CH619926A5 - - Google Patents
Download PDFInfo
- Publication number
- CH619926A5 CH619926A5 CH91876A CH91876A CH619926A5 CH 619926 A5 CH619926 A5 CH 619926A5 CH 91876 A CH91876 A CH 91876A CH 91876 A CH91876 A CH 91876A CH 619926 A5 CH619926 A5 CH 619926A5
- Authority
- CH
- Switzerland
- Prior art keywords
- reaction
- parts
- weight
- hydrocyanic acid
- hours
- Prior art date
Links
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 41
- -1 aliphatic radical Chemical class 0.000 description 37
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 29
- 238000006243 chemical reaction Methods 0.000 description 17
- 238000007127 saponification reaction Methods 0.000 description 14
- 239000000243 solution Substances 0.000 description 14
- 239000007795 chemical reaction product Substances 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 150000001412 amines Chemical class 0.000 description 9
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 8
- 238000000034 method Methods 0.000 description 7
- 150000002825 nitriles Chemical class 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- FSYKKLYZXJSNPZ-UHFFFAOYSA-N N-methylaminoacetic acid Natural products C[NH2+]CC([O-])=O FSYKKLYZXJSNPZ-UHFFFAOYSA-N 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 4
- 108010077895 Sarcosine Proteins 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 150000001447 alkali salts Chemical class 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229940043230 sarcosine Drugs 0.000 description 3
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 description 2
- 125000004337 3-ethylpentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical class [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- LIWAQLJGPBVORC-UHFFFAOYSA-N ethylmethylamine Chemical compound CCNC LIWAQLJGPBVORC-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000008098 formaldehyde solution Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- HFPZCAJZSCWRBC-UHFFFAOYSA-N p-cymene Chemical compound CC(C)C1=CC=C(C)C=C1 HFPZCAJZSCWRBC-UHFFFAOYSA-N 0.000 description 2
- XOKSLPVRUOBDEW-UHFFFAOYSA-N pinane Chemical compound CC1CCC2C(C)(C)C1C2 XOKSLPVRUOBDEW-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- MIWGNHMXTAYEQN-UHFFFAOYSA-N 2,2,3,3-tetramethylbutan-1-amine Chemical compound CC(C)(C)C(C)(C)CN MIWGNHMXTAYEQN-UHFFFAOYSA-N 0.000 description 1
- XTDQDBVBDLYELW-UHFFFAOYSA-N 2,2,3-trimethylpentane Chemical compound CCC(C)C(C)(C)C XTDQDBVBDLYELW-UHFFFAOYSA-N 0.000 description 1
- OKVWYBALHQFVFP-UHFFFAOYSA-N 2,3,3-trimethylpentane Chemical compound CCC(C)(C)C(C)C OKVWYBALHQFVFP-UHFFFAOYSA-N 0.000 description 1
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethanol Chemical compound COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- SRBFZHDQGSBBOR-IOVATXLUSA-N D-xylopyranose Chemical group O[C@@H]1COC(O)[C@H](O)[C@H]1O SRBFZHDQGSBBOR-IOVATXLUSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Natural products NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Natural products OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 1
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229940075397 calomel Drugs 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 150000003841 chloride salts Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- ZOMNIUBKTOKEHS-UHFFFAOYSA-L dimercury dichloride Chemical compound Cl[Hg][Hg]Cl ZOMNIUBKTOKEHS-UHFFFAOYSA-L 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- XMYQHJDBLRZMLW-UHFFFAOYSA-N methanolamine Chemical class NCO XMYQHJDBLRZMLW-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- ZCYXXKJEDCHMGH-UHFFFAOYSA-N nonane Chemical compound CCCC[CH]CCCC ZCYXXKJEDCHMGH-UHFFFAOYSA-N 0.000 description 1
- BKIMMITUMNQMOS-UHFFFAOYSA-N normal nonane Natural products CCCCCCCCC BKIMMITUMNQMOS-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229930006728 pinane Natural products 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- WHXRLGMKAWGISQ-UHFFFAOYSA-M potassium;2-(dimethylamino)acetate Chemical compound [K+].CN(C)CC([O-])=O WHXRLGMKAWGISQ-UHFFFAOYSA-M 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- PXXNTAGJWPJAGM-UHFFFAOYSA-N vertaline Natural products C1C2C=3C=C(OC)C(OC)=CC=3OC(C=C3)=CC=C3CCC(=O)OC1CC1N2CCCC1 PXXNTAGJWPJAGM-UHFFFAOYSA-N 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
- 238000004065 wastewater treatment Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Steroid Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2503582A DE2503582C3 (de) | 1975-01-29 | 1975-01-29 | Verfahren zur Herstellung von N-Alkylglycinnitrilen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH619926A5 true CH619926A5 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1980-10-31 |
Family
ID=5937580
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH91876A CH619926A5 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1975-01-29 | 1976-01-26 |
Country Status (7)
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2555769C3 (de) * | 1975-12-11 | 1980-01-03 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von an der Aminogruppe aliphatisch substituierten Glycinnitrilen |
| US4134889A (en) * | 1976-05-08 | 1979-01-16 | Basf Aktiengesellschaft | Manufacture of glycinonitriles |
| US4164511A (en) * | 1976-05-14 | 1979-08-14 | Basf Aktiengesellschaft | Manufacture of N-arylglycinonitriles |
| DE2748964A1 (de) * | 1977-11-02 | 1979-05-03 | Bayer Ag | Verfahren zur gewinnung von n,n -dimethylaminoacetonitril aus n,n-dimethylaminoacetonitril/wasser-gemischen |
| DE2840990A1 (de) * | 1978-09-21 | 1980-04-03 | Bayer Ag | Verfahren zur herstellung von n,n-dimethylaminoacetonitril |
| US4225504A (en) * | 1978-10-25 | 1980-09-30 | W. R. Grace & Co. | Monomeric N-methyleneaminoacetonitrile |
| JPS55122750A (en) * | 1979-03-14 | 1980-09-20 | Showa Denko Kk | Production of aminonitrile |
| DE3029205A1 (de) * | 1980-08-01 | 1982-03-11 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von aminonitrilen |
| DE3712329A1 (de) * | 1987-04-11 | 1988-10-20 | Basf Ag | Verfahren zur herstellung von serin-n,n-diessigsaeure und derivaten, ihre verwendung insbesondere als komplexbildner und diese enthaltende wasch- und reinigungsmittel |
| US5079380A (en) * | 1990-05-23 | 1992-01-07 | W. R. Grace & Co.-Conn. | Adiabatic process for the preparation of glycinonitrile |
| US5208363A (en) * | 1990-10-15 | 1993-05-04 | The Dow Chemical Company | Preparation of aminonitriles |
| DE4431212A1 (de) * | 1994-09-02 | 1996-03-07 | Basf Ag | Verfahren zur Herstellung von quaternierten Glycinnitrilen |
| US5814242A (en) * | 1995-06-07 | 1998-09-29 | The Clorox Company | Mixed peroxygen activator compositions |
| US6183665B1 (en) | 1995-06-07 | 2001-02-06 | The Clorox Company | Granular N-alkyl ammonium acetonitrile compositions |
| US6010994A (en) * | 1995-06-07 | 2000-01-04 | The Clorox Company | Liquid compositions containing N-alkyl ammonium acetonitrile salts |
| US6764613B2 (en) | 1995-06-07 | 2004-07-20 | Mid-America Commercialization Corporation | N-alkyl ammonium acetonitrile salts, methods therefor and compositions therewith |
| US6235218B1 (en) | 1995-06-07 | 2001-05-22 | The Clorox Company | Process for preparing N-alkyl ammonium acetonitrile compounds |
| US5888419A (en) * | 1995-06-07 | 1999-03-30 | The Clorox Company | Granular N-alkyl ammonium acetontrile compositions |
| US5792218A (en) * | 1995-06-07 | 1998-08-11 | The Clorox Company | N-alkyl ammonium acetonitrile activators in dense gas cleaning and method |
| US5739327A (en) * | 1995-06-07 | 1998-04-14 | The Clorox Company | N-alkyl ammonium acetonitrile bleach activators |
| DE10010593A1 (de) * | 2000-03-03 | 2001-09-06 | Clariant Gmbh | Farbstabile Lösung von Dimethylaminoacetonitril in Wasser und Verfahren zu ihrer Herstellung |
| DE10331481A1 (de) * | 2003-07-11 | 2005-02-24 | Degussa Ag | Verfahren zur Reduzierung der Formaldehyd- und Cyanid-Gehalte in Lösungen von Sarkosinsalzen |
| RU2598850C2 (ru) * | 2011-04-04 | 2016-09-27 | Басф Се | Способ получения водных растворов трехосновных солей щелочного металла метилглицин-n,n-диуксусной кислоты |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2860164A (en) * | 1957-08-07 | 1958-11-11 | Geigy Chem Corp | Carboxymethylation of primary and secondary amines |
| US3409666A (en) * | 1966-01-24 | 1968-11-05 | Standard Oil Co | Hydrolysis of aminonitriles |
| US3499920A (en) * | 1967-12-21 | 1970-03-10 | Grace W R & Co | Process for preparing n-methylglycinonitrile |
-
1975
- 1975-01-29 DE DE2503582A patent/DE2503582C3/de not_active Expired
-
1976
- 1976-01-16 US US05/649,582 patent/US4022815A/en not_active Expired - Lifetime
- 1976-01-19 CA CA243,945A patent/CA1056402A/en not_active Expired
- 1976-01-26 CH CH91876A patent/CH619926A5/de not_active IP Right Cessation
- 1976-01-28 BE BE163845A patent/BE837970A/xx not_active IP Right Cessation
- 1976-01-28 GB GB3259/76A patent/GB1526481A/en not_active Expired
- 1976-01-29 FR FR7602367A patent/FR2299315A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| FR2299315A1 (fr) | 1976-08-27 |
| FR2299315B1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1980-01-25 |
| DE2503582B2 (de) | 1979-02-15 |
| US4022815A (en) | 1977-05-10 |
| CA1056402A (en) | 1979-06-12 |
| BE837970A (fr) | 1976-07-28 |
| DE2503582A1 (de) | 1976-08-05 |
| DE2503582C3 (de) | 1979-10-04 |
| GB1526481A (en) | 1978-09-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH619926A5 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| CH628325A5 (de) | Verfahren zur herstellung von n-alkylglycinnitrilen. | |
| DE2502893C2 (de) | Cycloaliphatische Amine | |
| EP0045386B1 (de) | Verfahren zur Herstellung von Aminonitrilen | |
| DE2620445C3 (de) | Verfahren zur Herstellung von Glycinnitrilen | |
| EP0005276B1 (de) | Verfahren zur Herstellung von Monoarylthioharnstoffen | |
| DE3535889C1 (de) | Verfahren zur Herstellung von Z-2-Methyl-2-butensaeure | |
| EP0036161B1 (de) | Verfahren zur Herstellung von Alkalisalzen des Phenylglycins | |
| DE2655794C2 (de) | Verfahren zur Herstellung von Äthylencyanhydrin | |
| DE866647C (de) | Verfahren zur Herstellung von sekundaeren 1, 3-Alkendiaminen | |
| DE2620743C3 (de) | Verfahren zur Herstellung von a - substituierten Piperidinoacetonitrilen | |
| DE1059458B (de) | Verfahren zur Herstellung von N-Trichlormethylthioimiden | |
| DE1059468B (de) | Verfahren zur Herstellung von wasserfreien primaeren Aminen | |
| DE972652C (de) | Verfahren zur Herstellung von 1, 4-Dicyan-2-buten (Dihydromuconsaeuredinitril) | |
| DE874913C (de) | Verfahren zur Herstellung von Aminothiolactonen | |
| DE2621450C3 (de) | Verfahren zur Herstellung von N-Arylaminocarbonsäurenitrilen | |
| AT202125B (de) | Verfahren zur Herstellung von neuen α-Mercapto-Säureamiden | |
| DE157840C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| DE171789C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| AT235833B (de) | Verfahren zur Herstellung von neuen 5-Phenyl-2-amino-2-oxazolin-4-onen | |
| DE2045905A1 (de) | Substituierte Thioätherverbindungen | |
| DE2208925A1 (de) | Verfahren zur herstellung von aminoaethansulfonsaeuren | |
| DE1117594B (de) | Verfahren zur Herstellung sekundaerer Amine | |
| DE2621728A1 (de) | Verfahren zur herstellung von n-arylglycinnitrilen | |
| DE1095841B (de) | Verfahren zur Herstellung alkylsubstituierter Hydrazine |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |