CZ2006598A3 - Tricyklická benzopyranová sloucenina jako antiarytmické cinidlo - Google Patents
Tricyklická benzopyranová sloucenina jako antiarytmické cinidlo Download PDFInfo
- Publication number
- CZ2006598A3 CZ2006598A3 CZ20060598A CZ2006598A CZ2006598A3 CZ 2006598 A3 CZ2006598 A3 CZ 2006598A3 CZ 20060598 A CZ20060598 A CZ 20060598A CZ 2006598 A CZ2006598 A CZ 2006598A CZ 2006598 A3 CZ2006598 A3 CZ 2006598A3
- Authority
- CZ
- Czechia
- Prior art keywords
- group
- carbon atoms
- amino
- halogen atom
- optionally substituted
- Prior art date
Links
- -1 benzopyran compound Chemical class 0.000 title claims description 964
- 239000003416 antiarrhythmic agent Substances 0.000 title abstract description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 608
- 125000003277 amino group Chemical group 0.000 claims abstract description 140
- 150000001562 benzopyrans Chemical class 0.000 claims abstract description 125
- 150000003839 salts Chemical class 0.000 claims abstract description 124
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 91
- 150000001875 compounds Chemical class 0.000 claims abstract description 36
- 125000004429 atom Chemical group 0.000 claims abstract description 21
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 12
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims abstract description 11
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 10
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 9
- 125000004430 oxygen atom Chemical group O* 0.000 claims abstract description 9
- 125000004434 sulfur atom Chemical group 0.000 claims abstract description 9
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 5
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 claims abstract description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 534
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 440
- 125000005843 halogen group Chemical group 0.000 claims description 283
- 125000000217 alkyl group Chemical group 0.000 claims description 253
- 125000003545 alkoxy group Chemical group 0.000 claims description 234
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 191
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 175
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 113
- 125000003118 aryl group Chemical group 0.000 claims description 84
- 125000001072 heteroaryl group Chemical group 0.000 claims description 68
- 125000000623 heterocyclic group Chemical group 0.000 claims description 46
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 44
- 229910052799 carbon Inorganic materials 0.000 claims description 41
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 39
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 36
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 36
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 35
- 125000005129 aryl carbonyl group Chemical group 0.000 claims description 33
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 29
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 27
- 125000005223 heteroarylcarbonyl group Chemical group 0.000 claims description 27
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 claims description 26
- 101100298295 Drosophila melanogaster flfl gene Proteins 0.000 claims description 25
- 125000003282 alkyl amino group Chemical group 0.000 claims description 25
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 25
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 claims description 25
- IQQDNMHUOLMLNJ-UHFFFAOYSA-N quinolin-3-ol Chemical compound C1=CC=CC2=CC(O)=CN=C21 IQQDNMHUOLMLNJ-UHFFFAOYSA-N 0.000 claims description 24
- 150000001721 carbon Chemical group 0.000 claims description 22
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 22
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 22
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 19
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 18
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 17
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 15
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 claims description 15
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 claims description 15
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 15
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 14
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 13
- 241000543381 Cliftonia monophylla Species 0.000 claims description 13
- 125000001769 aryl amino group Chemical group 0.000 claims description 13
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical group NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 claims description 12
- 125000005241 heteroarylamino group Chemical group 0.000 claims description 12
- 125000005143 heteroarylsulfonyl group Chemical group 0.000 claims description 12
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 12
- 125000006254 cycloalkyl carbonyl group Chemical group 0.000 claims description 11
- 229910052736 halogen Inorganic materials 0.000 claims description 10
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims description 8
- 238000011282 treatment Methods 0.000 claims description 8
- 206010003119 arrhythmia Diseases 0.000 claims description 7
- 230000006793 arrhythmia Effects 0.000 claims description 7
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 claims description 7
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 6
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 6
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 6
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 6
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 239000004480 active ingredient Substances 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 125000006296 sulfonyl amino group Chemical group [H]N(*)S(*)(=O)=O 0.000 claims description 5
- CHIOVPNYOWEUJW-UHFFFAOYSA-N 2,2,7-trimethyl-4-(2-phenylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound C12=CC3=NC(C)=CC=C3C=C2OC(C)(C)C(O)C1NCCC1=CC=CC=C1 CHIOVPNYOWEUJW-UHFFFAOYSA-N 0.000 claims description 4
- HZIDZZCZABOJDG-UHFFFAOYSA-N 7-chloro-2,2,9-trimethyl-4-(3-methylbutylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound C1=C(Cl)N=C2C=C3C(NCCC(C)C)C(O)C(C)(C)OC3=CC2=C1C HZIDZZCZABOJDG-UHFFFAOYSA-N 0.000 claims description 4
- MALZGBGSFIRJBT-UHFFFAOYSA-N 7-chloro-4-(2-cyclopentylethylamino)-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(Cl)=NC3=CC=2C1NCCC1CCCC1 MALZGBGSFIRJBT-UHFFFAOYSA-N 0.000 claims description 4
- NFWWZVHIWDPWEY-UHFFFAOYSA-N 7-chloro-4-[2-(cyclopenten-1-yl)ethylamino]-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(Cl)=NC3=CC=2C1NCCC1=CCCC1 NFWWZVHIWDPWEY-UHFFFAOYSA-N 0.000 claims description 4
- KEOCMVKQQCQIJF-UHFFFAOYSA-N 8-hydroxy-4,7,7-trimethyl-9-(2-phenylethylamino)-8,9-dihydropyrano[2,3-g][1,4]benzoxazin-3-one Chemical compound OC1C(C)(C)OC=2C=C3N(C)C(=O)COC3=CC=2C1NCCC1=CC=CC=C1 KEOCMVKQQCQIJF-UHFFFAOYSA-N 0.000 claims description 4
- IDLTUNKJYAGSFN-UHFFFAOYSA-N 2,2-dimethyl-4-(2-phenylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC2=CC3=CC=CN=C3C=C2C1NCCC1=CC=CC=C1 IDLTUNKJYAGSFN-UHFFFAOYSA-N 0.000 claims description 3
- YFUJXCXOIXYJBA-UHFFFAOYSA-N 3-hydroxy-2,2,9-trimethyl-4-(2-phenylethylamino)-4,6-dihydro-3h-pyrano[2,3-g]quinolin-7-one Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(O)=NC3=CC=2C1NCCC1=CC=CC=C1 YFUJXCXOIXYJBA-UHFFFAOYSA-N 0.000 claims description 3
- WEPXBRHBWVVKAZ-UHFFFAOYSA-N 4-[2-(4-fluorophenyl)ethylamino]-7-(hydroxymethyl)-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(CO)=NC3=CC=2C1NCCC1=CC=C(F)C=C1 WEPXBRHBWVVKAZ-UHFFFAOYSA-N 0.000 claims description 3
- AOKCDZVLSLZJQS-UHFFFAOYSA-N 7-(aminomethyl)-2,2,9-trimethyl-4-(2-phenylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(CN)=NC3=CC=2C1NCCC1=CC=CC=C1 AOKCDZVLSLZJQS-UHFFFAOYSA-N 0.000 claims description 3
- NGWVFMQMEXBFMD-UHFFFAOYSA-N 7-chloro-2,2,9-trimethyl-4-(2-phenylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(Cl)=NC3=CC=2C1NCCC1=CC=CC=C1 NGWVFMQMEXBFMD-UHFFFAOYSA-N 0.000 claims description 3
- FQLGOINSFWFWGI-UHFFFAOYSA-N 7-chloro-2,2,9-trimethyl-4-(2-pyridin-2-ylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(Cl)=NC3=CC=2C1NCCC1=CC=CC=N1 FQLGOINSFWFWGI-UHFFFAOYSA-N 0.000 claims description 3
- UVSBPVGBBJBIPA-UHFFFAOYSA-N 7-chloro-2,2,9-trimethyl-4-(2-pyridin-3-ylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(Cl)=NC3=CC=2C1NCCC1=CC=CN=C1 UVSBPVGBBJBIPA-UHFFFAOYSA-N 0.000 claims description 3
- ACZVHCBJCSMHIL-UHFFFAOYSA-N 7-chloro-2,2,9-trimethyl-4-(pentylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound C1=C(Cl)N=C2C=C3C(NCCCCC)C(O)C(C)(C)OC3=CC2=C1C ACZVHCBJCSMHIL-UHFFFAOYSA-N 0.000 claims description 3
- KCHOBYCFOXAKNM-UHFFFAOYSA-N 7-chloro-4-(2-cyclohexylethylamino)-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(Cl)=NC3=CC=2C1NCCC1CCCCC1 KCHOBYCFOXAKNM-UHFFFAOYSA-N 0.000 claims description 3
- FQNGONYRIBIZMD-UHFFFAOYSA-N 7-chloro-4-[2-(4-chloropyrazol-1-yl)ethylamino]-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(Cl)=NC3=CC=2C1NCCN1C=C(Cl)C=N1 FQNGONYRIBIZMD-UHFFFAOYSA-N 0.000 claims description 3
- CYRVNMMXCDNQLC-UHFFFAOYSA-N 9-(hydroxymethyl)-2,2-dimethyl-4-(2-phenylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC2=CC3=C(CO)C=CN=C3C=C2C1NCCC1=CC=CC=C1 CYRVNMMXCDNQLC-UHFFFAOYSA-N 0.000 claims description 3
- WXXVQWSDMOAHHV-UHFFFAOYSA-N quinoline-7-carboxylic acid Chemical compound C1=CC=NC2=CC(C(=O)O)=CC=C21 WXXVQWSDMOAHHV-UHFFFAOYSA-N 0.000 claims description 3
- 125000004001 thioalkyl group Chemical group 0.000 claims description 3
- XEQQREZFQJPKEY-UHFFFAOYSA-N 3,3-dimethyl-1-(2-phenylethylamino)-1,2-dihydropyrano[3,2-f]quinolin-2-ol Chemical compound OC1C(C)(C)OC2=CC=C3N=CC=CC3=C2C1NCCC1=CC=CC=C1 XEQQREZFQJPKEY-UHFFFAOYSA-N 0.000 claims description 2
- OWYYYCYHGORREH-UHFFFAOYSA-N 3-hydroxy-2,2,9-trimethyl-4-(2-phenylethylamino)-3,4-dihydropyrano[2,3-g]quinoline-7-carbonitrile Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(C#N)=NC3=CC=2C1NCCC1=CC=CC=C1 OWYYYCYHGORREH-UHFFFAOYSA-N 0.000 claims description 2
- OXMHZVORVYGRFZ-UHFFFAOYSA-N 3-hydroxy-2,2,9-trimethyl-4-(2-phenylethylamino)-3,4-dihydropyrano[2,3-g]quinoline-7-carboxamide Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(C(N)=O)=NC3=CC=2C1NCCC1=CC=CC=C1 OXMHZVORVYGRFZ-UHFFFAOYSA-N 0.000 claims description 2
- VNWFRXCRHVNMIC-UHFFFAOYSA-N 4-(1-benzofuran-2-ylmethylamino)-7-chloro-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound C1=CC=C2OC(CNC3C=4C=C5N=C(Cl)C=C(C5=CC=4OC(C)(C)C3O)C)=CC2=C1 VNWFRXCRHVNMIC-UHFFFAOYSA-N 0.000 claims description 2
- ZZUSANGEAUESFL-UHFFFAOYSA-N 7-(hydroxymethyl)-2,2,9-trimethyl-4-(2-phenylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(CO)=NC3=CC=2C1NCCC1=CC=CC=C1 ZZUSANGEAUESFL-UHFFFAOYSA-N 0.000 claims description 2
- XPLJCDNSBAXQRO-UHFFFAOYSA-N 7-chloro-2,2,9-trimethyl-4-(2-methylpropylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound C1=C(Cl)N=C2C=C3C(NCC(C)C)C(O)C(C)(C)OC3=CC2=C1C XPLJCDNSBAXQRO-UHFFFAOYSA-N 0.000 claims description 2
- MXIJWHXNCBQJHS-UHFFFAOYSA-N 7-chloro-2,2,9-trimethyl-4-(2-pyridin-4-ylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(Cl)=NC3=CC=2C1NCCC1=CC=NC=C1 MXIJWHXNCBQJHS-UHFFFAOYSA-N 0.000 claims description 2
- IHFXTCWKIXGPLI-UHFFFAOYSA-N 7-chloro-2,2,9-trimethyl-4-[2-(1-methylpyrrolidin-2-yl)ethylamino]-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound CN1CCCC1CCNC1C2=CC3=NC(Cl)=CC(C)=C3C=C2OC(C)(C)C1O IHFXTCWKIXGPLI-UHFFFAOYSA-N 0.000 claims description 2
- FPRQSHYHIOERJP-UHFFFAOYSA-N 7-chloro-2,2,9-trimethyl-4-[2-(4-methylpyrazol-1-yl)ethylamino]-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound C1=C(C)C=NN1CCNC1C2=CC3=NC(Cl)=CC(C)=C3C=C2OC(C)(C)C1O FPRQSHYHIOERJP-UHFFFAOYSA-N 0.000 claims description 2
- OCWSNZPOQFDULI-UHFFFAOYSA-N 7-chloro-4-(2-hydroxypentylamino)-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound C1=C(Cl)N=C2C=C3C(NCC(O)CCC)C(O)C(C)(C)OC3=CC2=C1C OCWSNZPOQFDULI-UHFFFAOYSA-N 0.000 claims description 2
- BKMVAQVEIIIEJD-UHFFFAOYSA-N 7-chloro-4-(cyclopropylmethylamino)-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(Cl)=NC3=CC=2C1NCC1CC1 BKMVAQVEIIIEJD-UHFFFAOYSA-N 0.000 claims description 2
- LCMZFFXCFJBKEW-UHFFFAOYSA-N 7-chloro-4-(ethylamino)-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound C1=C(Cl)N=C2C=C3C(NCC)C(O)C(C)(C)OC3=CC2=C1C LCMZFFXCFJBKEW-UHFFFAOYSA-N 0.000 claims description 2
- AHJQDTJTOLKGCR-UHFFFAOYSA-N 7-chloro-4-[2-(n-ethyl-3-methylanilino)ethylamino]-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC2=CC3=C(C)C=C(Cl)N=C3C=C2C1NCCN(CC)C1=CC=CC(C)=C1 AHJQDTJTOLKGCR-UHFFFAOYSA-N 0.000 claims description 2
- BAQBVLMAIRROTP-OZJRSANCSA-N 7-chloro-4-[[(2r)-1-ethylpyrrolidin-2-yl]methylamino]-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound CCN1CCC[C@@H]1CNC1C2=CC3=NC(Cl)=CC(C)=C3C=C2OC(C)(C)C1O BAQBVLMAIRROTP-OZJRSANCSA-N 0.000 claims description 2
- WPHXOSQLRPKBQC-UHFFFAOYSA-N 7-chloro-4-[[6-(4-chlorophenyl)pyridin-3-yl]methylamino]-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(Cl)=NC3=CC=2C1NCC(C=N1)=CC=C1C1=CC=C(Cl)C=C1 WPHXOSQLRPKBQC-UHFFFAOYSA-N 0.000 claims description 2
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical compound C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 2
- 239000008194 pharmaceutical composition Substances 0.000 claims 2
- LMVGPQNBHMECBB-UHFFFAOYSA-N 2,2,7,9-tetramethyl-4-(2-phenylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound C12=CC3=NC(C)=CC(C)=C3C=C2OC(C)(C)C(O)C1NCCC1=CC=CC=C1 LMVGPQNBHMECBB-UHFFFAOYSA-N 0.000 claims 1
- 125000003890 2-phenylbutyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 claims 1
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims 1
- YHKRTDZFVQAXNA-UHFFFAOYSA-N 4-(2-anilinoethylamino)-7-chloro-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(Cl)=NC3=CC=2C1NCCNC1=CC=CC=C1 YHKRTDZFVQAXNA-UHFFFAOYSA-N 0.000 claims 1
- KMKAFGPNRRAYKI-UHFFFAOYSA-N 7-chloro-2,2,9-trimethyl-4-(2-piperidin-1-ylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(Cl)=NC3=CC=2C1NCCN1CCCCC1 KMKAFGPNRRAYKI-UHFFFAOYSA-N 0.000 claims 1
- ZRKWCAVJGJNPNW-UHFFFAOYSA-N 7-chloro-2,2,9-trimethyl-4-(2-thiophen-3-ylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(Cl)=NC3=CC=2C1NCCC=1C=CSC=1 ZRKWCAVJGJNPNW-UHFFFAOYSA-N 0.000 claims 1
- YMBOASLJUYMDCP-UHFFFAOYSA-N 7-chloro-2,2,9-trimethyl-4-(5-methylhexan-2-ylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound C1=C(Cl)N=C2C=C3C(NC(C)CCC(C)C)C(O)C(C)(C)OC3=CC2=C1C YMBOASLJUYMDCP-UHFFFAOYSA-N 0.000 claims 1
- HSXRMLRUJJJOPX-UHFFFAOYSA-N 7-chloro-2,2,9-trimethyl-4-[2-(thian-4-yl)ethylamino]-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(Cl)=NC3=CC=2C1NCCC1CCSCC1 HSXRMLRUJJJOPX-UHFFFAOYSA-N 0.000 claims 1
- DHAAIWSOKGHKQM-UHFFFAOYSA-N quinoline-3,7-diol Chemical compound N1=CC(=CC2=CC=C(C=C12)O)O DHAAIWSOKGHKQM-UHFFFAOYSA-N 0.000 claims 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 abstract description 4
- 125000005915 C6-C14 aryl group Chemical group 0.000 abstract 2
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 abstract 1
- 125000006553 (C3-C8) cycloalkenyl group Chemical group 0.000 abstract 1
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 abstract 1
- 239000000470 constituent Substances 0.000 abstract 1
- 239000000460 chlorine Substances 0.000 description 1141
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 567
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 554
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 364
- 125000004458 methylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])[H] 0.000 description 254
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 164
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 51
- 239000002904 solvent Substances 0.000 description 37
- 229920000728 polyester Polymers 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 11
- 230000000694 effects Effects 0.000 description 11
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 239000012071 phase Substances 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 8
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 8
- 229910006069 SO3H Inorganic materials 0.000 description 7
- 229910007219 SnPr Inorganic materials 0.000 description 7
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 7
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 6
- 125000005842 heteroatom Chemical group 0.000 description 5
- 239000003446 ligand Substances 0.000 description 5
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 5
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 4
- 239000003377 acid catalyst Substances 0.000 description 4
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 210000003205 muscle Anatomy 0.000 description 4
- BWHDROKFUHTORW-UHFFFAOYSA-N tritert-butylphosphane Chemical compound CC(C)(C)P(C(C)(C)C)C(C)(C)C BWHDROKFUHTORW-UHFFFAOYSA-N 0.000 description 4
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 description 3
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- 241001609027 Brosme Species 0.000 description 3
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 3
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 3
- 229910052707 ruthenium Inorganic materials 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 229910052723 transition metal Inorganic materials 0.000 description 3
- 150000003624 transition metals Chemical class 0.000 description 3
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 3
- 230000002861 ventricular Effects 0.000 description 3
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 2
- 125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 description 2
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 2
- KBOCOAKGVSVDNO-UHFFFAOYSA-N 7-chloro-4-[(2-hydroxy-2-phenylethyl)amino]-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(Cl)=NC3=CC=2C1NCC(O)C1=CC=CC=C1 KBOCOAKGVSVDNO-UHFFFAOYSA-N 0.000 description 2
- KTZDNDVKDFBDHQ-UHFFFAOYSA-N 7-chloro-4-[2-(2-fluorophenyl)ethylamino]-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(Cl)=NC3=CC=2C1NCCC1=CC=CC=C1F KTZDNDVKDFBDHQ-UHFFFAOYSA-N 0.000 description 2
- ODTMNOQRTBPFTK-UHFFFAOYSA-N 7-chloro-4-[2-(4-chlorophenyl)ethylamino]-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(Cl)=NC3=CC=2C1NCCC1=CC=C(Cl)C=C1 ODTMNOQRTBPFTK-UHFFFAOYSA-N 0.000 description 2
- SJROYWSEXZWKAM-UHFFFAOYSA-N 7-chloro-4-[2-(4-fluorophenyl)ethylamino]-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(Cl)=NC3=CC=2C1NCCC1=CC=C(F)C=C1 SJROYWSEXZWKAM-UHFFFAOYSA-N 0.000 description 2
- HZUJFGLZSGYMQT-UHFFFAOYSA-N 8-hydroxy-7,7-dimethyl-9-(2-phenylethylamino)-8,9-dihydro-1h-pyrano[3,2-g][1,4]benzoxazin-2-one Chemical compound OC1C(C)(C)OC2=CC=3OCC(=O)NC=3C=C2C1NCCC1=CC=CC=C1 HZUJFGLZSGYMQT-UHFFFAOYSA-N 0.000 description 2
- KOCXCSREADKFMD-UHFFFAOYSA-N 8-hydroxy-7,7-dimethyl-9-(2-phenylethylamino)-8,9-dihydro-4h-pyrano[2,3-g][1,4]benzoxazin-3-one Chemical compound OC1C(C)(C)OC2=CC=3NC(=O)COC=3C=C2C1NCCC1=CC=CC=C1 KOCXCSREADKFMD-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- TVZCRIROJQEVOT-CABCVRRESA-N Cromakalim Chemical compound N1([C@@H]2C3=CC(=CC=C3OC([C@H]2O)(C)C)C#N)CCCC1=O TVZCRIROJQEVOT-CABCVRRESA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000007810 chemical reaction solvent Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 229950004210 cromakalim Drugs 0.000 description 2
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 2
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- 125000006260 ethylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004672 ethylcarbonyl group Chemical group [H]C([H])([H])C([H])([H])C(*)=O 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- MHCFAGZWMAWTNR-UHFFFAOYSA-M lithium perchlorate Chemical compound [Li+].[O-]Cl(=O)(=O)=O MHCFAGZWMAWTNR-UHFFFAOYSA-M 0.000 description 2
- 229910001486 lithium perchlorate Inorganic materials 0.000 description 2
- 150000002688 maleic acid derivatives Chemical class 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- 125000004674 methylcarbonyl group Chemical group CC(=O)* 0.000 description 2
- 125000002004 n-butylamino group Chemical group [H]N(*)C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004676 n-butylcarbonyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C(*)=O 0.000 description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000006252 n-propylcarbonyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C(*)=O 0.000 description 2
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 2
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 2
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 description 2
- 125000004940 pyridazin-4-yl group Chemical group N1=NC=C(C=C1)* 0.000 description 2
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 2
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 2
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 125000006413 ring segment Chemical group 0.000 description 2
- YBCAZPLXEGKKFM-UHFFFAOYSA-K ruthenium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Ru+3] YBCAZPLXEGKKFM-UHFFFAOYSA-K 0.000 description 2
- 125000005309 thioalkoxy group Chemical group 0.000 description 2
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 2
- YWWDBCBWQNCYNR-UHFFFAOYSA-N trimethylphosphine Chemical compound CP(C)C YWWDBCBWQNCYNR-UHFFFAOYSA-N 0.000 description 2
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 2
- COIOYMYWGDAQPM-UHFFFAOYSA-N tris(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C COIOYMYWGDAQPM-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- UKSZBOKPHAQOMP-SVLSSHOZSA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 UKSZBOKPHAQOMP-SVLSSHOZSA-N 0.000 description 1
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 1
- QFMZQPDHXULLKC-UHFFFAOYSA-N 1,2-bis(diphenylphosphino)ethane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)CCP(C=1C=CC=CC=1)C1=CC=CC=C1 QFMZQPDHXULLKC-UHFFFAOYSA-N 0.000 description 1
- LVEYOSJUKRVCCF-UHFFFAOYSA-N 1,3-bis(diphenylphosphino)propane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)CCCP(C=1C=CC=CC=1)C1=CC=CC=C1 LVEYOSJUKRVCCF-UHFFFAOYSA-N 0.000 description 1
- VLOYHAHOSOHRFO-UHFFFAOYSA-N 1-[3-hydroxy-2,2,9-trimethyl-4-(2-phenylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-7-yl]ethanone Chemical compound C12=CC3=NC(C(=O)C)=CC(C)=C3C=C2OC(C)(C)C(O)C1NCCC1=CC=CC=C1 VLOYHAHOSOHRFO-UHFFFAOYSA-N 0.000 description 1
- PTXVSDKCUJCCLC-UHFFFAOYSA-N 1-hydroxyindole Chemical compound C1=CC=C2N(O)C=CC2=C1 PTXVSDKCUJCCLC-UHFFFAOYSA-N 0.000 description 1
- VGCNVPXAIFXIDF-UHFFFAOYSA-N 2h-chromen-4-amine Chemical class C1=CC=C2C(N)=CCOC2=C1 VGCNVPXAIFXIDF-UHFFFAOYSA-N 0.000 description 1
- 125000006041 3-hexenyl group Chemical group 0.000 description 1
- ZVQPSPFZVMLTID-UHFFFAOYSA-N 4-(benzylamino)-7-chloro-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(Cl)=NC3=CC=2C1NCC1=CC=CC=C1 ZVQPSPFZVMLTID-UHFFFAOYSA-N 0.000 description 1
- ILAFKBRUZSFDLN-UHFFFAOYSA-N 4-[2-(1,3-benzodioxol-5-yl)ethylamino]-7-chloro-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound C1=C2OCOC2=CC(CCNC2C=3C=C4N=C(Cl)C=C(C4=CC=3OC(C)(C)C2O)C)=C1 ILAFKBRUZSFDLN-UHFFFAOYSA-N 0.000 description 1
- BCJVBDBJSMFBRW-UHFFFAOYSA-N 4-diphenylphosphanylbutyl(diphenyl)phosphane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)CCCCP(C=1C=CC=CC=1)C1=CC=CC=C1 BCJVBDBJSMFBRW-UHFFFAOYSA-N 0.000 description 1
- XVQLNGKUONDIFY-UHFFFAOYSA-N 7,7-dimethyl-9-(2-phenylethylamino)-2,3,8,9-tetrahydro-1h-pyrano[3,2-g][1,4]benzoxazin-8-ol Chemical compound OC1C(C)(C)OC2=CC=3OCCNC=3C=C2C1NCCC1=CC=CC=C1 XVQLNGKUONDIFY-UHFFFAOYSA-N 0.000 description 1
- XBWPQJQYWLKBCY-UHFFFAOYSA-N 7,7-dimethyl-9-(2-phenylethylamino)-3,4,8,9-tetrahydro-2h-pyrano[2,3-g][1,4]benzoxazin-8-ol Chemical compound OC1C(C)(C)OC2=CC=3NCCOC=3C=C2C1NCCC1=CC=CC=C1 XBWPQJQYWLKBCY-UHFFFAOYSA-N 0.000 description 1
- WQZQDRKMVROFHJ-UHFFFAOYSA-N 7-chloro-2,2,9-trimethyl-4-(2-phenylbutylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC2=CC3=C(C)C=C(Cl)N=C3C=C2C1NCC(CC)C1=CC=CC=C1 WQZQDRKMVROFHJ-UHFFFAOYSA-N 0.000 description 1
- BRRSSWQQYAKFDT-UHFFFAOYSA-N 7-chloro-2,2,9-trimethyl-4-(2-pyrazol-1-ylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(Cl)=NC3=CC=2C1NCCN1C=CC=N1 BRRSSWQQYAKFDT-UHFFFAOYSA-N 0.000 description 1
- HVQPLDFHLAONCL-UHFFFAOYSA-N 7-chloro-2,2,9-trimethyl-4-(3-phenylpropylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound OC1C(C)(C)OC=2C=C3C(C)=CC(Cl)=NC3=CC=2C1NCCCC1=CC=CC=C1 HVQPLDFHLAONCL-UHFFFAOYSA-N 0.000 description 1
- WKCNSSVKPYPGHL-UHFFFAOYSA-N 7-chloro-4-(2,2-diethoxyethylamino)-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol Chemical compound C1=C(Cl)N=C2C=C3C(NCC(OCC)OCC)C(O)C(C)(C)OC3=CC2=C1C WKCNSSVKPYPGHL-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- OCUCCJIRFHNWBP-IYEMJOQQSA-L Copper gluconate Chemical class [Cu+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O OCUCCJIRFHNWBP-IYEMJOQQSA-L 0.000 description 1
- 241000282414 Homo sapiens Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 208000008589 Obesity Diseases 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 206010042434 Sudden death Diseases 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 208000018452 Torsade de pointes Diseases 0.000 description 1
- 208000002363 Torsades de Pointes Diseases 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000002078 anthracen-1-yl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C([*])=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 125000000748 anthracen-2-yl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C([H])=C([*])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- SIKJAQJRHWYJAI-UHFFFAOYSA-N benzopyrrole Natural products C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- YNHIGQDRGKUECZ-UHFFFAOYSA-L bis(triphenylphosphine)palladium(ii) dichloride Chemical compound [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 1
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 1
- VSPLSJCNZPDHCN-UHFFFAOYSA-M carbon monoxide;iridium;triphenylphosphane;chloride Chemical compound [Cl-].[Ir].[O+]#[C-].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 VSPLSJCNZPDHCN-UHFFFAOYSA-M 0.000 description 1
- 125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 230000002596 correlated effect Effects 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- WIWBLJMBLGWSIN-UHFFFAOYSA-L dichlorotris(triphenylphosphine)ruthenium(ii) Chemical compound [Cl-].[Cl-].[Ru+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 WIWBLJMBLGWSIN-UHFFFAOYSA-L 0.000 description 1
- MQIKJSYMMJWAMP-UHFFFAOYSA-N dicobalt octacarbonyl Chemical group [Co+2].[Co+2].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] MQIKJSYMMJWAMP-UHFFFAOYSA-N 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- IXTMWRCNAAVVAI-UHFFFAOYSA-N dofetilide Chemical compound C=1C=C(NS(C)(=O)=O)C=CC=1CCN(C)CCOC1=CC=C(NS(C)(=O)=O)C=C1 IXTMWRCNAAVVAI-UHFFFAOYSA-N 0.000 description 1
- 229960002994 dofetilide Drugs 0.000 description 1
- 239000003759 ester based solvent Substances 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- VMDTXBZDEOAFQF-UHFFFAOYSA-N formaldehyde;ruthenium Chemical compound [Ru].O=C VMDTXBZDEOAFQF-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 210000002837 heart atrium Anatomy 0.000 description 1
- ZPZZKNJQGCUFFP-UHFFFAOYSA-N hexan-3-ylphosphane Chemical compound CCCC(P)CC ZPZZKNJQGCUFFP-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- ORTFAQDWJHRMNX-UHFFFAOYSA-N hydroxidooxidocarbon(.) Chemical compound O[C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-N 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000003893 lactate salts Chemical class 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 150000004701 malic acid derivatives Chemical class 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 210000004165 myocardium Anatomy 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000004888 n-propyl amino group Chemical group [H]N(*)C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005933 neopentyloxycarbonyl group Chemical group 0.000 description 1
- 235000020824 obesity Nutrition 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- SONJTKJMTWTJCT-UHFFFAOYSA-K rhodium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Rh+3] SONJTKJMTWTJCT-UHFFFAOYSA-K 0.000 description 1
- QBERHIJABFXGRZ-UHFFFAOYSA-M rhodium;triphenylphosphane;chloride Chemical compound [Cl-].[Rh].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 QBERHIJABFXGRZ-UHFFFAOYSA-M 0.000 description 1
- BFPFOLJFUVTHEP-UHFFFAOYSA-N ruthenium;triphenylphosphane Chemical compound [Ru].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 BFPFOLJFUVTHEP-UHFFFAOYSA-N 0.000 description 1
- 150000003873 salicylate salts Chemical class 0.000 description 1
- 229960002370 sotalol Drugs 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 125000006253 t-butylcarbonyl group Chemical group [H]C([H])([H])C(C(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- RUPAXCPQAAOIPB-UHFFFAOYSA-N tert-butyl formate Chemical group CC(C)(C)OC=O RUPAXCPQAAOIPB-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- XTTGYFREQJCEML-UHFFFAOYSA-N tributyl phosphite Chemical compound CCCCOP(OCCCC)OCCCC XTTGYFREQJCEML-UHFFFAOYSA-N 0.000 description 1
- WLPUWLXVBWGYMZ-UHFFFAOYSA-N tricyclohexylphosphine Chemical compound C1CCCCC1P(C1CCCCC1)C1CCCCC1 WLPUWLXVBWGYMZ-UHFFFAOYSA-N 0.000 description 1
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 1
- RXJKFRMDXUJTEX-UHFFFAOYSA-N triethylphosphine Chemical compound CCP(CC)CC RXJKFRMDXUJTEX-UHFFFAOYSA-N 0.000 description 1
- AHZJKOKFZJYCLG-UHFFFAOYSA-K trifluoromethanesulfonate;ytterbium(3+) Chemical compound [Yb+3].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F AHZJKOKFZJYCLG-UHFFFAOYSA-K 0.000 description 1
- 125000001889 triflyl group Chemical group FC(F)(F)S(*)(=O)=O 0.000 description 1
- IGNTWNVBGLNYDV-UHFFFAOYSA-N triisopropylphosphine Chemical compound CC(C)P(C(C)C)C(C)C IGNTWNVBGLNYDV-UHFFFAOYSA-N 0.000 description 1
- KCTAHLRCZMOTKM-UHFFFAOYSA-N tripropylphosphane Chemical compound CCCP(CCC)CCC KCTAHLRCZMOTKM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/335—Heterocyclic compounds having oxygen as the only ring hetero atom, e.g. fungichromin
- A61K31/35—Heterocyclic compounds having oxygen as the only ring hetero atom, e.g. fungichromin having six-membered rings with one oxygen as the only ring hetero atom
- A61K31/352—Heterocyclic compounds having oxygen as the only ring hetero atom, e.g. fungichromin having six-membered rings with one oxygen as the only ring hetero atom condensed with carbocyclic rings, e.g. methantheline
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/06—Antiarrhythmics
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D498/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D498/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D515/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen, oxygen, and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D515/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen, oxygen, and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D515/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicinal Chemistry (AREA)
- Heart & Thoracic Surgery (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Cardiology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pyrane Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Plural Heterocyclic Compounds (AREA)
- Dental Preparations (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2004084605 | 2004-03-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CZ2006598A3 true CZ2006598A3 (cs) | 2006-11-15 |
Family
ID=34962589
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CZ20060598A CZ2006598A3 (cs) | 2004-03-23 | 2005-03-23 | Tricyklická benzopyranová sloucenina jako antiarytmické cinidlo |
Country Status (30)
| Country | Link |
|---|---|
| US (2) | US7652008B2 (https=) |
| EP (1) | EP1732929B1 (https=) |
| JP (1) | JP4840594B2 (https=) |
| KR (2) | KR101085979B1 (https=) |
| CN (3) | CN101429200B (https=) |
| AT (1) | ATE485299T1 (https=) |
| AU (2) | AU2005223612B2 (https=) |
| BR (1) | BRPI0508768A (https=) |
| CA (1) | CA2558139C (https=) |
| CY (1) | CY1111250T1 (https=) |
| CZ (1) | CZ2006598A3 (https=) |
| DE (1) | DE602005024245D1 (https=) |
| DK (1) | DK1732929T3 (https=) |
| EG (1) | EG27163A (https=) |
| ES (1) | ES2353021T3 (https=) |
| HR (1) | HRP20110005T1 (https=) |
| IL (1) | IL177950A (https=) |
| MX (1) | MXPA06010880A (https=) |
| NO (1) | NO339495B1 (https=) |
| NZ (2) | NZ585606A (https=) |
| PL (1) | PL1732929T3 (https=) |
| PT (1) | PT1732929E (https=) |
| RS (1) | RS51742B (https=) |
| RU (1) | RU2380370C2 (https=) |
| SI (1) | SI1732929T1 (https=) |
| SK (1) | SK287994B6 (https=) |
| TW (1) | TWI352704B (https=) |
| UA (1) | UA91189C2 (https=) |
| WO (1) | WO2005090357A1 (https=) |
| ZA (1) | ZA200607388B (https=) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR101085979B1 (ko) * | 2004-03-23 | 2011-11-22 | 닛산 가가쿠 고교 가부시키 가이샤 | 항부정맥제로 사용되는 삼환계 벤조피란 화합물 |
| AU2007225765B2 (en) | 2006-03-10 | 2012-05-24 | Nissan Chemical Industries, Ltd. | Process for producing optically active chromene oxide compound |
| WO2010018867A1 (ja) * | 2008-08-14 | 2010-02-18 | 日産化学工業株式会社 | ジ置換ベンゾピラン化合物 |
| RU2523279C2 (ru) * | 2009-04-30 | 2014-07-20 | Ниссан Кемикал Индастриз, Лтд. | Новая кристаллическая форма соединения трициклического бензопирана и способ его производства |
| LT2445502T (lt) | 2009-06-25 | 2017-09-25 | Alkermes Pharma Ireland Limited | Heterocikliniai junginiai, skirti neurologinių ir fiziologinių susirgimų gydymui |
| WO2014050613A1 (ja) * | 2012-09-27 | 2014-04-03 | 日産化学工業株式会社 | 含窒素複素環n-オキシド化合物の製造方法 |
| CN104507949B (zh) * | 2012-09-27 | 2017-07-28 | 日产化学工业株式会社 | 高纯度的含氮杂环化合物的制造方法 |
| EP3026047A4 (en) * | 2013-07-25 | 2017-05-17 | Nissan Chemical Industries, Ltd. | Method for producing heterocyclic compound |
| EP3567044A4 (en) * | 2017-01-06 | 2020-06-10 | Korea University Research and Business Foundation, Sejong Campus | INNOVATIVE CHINOLINONE DERIVATIVE AND PHARMACEUTICAL COMPOSITION FOR THE PREVENTION OR TREATMENT OF ALLERGIC DISEASES LIKE ASTHMA OR ATOPIA THEREFORE AS AN ACTIVE SUBSTANCE |
| EP3761983A1 (en) | 2018-03-05 | 2021-01-13 | Alkermes Pharma Ireland Limited | Aripiprazole dosing strategy |
| CN108727261B (zh) * | 2018-06-21 | 2021-09-24 | 济南大学 | 一种硝基取代喹那啶的制备方法 |
| EP3903882B1 (en) * | 2018-12-28 | 2025-05-21 | Osaka University | Therapeutic agent for inherited bradyarrhythmia |
| RU2754610C1 (ru) | 2020-04-14 | 2021-09-03 | Георгий Викторович ТЕЦ | Препарат для лечения заболеваний, вызванных бактериями |
| CN115916201B (zh) * | 2020-06-26 | 2024-09-17 | 国立大学法人大阪大学 | 药剂诱发性心动过缓及心动过缓性心律失常治疗药 |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ZM7682A1 (en) | 1981-09-25 | 1983-05-23 | Beecham Group Plc | Active compounds |
| JPS5867683U (ja) | 1981-10-28 | 1983-05-09 | 株式会社ナムコ | 歩行ロボツト |
| JPH0699439B2 (ja) * | 1988-02-03 | 1994-12-07 | 日産化学工業株式会社 | ピラノベンゾオキサジアゾール誘導体 |
| JP2658198B2 (ja) * | 1988-06-23 | 1997-09-30 | 日産化学工業株式会社 | ピラノベンゾトリアゾール誘導体 |
| US5097037A (en) * | 1989-07-17 | 1992-03-17 | Nissan Chemical Industries, Ltd. | Process for the optical resolution of pyranobenzoxadiazole compounds |
| JP2876712B2 (ja) * | 1989-07-17 | 1999-03-31 | 日産化学工業株式会社 | 光学活性ピラノベンゾオキサジアゾール誘導体 |
| US5164509A (en) * | 1990-11-26 | 1992-11-17 | E. R. Squibb & Sons, Inc. | Benzodiazolo analogs |
| JPH07300414A (ja) * | 1993-04-02 | 1995-11-14 | Nissan Chem Ind Ltd | 心不全治療薬 |
| CZ254095A3 (en) * | 1993-04-02 | 1996-01-17 | Nissan Chemical Ind Ltd | Medicaments for heart insuffiency |
| JP2734457B2 (ja) | 1994-02-23 | 1998-03-30 | 日産化学工業株式会社 | 不斉エポキシ化反応 |
| WO1995034547A1 (en) * | 1994-06-10 | 1995-12-21 | Smithkline Beecham Plc | C-4 amide substituted compounds and their use as therapeutic agents |
| AR007115A1 (es) * | 1996-05-15 | 1999-10-13 | Hoechst Ag | Cromanos sustituidos con sulfonamida, procedimiento para su preparacion, su empleo para la preparacion de medicamento o agente de diagnostico, asi como medicamento que los contiene |
| US6486178B1 (en) | 1998-06-03 | 2002-11-26 | Nissan Chemical Industries, Ltd. | Indane derivatives |
| AU5444499A (en) | 1998-09-01 | 2000-03-21 | Nissan Chemical Industries Ltd. | Benzoxazine derivatives |
| WO2000058300A1 (en) | 1999-03-25 | 2000-10-05 | Nissan Chemical Industries, Ltd. | Chroman derivatives |
| HUP0202690A3 (en) * | 1999-09-17 | 2005-02-28 | Nissan Chemical Ind Ltd | Benzopyran derivative having antiarrhytmic activity |
| US6555574B1 (en) | 1999-09-24 | 2003-04-29 | Nissan Chemical Industries, Ltd. | 4-oxybenzopyran derivative |
| WO2001025224A1 (en) | 1999-10-05 | 2001-04-12 | Nissan Chemical Industries, Ltd. | 4-oxybenzopyran derivative |
| TW589305B (en) | 2001-02-14 | 2004-06-01 | Nissan Chemical Ind Ltd | 4-aminobenzopyran derivatives |
| HUP0400362A3 (en) | 2001-06-25 | 2007-05-29 | Nissan Chemical Ind Ltd | Substituted benzopyran derivetives against arrhythmia |
| WO2003014113A1 (en) | 2001-08-06 | 2003-02-20 | Glenmark Pharmaceuticals Limited | Novel benzopyran compounds and process for their preparation and use |
| KR101085979B1 (ko) * | 2004-03-23 | 2011-11-22 | 닛산 가가쿠 고교 가부시키 가이샤 | 항부정맥제로 사용되는 삼환계 벤조피란 화합물 |
-
2005
- 2005-03-23 KR KR1020107027058A patent/KR101085979B1/ko not_active Expired - Fee Related
- 2005-03-23 CA CA2558139A patent/CA2558139C/en not_active Expired - Fee Related
- 2005-03-23 US US10/590,975 patent/US7652008B2/en active Active
- 2005-03-23 SI SI200531171T patent/SI1732929T1/sl unknown
- 2005-03-23 KR KR1020067021988A patent/KR101019402B1/ko not_active Expired - Lifetime
- 2005-03-23 WO PCT/JP2005/006004 patent/WO2005090357A1/en not_active Ceased
- 2005-03-23 PT PT05727581T patent/PT1732929E/pt unknown
- 2005-03-23 NZ NZ585606A patent/NZ585606A/en not_active IP Right Cessation
- 2005-03-23 PL PL05727581T patent/PL1732929T3/pl unknown
- 2005-03-23 UA UAA200611101A patent/UA91189C2/ru unknown
- 2005-03-23 ZA ZA200607388A patent/ZA200607388B/en unknown
- 2005-03-23 CN CN2008101707921A patent/CN101429200B/zh not_active Expired - Fee Related
- 2005-03-23 SK SK5079-2006A patent/SK287994B6/sk not_active IP Right Cessation
- 2005-03-23 CN CN2005800090295A patent/CN1934116B/zh not_active Expired - Lifetime
- 2005-03-23 CZ CZ20060598A patent/CZ2006598A3/cs unknown
- 2005-03-23 AT AT05727581T patent/ATE485299T1/de active
- 2005-03-23 HR HR20110005T patent/HRP20110005T1/hr unknown
- 2005-03-23 AU AU2005223612A patent/AU2005223612B2/en not_active Ceased
- 2005-03-23 JP JP2006530022A patent/JP4840594B2/ja not_active Expired - Lifetime
- 2005-03-23 TW TW094108962A patent/TWI352704B/zh not_active IP Right Cessation
- 2005-03-23 CN CN2011100751168A patent/CN102190661B/zh not_active Expired - Fee Related
- 2005-03-23 RU RU2006137284/04A patent/RU2380370C2/ru not_active IP Right Cessation
- 2005-03-23 DE DE602005024245T patent/DE602005024245D1/de not_active Expired - Lifetime
- 2005-03-23 RS RS20110028A patent/RS51742B/sr unknown
- 2005-03-23 ES ES05727581T patent/ES2353021T3/es not_active Expired - Lifetime
- 2005-03-23 DK DK05727581.0T patent/DK1732929T3/da active
- 2005-03-23 EP EP05727581A patent/EP1732929B1/en not_active Expired - Lifetime
- 2005-03-23 BR BRPI0508768-6A patent/BRPI0508768A/pt not_active Application Discontinuation
- 2005-03-23 MX MXPA06010880A patent/MXPA06010880A/es active IP Right Grant
- 2005-03-23 NZ NZ549570A patent/NZ549570A/en not_active IP Right Cessation
-
2006
- 2006-09-02 EG EGNA2006000900 patent/EG27163A/xx active
- 2006-09-07 IL IL177950A patent/IL177950A/en not_active IP Right Cessation
- 2006-10-23 NO NO20064819A patent/NO339495B1/no not_active IP Right Cessation
-
2009
- 2009-11-17 US US12/591,353 patent/US7964623B2/en not_active Expired - Fee Related
-
2010
- 2010-07-08 AU AU2010202900A patent/AU2010202900B2/en not_active Ceased
-
2011
- 2011-01-19 CY CY20111100060T patent/CY1111250T1/el unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US7964623B2 (en) | Tricyclic benzopyrane compound | |
| US7041700B2 (en) | Substituted benzopyran derivatives against arrhythmia | |
| RU2366658C2 (ru) | Бензопирановое соединение | |
| JP2010065030A (ja) | 3環性スピロベンゾピラン化合物 | |
| JPWO2010018867A1 (ja) | ジ置換ベンゾピラン化合物 | |
| HK1099299B (en) | Tricyclic benzopyran compound as anti-arrhythmic agents | |
| JP2010065029A (ja) | 複素環ピラン化合物 |