PL99757B1 - Srodek chwastobojczy - Google Patents
Srodek chwastobojczy Download PDFInfo
- Publication number
- PL99757B1 PL99757B1 PL1976192692A PL19269276A PL99757B1 PL 99757 B1 PL99757 B1 PL 99757B1 PL 1976192692 A PL1976192692 A PL 1976192692A PL 19269276 A PL19269276 A PL 19269276A PL 99757 B1 PL99757 B1 PL 99757B1
- Authority
- PL
- Poland
- Prior art keywords
- active ingredient
- agent
- salt
- water
- compound
- Prior art date
Links
- 239000004480 active ingredient Substances 0.000 claims description 21
- -1 nitro, methoxy, methyl Chemical group 0.000 claims description 19
- 239000000203 mixture Substances 0.000 claims description 14
- 230000002363 herbicidal effect Effects 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 11
- 239000004009 herbicide Substances 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 150000001768 cations Chemical class 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 238000009472 formulation Methods 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 239000002671 adjuvant Substances 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 description 24
- 241000196324 Embryophyta Species 0.000 description 22
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 239000002253 acid Substances 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 150000003839 salts Chemical class 0.000 description 10
- 229910052698 phosphorus Inorganic materials 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 229910052717 sulfur Inorganic materials 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000002270 dispersing agent Substances 0.000 description 6
- 239000000945 filler Substances 0.000 description 6
- XDDAORKBJWWYJS-UHFFFAOYSA-N glyphosate Chemical class OC(=O)CNCP(O)(O)=O XDDAORKBJWWYJS-UHFFFAOYSA-N 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 5
- 239000003337 fertilizer Substances 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 235000019198 oils Nutrition 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 239000004094 surface-active agent Substances 0.000 description 5
- 239000000080 wetting agent Substances 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 238000000921 elemental analysis Methods 0.000 description 4
- 231100000208 phytotoxic Toxicity 0.000 description 4
- 230000000885 phytotoxic effect Effects 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000007900 aqueous suspension Substances 0.000 description 3
- KTRFZWJCHOQHMN-UHFFFAOYSA-N chloromethanethioic s-acid Chemical compound SC(Cl)=O KTRFZWJCHOQHMN-UHFFFAOYSA-N 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 244000062793 Sorghum vulgare Species 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- KJFMBFZCATUALV-UHFFFAOYSA-N phenolphthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2C(=O)O1 KJFMBFZCATUALV-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- HBEFYGYBMKPNSZ-UHFFFAOYSA-N s-phenyl chloromethanethioate Chemical compound ClC(=O)SC1=CC=CC=C1 HBEFYGYBMKPNSZ-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- NDUPDOJHUQKPAG-UHFFFAOYSA-M 2,2-Dichloropropanoate Chemical compound CC(Cl)(Cl)C([O-])=O NDUPDOJHUQKPAG-UHFFFAOYSA-M 0.000 description 1
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 description 1
- HXKWSTRRCHTUEC-UHFFFAOYSA-N 2,4-Dichlorophenoxyaceticacid Chemical compound OC(=O)C(Cl)OC1=CC=C(Cl)C=C1 HXKWSTRRCHTUEC-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- NFAOATPOYUWEHM-UHFFFAOYSA-N 2-(6-methylheptyl)phenol Chemical compound CC(C)CCCCCC1=CC=CC=C1O NFAOATPOYUWEHM-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- MDBGGTQNNUOQRC-UHFFFAOYSA-N Allidochlor Chemical compound ClCC(=O)N(CC=C)CC=C MDBGGTQNNUOQRC-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical compound NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 1
- 241000239290 Araneae Species 0.000 description 1
- 235000000832 Ayote Nutrition 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- GNDPLESVYOSBPX-UHFFFAOYSA-N BrC=1C(N(C(NC1C)=O)C(C)C)=O.ClC1=C(C(=CC=C1Cl)Cl)CC(=O)O Chemical compound BrC=1C(N(C(NC1C)=O)C(C)C)=O.ClC1=C(C(=CC=C1Cl)Cl)CC(=O)O GNDPLESVYOSBPX-UHFFFAOYSA-N 0.000 description 1
- 235000011293 Brassica napus Nutrition 0.000 description 1
- 240000008100 Brassica rapa Species 0.000 description 1
- 235000000540 Brassica rapa subsp rapa Nutrition 0.000 description 1
- 240000006162 Chenopodium quinoa Species 0.000 description 1
- 240000004244 Cucurbita moschata Species 0.000 description 1
- 235000009854 Cucurbita moschata Nutrition 0.000 description 1
- 235000009804 Cucurbita pepo subsp pepo Nutrition 0.000 description 1
- QAHFOPIILNICLA-UHFFFAOYSA-N Diphenamid Chemical class C=1C=CC=CC=1C(C(=O)N(C)C)C1=CC=CC=C1 QAHFOPIILNICLA-UHFFFAOYSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- 244000248416 Fagopyrum cymosum Species 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 240000001549 Ipomoea eriocarpa Species 0.000 description 1
- 235000005146 Ipomoea eriocarpa Nutrition 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 244000110797 Polygonum persicaria Species 0.000 description 1
- 235000004442 Polygonum persicaria Nutrition 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 description 1
- 241000219100 Rhamnaceae Species 0.000 description 1
- 241000533293 Sesbania emerus Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 240000002439 Sorghum halepense Species 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 150000003869 acetamides Chemical class 0.000 description 1
- 150000008061 acetanilides Chemical class 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 150000001243 acetic acids Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000010692 aromatic oil Substances 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- 150000003940 butylamines Chemical class 0.000 description 1
- YYRMJZQKEFZXMX-UHFFFAOYSA-N calcium;phosphoric acid Chemical compound [Ca+2].OP(O)(O)=O.OP(O)(O)=O YYRMJZQKEFZXMX-UHFFFAOYSA-N 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 229940116901 diethyldithiocarbamate Drugs 0.000 description 1
- LMBWSYZSUOEYSN-UHFFFAOYSA-N diethyldithiocarbamic acid Chemical compound CCN(CC)C(S)=S LMBWSYZSUOEYSN-UHFFFAOYSA-N 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- SIQGBUJXKSJZAV-UHFFFAOYSA-L disodium;2-(phosphonomethylamino)acetate Chemical compound [Na+].[Na+].OP(O)(=O)CNCC([O-])=O.OP(O)(=O)CNCC([O-])=O SIQGBUJXKSJZAV-UHFFFAOYSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 150000002332 glycine derivatives Chemical class 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- XCOBTUNSZUJCDH-UHFFFAOYSA-B lithium magnesium sodium silicate Chemical compound [Li+].[Li+].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[Na+].[Na+].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3 XCOBTUNSZUJCDH-UHFFFAOYSA-B 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000019713 millet Nutrition 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- GXQTVBBEBYIVQX-UHFFFAOYSA-N o-(3-methylphenyl) chloromethanethioate Chemical compound CC1=CC=CC(OC(Cl)=S)=C1 GXQTVBBEBYIVQX-UHFFFAOYSA-N 0.000 description 1
- SFSPOXSIVFSJHM-UHFFFAOYSA-N o-benzyl chloromethanethioate Chemical compound ClC(=S)OCC1=CC=CC=C1 SFSPOXSIVFSJHM-UHFFFAOYSA-N 0.000 description 1
- DZLVDLVDQWAWJG-UHFFFAOYSA-N o-butyl chloromethanethioate Chemical compound CCCCOC(Cl)=S DZLVDLVDQWAWJG-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- MFOUDYKPLGXPGO-UHFFFAOYSA-N propachlor Chemical compound ClCC(=O)N(C(C)C)C1=CC=CC=C1 MFOUDYKPLGXPGO-UHFFFAOYSA-N 0.000 description 1
- 235000015136 pumpkin Nutrition 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 235000015067 sauces Nutrition 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- LADXKQRVAFSPTR-UHFFFAOYSA-M sodium;2-hydroxyethanesulfonate Chemical class [Na+].OCCS([O-])(=O)=O LADXKQRVAFSPTR-UHFFFAOYSA-M 0.000 description 1
- HIEHAIZHJZLEPQ-UHFFFAOYSA-M sodium;naphthalene-1-sulfonate Chemical class [Na+].C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 HIEHAIZHJZLEPQ-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000012439 solid excipient Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000002426 superphosphate Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- 150000003558 thiocarbamic acid derivatives Chemical class 0.000 description 1
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- ZSDSQXJSNMTJDA-UHFFFAOYSA-N trifluralin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O ZSDSQXJSNMTJDA-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/3804—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)] not used, see subgroups
- C07F9/3808—Acyclic saturated acids which can have further substituents on alkyl
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/644,784 US3991095A (en) | 1975-12-29 | 1975-12-29 | N-thiolcarbonyl derivatives of N-phosphonomethylglycine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL99757B1 true PL99757B1 (pl) | 1978-08-31 |
Family
ID=24586310
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1976192692A PL99757B1 (pl) | 1975-12-29 | 1976-09-27 | Srodek chwastobojczy |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US3991095A (enExample) |
| JP (1) | JPS5283331A (enExample) |
| AU (1) | AU501312B2 (enExample) |
| BE (1) | BE849902A (enExample) |
| BG (1) | BG35462A3 (enExample) |
| BR (1) | BR7607156A (enExample) |
| CA (1) | CA1083172A (enExample) |
| CH (1) | CH626508A5 (enExample) |
| CS (1) | CS207369B2 (enExample) |
| DD (2) | DD134530A5 (enExample) |
| DE (1) | DE2641318A1 (enExample) |
| FR (1) | FR2337140A1 (enExample) |
| GB (1) | GB1513347A (enExample) |
| HU (1) | HU184173B (enExample) |
| IL (1) | IL50476A (enExample) |
| IT (1) | IT1070831B (enExample) |
| MY (1) | MY7900234A (enExample) |
| NL (1) | NL161162C (enExample) |
| PH (1) | PH12171A (enExample) |
| PL (1) | PL99757B1 (enExample) |
| RO (3) | RO80036B (enExample) |
| SU (1) | SU667108A3 (enExample) |
| YU (1) | YU229476A (enExample) |
| ZA (1) | ZA765469B (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4175946A (en) * | 1978-07-10 | 1979-11-27 | Monsanto Company | Thio derivatives of N-trifluoroacetyl-N-phosphonomethylglycine |
| US4300942A (en) * | 1978-09-29 | 1981-11-17 | Monsanto Company | N-(Substituted carbonyl) derivatives of N-phos-phinylmethylglycinates and the herbicidal use thereof |
| US4251258A (en) * | 1978-09-29 | 1981-02-17 | Monsanto Company | N-(Substituted carbonyl) derivatives of N-phosphinylmethylglycinates and the herbicidal use thereof |
| US4231782A (en) * | 1978-11-03 | 1980-11-04 | Monsanto Company | N-Carbobenzoxy-N-phosphonomethylglycine thioesters |
| US4226611A (en) * | 1978-11-03 | 1980-10-07 | Monsanto Company | N-Phosphonomethylglycine thioester herbicides |
| US4251256A (en) * | 1978-12-22 | 1981-02-17 | Monsanto Company | Herbicidal N-substituted ethylene derivatives of N-phosphonomethylglycine |
| US4211548A (en) * | 1978-12-26 | 1980-07-08 | Monsanto Company | Esters of N-phosphinothioylmethylglycine and herbicidal method |
| US4211732A (en) * | 1978-12-26 | 1980-07-08 | Monsanto Company | N-Carbobenzoxy-N-phosphinothioylmethylgylcine esters |
| US4195983A (en) * | 1978-12-26 | 1980-04-01 | Monsanto Company | N-Trifluoroacetyl-N-phosphinothioylmethylglycine esters |
| US4191552A (en) * | 1979-02-02 | 1980-03-04 | Stauffer Chemical Company | Amine salts of substituted N-phosphonomethylureas and their use as plant growth regulators |
| US4261727A (en) * | 1979-08-02 | 1981-04-14 | Monsanto Company | Herbicidal N-substituted triesters of N-phosphonomethylglycine |
| US4323387A (en) * | 1980-07-28 | 1982-04-06 | Monsanto Company | N-Thiolcarbonyl derivatives of N-phosphonomethylglycinonitrile esters, herbicidal compositions and use thereof |
| US4395374A (en) * | 1981-01-02 | 1983-07-26 | Monsanto Company | Alkyl N-arylsulfenyl-N-diaryloxy-phosphinylmethylglycinates |
| US4457873A (en) * | 1983-03-24 | 1984-07-03 | Stauffer Chemical Company | Process for preparing phosphonomethylated amino acids |
| US4548760A (en) * | 1983-04-28 | 1985-10-22 | Stauffer Chemical Company | Process for preparing phosphonomethylated amino acids |
| US4491548A (en) * | 1983-04-28 | 1985-01-01 | Stauffer Chemical Company | Process for preparing phosphonomethylated amino acids |
| US4505736A (en) * | 1983-05-11 | 1985-03-19 | Monsanto Company | N-Phosphonomethylglycine derivatives and use as herbicides |
| US5580841A (en) * | 1985-05-29 | 1996-12-03 | Zeneca Limited | Solid, phytoactive compositions and method for their preparation |
| US5468718A (en) * | 1985-10-21 | 1995-11-21 | Ici Americas Inc. | Liquid, phytoactive compositions and method for their preparation |
| EP0973719A4 (en) | 1997-02-13 | 2000-05-17 | Monsanto Co | METHOD FOR PRODUCING AMINOCARBOXYLIC ACIDS |
| US8470741B2 (en) * | 2003-05-07 | 2013-06-25 | Croda Americas Llc | Homogeneous liquid saccharide and oil systems |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3455675A (en) * | 1968-06-25 | 1969-07-15 | Monsanto Co | Aminophosphonate herbicides |
| US3799758A (en) * | 1971-08-09 | 1974-03-26 | Monsanto Co | N-phosphonomethyl-glycine phytotoxicant compositions |
| US3853530A (en) * | 1971-03-10 | 1974-12-10 | Monsanto Co | Regulating plants with n-phosphonomethylglycine and derivatives thereof |
| US3835000A (en) * | 1972-12-21 | 1974-09-10 | Monsanto Co | Electrolytic process for producing n-phosphonomethyl glycine |
-
1975
- 1975-12-29 US US05/644,784 patent/US3991095A/en not_active Expired - Lifetime
-
1976
- 1976-09-09 NL NL7610010.A patent/NL161162C/xx not_active IP Right Cessation
- 1976-09-13 AU AU17675/76A patent/AU501312B2/en not_active Expired
- 1976-09-13 CA CA261,030A patent/CA1083172A/en not_active Expired
- 1976-09-13 IL IL50476A patent/IL50476A/xx unknown
- 1976-09-13 PH PH18901A patent/PH12171A/en unknown
- 1976-09-13 GB GB37789/76A patent/GB1513347A/en not_active Expired
- 1976-09-13 ZA ZA765469A patent/ZA765469B/xx unknown
- 1976-09-14 DE DE19762641318 patent/DE2641318A1/de not_active Withdrawn
- 1976-09-15 IT IT27229/76A patent/IT1070831B/it active
- 1976-09-17 CH CH1178876A patent/CH626508A5/de not_active IP Right Cessation
- 1976-09-17 YU YU02294/76A patent/YU229476A/xx unknown
- 1976-09-17 JP JP11087876A patent/JPS5283331A/ja active Granted
- 1976-09-20 HU HU76MO966A patent/HU184173B/hu unknown
- 1976-09-22 CS CS766148A patent/CS207369B2/cs unknown
- 1976-09-23 DD DD76203218A patent/DD134530A5/xx unknown
- 1976-09-23 DD DD7600194958A patent/DD128532A5/xx unknown
- 1976-09-27 PL PL1976192692A patent/PL99757B1/pl unknown
- 1976-09-27 SU SU762403951A patent/SU667108A3/ru active
- 1976-09-28 FR FR7629118A patent/FR2337140A1/fr active Granted
- 1976-10-01 RO RO87879A patent/RO80036B/ro unknown
- 1976-10-01 RO RO76114138A patent/RO88787A/ro unknown
- 1976-10-01 RO RO103631A patent/RO83585B/ro unknown
- 1976-10-21 BG BG034498A patent/BG35462A3/xx unknown
- 1976-10-26 BR BR7607156A patent/BR7607156A/pt unknown
- 1976-12-28 BE BE173674A patent/BE849902A/xx not_active IP Right Cessation
-
1979
- 1979-12-30 MY MY234/79A patent/MY7900234A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5283331A (en) | 1977-07-12 |
| IL50476A (en) | 1980-10-26 |
| ZA765469B (en) | 1977-08-31 |
| FR2337140B1 (enExample) | 1979-08-17 |
| DD128532A5 (de) | 1977-11-23 |
| NL7610010A (nl) | 1977-07-01 |
| NL161162B (nl) | 1979-08-15 |
| RO83585B (ro) | 1984-08-30 |
| SU667108A3 (ru) | 1979-06-05 |
| MY7900234A (en) | 1979-12-31 |
| AU501312B2 (en) | 1979-06-14 |
| RO83585A (ro) | 1984-06-21 |
| YU229476A (en) | 1983-01-21 |
| IL50476A0 (en) | 1976-11-30 |
| AU1767576A (en) | 1978-03-23 |
| FR2337140A1 (fr) | 1977-07-29 |
| GB1513347A (en) | 1978-06-07 |
| PH12171A (en) | 1978-11-21 |
| IT1070831B (it) | 1985-04-02 |
| CS207369B2 (en) | 1981-07-31 |
| RO80036A (ro) | 1983-02-15 |
| DD134530A5 (de) | 1979-03-07 |
| US3991095A (en) | 1976-11-09 |
| CA1083172A (en) | 1980-08-05 |
| RO80036B (ro) | 1983-02-28 |
| RO88787A (ro) | 1986-03-15 |
| HU184173B (en) | 1984-07-30 |
| CH626508A5 (enExample) | 1981-11-30 |
| DE2641318A1 (de) | 1977-07-07 |
| BR7607156A (pt) | 1977-09-13 |
| BG35462A3 (en) | 1984-04-15 |
| NL161162C (nl) | 1980-01-15 |
| BE849902A (fr) | 1977-06-28 |
| JPS5623436B2 (enExample) | 1981-05-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL99757B1 (pl) | Srodek chwastobojczy | |
| PL106856B1 (pl) | Srodek chwastobojczy | |
| FI62842B (fi) | N-karboximetyl-n-fosfonometyl-amidsyror anvaendbara som ograesmedel | |
| US4035177A (en) | Herbicidal N-thiolcarbonyl derivatives of N-phosphonomethylglycine | |
| EP0252055A1 (en) | Substituted pyridine herbicides | |
| WO1985004661A1 (en) | Novel phosphinates | |
| DK164498B (da) | 3,5-dicarboxylsyreestere af 2,6-bis-(fluoralkyl)-tetrahydropyraner og -piperidiner med herbicid aktivitet | |
| NZ203138A (en) | 3,5-bis(trifluoromethyl)phenoxy carboxylic acid derivatives and use in reducing herbicide injury to crop plants | |
| US4105432A (en) | Cyclized derivatives of N-(2-hydroxyalkyl)-N-phosphonomethylglycine compounds | |
| CA1210769A (en) | Herbicidal 2-haloacetamides | |
| JPS59130895A (ja) | N−ホスホノメチルグリシン錫およびその除草剤としての利用 | |
| EP0088743B1 (en) | Herbicidal pyrrole derivatives; composition and method | |
| US3228762A (en) | Method of killing weeds | |
| US4251256A (en) | Herbicidal N-substituted ethylene derivatives of N-phosphonomethylglycine | |
| CS223997B2 (en) | Herbicide means | |
| US4398941A (en) | Herbicidal composition and method | |
| US4251257A (en) | Herbicidal methods employing derivatives of N-phosphonomethylglycine | |
| US4242123A (en) | Herbicidal composition and method of use | |
| KR810000411B1 (ko) | N-포스포노메틸글리신 유도체의 제조방법 | |
| US4444580A (en) | N-Substituted N-(phosphonomethyl)aminoethanal derivatives as herbicides | |
| PL125380B1 (en) | Herbicide | |
| PL113273B1 (en) | Herbicide | |
| NO121276B (enExample) | ||
| PL89861B1 (enExample) | ||
| KR800001179B1 (ko) | N-포스포노메틸 글리신의 n-티올카보닐 유도체의 제조방법 |