CH570989A5 - - Google Patents
Info
- Publication number
- CH570989A5 CH570989A5 CH1410071A CH1410071A CH570989A5 CH 570989 A5 CH570989 A5 CH 570989A5 CH 1410071 A CH1410071 A CH 1410071A CH 1410071 A CH1410071 A CH 1410071A CH 570989 A5 CH570989 A5 CH 570989A5
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- alkyl radical
- mixture
- crystals
- radical
- Prior art date
Links
- -1 alkyl radical Chemical class 0.000 claims description 28
- 238000000034 method Methods 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 4
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 150000003254 radicals Chemical class 0.000 claims description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 24
- 239000013078 crystal Substances 0.000 description 15
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 14
- 239000000203 mixture Substances 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000002904 solvent Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 229960002449 glycine Drugs 0.000 description 2
- 229910010272 inorganic material Inorganic materials 0.000 description 2
- 239000011147 inorganic material Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Chemical compound COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 2
- NDQXKKFRNOPRDW-UHFFFAOYSA-N 1,1,1-triethoxyethane Chemical compound CCOC(C)(OCC)OCC NDQXKKFRNOPRDW-UHFFFAOYSA-N 0.000 description 1
- IYPXPGSELZFFMI-UHFFFAOYSA-N 1-phenyltetrazole Chemical compound C1=NN=NN1C1=CC=CC=C1 IYPXPGSELZFFMI-UHFFFAOYSA-N 0.000 description 1
- QMGRTPHVXPNNBK-UHFFFAOYSA-N 2-(5-methyltetrazol-1-yl)acetic acid Chemical compound CC1=NN=NN1CC(O)=O QMGRTPHVXPNNBK-UHFFFAOYSA-N 0.000 description 1
- GRWAIJBHBCCLGS-UHFFFAOYSA-N 2-(tetrazol-1-yl)acetic acid Chemical compound OC(=O)CN1C=NN=N1 GRWAIJBHBCCLGS-UHFFFAOYSA-N 0.000 description 1
- IVLXQGJVBGMLRR-UHFFFAOYSA-N 2-aminoacetic acid;hydron;chloride Chemical compound Cl.NCC(O)=O IVLXQGJVBGMLRR-UHFFFAOYSA-N 0.000 description 1
- UQRONKZLYKUEMO-UHFFFAOYSA-N 4-methyl-1-(2,4,6-trimethylphenyl)pent-4-en-2-one Chemical group CC(=C)CC(=O)Cc1c(C)cc(C)cc1C UQRONKZLYKUEMO-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- CBTVGIZVANVGBH-UHFFFAOYSA-N aminomethyl propanol Chemical compound CC(C)(N)CO CBTVGIZVANVGBH-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- MMCPOSDMTGQNKG-UHFFFAOYSA-N anilinium chloride Chemical compound Cl.NC1=CC=CC=C1 MMCPOSDMTGQNKG-UHFFFAOYSA-N 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- UUXFWHMUNNXFHD-UHFFFAOYSA-N barium azide Chemical compound [Ba+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] UUXFWHMUNNXFHD-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- UETLMBWMVIQIGU-UHFFFAOYSA-N calcium azide Chemical compound [Ca+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] UETLMBWMVIQIGU-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000002283 diesel fuel Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229960001269 glycine hydrochloride Drugs 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003893 lactate salts Chemical class 0.000 description 1
- GUWHRJQTTVADPB-UHFFFAOYSA-N lithium azide Chemical compound [Li+].[N-]=[N+]=[N-] GUWHRJQTTVADPB-UHFFFAOYSA-N 0.000 description 1
- TWRAJPCQPHBABR-UHFFFAOYSA-N magnesium;diazide Chemical compound [Mg+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] TWRAJPCQPHBABR-UHFFFAOYSA-N 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- ORTFAQDWJHRMNX-UHFFFAOYSA-M oxidooxomethyl Chemical compound [O-][C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-M 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- TZLVRPLSVNESQC-UHFFFAOYSA-N potassium azide Chemical compound [K+].[N-]=[N+]=[N-] TZLVRPLSVNESQC-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 239000002341 toxic gas Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D257/04—Five-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2167282A DE2167282C2 (de) | 1971-09-21 | 1971-09-21 | Verfahren zur Herstellung der 7-[2-(1H-Tetrazol-1-yl)-acetamido]-3-(2-methyl-1,3,4-thiadiazol-5-yl)-thiomethyl-3-cephem-4-carbonsäure |
| DE2147023A DE2147023C3 (de) | 1971-09-21 | 1971-09-21 | Verfahren zur Herstellung von 1H- Tetrazol-Verbindungen |
| FR7134269A FR2153772A5 (enExample) | 1971-09-21 | 1971-09-23 | |
| CH1410071A CH570989A5 (enExample) | 1971-09-21 | 1971-09-28 | |
| US00187561A US3767667A (en) | 1971-09-21 | 1971-10-07 | Process for preparing 1h-tetrazole compounds |
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2147023A DE2147023C3 (de) | 1971-09-21 | 1971-09-21 | Verfahren zur Herstellung von 1H- Tetrazol-Verbindungen |
| FR7134269A FR2153772A5 (enExample) | 1971-09-21 | 1971-09-23 | |
| CH1410071A CH570989A5 (enExample) | 1971-09-21 | 1971-09-28 | |
| US18756171A | 1971-10-07 | 1971-10-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH570989A5 true CH570989A5 (enExample) | 1975-12-31 |
Family
ID=27429540
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1410071A CH570989A5 (enExample) | 1971-09-21 | 1971-09-28 |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3767667A (enExample) |
| CH (1) | CH570989A5 (enExample) |
| DE (1) | DE2147023C3 (enExample) |
| FR (1) | FR2153772A5 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0012230A1 (de) * | 1978-12-14 | 1980-06-25 | Hüls Troisdorf Aktiengesellschaft | Verfahren zur Herstellung von 1H-Tetrazol-1-Essigsäure und deren Estern |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3962272A (en) * | 1972-08-14 | 1976-06-08 | Eli Lilly And Company | 1h-tetrazole-1-acetate esters and acids and process therefor |
| US4036849A (en) * | 1974-05-15 | 1977-07-19 | American Cyanamid Company | 1-(Para-substituted-phenyl)-1H-tetrazoles |
| US4010179A (en) * | 1974-05-15 | 1977-03-01 | American Cyanamid Company | 1-(Para-substituted-phenyl)-1H-tetrazoles |
| GB1486057A (en) * | 1975-06-09 | 1977-09-14 | Ici Ltd | Hydroxyphenyl tetrazoles and their use in the extraction of metals |
| JPS5536447A (en) * | 1978-09-07 | 1980-03-14 | Otsuka Pharmaceut Co Ltd | Butyramide derivative |
| FI73423C (fi) * | 1980-02-29 | 1987-10-09 | Otsuka Pharma Co Ltd | Foerfarande foer framstaellning av farmakologiskt verksamma tetrazolderivat. |
| US4338452A (en) * | 1980-09-17 | 1982-07-06 | Eli Lilly And Company | 1-and 2-(1-Alkyl-1H-tetrazol-5-yl-methyl)-1H-tetrazol-5-thiols and 1-cyanomethyl tetrazole-5-thiol |
| HUT41398A (en) * | 1984-10-04 | 1987-04-28 | Ici Plc | Insecticidal compositions comprising tetrazolyl derivatives as active substance and process for preparing the active substances |
| US5200419A (en) * | 1990-05-21 | 1993-04-06 | Warner-Lambert Company | Substituted tetrazoles and derivatives thereof acting at muscarinic receptors |
| KR100312639B1 (ko) * | 1994-09-28 | 2001-12-28 | 손 경 식 | 테트라졸-1-아세트산의회수방법 |
| CN100344617C (zh) * | 2005-11-30 | 2007-10-24 | 浙江工业大学 | 一种四氮唑类化合物的化学合成方法 |
| CN103724288B (zh) * | 2013-12-16 | 2015-11-04 | 山东艾孚特科技有限公司 | 原甲酸三乙酯法制备1h-四氮唑乙酸的后处理方法 |
| CN106831628B (zh) * | 2017-03-07 | 2019-04-23 | 山东省化工研究院 | 一种四氮唑乙酸的合成新工艺 |
| KR102090155B1 (ko) * | 2019-11-22 | 2020-03-17 | 국방과학연구소 | 베타인 수용액 내에서 5-치환-1h-테트라졸의 제조방법 |
-
1971
- 1971-09-21 DE DE2147023A patent/DE2147023C3/de not_active Expired
- 1971-09-23 FR FR7134269A patent/FR2153772A5/fr not_active Expired
- 1971-09-28 CH CH1410071A patent/CH570989A5/de not_active IP Right Cessation
- 1971-10-07 US US00187561A patent/US3767667A/en not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0012230A1 (de) * | 1978-12-14 | 1980-06-25 | Hüls Troisdorf Aktiengesellschaft | Verfahren zur Herstellung von 1H-Tetrazol-1-Essigsäure und deren Estern |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2153772A5 (enExample) | 1973-05-04 |
| DE2147023C3 (de) | 1982-04-29 |
| DE2147023A1 (de) | 1973-03-29 |
| US3767667A (en) | 1973-10-23 |
| DE2147023B2 (de) | 1981-07-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2760156C2 (enExample) | ||
| CH570989A5 (enExample) | ||
| DE1906527B2 (de) | Thioninderivate, Verfahren zu deren Herstellung und pharmazeutische Präparate, welche diese enthalten | |
| AT391866B (de) | Verfahren zur herstellung neuer s-triazolo (1,5-a) pyrimidine | |
| DE2356901A1 (de) | Verfahren zur herstellung von 3cyanochromonen | |
| DE2124907A1 (de) | 3 Amino 1,2,4 oxadiazole, Verfahren zu ihrer Herstellung und Arzneipraparate | |
| DE69913133T2 (de) | Verfahren zur herstellung von aceclofenac | |
| DE2728870C2 (de) | Verfahren zur Herstellung von D-Penicillamin und dessen Salzen | |
| AT385993B (de) | Verfahren zur herstellung von neuen cephemverbindungen | |
| AT336572B (de) | Verfahren zur herstellung von neuen alkylsulfonylaminoglycinen sowie deren salzen | |
| AT341091B (de) | Verfahren zur herstellung von cephalosporinen | |
| AT358174B (de) | Verfahren zur herstellung von neuen 2-nied. alkyl-7-subst.-2- oder -3-cephem-4-carbonsaeure- verbindungen | |
| DE2747121A1 (de) | 6-(m-aminophenyl-2,3,5,6-tetrahydroimidazo eckige klammer auf 2,1-b eckige klammer zu thiazolderivate, verfahren zu ihrer herstellung und ihre verwendung | |
| AT367394B (de) | Verfahren zur herstellung neuer indanderivate | |
| DE2253554A1 (de) | 2-amino-2-oxazoline und verfahren zu ihrer herstellung | |
| AT211296B (de) | Verfahren zur Herstellung von neuen Sulfamylanthranilsäuren | |
| AT360007B (de) | Verfahren zur herstellung von 2-(phenylamino)- imidazolin-(2)derivaten und deren salzen | |
| AT372940B (de) | Verfahren zur herstellung von (d)-(-)-phydroxyphenylglycylchlorid-hydrochlorid | |
| AT378190B (de) | Verfahren zur herstellung von neuen oximen | |
| DE2055796A1 (de) | Verfahren zur Herstellung von 7 Aminocephalosporansäure Derivaten | |
| DE2924900A1 (de) | Tetrazolylamide von phenoxycarbonsaeuren, verfahren zu deren herstellung und diese enthaltende neue antilipaemisch und antiatherosklerotisch wirkende arzneimittel | |
| AT216671B (de) | Verfahren zur Herstellung von Verbindungen verschiedener Penicilline mit Sulfonamiden | |
| DE2833174A1 (de) | P-substituierte n,n'-bis-(3-oxazolidinyl-2-on)-phosphoramide und verfahren zu ihrer herstellung | |
| DE1940081A1 (de) | delta?-Cephem-4-carbonsaeureester | |
| DE2137649B2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |