CS237313B2 - Method of manufacture of wafles - Google Patents
Method of manufacture of wafles Download PDFInfo
- Publication number
- CS237313B2 CS237313B2 CS802161A CS216180A CS237313B2 CS 237313 B2 CS237313 B2 CS 237313B2 CS 802161 A CS802161 A CS 802161A CS 216180 A CS216180 A CS 216180A CS 237313 B2 CS237313 B2 CS 237313B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- weight
- wafer
- dough
- baking
- pan
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 16
- 238000004519 manufacturing process Methods 0.000 title claims description 11
- 235000012431 wafers Nutrition 0.000 claims description 126
- 235000013312 flour Nutrition 0.000 claims description 30
- 239000000843 powder Substances 0.000 claims description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 21
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims description 16
- 235000000346 sugar Nutrition 0.000 claims description 12
- 244000299461 Theobroma cacao Species 0.000 claims description 11
- 241000209140 Triticum Species 0.000 claims description 11
- 235000021307 Triticum Nutrition 0.000 claims description 11
- 235000003599 food sweetener Nutrition 0.000 claims description 11
- 239000003765 sweetening agent Substances 0.000 claims description 11
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 claims description 9
- 239000000787 lecithin Substances 0.000 claims description 9
- 235000010445 lecithin Nutrition 0.000 claims description 9
- 229940067606 lecithin Drugs 0.000 claims description 9
- 239000003995 emulsifying agent Substances 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 8
- 229910000030 sodium bicarbonate Inorganic materials 0.000 claims description 8
- 235000017557 sodium bicarbonate Nutrition 0.000 claims description 8
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 claims description 6
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 claims description 6
- 229920002472 Starch Polymers 0.000 claims description 6
- 235000012538 ammonium bicarbonate Nutrition 0.000 claims description 6
- 239000001099 ammonium carbonate Substances 0.000 claims description 6
- OUHCLAKJJGMPSW-UHFFFAOYSA-L magnesium;hydrogen carbonate;hydroxide Chemical compound O.[Mg+2].[O-]C([O-])=O OUHCLAKJJGMPSW-UHFFFAOYSA-L 0.000 claims description 6
- 239000003921 oil Substances 0.000 claims description 6
- 235000019198 oils Nutrition 0.000 claims description 6
- 235000015112 vegetable and seed oil Nutrition 0.000 claims description 6
- 239000008158 vegetable oil Substances 0.000 claims description 6
- 235000008939 whole milk Nutrition 0.000 claims description 6
- 235000009470 Theobroma cacao Nutrition 0.000 claims description 5
- 229940100445 wheat starch Drugs 0.000 claims description 5
- 229930006000 Sucrose Natural products 0.000 claims description 4
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 claims description 4
- 235000012054 meals Nutrition 0.000 claims description 4
- 239000005720 sucrose Substances 0.000 claims description 4
- 239000007864 aqueous solution Substances 0.000 claims description 3
- 235000017060 Arachis glabrata Nutrition 0.000 claims description 2
- 244000105624 Arachis hypogaea Species 0.000 claims description 2
- 235000010777 Arachis hypogaea Nutrition 0.000 claims description 2
- 235000018262 Arachis monticola Nutrition 0.000 claims description 2
- 235000020232 peanut Nutrition 0.000 claims description 2
- 210000003850 cellular structure Anatomy 0.000 claims 1
- 235000014594 pastries Nutrition 0.000 claims 1
- 235000002639 sodium chloride Nutrition 0.000 description 11
- 150000003839 salts Chemical class 0.000 description 10
- 235000010469 Glycine max Nutrition 0.000 description 6
- 235000019219 chocolate Nutrition 0.000 description 6
- 235000013305 food Nutrition 0.000 description 5
- 241000282994 Cervidae Species 0.000 description 4
- 210000003056 antler Anatomy 0.000 description 4
- 210000002969 egg yolk Anatomy 0.000 description 4
- 235000019483 Peanut oil Nutrition 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 239000000312 peanut oil Substances 0.000 description 3
- 244000068988 Glycine max Species 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 230000001413 cellular effect Effects 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000004806 packaging method and process Methods 0.000 description 2
- 235000008476 powdered milk Nutrition 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 235000012773 waffles Nutrition 0.000 description 2
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 102000002322 Egg Proteins Human genes 0.000 description 1
- 108010000912 Egg Proteins Proteins 0.000 description 1
- 239000005715 Fructose Substances 0.000 description 1
- 229930091371 Fructose Natural products 0.000 description 1
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 description 1
- 108010068370 Glutens Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 235000019764 Soybean Meal Nutrition 0.000 description 1
- 240000002805 Triticum turgidum Species 0.000 description 1
- TVXBFESIOXBWNM-UHFFFAOYSA-N Xylitol Natural products OCCC(O)C(O)C(O)CCO TVXBFESIOXBWNM-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 235000013345 egg yolk Nutrition 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 235000021312 gluten Nutrition 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- HEBKCHPVOIAQTA-UHFFFAOYSA-N meso ribitol Natural products OCC(O)C(O)C(O)CO HEBKCHPVOIAQTA-UHFFFAOYSA-N 0.000 description 1
- 239000010447 natron Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 230000003014 reinforcing effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000004455 soybean meal Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000811 xylitol Substances 0.000 description 1
- 235000010447 xylitol Nutrition 0.000 description 1
- HEBKCHPVOIAQTA-SCDXWVJYSA-N xylitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)CO HEBKCHPVOIAQTA-SCDXWVJYSA-N 0.000 description 1
- 229960002675 xylitol Drugs 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A21—BAKING; EDIBLE DOUGHS
- A21D—TREATMENT OF FLOUR OR DOUGH FOR BAKING, e.g. BY ADDITION OF MATERIALS; BAKING; BAKERY PRODUCTS
- A21D10/00—Batters, dough or mixtures before baking
- A21D10/04—Batters
-
- A—HUMAN NECESSITIES
- A21—BAKING; EDIBLE DOUGHS
- A21D—TREATMENT OF FLOUR OR DOUGH FOR BAKING, e.g. BY ADDITION OF MATERIALS; BAKING; BAKERY PRODUCTS
- A21D13/00—Finished or partly finished bakery products
- A21D13/30—Filled, to be filled or stuffed products
- A21D13/36—Filled wafers
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Food Science & Technology (AREA)
- Bakery Products And Manufacturing Methods Therefor (AREA)
- Solid-Sorbent Or Filter-Aiding Compositions (AREA)
- Treatment Of Water By Ion Exchange (AREA)
- Manufacturing Of Electric Cables (AREA)
- Inorganic Compounds Of Heavy Metals (AREA)
- Moulding By Coating Moulds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2929496A DE2929496C2 (de) | 1979-07-20 | 1979-07-20 | Waffel mit glatter dichter Oberfläche und einer zellenartigen Innenstruktur zur Verwendung als gefüllte Waffel aus zwei oder mehreren Waffelblättern |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CS216180A2 CS216180A2 (en) | 1984-12-14 |
| CS237313B2 true CS237313B2 (en) | 1985-07-16 |
Family
ID=6076324
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS802161A CS237313B2 (en) | 1979-07-20 | 1980-03-27 | Method of manufacture of wafles |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US4629628A (da) |
| EP (1) | EP0022901B2 (da) |
| JP (1) | JPS5925585B2 (da) |
| AR (1) | AR225166A1 (da) |
| AT (1) | ATE8005T1 (da) |
| AU (1) | AU527777B2 (da) |
| CA (1) | CA1123659A (da) |
| CS (1) | CS237313B2 (da) |
| DD (1) | DD149603A5 (da) |
| DE (2) | DE2929496C2 (da) |
| DK (1) | DK44180A (da) |
| ES (1) | ES487045A1 (da) |
| FI (1) | FI66724C (da) |
| GR (1) | GR73182B (da) |
| IE (1) | IE49398B1 (da) |
| IL (1) | IL58788A (da) |
| MX (1) | MX6718E (da) |
| NO (1) | NO149908C (da) |
| NZ (1) | NZ192707A (da) |
| PH (1) | PH16865A (da) |
| PL (1) | PL221567A1 (da) |
| PT (1) | PT70617A (da) |
| TR (1) | TR20750A (da) |
| YU (1) | YU183980A (da) |
| ZA (1) | ZA80497B (da) |
Families Citing this family (48)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL193650C (nl) * | 1986-08-19 | 2000-06-06 | Ferrero Ohg | Bakkerijproduct en werkwijze voor de bereiding daarvan. |
| US5194272A (en) * | 1986-12-18 | 1993-03-16 | Sudmilch Aktiengesellschaft | Pack for foods and process for the production thereof |
| DE3643199A1 (de) * | 1986-12-18 | 1988-06-30 | Werner Georg Munk | Verpackung fuer nahrungs- und genussmittel und verfahren zu ihrer herstellung |
| JPS63273432A (ja) * | 1987-05-01 | 1988-11-10 | 伊藤 禎美 | 加熱加工済食品素地 |
| JPS63273433A (ja) * | 1987-05-01 | 1988-11-10 | 伊藤 禎美 | 可食容器の製造方法 |
| JPS63194387U (da) * | 1987-05-30 | 1988-12-14 | ||
| WO1995034482A1 (en) * | 1994-06-14 | 1995-12-21 | Borbely Jozsef | Environment-friendly packaging material prepared from a dough by baking, particularly for packaging fatty or oily foods |
| DE19539403C2 (de) * | 1995-10-11 | 2001-03-01 | Inst Getreideverarbeitung | Biopolymere Zusammensetzung und Verfahren zur Herstellung eines stabilisierten Produktes unter Verwendung dieser Zusammensetzung |
| GB2341306A (en) * | 1998-09-08 | 2000-03-15 | Nestle Sa | A sugar wafer |
| US7223437B2 (en) * | 2001-12-14 | 2007-05-29 | Archer Daniels Midland Company | Pressure molded proteinaceous wafers, ingredient inclusions, cookies, and waffle food products; pressure molding process method, mass balanced and viscosity specific batter for the manufacture of these food products, and final proteinaceous food products derived ut |
| EP1393631B1 (en) * | 2002-08-30 | 2007-03-14 | Kraft Foods R & D, Inc. Zweigniederlassung München | Crunchy wafer product |
| ATE410061T1 (de) * | 2004-11-26 | 2008-10-15 | Nestec Sa | Essbarer behälter für nahrungsmittel und verfahren zu seiner herstellung |
| DE602006004369D1 (de) * | 2005-09-23 | 2009-01-29 | Unilever Nv | Durchlüftete produkte mit niedrigem ph-wert |
| ES2356500T3 (es) * | 2005-09-23 | 2011-04-08 | Unilever Plc | Productos aireados con formación de crema reducida. |
| ATE422827T1 (de) * | 2005-09-23 | 2009-03-15 | Unilever Nv | Herstellungsverfahren für eine gefrorene und durchlüftete zusammensetzung |
| AU2007211713B2 (en) * | 2006-01-31 | 2011-09-01 | Unilever Plc | Aerated compositions comprising hydrophobin |
| BRPI0705417B1 (pt) * | 2006-12-20 | 2016-08-16 | Unilever Nv | produto alimentício aerado e processos para a produção de um produto alimentício aerado |
| WO2008116733A1 (en) * | 2007-03-26 | 2008-10-02 | Unilever N.V. | Aerated food products being warm containing soluble and/or insoluble solids and methods for producing them |
| WO2008116715A1 (en) * | 2007-03-26 | 2008-10-02 | Unilever N.V. | Aerated food products being warm or having been heated up and methods for producing them |
| CN101827932B (zh) * | 2007-10-18 | 2013-03-13 | 荷兰联合利华有限公司 | 制备发泡剂的方法 |
| AU2008229927B2 (en) * | 2007-10-25 | 2009-08-06 | Unilever Plc | Aerated fat-continuous products |
| NZ587092A (en) * | 2008-01-29 | 2012-08-31 | Potato Magic Australia Pty Ltd | Method of making a baked snack base product and the snack base product produced thereby |
| US20100112139A1 (en) * | 2008-03-28 | 2010-05-06 | Conopco, Inc., D/B/A Unilever | Foaming Agents Comprising Hydrophobin |
| WO2010043520A1 (en) * | 2008-10-16 | 2010-04-22 | Unilever Plc | Hydrophobin solution containing antifoam |
| CN101385477B (zh) * | 2008-10-28 | 2011-02-02 | 内蒙古伊利实业集团股份有限公司 | 含有坚果颗粒的蛋筒及其制备方法 |
| AU2009328324B2 (en) | 2008-12-16 | 2013-03-21 | Unilever Plc | Method for extracting hydrophobin from a solution |
| US8357420B2 (en) * | 2009-05-29 | 2013-01-22 | Conopco, Inc. | Oil-in-water emulsion |
| US8394444B2 (en) * | 2009-05-29 | 2013-03-12 | Conopco, Inc. | Oil-in-water emulsion |
| CA2704702C (en) | 2009-06-02 | 2018-06-12 | Unilever Plc | Aerated baked products |
| RU2400993C1 (ru) * | 2009-09-07 | 2010-10-10 | Олег Иванович Квасенков | Способ получения вафель (варианты) |
| RU2400996C1 (ru) * | 2009-09-15 | 2010-10-10 | Олег Иванович Квасенков | Способ получения вафель (варианты) |
| RU2400994C1 (ru) * | 2009-09-15 | 2010-10-10 | Олег Иванович Квасенков | Способ производства вафель (варианты) |
| RU2400995C1 (ru) * | 2009-09-15 | 2010-10-10 | Олег Иванович Квасенков | Способ получения вафель (варианты) |
| RU2407316C1 (ru) * | 2009-09-16 | 2010-12-27 | Олег Иванович Квасенков | Способ производства вафель (варианты) |
| RU2401000C1 (ru) * | 2009-09-16 | 2010-10-10 | Олег Иванович Квасенков | Способ получения вафель (варианты) |
| RU2400998C1 (ru) * | 2009-09-16 | 2010-10-10 | Олег Иванович Квасенков | Способ получения вафель (варианты) |
| RU2400997C1 (ru) * | 2009-09-16 | 2010-10-10 | Олег Иванович Квасенков | Способ производства вафель (варианты) |
| RU2400983C1 (ru) * | 2009-09-16 | 2010-10-10 | Олег Иванович Квасенков | Способ получения вафель (варианты) |
| RU2407317C1 (ru) * | 2009-09-17 | 2010-12-27 | Олег Иванович Квасенков | Способ производства вафель (варианты) |
| RU2401001C1 (ru) * | 2009-09-17 | 2010-10-10 | Олег Иванович Квасенков | Способ производства вафель (варианты) |
| RU2436378C1 (ru) * | 2010-09-10 | 2011-12-20 | Олег Иванович Квасенков | Способ получения хлебобулочного изделия |
| RU2436383C1 (ru) * | 2010-09-10 | 2011-12-20 | Олег Иванович Квасенков | Способ производства хлебобулочного изделия |
| RU2436381C1 (ru) * | 2010-09-10 | 2011-12-20 | Олег Иванович Квасенков | Способ производства хлебобулочного изделия |
| EP2481290B1 (de) * | 2011-01-28 | 2019-08-21 | S. Spitz GmbH | Waffelprodukt mit Schokolade sowie Verfahren zur Herstellung |
| RU2616782C1 (ru) * | 2016-01-26 | 2017-04-18 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Кубанский государственный технологический университет" (ФГБОУ ВО "КубГТУ") | Пищевая композиция для производства вафель |
| RU2682870C1 (ru) * | 2018-06-15 | 2019-03-22 | Федеральное государственное автономное образовательное учреждение высшего образования "Дальневосточный федеральный университет" (ДВФУ) | Смесь для приготовления листовых вафель |
| BE1027723B1 (nl) * | 2019-11-04 | 2021-06-08 | Biscuiterie Jules Destrooper Nv | Een wafel en een werkwijze ter vervaardiging van de wafel |
| JP7050855B2 (ja) * | 2020-05-28 | 2022-04-08 | 日世株式会社 | 焼き菓子の製造方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1166056A (en) * | 1912-01-25 | 1915-12-28 | Loose Wiles Biscuit Co | Process of forming filled wafers. |
| GB417055A (en) * | 1933-03-23 | 1934-09-24 | Jakob Richert | Improvements in or connected with apparatus for cooking wafers, waffles and the like |
| GB699574A (en) * | 1950-05-31 | 1953-11-11 | T & T Vicars Ltd | Improvements in or relating to wafer ovens |
| US3256804A (en) * | 1964-11-12 | 1966-06-21 | Petrin Frank | Waffle cooker |
| IT964954B (it) * | 1972-08-18 | 1974-01-31 | Salza S | Procedimento per la preparazione di cialde aproteiche per wafer e simili |
| US3962480A (en) * | 1974-07-19 | 1976-06-08 | Wolf Sidney K | Bread including nutritional amounts of magnesium |
| US4208441A (en) * | 1978-03-01 | 1980-06-17 | The Pillsbury Company | Process for cooking dough products |
-
1979
- 1979-07-20 DE DE2929496A patent/DE2929496C2/de not_active Expired
- 1979-11-23 IL IL58788A patent/IL58788A/xx unknown
- 1979-11-29 GR GR60635A patent/GR73182B/el unknown
- 1979-12-03 PH PH23357A patent/PH16865A/en unknown
- 1979-12-11 TR TR20750A patent/TR20750A/xx unknown
- 1979-12-19 ES ES487045A patent/ES487045A1/es not_active Expired
- 1979-12-20 PT PT70617A patent/PT70617A/pt unknown
-
1980
- 1980-01-18 CA CA343,961A patent/CA1123659A/en not_active Expired
- 1980-01-24 PL PL22156780A patent/PL221567A1/xx unknown
- 1980-01-24 NZ NZ192707A patent/NZ192707A/xx unknown
- 1980-01-28 FI FI800238A patent/FI66724C/fi not_active IP Right Cessation
- 1980-01-28 ZA ZA00800497A patent/ZA80497B/xx unknown
- 1980-01-29 AU AU55007/80A patent/AU527777B2/en not_active Expired
- 1980-01-30 AR AR279811A patent/AR225166A1/es active
- 1980-02-01 DK DK44180A patent/DK44180A/da not_active Application Discontinuation
- 1980-02-15 IE IE287/80A patent/IE49398B1/en not_active IP Right Cessation
- 1980-03-17 DD DD80219715A patent/DD149603A5/de unknown
- 1980-03-27 CS CS802161A patent/CS237313B2/cs unknown
- 1980-04-01 AT AT80101740T patent/ATE8005T1/de not_active IP Right Cessation
- 1980-04-01 DE DE8080101740T patent/DE3068289D1/de not_active Expired
- 1980-04-01 EP EP80101740A patent/EP0022901B2/de not_active Expired
- 1980-07-07 MX MX808911U patent/MX6718E/es unknown
- 1980-07-17 YU YU01839/80A patent/YU183980A/xx unknown
- 1980-07-18 NO NO802167A patent/NO149908C/no unknown
- 1980-07-21 JP JP55098840A patent/JPS5925585B2/ja not_active Expired
-
1981
- 1981-07-13 US US06/283,083 patent/US4629628A/en not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS237313B2 (en) | Method of manufacture of wafles | |
| US1817114A (en) | Method of making confection shells | |
| TR201808073A2 (tr) | Uzun raf ömürlü endüstri̇yel olarak üreti̇lmi̇ş yeni̇ bi̇r makaron ürünü ve üreti̇m yöntemi̇ | |
| US3544334A (en) | Multicolored cake batter and process for making same | |
| RU2355172C2 (ru) | Кондитерское изделие мучное | |
| RU2660258C1 (ru) | Вафельное изделие | |
| KR102721106B1 (ko) | 롤케이크용 케이크 시트 및 이를 이용한 롤케이크의 제조방법 | |
| RU67820U1 (ru) | Вафельное изделие | |
| JP2003524408A (ja) | 冷蔵ベーカリドウ製品 | |
| EP1385383B1 (en) | Ready to bake refrigerated dough | |
| RU2619450C1 (ru) | Торт кокосовый | |
| RU2660259C1 (ru) | Вафельное изделие | |
| RU2772776C1 (ru) | Конфета вафельная | |
| RU2654351C1 (ru) | Вафельное изделие | |
| RU2772775C1 (ru) | Конфета вафельная | |
| RU2803049C1 (ru) | Конфета вафельная | |
| RU2834281C1 (ru) | Вафельное изделие | |
| RU2733657C1 (ru) | Торт бисквитно-кремовый с определенным соотношением высоты слоя бисквита к высоте слоя крема | |
| RU2590943C2 (ru) | Конфета вафельная глазированная с зеленым чаем | |
| RU2289255C2 (ru) | Способ производства мучного кондитерского изделия | |
| RU77753U1 (ru) | Вафельное изделие | |
| RU2703202C1 (ru) | Вафельное изделие | |
| RU2654750C1 (ru) | Конфета вафельная глазированная с клюквой и вкусом яблока и корицы | |
| RU2191512C2 (ru) | Способ производства полуфабриката для кондитерских изделий | |
| RU2654781C1 (ru) | Конфета вафельная глазированная с клюквой и ванильным вкусом |