CH635088A5 - Verfahren zur herstellung von quartaeren sulfoalkylsalzen. - Google Patents
Verfahren zur herstellung von quartaeren sulfoalkylsalzen. Download PDFInfo
- Publication number
- CH635088A5 CH635088A5 CH571478A CH571478A CH635088A5 CH 635088 A5 CH635088 A5 CH 635088A5 CH 571478 A CH571478 A CH 571478A CH 571478 A CH571478 A CH 571478A CH 635088 A5 CH635088 A5 CH 635088A5
- Authority
- CH
- Switzerland
- Prior art keywords
- water
- hydrogen
- reaction mixture
- carbon atoms
- formula
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 title claims description 8
- 238000004519 manufacturing process Methods 0.000 title description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 14
- 239000001257 hydrogen Substances 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 11
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 239000011541 reaction mixture Substances 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 238000006243 chemical reaction Methods 0.000 claims description 5
- 150000002431 hydrogen Chemical class 0.000 claims description 5
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 239000008096 xylene Substances 0.000 claims description 4
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 150000001555 benzenes Chemical group 0.000 claims description 2
- 125000004122 cyclic group Chemical group 0.000 claims description 2
- 238000004821 distillation Methods 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 239000013589 supplement Substances 0.000 claims description 2
- 229910006069 SO3H Inorganic materials 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- -1 chlorine or bromine Chemical class 0.000 description 6
- 125000004964 sulfoalkyl group Chemical group 0.000 description 6
- 239000000203 mixture Substances 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- DXYYSGDWQCSKKO-UHFFFAOYSA-N 2-methylbenzothiazole Chemical compound C1=CC=C2SC(C)=NC2=C1 DXYYSGDWQCSKKO-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000000975 dye Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 4
- ANRHNWWPFJCPAZ-UHFFFAOYSA-M thionine Chemical compound [Cl-].C1=CC(N)=CC2=[S+]C3=CC(N)=CC=C3N=C21 ANRHNWWPFJCPAZ-UHFFFAOYSA-M 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 2
- WQPMYSHJKXVTME-UHFFFAOYSA-N 3-hydroxypropane-1-sulfonic acid Chemical compound OCCCS(O)(=O)=O WQPMYSHJKXVTME-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 230000001376 precipitating effect Effects 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- LXNGDRGLRRDJOB-UHFFFAOYSA-N 1-ethyl-2-methyl-5-(trifluoromethyl)benzimidazole Chemical compound FC(F)(F)C1=CC=C2N(CC)C(C)=NC2=C1 LXNGDRGLRRDJOB-UHFFFAOYSA-N 0.000 description 1
- ZZLZXZFVVOXVRG-UHFFFAOYSA-N 2,5,6-trimethyl-1,3-benzothiazole Chemical compound CC1=C(C)C=C2SC(C)=NC2=C1 ZZLZXZFVVOXVRG-UHFFFAOYSA-N 0.000 description 1
- RBDZTYJFIHAYLE-UHFFFAOYSA-M 2-(2-chloroprop-1-enyl)-3-ethyl-1,3-benzothiazol-3-ium;chloride Chemical compound [Cl-].C1=CC=C2[N+](CC)=C(C=C(C)Cl)SC2=C1 RBDZTYJFIHAYLE-UHFFFAOYSA-M 0.000 description 1
- JESFPXPFYDUKJP-UHFFFAOYSA-N 2-methyl-1,3-benzothiazol-3-ium;chloride Chemical compound Cl.C1=CC=C2SC(C)=NC2=C1 JESFPXPFYDUKJP-UHFFFAOYSA-N 0.000 description 1
- YEGPVWSPNYPPIK-UHFFFAOYSA-N 4-hydroxybutane-1-sulfonic acid Chemical compound OCCCCS(O)(=O)=O YEGPVWSPNYPPIK-UHFFFAOYSA-N 0.000 description 1
- PWMWNNDLYISLDO-UHFFFAOYSA-M OC(CS(=O)(=O)[O-])C.[K+] Chemical compound OC(CS(=O)(=O)[O-])C.[K+] PWMWNNDLYISLDO-UHFFFAOYSA-M 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
- HHEUTTLXESBJJP-UHFFFAOYSA-N [OH-].S(=O)(=O)(O)CCC[N+]1=CSC2=C1C=CC=C2 Chemical compound [OH-].S(=O)(=O)(O)CCC[N+]1=CSC2=C1C=CC=C2 HHEUTTLXESBJJP-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 230000000711 cancerogenic effect Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- CSKVLUWCGPWCQR-UHFFFAOYSA-M sodium;3-hydroxypropane-1-sulfonate Chemical compound [Na+].OCCCS([O-])(=O)=O CSKVLUWCGPWCQR-UHFFFAOYSA-M 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/54—Benzoxazoles; Hydrogenated benzoxazoles
- C07D263/56—Benzoxazoles; Hydrogenated benzoxazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/22—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/64—Benzothiazoles with only hydrocarbon or substituted hydrocarbon radicals attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D293/00—Heterocyclic compounds containing rings having nitrogen and selenium or nitrogen and tellurium, with or without oxygen or sulfur atoms, as the ring hetero atoms
- C07D293/10—Heterocyclic compounds containing rings having nitrogen and selenium or nitrogen and tellurium, with or without oxygen or sulfur atoms, as the ring hetero atoms condensed with carbocyclic rings or ring systems
- C07D293/12—Selenazoles; Hydrogenated selenazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Indole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT4976278A IT1156809B (it) | 1977-06-10 | 1978-06-08 | Procedimento per preparare sali quaternari solfoalchilici |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB24299/77A GB1593082A (en) | 1977-06-10 | 1977-06-10 | Preparation of sulphoalkyl quaternary salts |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH635088A5 true CH635088A5 (de) | 1983-03-15 |
Family
ID=10209501
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH571478A CH635088A5 (de) | 1977-06-10 | 1978-05-25 | Verfahren zur herstellung von quartaeren sulfoalkylsalzen. |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4287348A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS545973A (cg-RX-API-DMAC10.html) |
| BE (1) | BE868003A (cg-RX-API-DMAC10.html) |
| CH (1) | CH635088A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2825246C2 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2393797A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1593082A (cg-RX-API-DMAC10.html) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2803493A1 (de) * | 1978-01-27 | 1979-08-02 | Agfa Gevaert Ag | Verfahren zur herstellung von sulfoalkylquartaersalzen |
| DE3010427A1 (de) * | 1980-03-19 | 1981-09-24 | Agfa-Gevaert Ag, 5090 Leverkusen | Verfahren zur herstellung von sulfoalkylquartaersalzen |
| JPS5776335U (cg-RX-API-DMAC10.html) * | 1980-10-29 | 1982-05-11 | ||
| DE3118374A1 (de) * | 1981-05-09 | 1982-11-25 | Agfa-Gevaert Ag, 5090 Leverkusen | Verfahren zur herstellung von sulfoalkylquartaersalzen |
| DE3541098A1 (de) * | 1985-11-21 | 1987-05-27 | Agfa Gevaert Ag | Sulfoalkylierungsverfahren |
| US7214825B2 (en) | 2003-10-17 | 2007-05-08 | Honeywell International Inc. | O-(3-chloropropenyl) hydroxylamine free base |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2503776A (en) * | 1947-03-21 | 1950-04-11 | Eastman Kodak Co | Cyanine dyes containing a sulfohydrocarbon radical |
| US3274204A (en) * | 1960-08-01 | 1966-09-20 | Union Oil Co | Preparation of sulfato-betaine-type compounds |
| US3177210A (en) * | 1962-11-29 | 1965-04-06 | Polaroid Corp | Process for preparing cyanine spectral sensitizing dyes |
| US3522261A (en) * | 1965-10-23 | 1970-07-28 | Ash Stevens Inc | Esters of sulfonic acids containing quaternary ammonium groups and process for the preparation thereof |
| DE2128011A1 (de) * | 1971-06-05 | 1972-12-14 | Cassella Farbwerke Mainkur AG, 6000 Frankfurt-Fechenheim | Neue Sulfonyl verbindungen und Verfahren zu ihrer Herstellung |
-
1977
- 1977-06-10 GB GB24299/77A patent/GB1593082A/en not_active Expired
-
1978
- 1978-05-25 CH CH571478A patent/CH635088A5/de not_active IP Right Cessation
- 1978-05-30 JP JP6396278A patent/JPS545973A/ja active Granted
- 1978-06-05 US US05/912,702 patent/US4287348A/en not_active Expired - Lifetime
- 1978-06-08 DE DE2825246A patent/DE2825246C2/de not_active Expired
- 1978-06-09 BE BE188478A patent/BE868003A/xx not_active IP Right Cessation
- 1978-06-09 FR FR787817375A patent/FR2393797A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US4287348A (en) | 1981-09-01 |
| BE868003A (fr) | 1978-12-11 |
| FR2393797B1 (cg-RX-API-DMAC10.html) | 1982-10-29 |
| GB1593082A (en) | 1981-07-15 |
| DE2825246C2 (de) | 1981-12-10 |
| DE2825246A1 (de) | 1978-12-14 |
| JPS6225660B2 (cg-RX-API-DMAC10.html) | 1987-06-04 |
| FR2393797A1 (fr) | 1979-01-05 |
| JPS545973A (en) | 1979-01-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1668429A1 (de) | Verfahren zur Fluoralkylierung nucleophiler Verbindungen | |
| DE2825246C2 (de) | Herstellung quartaerer Sulfoalkylsalze | |
| DE2130919B2 (de) | Substituierte diphenylaether, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| DE2503699C2 (de) | Verfahren zur Herstellung von 1,2- Benzisothiazolen | |
| DE1104965B (de) | Verfahren zur Herstellung von Derivaten des Urazols | |
| DE69009604T2 (de) | 2-Alkyliminobenzothiazoline, ihre Herstellung und sie enthaltende Arzneimittel. | |
| EP0043013B1 (de) | Verfahren zur Herstellung von 2-Chlor-benzthiazolen | |
| DE2834312C2 (de) | Verfahren zur Herstellung von 2[N-(2-Hydroxyäthyl)-N-niederalkylaminomethyl]-benzhydrolen | |
| DE4426133A1 (de) | Verfahren zur Herstellung von aromatischen fluorierten Verbindungen und neue Diamide | |
| EP0393504B1 (de) | Phosphoniumverbindungen und Verfahren zu ihrer Herstellung | |
| DE1620285A1 (de) | Verfahren zur Herstellung von Thiazolverbindungen | |
| DE2065365A1 (de) | 1,3-disubstituierte azetidine und verfahren zu deren herstellung | |
| DE1301321B (de) | Verfahren zur Herstellung von Imidazo[2, 1-b]thiazolderivaten | |
| DE1670196C3 (de) | Verfahren zur Herstellung von 1,2-Benzisothiazolen | |
| DE955769C (de) | Verfahren zur Racemisierung von optisch aktiven 1-(p-Methoxybenzyl)-2-methyl-octahydroisochinolinen | |
| DE3884412T2 (de) | Verfahren zur Herstellung von alpha-(Benzyliden)-acetonylphosphonate. | |
| DE2065854C3 (de) | Verfahren zur Herstellung von 2,3,5,6-Tetrahydroimidazo- eckige Klammer auf 2,1-b] -thiazol | |
| DE2508891A1 (de) | N-(2- und 3-pyridyl)-1-polymethyleniminothiocarboxamide und deren herstellung | |
| AT258280B (de) | Verfahren zur Herstellung von neuen Benzofuranderivaten und ihren Salzen | |
| DE1545568A1 (de) | Verfahren zur Herstellung von substituierten 6-Phenyl-2,3,5,6-tetrahydroimidazo[2,1-b]thiazolen | |
| CH641174A5 (de) | Verfahren zur herstellung von n-(4'-chlor-3'-sulfamoyl-benzolsulfonyl)-n-methyl-2-aminomethyl-2-methyl-tetrahydrofuran. | |
| DE1670231C3 (de) | Verfahren zur Herstellung von substituierten 1,3-Diazacycloalkenen-(2) | |
| AT274806B (de) | Verfahren zur Herstellung von in 2-Stellung substituierten 1,3-Diazacyclopentenen-(2) | |
| AT243268B (de) | Verfahren zur Herstellung von neuen Benzochinolizin-Derivaten | |
| DE1147584B (de) | Verfahren zur Herstellung von substituierten 2-Mercaptothiazol-5-aldehyden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PUE | Assignment |
Owner name: ILFORD LIMITED |
|
| PL | Patent ceased | ||
| PL | Patent ceased |