CH670644A5 - - Google Patents
Download PDFInfo
- Publication number
- CH670644A5 CH670644A5 CH5051/86A CH505186A CH670644A5 CH 670644 A5 CH670644 A5 CH 670644A5 CH 5051/86 A CH5051/86 A CH 5051/86A CH 505186 A CH505186 A CH 505186A CH 670644 A5 CH670644 A5 CH 670644A5
- Authority
- CH
- Switzerland
- Prior art keywords
- group
- formula
- alkali metal
- unsubstituted
- compound
- Prior art date
Links
- -1 thiocarboxylic acid salt Chemical class 0.000 claims abstract description 39
- YBJHBAHKTGYVGT-ZKWXMUAHSA-N (+)-Biotin Chemical compound N1C(=O)N[C@@H]2[C@H](CCCCC(=O)O)SC[C@@H]21 YBJHBAHKTGYVGT-ZKWXMUAHSA-N 0.000 claims abstract description 34
- 238000000034 method Methods 0.000 claims abstract description 25
- 238000006243 chemical reaction Methods 0.000 claims abstract description 23
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 18
- 125000006239 protecting group Chemical group 0.000 claims abstract description 15
- 150000001875 compounds Chemical class 0.000 claims abstract description 14
- 239000001257 hydrogen Substances 0.000 claims abstract description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 9
- 125000001931 aliphatic group Chemical group 0.000 claims abstract description 5
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 claims abstract description 5
- 125000005843 halogen group Chemical group 0.000 claims abstract description 3
- 239000003054 catalyst Substances 0.000 claims description 16
- 229910052783 alkali metal Inorganic materials 0.000 claims description 14
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 12
- 238000005984 hydrogenation reaction Methods 0.000 claims description 9
- OROGUZVNAFJPHA-UHFFFAOYSA-N 3-hydroxy-2,4-dimethyl-2H-thiophen-5-one Chemical compound CC1SC(=O)C(C)=C1O OROGUZVNAFJPHA-UHFFFAOYSA-N 0.000 claims description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- 239000010948 rhodium Substances 0.000 claims description 7
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 7
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 6
- 150000001340 alkali metals Chemical group 0.000 claims description 6
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 6
- 229910052703 rhodium Inorganic materials 0.000 claims description 6
- 239000000463 material Substances 0.000 claims description 5
- 229910052763 palladium Inorganic materials 0.000 claims description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 4
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 239000002585 base Substances 0.000 claims description 4
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 4
- 229910052707 ruthenium Inorganic materials 0.000 claims description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 3
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 claims description 3
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 150000002431 hydrogen Chemical group 0.000 claims description 3
- 229910052697 platinum Inorganic materials 0.000 claims description 3
- 239000000377 silicon dioxide Substances 0.000 claims description 3
- 235000012239 silicon dioxide Nutrition 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 2
- 150000002084 enol ethers Chemical class 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 239000002815 homogeneous catalyst Substances 0.000 claims description 2
- 229910052741 iridium Inorganic materials 0.000 claims description 2
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 claims description 2
- 239000003446 ligand Substances 0.000 claims description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims 2
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 claims 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims 1
- 150000007513 acids Chemical class 0.000 claims 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 claims 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 1
- 125000005907 alkyl ester group Chemical group 0.000 claims 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 claims 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 claims 1
- 235000019253 formic acid Nutrition 0.000 claims 1
- 229910052987 metal hydride Inorganic materials 0.000 claims 1
- 150000004681 metal hydrides Chemical class 0.000 claims 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 claims 1
- DUYAAUVXQSMXQP-UHFFFAOYSA-M thioacetate Chemical compound CC([S-])=O DUYAAUVXQSMXQP-UHFFFAOYSA-M 0.000 claims 1
- 239000011135 tin Substances 0.000 claims 1
- 229910052718 tin Inorganic materials 0.000 claims 1
- 125000004665 trialkylsilyl group Chemical group 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract description 8
- 238000004519 manufacturing process Methods 0.000 abstract description 4
- 238000003776 cleavage reaction Methods 0.000 abstract description 2
- 239000000376 reactant Substances 0.000 abstract description 2
- 230000007017 scission Effects 0.000 abstract description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 abstract 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- 239000002904 solvent Substances 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 235000020958 biotin Nutrition 0.000 description 7
- 239000011616 biotin Substances 0.000 description 7
- 229960002685 biotin Drugs 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- JYWKEVKEKOTYEX-UHFFFAOYSA-N 2,6-dibromo-4-chloroiminocyclohexa-2,5-dien-1-one Chemical compound ClN=C1C=C(Br)C(=O)C(Br)=C1 JYWKEVKEKOTYEX-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 101150065749 Churc1 gene Proteins 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 238000000921 elemental analysis Methods 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- KWGRBVOPPLSCSI-WPRPVWTQSA-N (-)-ephedrine Chemical compound CN[C@@H](C)[C@H](O)C1=CC=CC=C1 KWGRBVOPPLSCSI-WPRPVWTQSA-N 0.000 description 2
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 2
- MLOSJPZSZWUDSK-UHFFFAOYSA-N 4-carboxybutyl(triphenyl)phosphanium;bromide Chemical compound [Br-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CCCCC(=O)O)C1=CC=CC=C1 MLOSJPZSZWUDSK-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 235000000638 D-biotin Nutrition 0.000 description 2
- 239000011665 D-biotin Substances 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 150000001733 carboxylic acid esters Chemical class 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- AHWALFGBDFAJAI-UHFFFAOYSA-N phenyl carbonochloridate Chemical compound ClC(=O)OC1=CC=CC=C1 AHWALFGBDFAJAI-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- CNZIQHGDUXRUJS-CIGIFLASSA-N (2R,3S,5E,9R)-5-(1-hydroxyethylidene)-8,8-dimethyl-7,16-diazapentacyclo[9.6.1.02,9.03,7.015,18]octadeca-1(17),11(18),12,14-tetraene-4,6-dione Chemical compound C\C(O)=C1\C(=O)[C@@H]2[C@@H]3[C@@H](Cc4cccc5[nH]cc3c45)C(C)(C)N2C1=O CNZIQHGDUXRUJS-CIGIFLASSA-N 0.000 description 1
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 1
- YKTZWOXKIAPYNJ-NLZRERSLSA-N 2-[(3ar,6as)-1-benzyl-2-oxo-3-[(1r)-1-phenylethyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-6-yl]pentanoic acid Chemical compound N1([C@H]2[C@@H](N(C1=O)[C@H](C)C=1C=CC=CC=1)CSC2C(CCC)C(O)=O)CC1=CC=CC=C1 YKTZWOXKIAPYNJ-NLZRERSLSA-N 0.000 description 1
- KJHKBWKMCYAPEW-WTNAPCKOSA-N 2-[(3ar,6as)-1-benzyl-2-oxo-3-[(1r)-1-phenylethyl]-4,6a-dihydro-3ah-thieno[3,4-d]imidazol-6-ylidene]pentanoic acid Chemical compound N1([C@H]2[C@@H](N(C1=O)[C@H](C)C=1C=CC=CC=1)CSC2=C(C(O)=O)CCC)CC1=CC=CC=C1 KJHKBWKMCYAPEW-WTNAPCKOSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- YBJHBAHKTGYVGT-ZXFLCMHBSA-N 5-[(3ar,4r,6as)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid Chemical compound N1C(=O)N[C@H]2[C@@H](CCCCC(=O)O)SC[C@H]21 YBJHBAHKTGYVGT-ZXFLCMHBSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- XJUZRXYOEPSWMB-UHFFFAOYSA-N Chloromethyl methyl ether Chemical compound COCCl XJUZRXYOEPSWMB-UHFFFAOYSA-N 0.000 description 1
- 206010048768 Dermatosis Diseases 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 1
- 229930003756 Vitamin B7 Natural products 0.000 description 1
- 238000007239 Wittig reaction Methods 0.000 description 1
- QPQGTZMAQRXCJW-UHFFFAOYSA-N [chloro(phenyl)phosphoryl]benzene Chemical compound C=1C=CC=CC=1P(=O)(Cl)C1=CC=CC=C1 QPQGTZMAQRXCJW-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 239000003674 animal food additive Substances 0.000 description 1
- 150000007860 aryl ester derivatives Chemical class 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- MXOSTENCGSDMRE-UHFFFAOYSA-N butyl-chloro-dimethylsilane Chemical compound CCCC[Si](C)(C)Cl MXOSTENCGSDMRE-UHFFFAOYSA-N 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 150000003983 crown ethers Chemical class 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 229940068840 d-biotin Drugs 0.000 description 1
- KWGRBVOPPLSCSI-UHFFFAOYSA-N d-ephedrine Natural products CNC(C)C(O)C1=CC=CC=C1 KWGRBVOPPLSCSI-UHFFFAOYSA-N 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- PGRHXDWITVMQBC-UHFFFAOYSA-N dehydroacetic acid Natural products CC(=O)C1C(=O)OC(C)=CC1=O PGRHXDWITVMQBC-UHFFFAOYSA-N 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- LGTLXDJOAJDFLR-UHFFFAOYSA-N diethyl chlorophosphate Chemical compound CCOP(Cl)(=O)OCC LGTLXDJOAJDFLR-UHFFFAOYSA-N 0.000 description 1
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229960002179 ephedrine Drugs 0.000 description 1
- 238000010931 ester hydrolysis Methods 0.000 description 1
- 150000002148 esters Chemical group 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- PEQJBOMPGWYIRO-UHFFFAOYSA-N n-ethyl-3,4-dimethoxyaniline Chemical compound CCNC1=CC=C(OC)C(OC)=C1 PEQJBOMPGWYIRO-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000011182 sodium carbonates Nutrition 0.000 description 1
- RBBWNXJFTBCLKT-UHFFFAOYSA-M sodium;ethanethioate Chemical compound [Na+].CC([S-])=O RBBWNXJFTBCLKT-UHFFFAOYSA-M 0.000 description 1
- JTHUJOZLDHAGIH-UHFFFAOYSA-M sodium;thiobenzate Chemical compound [Na+].[O-]C(=S)C1=CC=CC=C1 JTHUJOZLDHAGIH-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 235000011912 vitamin B7 Nutrition 0.000 description 1
- 239000011735 vitamin B7 Substances 0.000 description 1
- 150000003722 vitamin derivatives Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D495/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms
- C07D495/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D495/04—Ortho-condensed systems
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Saccharide Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Catalysts (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Priority Applications (25)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH5051/86A CH670644A5 (show.php) | 1986-12-18 | 1986-12-18 | |
| IE330787A IE60518B1 (en) | 1986-12-18 | 1987-12-04 | Process for the preparation of (+)-biotin |
| DK638287A DK638287A (da) | 1986-12-18 | 1987-12-04 | Fremgangsmaade til fremstilling af (+)-biotin |
| FI875371A FI90423C (fi) | 1986-12-18 | 1987-12-07 | Menetelmä (+)-biotiinin valmistamiseksi |
| IL84770A IL84770A (en) | 1986-12-18 | 1987-12-09 | Process for the preparation of (+)-biotin from 1-(1-phenylalkyl)-1h-furo- (3,4-d)-imidazole-2,4 (3h, 6h)-dione derivatives and the new intermediate (3as, 6ar)-3a, 6a-dihydro-1- (1-phenylalkyl)-1h-furo (3,4-d)-imidazole 2,4 (3h, 6h)-dione |
| ES198787118342T ES2032428T3 (es) | 1986-12-18 | 1987-12-10 | Procedimiento para preparar (+)-biotina. |
| DE8787118342T DE3778135D1 (de) | 1986-12-18 | 1987-12-10 | Verfahren zur herstellung von (+)-biotin. |
| EP87118342A EP0273270B1 (de) | 1986-12-18 | 1987-12-10 | Verfahren zur Herstellung von (+)-Biotin |
| AT87118342T ATE74606T1 (de) | 1986-12-18 | 1987-12-10 | Verfahren zur herstellung von (+)-biotin. |
| JP62317297A JP2560360B2 (ja) | 1986-12-18 | 1987-12-15 | (+)−ビオチンの製造方法 |
| SU874203838A SU1600631A3 (ru) | 1986-12-18 | 1987-12-15 | Способ получени (3 @ S,6 @ R)-1-(1-фенилэтил)-дигидро-1Н-фуро-(3,4- @ )-имидазол-2,4(3Н,3 @ Н)-дионов |
| YU229487A YU46432B (sh) | 1986-12-18 | 1987-12-16 | NOVI (3aS, 6aR)-1-(1-FENILETIL)-DIHIDRO-1H-FURO (3,4-d)-IMIDAZOL-2-4-(3H,3aH)-DIONI IN POSTOPEK ZA NJIHOVO PRIPRANO |
| US07/134,210 US4876350A (en) | 1986-10-18 | 1987-12-16 | Process for the production of (+) biotin |
| NO875279A NO166941C (no) | 1986-12-18 | 1987-12-17 | Fremgangsmaate for fremstilling av (+)-biotin. |
| CA000554630A CA1322757C (en) | 1986-12-18 | 1987-12-17 | Process for the production of (+) biotin |
| PT86401A PT86401B (pt) | 1986-12-18 | 1987-12-17 | Processo de preparacao de (+)-biotina |
| HU875756A HU199475B (en) | 1986-12-18 | 1987-12-17 | Process for producing 1-(1-phenylethyl)-dihydro-1h-furo/3,4-d/imidazole-2,4(3h,3ah)-dione derivatives |
| DD87310744A DD264920A5 (de) | 1986-12-18 | 1987-12-18 | Verfahren zur herstellung von (+)-biotin |
| US07/271,180 US5117003A (en) | 1986-12-18 | 1989-01-10 | Process for the production of (+) biotin |
| US07/777,914 US5162540A (en) | 1986-12-18 | 1991-10-17 | Process for the production of (+) biotin |
| CA000616416A CA1329936C (en) | 1986-12-18 | 1992-06-23 | Intermediates for the production of (+) biotin |
| LV930120A LV5265A3 (lv) | 1986-12-18 | 1993-02-16 | Panemiens (3as,6ar)-1-(1-feniletil)-dihidro-1h-furo-(3,4-d)-imidazol-2,4(3h,3ah)-dionu iegusanai |
| LTRP360A LT2103B (lt) | 1986-12-18 | 1993-02-26 | (3as,6ar)-1-(1-feniletil)-dihidro-ih-furo-(3,4d)-imidazol-2,4 (3h,3ah)-dionu gavimo budas |
| GEAP1993998A GEP19960473B (en) | 1986-12-18 | 1993-07-12 | Method of producing (3as, 6ar)-1-(phenylethyl)-dihydro-1n-(3,4-d)-imidazol-2,4(3n, 3an)-dions |
| JP8105162A JPH08319290A (ja) | 1986-12-18 | 1996-04-25 | イミダゾール誘導体 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH5051/86A CH670644A5 (show.php) | 1986-12-18 | 1986-12-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH670644A5 true CH670644A5 (show.php) | 1989-06-30 |
Family
ID=4287129
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH5051/86A CH670644A5 (show.php) | 1986-10-18 | 1986-12-18 |
Country Status (19)
| Country | Link |
|---|---|
| US (2) | US4876350A (show.php) |
| EP (1) | EP0273270B1 (show.php) |
| JP (2) | JP2560360B2 (show.php) |
| AT (1) | ATE74606T1 (show.php) |
| CA (1) | CA1322757C (show.php) |
| CH (1) | CH670644A5 (show.php) |
| DD (1) | DD264920A5 (show.php) |
| DE (1) | DE3778135D1 (show.php) |
| DK (1) | DK638287A (show.php) |
| ES (1) | ES2032428T3 (show.php) |
| FI (1) | FI90423C (show.php) |
| GE (1) | GEP19960473B (show.php) |
| HU (1) | HU199475B (show.php) |
| IE (1) | IE60518B1 (show.php) |
| IL (1) | IL84770A (show.php) |
| NO (1) | NO166941C (show.php) |
| PT (1) | PT86401B (show.php) |
| SU (1) | SU1600631A3 (show.php) |
| YU (1) | YU46432B (show.php) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8720394D0 (en) * | 1987-08-28 | 1987-10-07 | Ici Plc | Nucleotide probes |
| FI95034C (fi) * | 1989-03-15 | 1995-12-11 | Lonza Ag | Menetelmä 1,3-substituoidun tetrahydro-1H-tieno/3,4-d/-imidatsol-2(3H)-on-4-ylideenipentaanihappoesterin valmistamiseksi |
| DE4107121C1 (show.php) * | 1991-03-06 | 1992-06-11 | Merck Patent Gmbh, 6100 Darmstadt, De | |
| FI935609A7 (fi) * | 1992-12-18 | 1994-06-19 | Lonza Ag | Dihydrofuroimidatsolijohdannaisten asymmetrinen hydraus |
| ES2088703T3 (es) * | 1993-04-20 | 1996-08-16 | Lonza Ag | Hidrogenacion asimetrica de derivados del furoimidazol. |
| CA2122511A1 (en) * | 1993-05-14 | 1994-11-15 | John Mcgarrity | Asymmetric hydrogenation of furoimidazole derivatives |
| DE4411101C2 (de) * | 1994-03-30 | 1996-02-01 | Merck Patent Gmbh | Verfahren zur Herstellung eines D-(+)-Biotin-Zwischenproduktes |
| AU4944397A (en) * | 1996-10-09 | 1998-05-05 | Lonza A.G. | Method for the manufacture of biotine (+) |
| HRP20040353B1 (hr) * | 2001-10-19 | 2012-10-31 | Isotechnika Inc. | Smjese analoga ciklosporina i njihova uporaba kao imunomodulirajuä†ih sredstava |
| HRP20070058B1 (hr) * | 2001-10-19 | 2014-05-23 | Isotechnika Inc. | Sinteza ciklosporinskih analoga |
| CN103936759B (zh) * | 2014-03-11 | 2016-01-13 | 新发药业有限公司 | (3aS,6aR)-1,3-二苄基-四氢-4H-噻吩并[3,4-d]咪唑-2,4-(1H)-二酮的简便制备方法 |
| CN104530076B (zh) * | 2014-12-17 | 2016-08-17 | 新发药业有限公司 | (3aS,6aR)-1,3-二苄基四氢-4H-噻吩并[3,4-d]咪唑-2,4-(1H)-二酮的合成方法 |
| CN107686488B (zh) * | 2016-08-05 | 2020-04-28 | 浙江医药股份有限公司新昌制药厂 | 一种生物素中间体的合成方法 |
| CN117362303B (zh) * | 2022-07-02 | 2026-02-03 | 黑龙江联顺生物科技有限公司 | 一种生物素中间体环酐的制备方法 |
| EP4495123A1 (en) | 2023-07-19 | 2025-01-22 | DSM IP Assets B.V. | An improved process for producing d-biotin intermediates |
Family Cites Families (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2784191A (en) * | 1957-03-05 | Process for the production of lactams | ||
| DE154225C (show.php) * | ||||
| US2489235A (en) * | 1947-07-24 | 1949-11-22 | Hoffmann La Roche | Synthesis of biotin |
| US2535010A (en) * | 1948-10-02 | 1950-12-19 | Rohm & Haas | Transetherification of beta-ethersubstituted esters |
| DE850007C (de) * | 1950-12-22 | 1952-09-22 | Basf Ag | Verfahren zur Herstellung von N-Aryl-ª‡-pyrrolidonen |
| JPS463580Y1 (show.php) * | 1967-06-13 | 1971-02-06 | ||
| BE759512A (fr) * | 1969-11-29 | 1971-05-27 | Hoffmann La Roche | Lactone |
| DD111577A5 (show.php) * | 1972-06-22 | 1975-02-20 | ||
| JPS5315074B2 (show.php) * | 1973-06-14 | 1978-05-22 | ||
| JPS5067627A (show.php) * | 1973-10-17 | 1975-06-06 | ||
| IT1045043B (it) * | 1975-08-13 | 1980-04-21 | Isf Spa | Derivati pirrolidinici |
| IT1075564B (it) * | 1977-02-11 | 1985-04-22 | Isf Spa | Procedimento per la preparazione di derivati pirrolidinici |
| IT1075280B (it) * | 1977-02-11 | 1985-04-22 | Isf Spa | Procedimento per la preparazione di derivati pirrolidinici |
| JPS603387B2 (ja) * | 1980-07-10 | 1985-01-28 | 住友化学工業株式会社 | 新規光学活性イミダゾリジン−2−オン誘導体およびその製法 |
| DD154225A1 (de) * | 1980-11-10 | 1982-03-03 | Horst Seiferth | Verfahren zur herstellung beschichteter textiler flaechengebilde |
| JPS5812272B2 (ja) * | 1981-04-28 | 1983-03-07 | 電気化学工業株式会社 | 4−ヒドロキシ−2−ピロリドンの製造法 |
| DE3268046D1 (en) * | 1981-12-07 | 1986-01-30 | Hoffmann La Roche | Process for the preparation of an optically active lactone, and starting products for the process |
| JPS58124791A (ja) * | 1982-01-19 | 1983-07-25 | Sumitomo Chem Co Ltd | ビオチンの製造法 |
| DK43985A (da) * | 1984-03-09 | 1985-09-10 | Hoffmann La Roche | Fremgangsmaade til fremstilling af heterocycliske forbindelser |
| EP0161580B1 (de) * | 1984-05-18 | 1990-11-07 | F. Hoffmann-La Roche Ag | Verfahren zur Herstellung eines Lactons |
| EP0173185B1 (de) * | 1984-08-25 | 1990-01-31 | MERCK PATENT GmbH | Verfahren zur Herstellung von (3a5,6aR)-und/oder(3aR,6a5)-1,3-Dibenzyl-hexahydro-1H-furo(3,4-d)imidazol-2,4-dion |
| FI83510C (fi) * | 1985-02-22 | 1991-07-25 | Ciba Geigy Ag | Foerfarande foer framstaellning av nya, terapeutiskt anvaendbara bi-2h- pyrroli(di)ndioner. |
| CH671227A5 (show.php) * | 1986-12-02 | 1989-08-15 | Lonza Ag |
-
1986
- 1986-12-18 CH CH5051/86A patent/CH670644A5/de not_active IP Right Cessation
-
1987
- 1987-12-04 DK DK638287A patent/DK638287A/da not_active Application Discontinuation
- 1987-12-04 IE IE330787A patent/IE60518B1/en not_active IP Right Cessation
- 1987-12-07 FI FI875371A patent/FI90423C/fi not_active IP Right Cessation
- 1987-12-09 IL IL84770A patent/IL84770A/xx not_active IP Right Cessation
- 1987-12-10 ES ES198787118342T patent/ES2032428T3/es not_active Expired - Lifetime
- 1987-12-10 DE DE8787118342T patent/DE3778135D1/de not_active Expired - Fee Related
- 1987-12-10 AT AT87118342T patent/ATE74606T1/de not_active IP Right Cessation
- 1987-12-10 EP EP87118342A patent/EP0273270B1/de not_active Expired - Lifetime
- 1987-12-15 SU SU874203838A patent/SU1600631A3/ru active
- 1987-12-15 JP JP62317297A patent/JP2560360B2/ja not_active Expired - Lifetime
- 1987-12-16 YU YU229487A patent/YU46432B/sh unknown
- 1987-12-16 US US07/134,210 patent/US4876350A/en not_active Expired - Fee Related
- 1987-12-17 PT PT86401A patent/PT86401B/pt not_active IP Right Cessation
- 1987-12-17 CA CA000554630A patent/CA1322757C/en not_active Expired - Fee Related
- 1987-12-17 HU HU875756A patent/HU199475B/hu not_active IP Right Cessation
- 1987-12-17 NO NO875279A patent/NO166941C/no unknown
- 1987-12-18 DD DD87310744A patent/DD264920A5/de not_active IP Right Cessation
-
1989
- 1989-01-10 US US07/271,180 patent/US5117003A/en not_active Expired - Fee Related
-
1993
- 1993-07-12 GE GEAP1993998A patent/GEP19960473B/en unknown
-
1996
- 1996-04-25 JP JP8105162A patent/JPH08319290A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DE3778135D1 (de) | 1992-05-14 |
| EP0273270B1 (de) | 1992-04-08 |
| IE60518B1 (en) | 1994-07-27 |
| ES2032428T3 (es) | 1993-02-16 |
| ATE74606T1 (de) | 1992-04-15 |
| IE873307L (en) | 1988-06-18 |
| GEP19960473B (en) | 1996-06-26 |
| FI875371A7 (fi) | 1988-06-19 |
| YU229487A (en) | 1988-10-31 |
| NO875279L (no) | 1988-06-20 |
| DK638287A (da) | 1988-06-19 |
| JPS63165387A (ja) | 1988-07-08 |
| FI875371A0 (fi) | 1987-12-07 |
| US5117003A (en) | 1992-05-26 |
| FI90423B (fi) | 1993-10-29 |
| DD264920A5 (de) | 1989-02-15 |
| HU199475B (en) | 1990-02-28 |
| CA1322757C (en) | 1993-10-05 |
| FI90423C (fi) | 1994-02-10 |
| NO166941C (no) | 1991-09-18 |
| NO166941B (no) | 1991-06-10 |
| HUT47290A (en) | 1989-02-28 |
| IL84770A (en) | 1993-05-13 |
| DK638287D0 (da) | 1987-12-04 |
| NO875279D0 (no) | 1987-12-17 |
| SU1600631A3 (ru) | 1990-10-15 |
| PT86401B (pt) | 1990-11-20 |
| IL84770A0 (en) | 1988-05-31 |
| JPH08319290A (ja) | 1996-12-03 |
| JP2560360B2 (ja) | 1996-12-04 |
| YU46432B (sh) | 1993-10-20 |
| US4876350A (en) | 1989-10-24 |
| EP0273270A1 (de) | 1988-07-06 |
| PT86401A (de) | 1988-01-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2614406C2 (show.php) | ||
| DE60004087T2 (de) | Verfahren und zwischenprodukte zur herstellung von imidazolinon alpha v integrin antagonisten | |
| CH670644A5 (show.php) | ||
| CH633536A5 (de) | Verfahren zur herstellung neuer tetracyclischer piperidin- oder pyrrolidinderivate. | |
| DE2603600A1 (de) | Alpha-aminomethyl-5-hydroxy-2- pyridinmethanol-derivate | |
| EP0270076B1 (de) | Imidazolderivate und ein Verfahren zu deren Herstellung | |
| DE2833888A1 (de) | Thiophen-derivate, deren herstellung und verwendung | |
| DE60313157T2 (de) | Ein verfahren zur herstellung von clopidogrel | |
| DE60104704T2 (de) | Verfahren zur herstellung einer substituierten imidazopyridinverbindung | |
| EP0161580B1 (de) | Verfahren zur Herstellung eines Lactons | |
| DE4117507A1 (de) | Verfahren zur herstellung von n(pfeil hoch)6(pfeil hoch)-substituierten lysin-derivaten | |
| EP0389425B1 (de) | Neue Benzothiopyranylamine | |
| DE2258257A1 (de) | Citronensaeurederivate | |
| CH653996A5 (de) | Tryptaminderivate und verfahren zu deren herstellung. | |
| DE69011620T2 (de) | Iso- und heterozyklische Phenylsulfonamide. | |
| DD148779A5 (de) | Verfahren zur herstellung von vindesin | |
| DE3026602C2 (show.php) | ||
| WO1990012796A1 (de) | 8β-SUBSTITUIERTE ERGOLINE, VERFAHREN ZU IHRER HERSTELLUNG UND IHRE VERWENDUNG | |
| DE19600034A1 (de) | Cyclopropanverbindungen und Verfahren zu deren Herstellung | |
| WO2007009143A2 (de) | Verfahren zur herstellung nebivolol | |
| DE2618721C2 (de) | Benzo(b)-bicyclo[3,3,1]nonene, Verfahren zu deren Herstellung und pharmazeutische Mittel, die diese Verbindungen enthalten | |
| EP0090769B1 (de) | Verfahren zur Herstellung von 1,2,5,6-Tetrahydro-4H-pyrrolo(3,2,1-ij)-chinolin-4-on und neue 5-Halogen-1,2,3-(1,2-dihydropyrrolo)-4-chinolone als Zwischenprodukte zur Durchführung des Verfahrens | |
| WO2000026193A1 (de) | Verfahren zur herstellung von 4-[(2',5'-diamino-6'-halogenpyrimidin-4'-yl)amino]-cyclopent-2-enylmethanolen | |
| DD244555A5 (de) | Verfahren zur herstellung von eburnamenin-derivaten | |
| DE1468359A1 (de) | Verfahren zur Herstellung von Dibenzocycloheptehderivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |