CH626508A5 - - Google Patents
Download PDFInfo
- Publication number
- CH626508A5 CH626508A5 CH1178876A CH1178876A CH626508A5 CH 626508 A5 CH626508 A5 CH 626508A5 CH 1178876 A CH1178876 A CH 1178876A CH 1178876 A CH1178876 A CH 1178876A CH 626508 A5 CH626508 A5 CH 626508A5
- Authority
- CH
- Switzerland
- Prior art keywords
- cation
- formula
- given
- phenyl
- phosphonomethylglycine
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 20
- -1 nitro, methyl Chemical group 0.000 claims description 18
- 239000000203 mixture Substances 0.000 claims description 17
- 239000004009 herbicide Substances 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 12
- XDDAORKBJWWYJS-UHFFFAOYSA-N glyphosate Chemical compound OC(=O)CNCP(O)(O)=O XDDAORKBJWWYJS-UHFFFAOYSA-N 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 8
- 150000001768 cations Chemical class 0.000 claims description 8
- 230000002363 herbicidal effect Effects 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 claims description 3
- 230000012010 growth Effects 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 239000004480 active ingredient Substances 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- 239000003795 chemical substances by application Substances 0.000 description 10
- 239000007787 solid Substances 0.000 description 10
- 239000000243 solution Substances 0.000 description 9
- 239000002270 dispersing agent Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000004606 Fillers/Extenders Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000003337 fertilizer Substances 0.000 description 6
- 239000004094 surface-active agent Substances 0.000 description 6
- 239000003921 oil Substances 0.000 description 5
- 235000019198 oils Nutrition 0.000 description 5
- 238000011282 treatment Methods 0.000 description 5
- 239000000080 wetting agent Substances 0.000 description 5
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- 244000062793 Sorghum vulgare Species 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- 238000000921 elemental analysis Methods 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 229910052698 phosphorus Inorganic materials 0.000 description 4
- 239000011574 phosphorus Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000007921 spray Substances 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- 239000011593 sulfur Substances 0.000 description 4
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- 230000003750 conditioning effect Effects 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 150000004683 dihydrates Chemical class 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 235000019713 millet Nutrition 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- KJFMBFZCATUALV-UHFFFAOYSA-N phenolphthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2C(=O)O1 KJFMBFZCATUALV-UHFFFAOYSA-N 0.000 description 2
- 231100000208 phytotoxic Toxicity 0.000 description 2
- 230000000885 phytotoxic effect Effects 0.000 description 2
- QCMHWZUFWLOOGI-UHFFFAOYSA-N s-ethyl chloromethanethioate Chemical compound CCSC(Cl)=O QCMHWZUFWLOOGI-UHFFFAOYSA-N 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000003784 tall oil Substances 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- UVMISZGSKYNDJY-UHFFFAOYSA-N 1-butyl-3-(3,4-dichlorophenyl)-1-methylurea 2-(naphthalen-1-ylcarbamoyl)benzoic acid Chemical compound CCCCN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1.OC(=O)C1=CC=CC=C1C(=O)NC1=CC=CC2=CC=CC=C12 UVMISZGSKYNDJY-UHFFFAOYSA-N 0.000 description 1
- NDUPDOJHUQKPAG-UHFFFAOYSA-M 2,2-Dichloropropanoate Chemical compound CC(Cl)(Cl)C([O-])=O NDUPDOJHUQKPAG-UHFFFAOYSA-M 0.000 description 1
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- STBFAYAECBXZNQ-UHFFFAOYSA-N 2-[3-methyl-n-(phosphonomethyl)anilino]-3-oxo-3-thiophen-2-ylpropanoic acid Chemical compound CC1=CC=CC(N(CP(O)(O)=O)C(C(O)=O)C(=O)C=2SC=CC=2)=C1 STBFAYAECBXZNQ-UHFFFAOYSA-N 0.000 description 1
- WRHBQTDMNMWLRV-UHFFFAOYSA-N 2-[4-chloro-N-(phosphonomethyl)anilino]-3-oxo-3-thiophen-2-ylpropanoic acid Chemical compound C=1C=CSC=1C(=O)C(C(=O)O)N(CP(O)(O)=O)C1=CC=C(Cl)C=C1 WRHBQTDMNMWLRV-UHFFFAOYSA-N 0.000 description 1
- YBFKDMAHGQZOOO-UHFFFAOYSA-N 2-[butyl(phosphonomethyl)amino]-3-oxo-3-thiophen-2-ylpropanoic acid Chemical compound CCCCN(CP(O)(O)=O)C(C(O)=O)C(=O)C1=CC=CS1 YBFKDMAHGQZOOO-UHFFFAOYSA-N 0.000 description 1
- AXBRAUQUUQIMCK-UHFFFAOYSA-N 2-[ethyl(phosphonomethyl)amino]-3-oxo-3-thiophen-2-ylpropanoic acid Chemical compound OP(=O)(O)CN(CC)C(C(O)=O)C(=O)C1=CC=CS1 AXBRAUQUUQIMCK-UHFFFAOYSA-N 0.000 description 1
- GCZOAVGKEYFEKF-UHFFFAOYSA-N 2-[phosphonomethyl(thiophene-2-carbonyl)amino]acetic acid Chemical compound OC(=O)CN(CP(O)(O)=O)C(=O)C1=CC=CS1 GCZOAVGKEYFEKF-UHFFFAOYSA-N 0.000 description 1
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- WNSJPNAEKLLFCU-UHFFFAOYSA-N 3-amino-2,5-dichlorobenzoic acid 1H-1,2,4-triazol-5-amine Chemical compound NC1=NNC=N1.NC=1C(=C(C(=O)O)C=C(C1)Cl)Cl WNSJPNAEKLLFCU-UHFFFAOYSA-N 0.000 description 1
- LMQXGAXXUTXYGK-UHFFFAOYSA-N 3-oxo-2-[n-(phosphonomethyl)anilino]-3-thiophen-2-ylpropanoic acid Chemical compound C=1C=CSC=1C(=O)C(C(=O)O)N(CP(O)(O)=O)C1=CC=CC=C1 LMQXGAXXUTXYGK-UHFFFAOYSA-N 0.000 description 1
- XZKRJSXNQXQPJT-UHFFFAOYSA-N 3-oxo-2-[phosphonomethyl(propan-2-yl)amino]-3-thiophen-2-ylpropanoic acid Chemical compound OP(=O)(O)CN(C(C)C)C(C(O)=O)C(=O)C1=CC=CS1 XZKRJSXNQXQPJT-UHFFFAOYSA-N 0.000 description 1
- UCCBUUSRMUQGPH-UHFFFAOYSA-N 6-chloro-2-n,4-n-diethyl-1,3,5-triazine-2,4-diamine;6-chloro-2-n,4-n-di(propan-2-yl)-1,3,5-triazine-2,4-diamine Chemical compound CCNC1=NC(Cl)=NC(NCC)=N1.CC(C)NC1=NC(Cl)=NC(NC(C)C)=N1 UCCBUUSRMUQGPH-UHFFFAOYSA-N 0.000 description 1
- XKJMBINCVNINCA-UHFFFAOYSA-N Alfalone Chemical compound CON(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XKJMBINCVNINCA-UHFFFAOYSA-N 0.000 description 1
- MDBGGTQNNUOQRC-UHFFFAOYSA-N Allidochlor Chemical compound ClCC(=O)N(CC=C)CC=C MDBGGTQNNUOQRC-UHFFFAOYSA-N 0.000 description 1
- 240000005528 Arctium lappa Species 0.000 description 1
- 235000003130 Arctium lappa Nutrition 0.000 description 1
- 235000008078 Arctium minus Nutrition 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- 241001148727 Bromus tectorum Species 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 240000006122 Chenopodium album Species 0.000 description 1
- 235000011498 Chenopodium album var missouriense Nutrition 0.000 description 1
- 235000013328 Chenopodium album var. album Nutrition 0.000 description 1
- 235000014052 Chenopodium album var. microphyllum Nutrition 0.000 description 1
- 235000014050 Chenopodium album var. stevensii Nutrition 0.000 description 1
- 235000013012 Chenopodium album var. striatum Nutrition 0.000 description 1
- 241000132536 Cirsium Species 0.000 description 1
- 241001547427 Cissampelos pareira Species 0.000 description 1
- 241000234653 Cyperus Species 0.000 description 1
- SPANOECCGNXGNR-UITAMQMPSA-N Diallat Chemical compound CC(C)N(C(C)C)C(=O)SC\C(Cl)=C\Cl SPANOECCGNXGNR-UITAMQMPSA-N 0.000 description 1
- 235000017896 Digitaria Nutrition 0.000 description 1
- 241001303487 Digitaria <clam> Species 0.000 description 1
- QAHFOPIILNICLA-UHFFFAOYSA-N Diphenamid Chemical compound C=1C=CC=CC=1C(C(=O)N(C)C)C1=CC=CC=C1 QAHFOPIILNICLA-UHFFFAOYSA-N 0.000 description 1
- 241000508725 Elymus repens Species 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 239000005574 MCPA Substances 0.000 description 1
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 241000209117 Panicum Species 0.000 description 1
- 235000006443 Panicum miliaceum subsp. miliaceum Nutrition 0.000 description 1
- 235000009037 Panicum miliaceum subsp. ruderale Nutrition 0.000 description 1
- 240000000275 Persicaria hydropiper Species 0.000 description 1
- 235000017337 Persicaria hydropiper Nutrition 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 244000292697 Polygonum aviculare Species 0.000 description 1
- 235000006386 Polygonum aviculare Nutrition 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 241000533293 Sesbania emerus Species 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- XJCLWVXTCRQIDI-UHFFFAOYSA-N Sulfallate Chemical compound CCN(CC)C(=S)SCC(Cl)=C XJCLWVXTCRQIDI-UHFFFAOYSA-N 0.000 description 1
- WHKUVVPPKQRRBV-UHFFFAOYSA-N Trasan Chemical compound CC1=CC(Cl)=CC=C1OCC(O)=O WHKUVVPPKQRRBV-UHFFFAOYSA-N 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 150000003869 acetamides Chemical class 0.000 description 1
- 150000008061 acetanilides Chemical class 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 150000001243 acetic acids Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- PXWUKZGIHQRDHL-UHFFFAOYSA-N atraton Chemical compound CCNC1=NC(NC(C)C)=NC(OC)=N1 PXWUKZGIHQRDHL-UHFFFAOYSA-N 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- UWRPUGNJNQUMEH-UHFFFAOYSA-N benzenethiol;carbonochloridic acid Chemical compound OC(Cl)=O.SC1=CC=CC=C1 UWRPUGNJNQUMEH-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- WQAQPCDUOCURKW-UHFFFAOYSA-N butanethiol Chemical compound CCCCS WQAQPCDUOCURKW-UHFFFAOYSA-N 0.000 description 1
- 150000003940 butylamines Chemical class 0.000 description 1
- YYRMJZQKEFZXMX-UHFFFAOYSA-N calcium;phosphoric acid Chemical compound [Ca+2].OP(O)(O)=O.OP(O)(O)=O YYRMJZQKEFZXMX-UHFFFAOYSA-N 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- IVUXTESCPZUGJC-UHFFFAOYSA-N chloroxuron Chemical compound C1=CC(NC(=O)N(C)C)=CC=C1OC1=CC=C(Cl)C=C1 IVUXTESCPZUGJC-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- SDIXRDNYIMOKSG-UHFFFAOYSA-L disodium methyl arsenate Chemical compound [Na+].[Na+].C[As]([O-])([O-])=O SDIXRDNYIMOKSG-UHFFFAOYSA-L 0.000 description 1
- JMGZBMRVDHKMKB-UHFFFAOYSA-L disodium;2-sulfobutanedioate Chemical compound [Na+].[Na+].OS(=O)(=O)C(C([O-])=O)CC([O-])=O JMGZBMRVDHKMKB-UHFFFAOYSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 229940060296 dodecylbenzenesulfonic acid Drugs 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- XCOBTUNSZUJCDH-UHFFFAOYSA-B lithium magnesium sodium silicate Chemical compound [Li+].[Li+].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[Na+].[Na+].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3 XCOBTUNSZUJCDH-UHFFFAOYSA-B 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- XITQUSLLOSKDTB-UHFFFAOYSA-N nitrofen Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC1=CC=C(Cl)C=C1Cl XITQUSLLOSKDTB-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- INFDPOAKFNIJBF-UHFFFAOYSA-N paraquat Chemical compound C1=C[N+](C)=CC=C1C1=CC=[N+](C)C=C1 INFDPOAKFNIJBF-UHFFFAOYSA-N 0.000 description 1
- FIKAKWIAUPDISJ-UHFFFAOYSA-L paraquat dichloride Chemical compound [Cl-].[Cl-].C1=C[N+](C)=CC=C1C1=CC=[N+](C)C=C1 FIKAKWIAUPDISJ-UHFFFAOYSA-L 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N phosphonic acid group Chemical group P(O)(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229940045998 sodium isethionate Drugs 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- LADXKQRVAFSPTR-UHFFFAOYSA-M sodium;2-hydroxyethanesulfonate Chemical compound [Na+].OCCS([O-])(=O)=O LADXKQRVAFSPTR-UHFFFAOYSA-M 0.000 description 1
- HIEHAIZHJZLEPQ-UHFFFAOYSA-M sodium;naphthalene-1-sulfonate Chemical compound [Na+].C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 HIEHAIZHJZLEPQ-UHFFFAOYSA-M 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 239000002426 superphosphate Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 229940104261 taurate Drugs 0.000 description 1
- XOAAWQZATWQOTB-UHFFFAOYSA-N taurine Chemical compound NCCS(O)(=O)=O XOAAWQZATWQOTB-UHFFFAOYSA-N 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 230000009105 vegetative growth Effects 0.000 description 1
- 239000000341 volatile oil Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/3804—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)] not used, see subgroups
- C07F9/3808—Acyclic saturated acids which can have further substituents on alkyl
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/644,784 US3991095A (en) | 1975-12-29 | 1975-12-29 | N-thiolcarbonyl derivatives of N-phosphonomethylglycine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH626508A5 true CH626508A5 (enExample) | 1981-11-30 |
Family
ID=24586310
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1178876A CH626508A5 (enExample) | 1975-12-29 | 1976-09-17 |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US3991095A (enExample) |
| JP (1) | JPS5283331A (enExample) |
| AU (1) | AU501312B2 (enExample) |
| BE (1) | BE849902A (enExample) |
| BG (1) | BG35462A3 (enExample) |
| BR (1) | BR7607156A (enExample) |
| CA (1) | CA1083172A (enExample) |
| CH (1) | CH626508A5 (enExample) |
| CS (1) | CS207369B2 (enExample) |
| DD (2) | DD134530A5 (enExample) |
| DE (1) | DE2641318A1 (enExample) |
| FR (1) | FR2337140A1 (enExample) |
| GB (1) | GB1513347A (enExample) |
| HU (1) | HU184173B (enExample) |
| IL (1) | IL50476A (enExample) |
| IT (1) | IT1070831B (enExample) |
| MY (1) | MY7900234A (enExample) |
| NL (1) | NL161162C (enExample) |
| PH (1) | PH12171A (enExample) |
| PL (1) | PL99757B1 (enExample) |
| RO (3) | RO80036B (enExample) |
| SU (1) | SU667108A3 (enExample) |
| YU (1) | YU229476A (enExample) |
| ZA (1) | ZA765469B (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4175946A (en) * | 1978-07-10 | 1979-11-27 | Monsanto Company | Thio derivatives of N-trifluoroacetyl-N-phosphonomethylglycine |
| US4300942A (en) * | 1978-09-29 | 1981-11-17 | Monsanto Company | N-(Substituted carbonyl) derivatives of N-phos-phinylmethylglycinates and the herbicidal use thereof |
| US4251258A (en) * | 1978-09-29 | 1981-02-17 | Monsanto Company | N-(Substituted carbonyl) derivatives of N-phosphinylmethylglycinates and the herbicidal use thereof |
| US4231782A (en) * | 1978-11-03 | 1980-11-04 | Monsanto Company | N-Carbobenzoxy-N-phosphonomethylglycine thioesters |
| US4226611A (en) * | 1978-11-03 | 1980-10-07 | Monsanto Company | N-Phosphonomethylglycine thioester herbicides |
| US4251256A (en) * | 1978-12-22 | 1981-02-17 | Monsanto Company | Herbicidal N-substituted ethylene derivatives of N-phosphonomethylglycine |
| US4195983A (en) * | 1978-12-26 | 1980-04-01 | Monsanto Company | N-Trifluoroacetyl-N-phosphinothioylmethylglycine esters |
| US4211548A (en) * | 1978-12-26 | 1980-07-08 | Monsanto Company | Esters of N-phosphinothioylmethylglycine and herbicidal method |
| US4211732A (en) * | 1978-12-26 | 1980-07-08 | Monsanto Company | N-Carbobenzoxy-N-phosphinothioylmethylgylcine esters |
| US4191552A (en) * | 1979-02-02 | 1980-03-04 | Stauffer Chemical Company | Amine salts of substituted N-phosphonomethylureas and their use as plant growth regulators |
| US4261727A (en) * | 1979-08-02 | 1981-04-14 | Monsanto Company | Herbicidal N-substituted triesters of N-phosphonomethylglycine |
| US4323387A (en) * | 1980-07-28 | 1982-04-06 | Monsanto Company | N-Thiolcarbonyl derivatives of N-phosphonomethylglycinonitrile esters, herbicidal compositions and use thereof |
| US4395374A (en) * | 1981-01-02 | 1983-07-26 | Monsanto Company | Alkyl N-arylsulfenyl-N-diaryloxy-phosphinylmethylglycinates |
| US4457873A (en) * | 1983-03-24 | 1984-07-03 | Stauffer Chemical Company | Process for preparing phosphonomethylated amino acids |
| US4491548A (en) * | 1983-04-28 | 1985-01-01 | Stauffer Chemical Company | Process for preparing phosphonomethylated amino acids |
| US4548760A (en) * | 1983-04-28 | 1985-10-22 | Stauffer Chemical Company | Process for preparing phosphonomethylated amino acids |
| US4505736A (en) * | 1983-05-11 | 1985-03-19 | Monsanto Company | N-Phosphonomethylglycine derivatives and use as herbicides |
| US5580841A (en) * | 1985-05-29 | 1996-12-03 | Zeneca Limited | Solid, phytoactive compositions and method for their preparation |
| US5468718A (en) * | 1985-10-21 | 1995-11-21 | Ici Americas Inc. | Liquid, phytoactive compositions and method for their preparation |
| IL129839A0 (en) | 1997-02-13 | 2000-02-29 | Monsanto Co | Method of preparing amino carboxylic acids |
| US8470741B2 (en) * | 2003-05-07 | 2013-06-25 | Croda Americas Llc | Homogeneous liquid saccharide and oil systems |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3455675A (en) * | 1968-06-25 | 1969-07-15 | Monsanto Co | Aminophosphonate herbicides |
| US3799758A (en) * | 1971-08-09 | 1974-03-26 | Monsanto Co | N-phosphonomethyl-glycine phytotoxicant compositions |
| US3853530A (en) * | 1971-03-10 | 1974-12-10 | Monsanto Co | Regulating plants with n-phosphonomethylglycine and derivatives thereof |
| US3835000A (en) * | 1972-12-21 | 1974-09-10 | Monsanto Co | Electrolytic process for producing n-phosphonomethyl glycine |
-
1975
- 1975-12-29 US US05/644,784 patent/US3991095A/en not_active Expired - Lifetime
-
1976
- 1976-09-09 NL NL7610010.A patent/NL161162C/xx not_active IP Right Cessation
- 1976-09-13 IL IL50476A patent/IL50476A/xx unknown
- 1976-09-13 CA CA261,030A patent/CA1083172A/en not_active Expired
- 1976-09-13 ZA ZA765469A patent/ZA765469B/xx unknown
- 1976-09-13 PH PH18901A patent/PH12171A/en unknown
- 1976-09-13 AU AU17675/76A patent/AU501312B2/en not_active Expired
- 1976-09-13 GB GB37789/76A patent/GB1513347A/en not_active Expired
- 1976-09-14 DE DE19762641318 patent/DE2641318A1/de not_active Withdrawn
- 1976-09-15 IT IT27229/76A patent/IT1070831B/it active
- 1976-09-17 JP JP11087876A patent/JPS5283331A/ja active Granted
- 1976-09-17 YU YU02294/76A patent/YU229476A/xx unknown
- 1976-09-17 CH CH1178876A patent/CH626508A5/de not_active IP Right Cessation
- 1976-09-20 HU HU76MO966A patent/HU184173B/hu unknown
- 1976-09-22 CS CS766148A patent/CS207369B2/cs unknown
- 1976-09-23 DD DD76203218A patent/DD134530A5/xx unknown
- 1976-09-23 DD DD7600194958A patent/DD128532A5/xx unknown
- 1976-09-27 PL PL1976192692A patent/PL99757B1/pl unknown
- 1976-09-27 SU SU762403951A patent/SU667108A3/ru active
- 1976-09-28 FR FR7629118A patent/FR2337140A1/fr active Granted
- 1976-10-01 RO RO87879A patent/RO80036B/ro unknown
- 1976-10-01 RO RO76114138A patent/RO88787A/ro unknown
- 1976-10-01 RO RO103631A patent/RO83585B/ro unknown
- 1976-10-21 BG BG034498A patent/BG35462A3/xx unknown
- 1976-10-26 BR BR7607156A patent/BR7607156A/pt unknown
- 1976-12-28 BE BE173674A patent/BE849902A/xx not_active IP Right Cessation
-
1979
- 1979-12-30 MY MY234/79A patent/MY7900234A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL50476A (en) | 1980-10-26 |
| AU501312B2 (en) | 1979-06-14 |
| BG35462A3 (en) | 1984-04-15 |
| DD128532A5 (de) | 1977-11-23 |
| RO83585A (ro) | 1984-06-21 |
| FR2337140B1 (enExample) | 1979-08-17 |
| CS207369B2 (en) | 1981-07-31 |
| MY7900234A (en) | 1979-12-31 |
| IT1070831B (it) | 1985-04-02 |
| IL50476A0 (en) | 1976-11-30 |
| HU184173B (en) | 1984-07-30 |
| NL161162C (nl) | 1980-01-15 |
| NL7610010A (nl) | 1977-07-01 |
| CA1083172A (en) | 1980-08-05 |
| DE2641318A1 (de) | 1977-07-07 |
| NL161162B (nl) | 1979-08-15 |
| RO83585B (ro) | 1984-08-30 |
| AU1767576A (en) | 1978-03-23 |
| FR2337140A1 (fr) | 1977-07-29 |
| GB1513347A (en) | 1978-06-07 |
| RO80036B (ro) | 1983-02-28 |
| BR7607156A (pt) | 1977-09-13 |
| RO80036A (ro) | 1983-02-15 |
| BE849902A (fr) | 1977-06-28 |
| JPS5623436B2 (enExample) | 1981-05-30 |
| PH12171A (en) | 1978-11-21 |
| ZA765469B (en) | 1977-08-31 |
| JPS5283331A (en) | 1977-07-12 |
| US3991095A (en) | 1976-11-09 |
| SU667108A3 (ru) | 1979-06-05 |
| YU229476A (en) | 1983-01-21 |
| RO88787A (ro) | 1986-03-15 |
| PL99757B1 (pl) | 1978-08-31 |
| DD134530A5 (de) | 1979-03-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH626508A5 (enExample) | ||
| EP0048436B1 (de) | Herbizide Mittel | |
| CH627922A5 (de) | Herbizides mittel. | |
| DE2406475C2 (de) | 5-Acetamido-2,4-dimethyltrifluormethansulfonanilid und dessen landwirtschaftlich geeignete Salze, Verfahren zur Herstellung dieser Verbindungen und diese Verbindungen enthaltende Mittel | |
| DE2622837A1 (de) | N-(perfluoracyl)-n-phosphonomethylglycinverbindungen, verfahren zu deren herstellung sie enthaltende herbizide mittel und deren verwendung | |
| CH628905A5 (de) | Verfahren zur herstellung von herbizid wirksamen neuen n-phosphonomethylglycin-derivaten. | |
| DE2551027C2 (de) | 2-Trifluormethylmethan-sulfonanilide, Verfahren zu deren Herstellung und deren Verwendung als Herbicide | |
| AT334134B (de) | Bekampfung von pilzschadlingen | |
| DE2061133A1 (de) | Pestizide Verbindung,Verfahren zu ihrer Herstellung und Verwendung | |
| DE2828915A1 (de) | Lactone der n-(2-hydroxyalkyl)- n-phosphonomethylglycinverbindungen und ihre verwendung als herbizide | |
| DD251067A5 (de) | Herbizide zusammensetzung | |
| DD218268A5 (de) | Herbizide zusammensetzung | |
| DE2536149B2 (de) | N-Phosphonomethylglycinphenylhydrazide und Verfahren zu ihrer Herstellung | |
| DE2014849A1 (de) | Verfahren zur Erhöhung des Zuckerge haltes von Zuckerrohr | |
| CH636105A5 (de) | N-hydroxy-n-phosphonomethylglycin mit herbizider wirksamkeit und seine als herbizide geeigneten salze. | |
| DE1955892C3 (de) | Verwendung eines Benzylthiolcarbamates als Herbizid | |
| AT362615B (de) | Herbizide zubereitungen | |
| DE3309141A1 (de) | Herbizide zusammensetzung | |
| DE2349970A1 (de) | N-benzoyl-n-(3-chlor-4-fluorphenyl)-2amino-propionsaeureester und deren verwendung als herbizide | |
| AT276448B (de) | Verfahren zur Erhöhung des maximalen Zuckergehalts von Zuckerrohr | |
| DE1124296B (de) | Herbicide Mittel und Verfahren zur Herstellung der Wirkstoffe in ihren Loesungen in OElen | |
| EP0006184A1 (de) | 1-Trimethylsilylphenyl-3-mono- und -di-halobenzoyl-harnstoffe, Verfahren zu ihrer Herstellung, Mittel welche diese Harnstoffe enthalten und deren Verwendung zur Bekämpfung von Insekten | |
| DD143554A5 (de) | Herbizide zusammensetzung | |
| DE3110525A1 (de) | 2-halogenacetanilide und ihre verwendung als herbizide | |
| DE3110475A1 (de) | 2-halogenacetanilide und ihre verwendung als herbizide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |