CH619444A5 - - Google Patents
Download PDFInfo
- Publication number
- CH619444A5 CH619444A5 CH1628775A CH1628775A CH619444A5 CH 619444 A5 CH619444 A5 CH 619444A5 CH 1628775 A CH1628775 A CH 1628775A CH 1628775 A CH1628775 A CH 1628775A CH 619444 A5 CH619444 A5 CH 619444A5
- Authority
- CH
- Switzerland
- Prior art keywords
- pharmaceutically acceptable
- prepared
- acid addition
- acceptable acid
- benzene
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 41
- 150000003839 salts Chemical class 0.000 claims description 20
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 13
- 239000003589 local anesthetic agent Substances 0.000 claims description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 10
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 8
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 6
- 150000002170 ethers Chemical class 0.000 claims description 5
- 238000009835 boiling Methods 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 4
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical group C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000003386 piperidinyl group Chemical group 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims 3
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims 1
- 239000003960 organic solvent Substances 0.000 claims 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical group [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 description 15
- NNJVILVZKWQKPM-UHFFFAOYSA-N Lidocaine Chemical compound CCN(CC)CC(=O)NC1=C(C)C=CC=C1C NNJVILVZKWQKPM-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 206010002091 Anaesthesia Diseases 0.000 description 8
- 230000037005 anaesthesia Effects 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- 238000004458 analytical method Methods 0.000 description 7
- OECNHRSNFLARHZ-UHFFFAOYSA-N n-[2-(2-butoxyphenoxy)ethyl]-n-propan-2-ylpropan-2-amine Chemical compound CCCCOC1=CC=CC=C1OCCN(C(C)C)C(C)C OECNHRSNFLARHZ-UHFFFAOYSA-N 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 229960004194 lidocaine Drugs 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- VTUSIVBDOCDNHS-UHFFFAOYSA-N Etidocaine Chemical compound CCCN(CC)C(CC)C(=O)NC1=C(C)C=CC=C1C VTUSIVBDOCDNHS-UHFFFAOYSA-N 0.000 description 5
- 230000003444 anaesthetic effect Effects 0.000 description 5
- 229960003976 etidocaine Drugs 0.000 description 5
- 230000008595 infiltration Effects 0.000 description 5
- 238000001764 infiltration Methods 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- BEZSPGRAGVCHQN-UHFFFAOYSA-N n,n-diethyl-2-[2-(2-methylpropoxy)phenoxy]ethanamine Chemical compound CCN(CC)CCOC1=CC=CC=C1OCC(C)C BEZSPGRAGVCHQN-UHFFFAOYSA-N 0.000 description 4
- NQTUEEJBIIYOMY-UHFFFAOYSA-N n,n-diethyl-3-[2-(2-methylpropoxy)phenoxy]propan-1-amine Chemical compound CCN(CC)CCCOC1=CC=CC=C1OCC(C)C NQTUEEJBIIYOMY-UHFFFAOYSA-N 0.000 description 4
- FFVASTJVNYZGQR-UHFFFAOYSA-N 1-[2-(2-butoxyphenoxy)ethyl]piperidine Chemical compound CCCCOC1=CC=CC=C1OCCN1CCCCC1 FFVASTJVNYZGQR-UHFFFAOYSA-N 0.000 description 3
- PBVUSKGIFXCUMR-UHFFFAOYSA-N 2-(2-methylpropoxy)phenol Chemical compound CC(C)COC1=CC=CC=C1O PBVUSKGIFXCUMR-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 230000007059 acute toxicity Effects 0.000 description 3
- 231100000403 acute toxicity Toxicity 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- ZPHQBFRCXUIIAZ-UHFFFAOYSA-N benzene;hydrochloride Chemical compound Cl.C1=CC=CC=C1 ZPHQBFRCXUIIAZ-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 235000011187 glycerol Nutrition 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- IUSXYVRFJVAVOB-UHFFFAOYSA-N n-(2-chloroethyl)-n-propan-2-ylpropan-2-amine;hydron;chloride Chemical compound Cl.CC(C)N(C(C)C)CCCl IUSXYVRFJVAVOB-UHFFFAOYSA-N 0.000 description 3
- VJMXBYMZCAXDNB-UHFFFAOYSA-N n-[2-[2-(2-methylpropoxy)phenoxy]ethyl]-n-propan-2-ylpropan-2-amine Chemical compound CC(C)COC1=CC=CC=C1OCCN(C(C)C)C(C)C VJMXBYMZCAXDNB-UHFFFAOYSA-N 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 239000012085 test solution Substances 0.000 description 3
- UCTWMZQNUQWSLP-VIFPVBQESA-N (R)-adrenaline Chemical compound CNC[C@H](O)C1=CC=C(O)C(O)=C1 UCTWMZQNUQWSLP-VIFPVBQESA-N 0.000 description 2
- 229930182837 (R)-adrenaline Natural products 0.000 description 2
- KKOWXJFINYUXEE-UHFFFAOYSA-N 2-butoxyphenol Chemical compound CCCCOC1=CC=CC=C1O KKOWXJFINYUXEE-UHFFFAOYSA-N 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 2
- 241000700198 Cavia Species 0.000 description 2
- 241000700199 Cavia porcellus Species 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- 229960005139 epinephrine Drugs 0.000 description 2
- 229960005015 local anesthetics Drugs 0.000 description 2
- OTEAKJIIJRDXBV-UHFFFAOYSA-N n,n-diethyl-2-(2-methoxyphenoxy)ethanamine Chemical compound CCN(CC)CCOC1=CC=CC=C1OC OTEAKJIIJRDXBV-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 210000003497 sciatic nerve Anatomy 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000008215 water for injection Substances 0.000 description 2
- VFLQQZCRHPIGJU-UHFFFAOYSA-N 1-(2-chloroethyl)piperidine;hydron;chloride Chemical compound Cl.ClCCN1CCCCC1 VFLQQZCRHPIGJU-UHFFFAOYSA-N 0.000 description 1
- RAGSWDIQBBZLLL-UHFFFAOYSA-N 2-chloroethyl(diethyl)azanium;chloride Chemical compound Cl.CCN(CC)CCCl RAGSWDIQBBZLLL-UHFFFAOYSA-N 0.000 description 1
- JFSVGKRARHIICJ-UHFFFAOYSA-N 2-propoxyphenol Chemical compound CCCOC1=CC=CC=C1O JFSVGKRARHIICJ-UHFFFAOYSA-N 0.000 description 1
- YSRGCDWKSZVEQF-UHFFFAOYSA-N 3-(2-butoxyphenoxy)-n,n-diethylpropan-1-amine Chemical compound CCCCOC1=CC=CC=C1OCCCN(CC)CC YSRGCDWKSZVEQF-UHFFFAOYSA-N 0.000 description 1
- WVUULNDRFBHTFG-UHFFFAOYSA-N 3-chloro-n,n-diethylpropan-1-amine Chemical compound CCN(CC)CCCCl WVUULNDRFBHTFG-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- -1 N-ethyl-n-propylamino Chemical group 0.000 description 1
- 208000003251 Pruritus Diseases 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 230000036592 analgesia Effects 0.000 description 1
- 229940035674 anesthetics Drugs 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003874 central nervous system depressant Substances 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- QFXZANXYUCUTQH-UHFFFAOYSA-N ethynol Chemical compound OC#C QFXZANXYUCUTQH-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 239000003193 general anesthetic agent Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000002690 local anesthesia Methods 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 208000022084 motor paralysis Diseases 0.000 description 1
- 210000004400 mucous membrane Anatomy 0.000 description 1
- XWWNMQLAMVYANA-UHFFFAOYSA-N n-[2-[2-(2-methylpropoxy)phenoxy]ethyl]-n-propan-2-ylpropan-2-amine;hydrochloride Chemical compound Cl.CC(C)COC1=CC=CC=C1OCCN(C(C)C)C(C)C XWWNMQLAMVYANA-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000003182 parenteral nutrition solution Substances 0.000 description 1
- 239000011505 plaster Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 229940001584 sodium metabisulfite Drugs 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- 230000002889 sympathetic effect Effects 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000005526 vasoconstrictor agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE7416143A SE399419B (sv) | 1974-12-20 | 1974-12-20 | Analogiforfarande for framstellning av nya lokalanestetiska foreningar |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH619444A5 true CH619444A5 (https=) | 1980-09-30 |
Family
ID=20323087
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1628775A CH619444A5 (https=) | 1974-12-20 | 1975-12-16 |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4073917A (https=) |
| JP (1) | JPS5186430A (https=) |
| AT (1) | AT339282B (https=) |
| AU (1) | AU501802B2 (https=) |
| BE (1) | BE836844A (https=) |
| CA (1) | CA1052379A (https=) |
| CH (1) | CH619444A5 (https=) |
| CS (1) | CS191290B2 (https=) |
| DD (1) | DD123310A5 (https=) |
| DE (1) | DE2554978A1 (https=) |
| DK (1) | DK136859B (https=) |
| FI (1) | FI63930C (https=) |
| FR (1) | FR2358141A1 (https=) |
| GB (1) | GB1516539A (https=) |
| HU (1) | HU174252B (https=) |
| IE (1) | IE42763B1 (https=) |
| LU (1) | LU74070A1 (https=) |
| NL (1) | NL7514793A (https=) |
| NO (1) | NO141554C (https=) |
| NZ (1) | NZ179553A (https=) |
| SE (1) | SE399419B (https=) |
| SU (1) | SU604481A3 (https=) |
| ZA (1) | ZA757571B (https=) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK368687A (da) * | 1986-11-21 | 1988-05-22 | Cheminova As | Aminoalkylerede hydroxyforbindelser og deres anvendelse som fungicider |
| GB8823405D0 (en) * | 1988-10-05 | 1988-11-09 | Erba Carlo Spa | Aryloxy-arythio-heteraryloxy-heteroarylthio-alkenylene derivatives of amines |
| US7799337B2 (en) | 1997-07-21 | 2010-09-21 | Levin Bruce H | Method for directed intranasal administration of a composition |
| JP2000302737A (ja) * | 1999-04-16 | 2000-10-31 | Shiseido Co Ltd | 二置換ベンゼン誘導体 |
| US8473062B2 (en) * | 2008-05-01 | 2013-06-25 | Autonomic Technologies, Inc. | Method and device for the treatment of headache |
| US8412336B2 (en) * | 2008-12-29 | 2013-04-02 | Autonomic Technologies, Inc. | Integrated delivery and visualization tool for a neuromodulation system |
| US9320908B2 (en) * | 2009-01-15 | 2016-04-26 | Autonomic Technologies, Inc. | Approval per use implanted neurostimulator |
| US8494641B2 (en) * | 2009-04-22 | 2013-07-23 | Autonomic Technologies, Inc. | Implantable neurostimulator with integral hermetic electronic enclosure, circuit substrate, monolithic feed-through, lead assembly and anchoring mechanism |
| US20100185249A1 (en) * | 2009-01-22 | 2010-07-22 | Wingeier Brett M | Method and Devices for Adrenal Stimulation |
| US8309064B2 (en) * | 2009-11-09 | 2012-11-13 | Conopco, Inc. | Skin care compositions comprising phenoxyalkyl amines |
| US8425885B2 (en) | 2009-11-09 | 2013-04-23 | Conopco, Inc. | Substituted 3-(phenoxymethyl) benzyl amines and personal care compositions |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2967201A (en) * | 1958-06-02 | 1961-01-03 | Lilly Co Eli | Alkylaminoalkyl ethers of phenols |
| BE583205A (https=) * | 1958-10-02 | |||
| AT213872B (de) * | 1959-08-05 | 1961-03-10 | Ciba Geigy | Verfahren zur Herstellung neuer basischer Phenoläther und ihrer Salze |
| US3904622A (en) * | 1968-02-16 | 1975-09-09 | Ile De France | Dialkylaminoalkyl ethers of 2-alkoxy-3,5-dihalobenzene |
| FR1601591A (en) * | 1968-12-24 | 1970-08-31 | Hypocholesterolaemic phenoxyalkylamines |
-
1974
- 1974-12-20 SE SE7416143A patent/SE399419B/xx unknown
-
1975
- 1975-12-02 ZA ZA757571A patent/ZA757571B/xx unknown
- 1975-12-06 DE DE19752554978 patent/DE2554978A1/de not_active Ceased
- 1975-12-10 FI FI753481A patent/FI63930C/fi not_active IP Right Cessation
- 1975-12-12 NO NO754230A patent/NO141554C/no unknown
- 1975-12-15 AU AU87538/75A patent/AU501802B2/en not_active Expired
- 1975-12-15 NZ NZ179553A patent/NZ179553A/xx unknown
- 1975-12-15 AT AT948175A patent/AT339282B/de active
- 1975-12-16 SU SU752198003A patent/SU604481A3/ru active
- 1975-12-16 CH CH1628775A patent/CH619444A5/de not_active IP Right Cessation
- 1975-12-18 CS CS758674A patent/CS191290B2/cs unknown
- 1975-12-18 US US05/641,984 patent/US4073917A/en not_active Expired - Lifetime
- 1975-12-18 NL NL7514793A patent/NL7514793A/xx not_active Application Discontinuation
- 1975-12-18 CA CA242,046A patent/CA1052379A/en not_active Expired
- 1975-12-18 DD DD190289A patent/DD123310A5/xx unknown
- 1975-12-19 BE BE162911A patent/BE836844A/xx not_active IP Right Cessation
- 1975-12-19 LU LU74070A patent/LU74070A1/xx unknown
- 1975-12-19 HU HU75AA837A patent/HU174252B/hu unknown
- 1975-12-19 DK DK582675AA patent/DK136859B/da not_active IP Right Cessation
- 1975-12-19 JP JP50150663A patent/JPS5186430A/ja active Pending
- 1975-12-19 GB GB52232/75A patent/GB1516539A/en not_active Expired
- 1975-12-19 IE IE2765/75A patent/IE42763B1/en unknown
- 1975-12-19 FR FR7539191A patent/FR2358141A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| NL7514793A (nl) | 1976-06-22 |
| DK582675A (https=) | 1976-06-21 |
| BE836844A (fr) | 1976-06-21 |
| SE7416143L (sv) | 1976-06-21 |
| SU604481A3 (ru) | 1978-04-25 |
| DK136859B (da) | 1977-12-05 |
| AT339282B (de) | 1977-10-10 |
| IE42763B1 (en) | 1980-10-08 |
| CS191290B2 (en) | 1979-06-29 |
| GB1516539A (en) | 1978-07-05 |
| IE42763L (en) | 1976-06-20 |
| NO754230L (https=) | 1976-06-22 |
| NO141554B (no) | 1979-12-27 |
| AU8753875A (en) | 1977-06-23 |
| FI63930C (fi) | 1983-09-12 |
| FI753481A7 (https=) | 1976-06-21 |
| DE2554978A1 (de) | 1976-07-08 |
| DD123310A5 (https=) | 1976-12-12 |
| FI63930B (fi) | 1983-05-31 |
| SE399419B (sv) | 1978-02-13 |
| NO141554C (no) | 1980-04-08 |
| US4073917A (en) | 1978-02-14 |
| FR2358141A1 (fr) | 1978-02-10 |
| AU501802B2 (en) | 1979-06-28 |
| DK136859C (https=) | 1978-05-16 |
| FR2358141B1 (https=) | 1979-01-19 |
| ZA757571B (en) | 1976-11-24 |
| JPS5186430A (https=) | 1976-07-29 |
| CA1052379A (en) | 1979-04-10 |
| HU174252B (hu) | 1979-12-28 |
| NZ179553A (en) | 1978-06-02 |
| ATA948175A (de) | 1977-02-15 |
| LU74070A1 (https=) | 1976-11-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3047142C2 (de) | Basische 1,7,7-Trimethylbicyclo[2,2,1]heptyläther, Verfahren zur Herstellung derselben und diese enthaltende Arzneimittel | |
| DD201139A5 (de) | Verfahren zur herstellung von (-)-n-methyl-3-(2-methylphenoxy)-3-phenylpropylamin und seinen pharmazeutisch unbedenklichen salzen | |
| LU83945A1 (de) | Ammoniumsalz einer substituierten carbonsaeure,verfahren zu seiner herstellung,seine verwendung und pharmazeutische praeparate | |
| CH619444A5 (https=) | ||
| DD144763A5 (de) | Verfahren zur herstellung von phenethanolaminen | |
| EP0152868A2 (de) | Isoxazol-Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2461069C3 (de) | 2-(4-Benzylphenoxy)-alkancarbonsäureester, Verfahren zu ihrer Herstellung und diese Ester enthaltende Arzneimittel | |
| DE2719246A1 (de) | Piperazinderivate und diese enthaltende arzneimittel | |
| DE2348973B2 (de) | 1 -(m-Trifluormethylphenyl)-4-propylpiperazin-derivate, Verfahren zur ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE3013502C2 (de) | [2''-(Trifluormethyl)-phenthiazin-10''-yl-(n-prop-3'''ylpiperazin-4''''-yläth-2'''''-yl)]-ester, Verfahren zur Herstellung derselben und diese enthaltende Arzneimittel | |
| DE2332733A1 (de) | Psychotherapeutisch wirksame 2-aminothiazolabkoemmlinge und diese enthaltende arzneimittel | |
| AT256816B (de) | Verfahren zur Herstellung von neuen substituierten 1-Phenyl-2-aminoalkanolen und deren Säureadditionssalzen | |
| DE3101093A1 (de) | 1-phenyl-4-morpholino-but-1-en-3-ol-derivate, verfahren zu ihrer herstellung und sie enthaltende arzneimittel | |
| DE2410939A1 (de) | Lokalanaesthetisches mittel | |
| DE2939914A1 (de) | N-(1-methyl-2-pyrrolidinylmethyl)-2,3- dimethoxy-5-methylsulfamoylbenzamid, verfahren zu seiner herstellung und seine therapeutische verwendung | |
| DE2346937A1 (de) | N'-(aminoacylaminophenyl)-acetamidine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| AT329551B (de) | Verfahren zur herstellung neuer derivate des n-phenyl-n-alkanoyl-2-aminoindans | |
| DE1802631A1 (de) | Neue chemotherapeutisch wirksame tricyclische Aminoketone und Verfahren zu deren Herstellung | |
| AT338781B (de) | Verfahren zur herstellung neuer 1,3-benzodioxol-derivate und ihrer salze | |
| AT326641B (de) | Verfahren zur herstellung von neuen n,n-dialkylaminoessigsaure-2,6-xylididen | |
| AT330770B (de) | Verfahren zur herstellung von neuen 2- (aminophenylimino) -3-aza-1-thiacycloalkanderivaten und ihren salzen | |
| DE1006850B (de) | Verfahren zur Herstellung analgetisch wirksamer AEther des Salicylsaeureamides | |
| DE1695328C3 (de) | Cinnamylpiperazinverbindungen, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneipräparate | |
| AT238183B (de) | Verfahren zur Herstellung neuer Pyrrolidinverbindungen | |
| DE1445638C (de) | 9 geschweifte Klammer auf gamma eckige Klammer auf N* (beta hydroxyaryl) piperazino eckige Klammer zu propyl geschweifte Klam mer zu 9,10 dihydro 9,10 athano (1,2) anthra zen und seme Salze, Verfahren zu deren Her stellung und pharmazeutisches Mittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |