000 description 1
- KHCZSJXTDDHLGJ-UHFFFAOYSA-N 2,3,4,5,6-pentachloroaniline Chemical compound NC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl KHCZSJXTDDHLGJ-UHFFFAOYSA-N 0.000 description 1
- JXWUMFLJRZJKAZ-UHFFFAOYSA-N 2,3-dichloro-1-methoxy-4-nitrobenzene Chemical compound COC1=CC=C([N+]([O-])=O)C(Cl)=C1Cl JXWUMFLJRZJKAZ-UHFFFAOYSA-N 0.000 description 1
- LZYMHTVWOMZPEO-UHFFFAOYSA-N 2,3-dichloro-4-methoxyaniline Chemical compound COC1=CC=C(N)C(Cl)=C1Cl LZYMHTVWOMZPEO-UHFFFAOYSA-N 0.000 description 1
- CNMBMHIFTUIKLJ-UHFFFAOYSA-N 2,3-dichloro-5-methoxyaniline Chemical compound COC1=CC(N)=C(Cl)C(Cl)=C1 CNMBMHIFTUIKLJ-UHFFFAOYSA-N 0.000 description 1
- SKGXUFZRYNGFJS-UHFFFAOYSA-N 2,3-dichloronaphthalene Chemical compound C1=CC=C2C=C(Cl)C(Cl)=CC2=C1 SKGXUFZRYNGFJS-UHFFFAOYSA-N 0.000 description 1
- JHZWCHORDSEJQD-UHFFFAOYSA-N 2,5-dichloro-3-methoxyaniline Chemical compound COC1=CC(Cl)=CC(N)=C1Cl JHZWCHORDSEJQD-UHFFFAOYSA-N 0.000 description 1
- VCMXIPGKIUDONN-UHFFFAOYSA-N 2,5-dichloro-4-methoxyaniline Chemical compound COC1=CC(Cl)=C(N)C=C1Cl VCMXIPGKIUDONN-UHFFFAOYSA-N 0.000 description 1
- QXDILMJTDWNTAV-UHFFFAOYSA-N 2,5-dichloro-4-phenoxyaniline Chemical compound C1=C(Cl)C(N)=CC(Cl)=C1OC1=CC=CC=C1 QXDILMJTDWNTAV-UHFFFAOYSA-N 0.000 description 1
- DWOBGCPUQNFAFB-UHFFFAOYSA-N 2-benzylaniline Chemical compound NC1=CC=CC=C1CC1=CC=CC=C1 DWOBGCPUQNFAFB-UHFFFAOYSA-N 0.000 description 1
- YNMZQQXVRYHMKT-UHFFFAOYSA-N 3,4-dichloro-2-methoxyaniline Chemical compound COC1=C(N)C=CC(Cl)=C1Cl YNMZQQXVRYHMKT-UHFFFAOYSA-N 0.000 description 1
- RLTUJGIRWIFRLO-UHFFFAOYSA-N 3,4-dichloro-5-methoxyaniline Chemical compound COC1=CC(N)=CC(Cl)=C1Cl RLTUJGIRWIFRLO-UHFFFAOYSA-N 0.000 description 1
- VPZJHTWLWKFPQW-UHFFFAOYSA-N 3-chloro-2-methoxyaniline Chemical compound COC1=C(N)C=CC=C1Cl VPZJHTWLWKFPQW-UHFFFAOYSA-N 0.000 description 1
- XQVCBOLNTSUFGD-UHFFFAOYSA-N 3-chloro-4-methoxyaniline Chemical compound COC1=CC=C(N)C=C1Cl XQVCBOLNTSUFGD-UHFFFAOYSA-N 0.000 description 1
- RQKFYFNZSHWXAW-UHFFFAOYSA-N 3-chloro-p-toluidine Chemical compound CC1=CC=C(N)C=C1Cl RQKFYFNZSHWXAW-UHFFFAOYSA-N 0.000 description 1
- OMUPQCXITFAUCB-UHFFFAOYSA-N 4,5-dichloro-2-methoxyaniline Chemical compound COC1=CC(Cl)=C(Cl)C=C1N OMUPQCXITFAUCB-UHFFFAOYSA-N 0.000 description 1
- PDOWROQDIXWGIV-UHFFFAOYSA-N 4,5-dichloro-2-phenoxyaniline Chemical compound NC1=CC(Cl)=C(Cl)C=C1OC1=CC=CC=C1 PDOWROQDIXWGIV-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical class NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- WRZOMWDJOLIVQP-UHFFFAOYSA-N 5-Chloro-ortho-toluidine Chemical compound CC1=CC=C(Cl)C=C1N WRZOMWDJOLIVQP-UHFFFAOYSA-N 0.000 description 1
- WBSMIPLNPSCJFS-UHFFFAOYSA-N 5-chloro-2-methoxyaniline Chemical compound COC1=CC=C(Cl)C=C1N WBSMIPLNPSCJFS-UHFFFAOYSA-N 0.000 description 1
- SXEBHIMOUHBBOS-UHFFFAOYSA-N 5-chloro-2-phenoxyaniline Chemical compound NC1=CC(Cl)=CC=C1OC1=CC=CC=C1 SXEBHIMOUHBBOS-UHFFFAOYSA-N 0.000 description 1
- LMKKQQBWNMUMOW-UHFFFAOYSA-N ClC1(C)C(C=C(C=C1)Cl)[N+](=O)[O-] Chemical compound ClC1(C)C(C=C(C=C1)Cl)[N+](=O)[O-] LMKKQQBWNMUMOW-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 1
- 229910001617 alkaline earth metal chloride Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000000382 dechlorinating effect Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 229910001510 metal chloride Inorganic materials 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- DQNOIKMHTBFYTD-UHFFFAOYSA-N n,n,2,3-tetrachloroaniline Chemical compound ClN(Cl)C1=CC=CC(Cl)=C1Cl DQNOIKMHTBFYTD-UHFFFAOYSA-N 0.000 description 1
- KUWAAZMPJBFLEO-UHFFFAOYSA-N n,n,2-trichloroaniline Chemical compound ClN(Cl)C1=CC=CC=C1Cl KUWAAZMPJBFLEO-UHFFFAOYSA-N 0.000 description 1
- GGMULJXAZFGKEG-UHFFFAOYSA-N n-chloro-3-methylaniline Chemical compound CC1=CC=CC(NCl)=C1 GGMULJXAZFGKEG-UHFFFAOYSA-N 0.000 description 1
- NSBIQPJIWUJBBX-UHFFFAOYSA-N n-methoxyaniline Chemical compound CONC1=CC=CC=C1 NSBIQPJIWUJBBX-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/74—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C215/76—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton of the same non-condensed six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
FR7904483A FR2449077A2 (fr) | 1979-02-15 | 1979-02-15 | Procede de preparation d'anilines metachlorees |
Publications (1)
Publication Number | Publication Date |
---|---|
DD149060A5 true DD149060A5 (de) | 1981-06-24 |
Family
ID=9222292
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DD80219034A DD149060A5 (de) | 1979-02-15 | 1980-02-13 | Verfahren zur herstellung m-chlor-substituierter aniline |
Country Status (22)
Country | Link |
---|---|
US (1) | US4324914A (cs) |
JP (1) | JPS5928544B2 (cs) |
AT (1) | AT372370B (cs) |
BE (1) | BE881754A (cs) |
BR (1) | BR8000910A (cs) |
CA (1) | CA1139313A (cs) |
CH (1) | CH642049A5 (cs) |
DD (1) | DD149060A5 (cs) |
DE (1) | DE3003960A1 (cs) |
DK (1) | DK153392C (cs) |
ES (1) | ES488572A1 (cs) |
FR (1) | FR2449077A2 (cs) |
GB (1) | GB2042542B (cs) |
HU (1) | HU185214B (cs) |
IE (1) | IE49393B1 (cs) |
IL (1) | IL59190A (cs) |
IT (1) | IT1127360B (cs) |
LU (1) | LU82167A1 (cs) |
NL (1) | NL8000620A (cs) |
SE (1) | SE447897B (cs) |
SU (1) | SU1082316A3 (cs) |
YU (1) | YU42323B (cs) |
Families Citing this family (9)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE3127026A1 (de) * | 1981-07-09 | 1983-01-20 | Bayer Ag, 5090 Leverkusen | Verrfahren zur herstellung von m-chlorsubstituiertenanilinen |
FR2521132A1 (fr) * | 1982-02-05 | 1983-08-12 | Rhone Poulenc Agrochimie | Procede de preparation de metahalogeno-anilines |
US4888425A (en) * | 1982-04-30 | 1989-12-19 | Union Carbide Chemicals And Plastics Company Inc. | Preparation of polyalkylene polyamines |
JPS5955855A (ja) * | 1982-09-27 | 1984-03-31 | Mitsui Toatsu Chem Inc | 3,3′−ジアミノジフエニルメタンの製造方法 |
JPS62132400U (cs) * | 1986-02-14 | 1987-08-20 | ||
USRE34745E (en) * | 1986-10-30 | 1994-09-27 | The Dow Chemical Company | High purity process for the preparation of 4,6-diamino-1,3-benzenediol |
US5001279A (en) * | 1989-11-17 | 1991-03-19 | The Dow Chemical Company | Aqueous synthesis of 2-halo-4,6-dinitroresorcinol and 4,6-diaminoresorcinol |
US5294742A (en) * | 1992-03-21 | 1994-03-15 | Hoechst Atkiengesellschaft | Process for preparing 3,5-difluoroaniline |
EP2259809B1 (en) * | 2008-02-29 | 2016-05-25 | Cook Biotech Incorporated | Coated embolization device |
Family Cites Families (7)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3148217A (en) * | 1961-11-16 | 1964-09-08 | Gen Aniline & Film Corp | Catalytic hydrogenation of halonitrobenzene compounds |
DE2032565A1 (de) * | 1970-07-01 | 1972-01-05 | Farbwerke Hoechst AG, vormals Meister Lucius & Bruning, 6000 Frankfurt | Verfahren zur Herstellung von 3 Difluorchlormethylanihn |
DE2036313C3 (de) * | 1970-07-22 | 1982-03-25 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Halogen-substituiertenaromatischen Aminen |
CS188122B2 (en) * | 1971-02-08 | 1979-02-28 | Kurt Habig | Method of production the sulfide catalysts with the platinum on coal |
DE2503187C3 (de) * | 1975-01-27 | 1979-05-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung durch Chlor meta-substituierte Aniline |
FR2403990A1 (fr) * | 1977-09-22 | 1979-04-20 | Philagro Sa | Procede de deshalogenation d'amines aromatiques halogenees |
DE2758111A1 (de) * | 1977-12-24 | 1979-07-05 | Basf Ag | Verfahren zur herstellung von halogenanilinen |
-
1979
- 1979-02-15 FR FR7904483A patent/FR2449077A2/fr active Granted
-
1980
- 1980-01-22 IL IL59190A patent/IL59190A/xx unknown
- 1980-01-23 US US06/114,651 patent/US4324914A/en not_active Expired - Lifetime
- 1980-01-31 NL NL8000620A patent/NL8000620A/nl not_active Application Discontinuation
- 1980-02-04 DE DE19803003960 patent/DE3003960A1/de active Granted
- 1980-02-13 IT IT47892/80A patent/IT1127360B/it active
- 1980-02-13 YU YU378/80A patent/YU42323B/xx unknown
- 1980-02-13 GB GB8004746A patent/GB2042542B/en not_active Expired
- 1980-02-13 CA CA000345561A patent/CA1139313A/en not_active Expired
- 1980-02-13 DD DD80219034A patent/DD149060A5/de not_active IP Right Cessation
- 1980-02-13 IE IE277/80A patent/IE49393B1/en unknown
- 1980-02-14 DK DK062880A patent/DK153392C/da active
- 1980-02-14 LU LU82167A patent/LU82167A1/fr unknown
- 1980-02-14 SE SE8001166A patent/SE447897B/sv not_active IP Right Cessation
- 1980-02-14 BR BR8000910A patent/BR8000910A/pt unknown
- 1980-02-14 CH CH123780A patent/CH642049A5/fr not_active IP Right Cessation
- 1980-02-14 JP JP55017165A patent/JPS5928544B2/ja not_active Expired
- 1980-02-14 ES ES488572A patent/ES488572A1/es not_active Expired
- 1980-02-14 SU SU802882799A patent/SU1082316A3/ru active
- 1980-02-14 HU HU80337A patent/HU185214B/hu unknown
- 1980-02-15 AT AT0085480A patent/AT372370B/de not_active IP Right Cessation
- 1980-02-15 BE BE0/199423A patent/BE881754A/fr unknown
Also Published As
Publication number | Publication date |
---|---|
CA1139313A (en) | 1983-01-11 |
IE800277L (en) | 1980-08-15 |
LU82167A1 (fr) | 1981-09-10 |
JPS55149229A (en) | 1980-11-20 |
YU37880A (en) | 1983-01-21 |
IL59190A0 (en) | 1980-05-30 |
DK62880A (da) | 1980-08-16 |
IE49393B1 (en) | 1985-10-02 |
ES488572A1 (es) | 1980-10-01 |
AT372370B (de) | 1983-09-26 |
US4324914A (en) | 1982-04-13 |
HU185214B (en) | 1984-12-28 |
DK153392C (da) | 1988-11-28 |
DE3003960A1 (de) | 1980-08-28 |
SE8001166L (sv) | 1980-08-16 |
FR2449077A2 (fr) | 1980-09-12 |
FR2449077B2 (cs) | 1983-04-29 |
GB2042542B (en) | 1983-05-05 |
BE881754A (fr) | 1980-08-18 |
GB2042542A (en) | 1980-09-24 |
SU1082316A3 (ru) | 1984-03-23 |
BR8000910A (pt) | 1980-10-29 |
JPS5928544B2 (ja) | 1984-07-13 |
NL8000620A (nl) | 1980-08-19 |
IL59190A (en) | 1983-06-15 |
ATA85480A (de) | 1983-02-15 |
DE3003960C2 (cs) | 1990-07-05 |
IT8047892A0 (it) | 1980-02-13 |
SE447897B (sv) | 1986-12-22 |
CH642049A5 (fr) | 1984-03-30 |
DK153392B (da) | 1988-07-11 |
IT1127360B (it) | 1986-05-21 |
YU42323B (en) | 1988-08-31 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE2441650C3 (de) | Verfahren zur Herstellung von halogenierten aromatischen primären Aminen | |
DE2549900C3 (de) | Verfahren zur Herstellung chlorierter aromatischer Amine | |
DE2118369C3 (de) | Verfahren zur Herstellung von N-Arylhydroxylaminen | |
CH637036A5 (de) | Verfahren zur herstellung eines raney-nickel-eisen-katalysators mit hohem eisengehalt. | |
DD149060A5 (de) | Verfahren zur herstellung m-chlor-substituierter aniline | |
DE2316028B2 (de) | Verfahren zur gleichzeitigen Verringerung des Gehalts an Verbindungen mit hydrolysierbarem Chlor und an sauer wirkenden Verbindungen in einem organischen Roh-Isocyanat | |
DE2503187B2 (de) | Verfahren zur Herstellung durch Chlor meta-substituierte Aniline | |
DE2615079A1 (de) | Verfahren zur katalytischen reduktion von halogensubstituierten mononitroaromatischen kohlenwasserstoffen | |
DE3443385C2 (cs) | ||
DD298088A5 (de) | Verfahren zur herstellung von chlorsubstituierten aromatischen aminen | |
DE2436111C2 (de) | Verfahren zur Herstellung eines Phenylendiamins | |
DD295339A5 (de) | Verfahren zur hydrierung von halogenierten nitroaromaten in gegenwart einer schwefelverbindung | |
DD299175A5 (de) | Verfahren zur hydrierung von halogenierten nitroaromatischen verbindungen in gegenwart von katalysatoren auf der grundlage von edelmetallen | |
DD149062A5 (de) | Verfahren zur herstellung m-chlorsubstituierter aniline | |
DE2709966B1 (de) | Verfahren zur Herstellung von ß- Dimethylaminopropionitril | |
DD149061A5 (de) | Verfahren zur herstellung m-chlorsubstituierter aniline | |
DE2903950A1 (de) | Verfahren zur herstellung von urethanen | |
DE2258769B2 (de) | Verfahren zur Herstellung von Halogenanilinen | |
EP0030269B1 (de) | Verfahren zur Rückführung des Edelmetallkatalysators bei der Herstellung aromatischer Urethane | |
DD201584A5 (de) | Verfahren zur selektiven herstellung m-chlorierter aniline | |
EP0479877B1 (de) | Verfahren zur herstellung von n-alkyl-halogenanilinen | |
DE2743610C3 (de) | Verfahren zur Herstellung von chlorsubstituierten aromatischen Aminen | |
EP0173202B1 (de) | Verfahren zur Herstellung von Chlor-o-nitroanilinen | |
DE2609530B1 (de) | Verfahren zur herstellung von hydrazobenzol | |
DD201894A5 (de) | Verfahren zur herstellung von 2-(4-aminophenyl)5-aminobenzimidazol und seinen substituierten derivaten |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
ENJ | Ceased due to non-payment of renewal fee |