CA1341164C - 1-hydroxyethyl-azole derivatives, a process for their preparation and their use as plant growth regulators and fungicides - Google Patents
1-hydroxyethyl-azole derivatives, a process for their preparation and their use as plant growth regulators and fungicides Download PDFInfo
- Publication number
- CA1341164C CA1341164C CA000617114A CA617114A CA1341164C CA 1341164 C CA1341164 C CA 1341164C CA 000617114 A CA000617114 A CA 000617114A CA 617114 A CA617114 A CA 617114A CA 1341164 C CA1341164 C CA 1341164C
- Authority
- CA
- Canada
- Prior art keywords
- carbon atoms
- radical
- halogen
- plants
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000000034 method Methods 0.000 title claims abstract description 47
- 230000008569 process Effects 0.000 title claims abstract description 29
- GNBNHUUABUEZGZ-UHFFFAOYSA-N 1-(1h-pyrrol-2-yl)ethanol Chemical class CC(O)C1=CC=CN1 GNBNHUUABUEZGZ-UHFFFAOYSA-N 0.000 title claims abstract description 7
- 238000002360 preparation method Methods 0.000 title abstract description 21
- 239000000417 fungicide Substances 0.000 title abstract description 6
- 239000005648 plant growth regulator Substances 0.000 title abstract description 5
- -1 alkyl radical Chemical class 0.000 claims abstract description 69
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 67
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 26
- 239000002253 acid Substances 0.000 claims abstract description 25
- 125000005843 halogen group Chemical group 0.000 claims abstract description 25
- 150000003839 salts Chemical class 0.000 claims abstract description 25
- 229910052751 metal Chemical class 0.000 claims abstract description 19
- 239000002184 metal Chemical class 0.000 claims abstract description 19
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 16
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims abstract description 9
- 150000003254 radicals Chemical class 0.000 claims abstract description 8
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 6
- 125000001188 haloalkyl group Chemical group 0.000 claims abstract description 6
- 230000000737 periodic effect Effects 0.000 claims abstract description 4
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical compound O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 claims abstract description 4
- 150000001875 compounds Chemical class 0.000 claims description 122
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 42
- 239000000203 mixture Substances 0.000 claims description 30
- 230000008635 plant growth Effects 0.000 claims description 23
- 239000003085 diluting agent Substances 0.000 claims description 21
- 230000001105 regulatory effect Effects 0.000 claims description 20
- 241000233866 Fungi Species 0.000 claims description 18
- 239000000460 chlorine Substances 0.000 claims description 13
- 239000002689 soil Substances 0.000 claims description 13
- 230000009471 action Effects 0.000 claims description 12
- 150000002367 halogens Chemical group 0.000 claims description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 9
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 8
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 8
- 239000011737 fluorine Substances 0.000 claims description 8
- 229910052731 fluorine Inorganic materials 0.000 claims description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 7
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 7
- 229910052725 zinc Inorganic materials 0.000 claims description 7
- 239000011701 zinc Substances 0.000 claims description 7
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 claims description 6
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 239000007787 solid Substances 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 5
- 230000000855 fungicidal effect Effects 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 5
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 4
- 229910052802 copper Inorganic materials 0.000 claims description 4
- 239000010949 copper Substances 0.000 claims description 4
- 239000012433 hydrogen halide Substances 0.000 claims description 4
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 4
- 229910052742 iron Inorganic materials 0.000 claims description 4
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 claims description 4
- 239000007788 liquid Substances 0.000 claims description 4
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 4
- 239000001117 sulphuric acid Substances 0.000 claims description 4
- 235000011149 sulphuric acid Nutrition 0.000 claims description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 3
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 claims description 3
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 3
- 150000001450 anions Chemical class 0.000 claims description 3
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 claims description 3
- 239000011777 magnesium Substances 0.000 claims description 3
- 229910052749 magnesium Inorganic materials 0.000 claims description 3
- 229910052759 nickel Inorganic materials 0.000 claims description 3
- 239000004094 surface-active agent Substances 0.000 claims description 3
- 239000011135 tin Substances 0.000 claims description 3
- 229910052718 tin Inorganic materials 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 2
- HFVMEOPYDLEHBR-UHFFFAOYSA-N (2-fluorophenyl)-phenylmethanol Chemical compound C=1C=CC=C(F)C=1C(O)C1=CC=CC=C1 HFVMEOPYDLEHBR-UHFFFAOYSA-N 0.000 claims 2
- QISOBCMNUJQOJU-UHFFFAOYSA-N 4-bromo-1h-pyrazole-5-carboxylic acid Chemical compound OC(=O)C=1NN=CC=1Br QISOBCMNUJQOJU-UHFFFAOYSA-N 0.000 claims 2
- PXRKCOCTEMYUEG-UHFFFAOYSA-N 5-aminoisoindole-1,3-dione Chemical compound NC1=CC=C2C(=O)NC(=O)C2=C1 PXRKCOCTEMYUEG-UHFFFAOYSA-N 0.000 claims 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims 2
- 231100001184 nonphytotoxic Toxicity 0.000 claims 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 claims 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 claims 2
- 229910052799 carbon Inorganic materials 0.000 abstract description 2
- 241000196324 Embryophyta Species 0.000 description 59
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- 239000003630 growth substance Substances 0.000 description 21
- 230000012010 growth Effects 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 13
- 230000017066 negative regulation of growth Effects 0.000 description 13
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- 235000013399 edible fruits Nutrition 0.000 description 11
- 238000003306 harvesting Methods 0.000 description 10
- 239000000126 substance Substances 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 239000003995 emulsifying agent Substances 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 125000001309 chloro group Chemical group Cl* 0.000 description 8
- 150000002924 oxiranes Chemical class 0.000 description 8
- 235000013339 cereals Nutrition 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- 239000008187 granular material Substances 0.000 description 6
- 230000009105 vegetative growth Effects 0.000 description 6
- 240000005979 Hordeum vulgare Species 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000000969 carrier Substances 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- YMWUJEATGCHHMB-UHFFFAOYSA-N dichloromethane Natural products ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 5
- 208000015181 infectious disease Diseases 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 241000221785 Erysiphales Species 0.000 description 4
- 244000068988 Glycine max Species 0.000 description 4
- 235000007340 Hordeum vulgare Nutrition 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 230000008901 benefit Effects 0.000 description 4
- 229910002092 carbon dioxide Inorganic materials 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- 150000002576 ketones Chemical class 0.000 description 4
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- 241000221787 Erysiphe Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 244000061176 Nicotiana tabacum Species 0.000 description 3
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 3
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 235000021536 Sugar beet Nutrition 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 244000038559 crop plants Species 0.000 description 3
- 230000035613 defoliation Effects 0.000 description 3
- 230000018109 developmental process Effects 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 230000001681 protective effect Effects 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- ZDZOJEUYRFMJHH-UHFFFAOYSA-N 2-tert-butyl-2-[(4-chlorophenoxy)methyl]oxirane Chemical compound C=1C=C(Cl)C=CC=1OCC1(C(C)(C)C)CO1 ZDZOJEUYRFMJHH-UHFFFAOYSA-N 0.000 description 2
- 244000099147 Ananas comosus Species 0.000 description 2
- 235000007119 Ananas comosus Nutrition 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 239000004606 Fillers/Extenders Substances 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 244000299507 Gossypium hirsutum Species 0.000 description 2
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- 206010037888 Rash pustular Diseases 0.000 description 2
- 240000000111 Saccharum officinarum Species 0.000 description 2
- 235000007201 Saccharum officinarum Nutrition 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 240000003768 Solanum lycopersicum Species 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- UHZZMRAGKVHANO-UHFFFAOYSA-M chlormequat chloride Chemical compound [Cl-].C[N+](C)(C)CCCl UHZZMRAGKVHANO-UHFFFAOYSA-M 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 238000010410 dusting Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 230000002538 fungal effect Effects 0.000 description 2
- 230000035784 germination Effects 0.000 description 2
- 125000004438 haloalkoxy group Chemical group 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 229920000126 latex Polymers 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- LGRLWUINFJPLSH-UHFFFAOYSA-N methanide Chemical compound [CH3-] LGRLWUINFJPLSH-UHFFFAOYSA-N 0.000 description 2
- ANXKZXRDXAZQJT-UHFFFAOYSA-M methyl sulfate;trimethylsulfanium Chemical compound C[S+](C)C.COS([O-])(=O)=O ANXKZXRDXAZQJT-UHFFFAOYSA-M 0.000 description 2
- XTEGVFVZDVNBPF-UHFFFAOYSA-N naphthalene-1,5-disulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1S(O)(=O)=O XTEGVFVZDVNBPF-UHFFFAOYSA-N 0.000 description 2
- 235000015097 nutrients Nutrition 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 125000003884 phenylalkyl group Chemical group 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000011814 protection agent Substances 0.000 description 2
- 208000029561 pustule Diseases 0.000 description 2
- 230000005070 ripening Effects 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 230000000638 stimulation Effects 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 230000009885 systemic effect Effects 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- UDPGUMQDCGORJQ-UHFFFAOYSA-N (2-chloroethyl)phosphonic acid Chemical compound OP(O)(=O)CCCl UDPGUMQDCGORJQ-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- XBIAGSJDARBSKG-UHFFFAOYSA-N 1-hydroxypyrrole Chemical class ON1C=CC=C1 XBIAGSJDARBSKG-UHFFFAOYSA-N 0.000 description 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- ANHAEBWRQNIPEV-UHFFFAOYSA-N 2-chloroethyl dihydrogen phosphate Chemical compound OP(O)(=O)OCCCl ANHAEBWRQNIPEV-UHFFFAOYSA-N 0.000 description 1
- QLCGXXYDHCTVKP-UHFFFAOYSA-N 2-tert-butyl-2-[2-(4-chlorophenyl)ethyl]oxirane Chemical compound C=1C=C(Cl)C=CC=1CCC1(C(C)(C)C)CO1 QLCGXXYDHCTVKP-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- RGCKGOZRHPZPFP-UHFFFAOYSA-N Alizarin Natural products C1=CC=C2C(=O)C3=C(O)C(O)=CC=C3C(=O)C2=C1 RGCKGOZRHPZPFP-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 229910021532 Calcite Inorganic materials 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 241000760356 Chytridiomycetes Species 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 240000007154 Coffea arabica Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 240000002024 Gossypium herbaceum Species 0.000 description 1
- 235000004341 Gossypium herbaceum Nutrition 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 244000043261 Hevea brasiliensis Species 0.000 description 1
- 241000257303 Hymenoptera Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000233654 Oomycetes Species 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 239000006004 Quartz sand Substances 0.000 description 1
- 239000004113 Sepiolite Substances 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- 240000006064 Urena lobata Species 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 230000002730 additional effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- HFVAFDPGUJEFBQ-UHFFFAOYSA-M alizarin red S Chemical compound [Na+].O=C1C2=CC=CC=C2C(=O)C2=C1C=C(S([O-])(=O)=O)C(O)=C2O HFVAFDPGUJEFBQ-UHFFFAOYSA-M 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 150000003974 aralkylamines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 238000009395 breeding Methods 0.000 description 1
- 230000001488 breeding effect Effects 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 235000016213 coffee Nutrition 0.000 description 1
- 235000013353 coffee beverage Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000009036 growth inhibition Effects 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000036512 infertility Effects 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- DCYOBGZUOMKFPA-UHFFFAOYSA-N iron(2+);iron(3+);octadecacyanide Chemical compound [Fe+2].[Fe+2].[Fe+2].[Fe+3].[Fe+3].[Fe+3].[Fe+3].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] DCYOBGZUOMKFPA-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 239000004579 marble Substances 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 230000003641 microbiacidal effect Effects 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 229920005615 natural polymer Polymers 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000002420 orchard Substances 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 1
- 230000008659 phytopathology Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 229960003351 prussian blue Drugs 0.000 description 1
- 239000013225 prussian blue Substances 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 229910052624 sepiolite Inorganic materials 0.000 description 1
- 235000019355 sepiolite Nutrition 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000005728 strengthening Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 230000005068 transpiration Effects 0.000 description 1
- 238000009369 viticulture Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/48—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with two nitrogen atoms as the only ring hetero atoms
- A01N43/50—1,3-Diazoles; Hydrogenated 1,3-diazoles
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/64—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with three nitrogen atoms as the only ring hetero atoms
- A01N43/647—Triazoles; Hydrogenated triazoles
- A01N43/653—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/04—Compounds containing oxirane rings containing only hydrogen and carbon atoms in addition to the ring oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/08—Compounds containing oxirane rings with hydrocarbon radicals, substituted by halogen atoms, nitro radicals or nitroso radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/12—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms
- C07D303/18—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms by etherified hydroxyl radicals
- C07D303/20—Ethers with hydroxy compounds containing no oxirane rings
- C07D303/22—Ethers with hydroxy compounds containing no oxirane rings with monohydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Epoxy Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803018866 DE3018866A1 (de) | 1980-05-16 | 1980-05-16 | 1-hydroxyethyl-azol-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als pflanzenwachstumsregulatoren und fungizide |
| DEP3018866.0 | 1980-05-16 | ||
| DEP3106076.5 | 1981-02-19 | ||
| DE19813106076 DE3106076A1 (de) | 1981-02-19 | 1981-02-19 | 1-hydroxyethyl-azol-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als pflanzenwachstumsregulatoren und fungizide |
Related Parent Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000617114A Division CA1341164C (en) | 1980-05-16 | 1981-05-15 | 1-hydroxyethyl-azole derivatives, a process for their preparation and their use as plant growth regulators and fungicides |
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000617114A Division CA1341164C (en) | 1980-05-16 | 1981-05-15 | 1-hydroxyethyl-azole derivatives, a process for their preparation and their use as plant growth regulators and fungicides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1341164C true CA1341164C (en) | 2001-01-02 |
Family
ID=25785513
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000617114A Expired - Lifetime CA1341164C (en) | 1980-05-16 | 1981-05-15 | 1-hydroxyethyl-azole derivatives, a process for their preparation and their use as plant growth regulators and fungicides |
| CA000377689A Expired - Fee Related CA1341521C (en) | 1980-05-16 | 2005-08-15 | 1-hydroxyethyl-azole derivatives, a process for their preparation and their use as plant growth regulators and fungicides |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000377689A Expired - Fee Related CA1341521C (en) | 1980-05-16 | 2005-08-15 | 1-hydroxyethyl-azole derivatives, a process for their preparation and their use as plant growth regulators and fungicides |
Country Status (24)
| Country | Link |
|---|---|
| US (8) | US4532341A (Sortimente) |
| EP (3) | EP0072580B1 (Sortimente) |
| JP (2) | JPH02167270A (Sortimente) |
| AR (2) | AR227310A1 (Sortimente) |
| AT (3) | ATE8391T1 (Sortimente) |
| AU (3) | AU542623B2 (Sortimente) |
| BR (1) | BR8103049A (Sortimente) |
| CA (2) | CA1341164C (Sortimente) |
| DD (2) | DD158847A5 (Sortimente) |
| DE (1) | DE3164696D1 (Sortimente) |
| DK (4) | DK158152C (Sortimente) |
| EG (1) | EG14836A (Sortimente) |
| ES (1) | ES502234A0 (Sortimente) |
| FI (3) | FI861230A7 (Sortimente) |
| GR (1) | GR78229B (Sortimente) |
| HU (3) | HU188092B (Sortimente) |
| IE (3) | IE52450B1 (Sortimente) |
| IL (6) | IL75521A (Sortimente) |
| NL (1) | NL971022I2 (Sortimente) |
| NZ (4) | NZ207097A (Sortimente) |
| OA (1) | OA06809A (Sortimente) |
| PH (3) | PH17636A (Sortimente) |
| PT (1) | PT72979B (Sortimente) |
| TR (4) | TR22400A (Sortimente) |
Families Citing this family (198)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0052424B2 (en) * | 1980-11-19 | 1990-02-28 | Imperial Chemical Industries Plc | Triazole compounds, a process for preparing them, their use as plant fungicides and fungicidal compositions containing them |
| CA1162540A (en) * | 1980-12-24 | 1984-02-21 | Ikutaro Saji | Imidazolylpropanol compounds and their acid addition salts, and production and use thereof |
| GR78218B (Sortimente) * | 1981-07-02 | 1984-09-26 | Ciba Geigy Ag | |
| US4435399A (en) * | 1981-07-18 | 1984-03-06 | Pfizer Inc. | 2-Aryl-1-(imidazol-1-yl)-8-(4-piperazin-1-ylphenoxy) octan-2-ol antifungal agents |
| DE3145857A1 (de) * | 1981-11-19 | 1983-05-26 | Bayer Ag, 5090 Leverkusen | Alkylcyloalkyl-triazolylmethyl-ketone und verfahreen zu ihrer herstellung |
| DE3202604A1 (de) * | 1982-01-27 | 1983-08-04 | Bayer Ag, 5090 Leverkusen | Ether-derivate von substituierten 1-hydroxyalkyl-azolen, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide und pflanzenwachstumsregulatoren |
| DE3202613A1 (de) * | 1982-01-27 | 1983-08-04 | Bayer Ag, 5090 Leverkusen | Antimykotische mittel |
| DE3202601A1 (de) * | 1982-01-27 | 1983-08-04 | Bayer Ag, 5090 Leverkusen | Substituierte 1 -hydroxyalkyl-azolyl-derivate, verfahren zu ihrer herstellung sowie ihrer verwendung als fungizide und pflanzenwachstumsregulatoren |
| US4940481A (en) * | 1982-03-04 | 1990-07-10 | Ciba-Geigy Corporation | Microbicidal and growth regulating compositions |
| GB8504093D0 (en) * | 1985-02-18 | 1985-03-20 | Ici Plc | Alkene alkyne/cycloalkylene derivatives |
| US5236953A (en) * | 1982-04-14 | 1993-08-17 | Imperial Chemical Industries Plc | Alkene, alkyne or cycloalkylene derivatives |
| EP0097426B1 (en) * | 1982-06-14 | 1988-09-07 | Imperial Chemical Industries Plc | Triazole compounds |
| DE3229274A1 (de) * | 1982-08-05 | 1984-02-09 | Bayer Ag, 5090 Leverkusen | Substituierte azolylvinyl-ketone und -carbinole |
| DE3232647A1 (de) * | 1982-09-02 | 1984-03-08 | Bayer Ag, 5090 Leverkusen | Substituierte tert.-butanol-derivate, verfahren zu ihrer herstellung und diese enthaltende antimykotische mittel |
| DE3237400A1 (de) * | 1982-10-08 | 1984-04-12 | Bayer Ag, 5090 Leverkusen | Substituierte 1-hydroxyethyl-triazolyl-derivate |
| US4505919A (en) * | 1982-10-09 | 1985-03-19 | Pfizer Inc. | Antifungal S-arylmethyl- and S-heterocyclylmethyl ethers of 2-aryl-3-mercapto-1-(1H-1,2,4-triazol-1-yl) propan-2-ols |
| KR880001813B1 (ko) * | 1983-01-10 | 1988-09-19 | 시바-가이기 코오포레이숀 | 플루오로아졸릴 프로판 유도체의 제조방법 |
| DE3461637D1 (en) * | 1983-02-16 | 1987-01-22 | Pfizer Ltd | Triazole antifungal agents |
| DE3307217A1 (de) * | 1983-03-02 | 1984-09-06 | Bayer Ag, 5090 Leverkusen | Substituierte 1,3-diazolyl-2-propanole, verfahren zu ihrer herstellung und ihre verwendung als antimykotische mittel |
| DE3311702A1 (de) * | 1983-03-30 | 1984-10-04 | Bayer Ag, 5090 Leverkusen | Fungizide mittel, verfahren zu ihrer herstellung und deren verwendung |
| DE3315524A1 (de) * | 1983-04-29 | 1984-10-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von oxiranen |
| DE3315510A1 (de) * | 1983-04-29 | 1984-10-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von oxiranen |
| DE3315619A1 (de) * | 1983-04-29 | 1984-10-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von oxiranen |
| DE3315681A1 (de) * | 1983-04-29 | 1984-10-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von oxiranen |
| DE3315808A1 (de) * | 1983-04-30 | 1984-10-31 | Bayer Ag, 5090 Leverkusen | Antivirale mittel |
| ATE66676T1 (de) * | 1983-05-19 | 1991-09-15 | Ciba Geigy Ag | Verfahren zur herstellung von 1triazolylethylether-derivaten, sowie mikrobizide mittel enthaltende neue 1-triazolyl- phenoxyphenylethylether-derivate als wirkstoffe und deren verwendung. |
| DE3321158A1 (de) * | 1983-06-11 | 1984-12-13 | Bayer Ag, 5090 Leverkusen | Azolylmethyl-thienyl-carbinol-derivate |
| DE3333411A1 (de) * | 1983-09-16 | 1985-04-04 | Bayer Ag, 5090 Leverkusen | Fungizide mittel |
| US5250560A (en) * | 1983-09-16 | 1993-10-05 | Bayer Aktiengesellschaft | Fungicidal agents |
| US5198231A (en) * | 1983-09-16 | 1993-03-30 | Bayer Aktiengesellschaft | Fungicidal agents |
| DE3333412A1 (de) | 1983-09-16 | 1985-04-04 | Bayer Ag, 5090 Leverkusen | Fungizide mittel |
| DE3334779A1 (de) * | 1983-09-26 | 1985-04-11 | Bayer Ag, 5090 Leverkusen | Hydroxyethyl-azol-derivate |
| DE3342692A1 (de) | 1983-11-25 | 1985-06-05 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von ss-hydroxyethyl-(1,2,4-triazol)-derivaten |
| DE3401714A1 (de) * | 1984-01-19 | 1985-07-25 | Celamerck Gmbh & Co Kg, 6507 Ingelheim | Neuartige azole mit enoletherstruktur, ihre herstellung und verwendung |
| GB8406000D0 (en) * | 1984-03-07 | 1984-04-11 | Ici Plc | Olefine derivatives |
| CN1008735B (zh) * | 1984-11-02 | 1990-07-11 | 拜尔公司 | 以取代的氮杂茂基甲基-环丙基-甲醇衍生物为活性成分的组合物 |
| DE3582305D1 (de) * | 1984-11-02 | 1991-05-02 | Bayer Ag | Optisch aktives 2-(4-chlorphenoxymethyl)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)-2-butanol, ein verfahren zu dessen herstellung und dessen verwendung als antimykotikum. |
| DE3508909A1 (de) * | 1985-03-13 | 1986-09-18 | Bayer Ag, 5090 Leverkusen | Piperazinylmethyl-1,2,4-triazolylmethyl-carbinole |
| US4863505A (en) * | 1985-09-12 | 1989-09-05 | Kureha Kagaku Kogyo Kabushiki Kaisha | Novel derivative of azole, and agricultural and horticultural composition containing the same as an active incredient |
| DE3537817A1 (de) * | 1985-10-24 | 1987-04-30 | Bayer Ag | Verfahren zur herstellung von oxiranen |
| DE3540525A1 (de) * | 1985-11-15 | 1987-05-27 | Bayer Ag | Mittel zur regulierung des pflanzenwachstums |
| GB8603951D0 (en) * | 1986-02-18 | 1986-03-26 | Ici Plc | Heterocyclic compounds |
| DE3702301A1 (de) * | 1986-03-06 | 1987-09-10 | Bayer Ag | 2-hydroxyethyl-azol-derivate |
| ATE54312T1 (de) * | 1986-03-06 | 1990-07-15 | Bayer Ag | 2-hydroxyethyl-azol-derivate. |
| US4952232A (en) * | 1987-04-29 | 1990-08-28 | E. I. Du Pont De Nemours And Company | Antifungal carbinols |
| DE3621494A1 (de) * | 1986-06-27 | 1988-01-07 | Bayer Ag | Verwendung von 1-aryl-3-hydroxy-3-alkyl-4-(1,2,4-triazol-1-yl) -butan-derivaten als mikrobizide fuer den materialschutz |
| DE3627673A1 (de) * | 1986-08-14 | 1988-02-25 | Bayer Ag | Verfahren zur herstellung optisch aktiver 2-hydroxyethyl-azol-derivate |
| US5239089A (en) * | 1986-11-10 | 1993-08-24 | Kureha Kagaku Kogyo Kabushiki Kaisha | Oxirane derivatives useful for making fungicidal azole compounds |
| JPH0625140B2 (ja) * | 1986-11-10 | 1994-04-06 | 呉羽化学工業株式会社 | 新規アゾール誘導体、その製造方法及び該誘導体の農園芸用薬剤 |
| DE3700923A1 (de) * | 1987-01-15 | 1988-07-28 | Bayer Ag | Fungizide wirkstoffkombination |
| DE3703082A1 (de) * | 1987-02-03 | 1988-08-11 | Bayer Ag | Verfahren zur herstellung optisch aktiver 2-hydroxyethyl-azol-derivate |
| DE3716560A1 (de) * | 1987-05-18 | 1988-12-01 | Bayer Ag | Hydroxyalkyl-triazolyl-derivate |
| DE3716559A1 (de) * | 1987-05-18 | 1988-12-01 | Bayer Ag | Hydroxyalkyl-triazolyl-derivate |
| DE3716558A1 (de) * | 1987-05-18 | 1988-12-01 | Bayer Ag | Hydroxyalkyl-azolyl-derivate |
| DE3812967A1 (de) * | 1987-06-24 | 1989-01-05 | Bayer Ag | Azolylmethyl-cyclopropyl-derivate |
| DE3720998A1 (de) * | 1987-06-25 | 1989-01-05 | Bayer Ag | Verwendung von 1-(4-chlorphenyl)-4,4-dimethyl-3- (1,2,4-triazol-1-yl-methyl)-pentan-3-ol zur bekaempfung von pseudocercosporella herpotrichoides |
| DE3813129A1 (de) * | 1987-07-01 | 1989-01-12 | Bayer Ag | Hydroxyethyl-azolyl-derivate |
| DE3722133A1 (de) * | 1987-07-04 | 1989-01-12 | Bayer Ag | Azolyl-tetrahydropyran-derivate |
| DE3813874A1 (de) * | 1987-07-10 | 1989-01-19 | Bayer Ag | Hydroxyalkyl-azolyl-derivate |
| DE3724645A1 (de) * | 1987-07-25 | 1989-02-02 | Basf Ag | Hydroxyethyl-azol-derivate und ihre verwendung als fungizide |
| DE3732385A1 (de) * | 1987-09-25 | 1989-04-06 | Bayer Ag | Hydroxyalkylcyclopropyl1-1,2,4-triazolyl- oder -imidazolyl-derivate und ihre verwendung als antimykotische mittel |
| DE3733754A1 (de) * | 1987-10-06 | 1989-04-20 | Bayer Ag | Verfahren zur herstellung von 1-(4-chlorphenyl)-3-(1,2,4-triazol-1-yl-methyl)-4,4-dimethyl-pentan-3-ol |
| DE3736651C2 (de) * | 1987-10-29 | 1995-11-23 | Bayer Ag | Fungizide Wirkstoffkombinationen |
| DE3804981A1 (de) * | 1988-02-18 | 1989-08-31 | Bayer Ag | Substituierte triazole |
| US5266586A (en) * | 1988-02-18 | 1993-11-30 | Bayer Aktiengesellschaft | Fungicidal substituted triazoles |
| US5187178A (en) * | 1988-02-18 | 1993-02-16 | Bayer Aktiengesellschaft | Fungicidal substituted triazoles |
| DE3809069A1 (de) * | 1988-03-18 | 1989-09-28 | Basf Ag | Azolylmethylallylalkohole und diese enthaltende fungizide |
| DE3813253A1 (de) * | 1988-04-20 | 1989-11-02 | Bayer Ag | Substituierte triazolylmethylcarbinole |
| DE3823174A1 (de) * | 1988-07-08 | 1990-01-11 | Bayer Ag | Optisch aktive (1,3-oxathian-2-yl)-oxirane, ihre herstellung und verwendung als zwischenprodukte, sowie verfahren zur herstellung von optisch aktiven 2-hydroxyethyl-1,2,4-triazol-derivaten |
| DE3824435A1 (de) * | 1988-07-19 | 1990-01-25 | Bayer Ag, 51373 Leverkusen | Substituierte 2,2-dihalogencyclopropyl-hydroxyethyl-1,2,4-triazole, verfahren sowie 2,2-dihalogencyclopropyl-oxirane, cyclopropylketone und halogenmethyl-cyclpropyl-ketone als zwischenprodukte zu ihrer herstellung, und ihre verwendung in fungiziden mitteln |
| DE3824434A1 (de) * | 1988-07-19 | 1990-01-25 | Bayer Ag, 51373 Leverkusen | Substituierte 1-aryl-3-cycloalkyl-4-(1,2,4-triazol-1-yl)-but-1-in-3-ole, verfahren sowie substituierte 2-arylethinyl-2-cycloalkyl-oxirane und cycloalkyl-arylethinylketone als zwischenprodukte zu ihrer herstellung, und ihre verwendung in fungiziden mitteln |
| US5024785A (en) * | 1989-01-17 | 1991-06-18 | The Dow Chemical Company | Liquid crystal/rigid rodlike polymer modified epoxy/vinyl ester resins |
| US5164464A (en) * | 1989-01-17 | 1992-11-17 | The Dow Chemical Company | Vinyl ester resins containing mesogenic/rigid rodlike moieties |
| US4962163A (en) * | 1989-01-17 | 1990-10-09 | The Dow Chemical Company | Vinyl ester resins containing mesogenic/rigid rodlike moieties |
| DE3905316A1 (de) * | 1989-02-21 | 1990-08-23 | Bayer Ag | Cyclopropyl-hydroxyethyl-azolyl-derivate |
| DE3906556A1 (de) * | 1989-03-02 | 1990-09-06 | Desowag Materialschutz Gmbh | Mittel oder konzentrat zum konservieren von holz oder holzwerkstoffen |
| DE3906771A1 (de) * | 1989-03-03 | 1990-09-06 | Basf Ag | 1-hydroxi-1,2,4-triazolverbindungen und diese enthaltende fungizide |
| DE3910921C1 (Sortimente) * | 1989-04-05 | 1990-05-17 | Bayer Ag, 5090 Leverkusen, De | |
| DE3910922C1 (Sortimente) * | 1989-04-05 | 1990-05-17 | Bayer Ag, 5090 Leverkusen, De | |
| DE3921163A1 (de) * | 1989-06-28 | 1991-01-10 | Bayer Ag | Hydroxy-keto-azole |
| DE3934714A1 (de) * | 1989-10-18 | 1991-04-25 | Bayer Ag | Fungizide wirkstoffkombinationen |
| DE4001115A1 (de) * | 1990-01-17 | 1991-07-18 | Bayer Ag | Fungizide wirkstoffkombinationen |
| FR2662911B1 (fr) * | 1990-06-12 | 1996-12-13 | Rhone Poulenc Agrochimie | Procede pour proteger les produits de multiplication des vegetaux et les vegetaux en resultant au moyen d'un triazolyl cyclopentanol. |
| DE4018927A1 (de) * | 1990-06-13 | 1991-12-19 | Bayer Ag | Azolyl-propanol-derivate |
| US5230892A (en) * | 1990-08-24 | 1993-07-27 | Bayer Aktiengesellschaft | Solid formulations |
| FR2668893A1 (fr) * | 1990-11-13 | 1992-05-15 | Rhone Poulenc Agrochimie | Procede pour proteger les produits de multiplication des vegetaux a l'aide de triazolyl ou imidazolyl methyl allyl alcool et composes nouveaux pour mettre en óoeuvre le procede. |
| DK0487451T3 (da) * | 1990-11-16 | 1996-05-06 | Ciba Geigy Ag | Mikrobicide midler |
| DE4113158A1 (de) * | 1991-04-23 | 1992-10-29 | Bayer Ag | Mikrobizide wirkstoffkombinationen |
| DE4131205A1 (de) | 1991-09-19 | 1993-03-25 | Bayer Ag | Wasserbasierte, loesungsmittel- und emulgatorfreie mikrobizide wirkstoffkombination |
| SG47444A1 (en) * | 1991-12-19 | 1998-04-17 | Ciba Geigy Ag | Microbicides |
| DK0556157T3 (da) * | 1992-02-13 | 1998-08-10 | Novartis Ag | Fungicide blandinger på basis af triazol-fungicider og et 4,6-dimethyl-N-phenyl-2-pyrimidinamin. |
| FR2690441A1 (fr) * | 1992-04-08 | 1993-10-29 | Rhone Poulenc Agrochimie | Nouveaux dérivés triazole et imidazole fongicides. |
| DE4325558A1 (de) * | 1992-07-31 | 1994-02-03 | Shell Int Research | Fungizide Zusammensetzung |
| DE4300452A1 (de) * | 1993-01-11 | 1994-07-14 | Bayer Ag | Mittel zur Hemmung des Pflanzenwachstums |
| DE4304172A1 (de) | 1993-02-12 | 1994-08-25 | Bayer Ag | Fungizide Wirkstoffkombinationen |
| EP0613890A1 (en) * | 1993-02-28 | 1994-09-07 | Nihon Nohyaku Co., Ltd. | Novel triazole compound, process for preparing the same and antifungal agent containing the same |
| SK36096A3 (en) * | 1993-09-16 | 1996-09-04 | Bayer Ag | Butenol-triazolyl derivatives, their manufacture and use as microbicides |
| ATE136734T1 (de) * | 1993-09-24 | 1996-05-15 | Basf Ag | Fungizide mischungen |
| DE4412332A1 (de) * | 1994-04-11 | 1995-10-12 | Bayer Ag | Silyloxy-cyclopropyl-azolyl-Derivate |
| TW286264B (Sortimente) * | 1994-05-20 | 1996-09-21 | Ciba Geigy Ag | |
| DE4426753A1 (de) * | 1994-07-28 | 1996-02-01 | Bayer Ag | Mittel zur Bekämpfung von Pflanzenschädlingen |
| US5591726A (en) * | 1994-09-26 | 1997-01-07 | American Cyanamid Company | Heterocyclylalkyl diarylboron ester and thioester fungicidal agents |
| DE19505938A1 (de) * | 1995-02-21 | 1996-08-22 | Bayer Ag | Verfahren zur Herstellung von 1-(4-Chlorphenyl)-4,4-dimethyl-pentan-3-on |
| DE19617282A1 (de) * | 1996-04-30 | 1997-11-06 | Bayer Ag | Triazolyl-mercaptide |
| DE19617461A1 (de) * | 1996-05-02 | 1997-11-06 | Bayer Ag | Acylmercapto-triazolyl-Derivate |
| DE19619544A1 (de) | 1996-05-15 | 1997-11-20 | Bayer Ag | Triazolyl-Disulfide |
| DE19620408A1 (de) * | 1996-05-21 | 1997-11-27 | Bayer Ag | Mercapto-imidazolyl-Derivate |
| DE19620407A1 (de) * | 1996-05-21 | 1997-11-27 | Bayer Ag | Thiocyano-triazolyl-Derivate |
| DE19620590A1 (de) * | 1996-05-22 | 1997-11-27 | Bayer Ag | Sulfonyl-mercapto-triazolyl-Derivate |
| US6297236B1 (en) | 1998-04-06 | 2001-10-02 | Bayer Aktiengesellschaft | Fungicide active substance combinations |
| DE19716257A1 (de) * | 1997-04-18 | 1998-10-22 | Bayer Ag | Fungizide Wirkstoffkombination |
| WO1999000013A2 (en) * | 1997-06-30 | 1999-01-07 | Monsanto Company | Microparticles containing agricultural active ingredients |
| DE19829113A1 (de) | 1998-06-10 | 1999-12-16 | Bayer Ag | Mittel zur Bekämpfung von Pflanzenschädlingen |
| ID27072A (id) | 1998-06-10 | 2001-02-22 | Bayer Ag | Komposisi-komposisi untuk mengontrol hama tanaman |
| RU2001101908A (ru) * | 1998-06-17 | 2003-02-10 | Байер Акциенгезельшафт (De) | Средства для борьбы с вредителями растений |
| DE19834028A1 (de) | 1998-07-28 | 2000-02-03 | Wolman Gmbh Dr | Verfahren zur Behandlung von Holz gegen den Befall durch holzschädigende Pilze |
| ES2151847B1 (es) * | 1998-10-07 | 2001-08-16 | Rodriguez Juan Carlos Caubin | Util para orinar las mujeres. |
| PL200668B1 (pl) * | 1999-12-13 | 2009-01-30 | Bayer Ag | Kombinacje substancji aktywnych, zastosowanie tych kombinacji i sposób wytwarzania środków grzybobójczych |
| DE10019758A1 (de) | 2000-04-20 | 2001-10-25 | Bayer Ag | Fungizide Wirkstoffkombinationen |
| DE10103832A1 (de) * | 2000-05-11 | 2001-11-15 | Bayer Ag | Fungizide Wirkstoffkombinationen |
| DE10049804A1 (de) * | 2000-10-09 | 2002-04-18 | Bayer Ag | Wirkstoffkombinationen mit fungiziden und akariziden Eigenschaften |
| DE10059605A1 (de) | 2000-12-01 | 2002-06-06 | Bayer Ag | Fungizide Wirkstoffkombinationen |
| WO2002083732A2 (de) * | 2001-04-12 | 2002-10-24 | Basf Aktiengesellschaft | Bioregulatorische wirkstoffkombination |
| DE10141618A1 (de) * | 2001-08-24 | 2003-03-06 | Bayer Cropscience Ag | Fungizide Wirkstoffkombinationen |
| BR0308830A (pt) * | 2002-04-05 | 2005-01-25 | Basf Ag | Mistura fungicida, processo para combater nocivos, e, agente fungicida |
| DE10228104A1 (de) * | 2002-06-24 | 2004-01-15 | Bayer Cropscience Ag | Fungizide Wirkstoffkombination |
| JP2005537259A (ja) * | 2002-07-10 | 2005-12-08 | ビーエーエスエフ アクチェンゲゼルシャフト | ジチアノンに基づく殺菌混合物 |
| CN1681389A (zh) * | 2002-08-19 | 2005-10-12 | 巴斯福股份公司 | 含羧酸的试剂及其在植物栽培中的用途 |
| MXPA05004736A (es) * | 2002-11-12 | 2005-08-02 | Basf Ag | Metodo para mejorar el rendimiento en vegetales resistentes al glifosato. |
| DE10333373A1 (de) | 2003-07-23 | 2005-02-10 | Bayer Ag | Fungizide Wirkstoffkombinationen |
| DE10335183A1 (de) * | 2003-07-30 | 2005-02-24 | Bayer Cropscience Ag | Fungizide Wirkstoffkombinationen |
| DE10341945A1 (de) * | 2003-09-11 | 2005-04-21 | Bayer Cropscience Ag | Verwendung von fungiziden Mitteln zur Beizung von Saatgut |
| NZ546338A (en) * | 2003-10-01 | 2008-08-29 | Basf Ag | Fungicidal mixtures of a triazolopyrimidine derivative and a tebuconazole |
| DE10347090A1 (de) | 2003-10-10 | 2005-05-04 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE10349501A1 (de) | 2003-10-23 | 2005-05-25 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE10349503A1 (de) | 2003-10-23 | 2005-05-25 | Bayer Cropscience Ag | Fungizide Wirkstoffkombinationen |
| EP1563731A1 (en) * | 2004-02-12 | 2005-08-17 | Bayer CropScience S.A. | Fungicidal composition comprising a pyridylethylbenzamide derivative and a compound capable of inhibiting the ergosterol biosynthesis |
| EP2255630A3 (de) | 2004-04-30 | 2012-09-26 | Basf Se | Fungizide Mischungen |
| DE102004049761A1 (de) | 2004-10-12 | 2006-04-13 | Bayer Cropscience Ag | Fungizide Wirkstoffkombinationen |
| DE102005015677A1 (de) * | 2005-04-06 | 2006-10-12 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE102005015850A1 (de) | 2005-04-07 | 2006-10-12 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| EA201270781A1 (ru) | 2005-06-09 | 2013-09-30 | Байер Кропсайенс Аг | Комбинации биологически активных веществ |
| DE102005026482A1 (de) | 2005-06-09 | 2006-12-14 | Bayer Cropscience Ag | Wirkstoffkombinationen |
| EP2314163A3 (en) | 2005-07-21 | 2011-08-31 | Syngenta Participations AG | Fungicidal compositions comprising tebuconazole |
| DE102005035300A1 (de) * | 2005-07-28 | 2007-02-01 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE202006021232U1 (de) | 2005-09-09 | 2013-12-16 | Basf Se | Fungizide Mischungen auf der Basis von Triazolen |
| DE102006023263A1 (de) | 2006-05-18 | 2007-11-22 | Bayer Cropscience Ag | Synergistische Wirkstoffkombinationen |
| US20100041905A1 (en) * | 2006-07-18 | 2010-02-18 | Astrazeneca Ab | Process for the Preparation of Substituted 2-Acetylamino-Alkoxyphenyl |
| US20100041682A1 (en) | 2006-09-18 | 2010-02-18 | Langewald Juergen | Ternary Pesticidal Mixtures |
| US7772156B2 (en) * | 2006-11-01 | 2010-08-10 | Buckman Laboratories International, Inc. | Microbicidal compositions including a cyanodithiocarbimate and a second microbicide, and methods of using the same |
| CA2670477A1 (en) | 2006-12-07 | 2008-06-12 | Basf Se | Compositions and kits comprising a fungicidal triazole and an alkoxylated alcohol, and their uses |
| EP2258177A3 (en) | 2006-12-15 | 2011-11-09 | Rohm and Haas Company | Mixtures comprising 1-methylcyclopropene |
| WO2008095924A2 (de) | 2007-02-06 | 2008-08-14 | Basf Se | Insektizide als safener für fungizide mit phytotoxischer wirkung |
| CL2008001181A1 (es) | 2007-04-23 | 2009-10-23 | Basf Se | Metodo para mejorar la salud de la planta y/o controlar plagas en plantas con al menos una modificacion transgenica relacionada con el aumento del rendimiento que consiste en la aplicacion de una composicion quimica que comprende al menos un ingrediente activo seleccionado de insecticidas, fungicidas o herbicidas. |
| CN102726417B (zh) | 2007-04-25 | 2014-07-02 | 先正达参股股份有限公司 | 杀真菌组合物 |
| EP2000028A1 (de) * | 2007-06-06 | 2008-12-10 | Bayer CropScience Aktiengesellschaft | Fungizide Wirkstoffkombinationen |
| JP2010540495A (ja) | 2007-09-26 | 2010-12-24 | ビーエーエスエフ ソシエタス・ヨーロピア | ボスカリド及びクロロタロニルを含む三成分殺菌組成物 |
| DE102007045920B4 (de) | 2007-09-26 | 2018-07-05 | Bayer Intellectual Property Gmbh | Synergistische Wirkstoffkombinationen |
| GB0823002D0 (en) * | 2008-12-17 | 2009-01-28 | Syngenta Participations Ag | Isoxazoles derivatives with plant growth regulating properties |
| EP2100506A2 (en) | 2009-01-23 | 2009-09-16 | Bayer CropScience AG | Uses of fluopyram |
| KR101647703B1 (ko) | 2009-03-25 | 2016-08-11 | 바이엘 인텔렉쳐 프로퍼티 게엠베하 | 상승적 활성 성분 배합물 |
| BRPI1010096A2 (pt) | 2009-06-18 | 2016-03-15 | Basf Se | compostos de formulas i e ii, composição agrícola, uso de um composto, método de controle de fungos nocivos, semente, composição farmacêutica, uso de um composto e método de tratamento contra o câncer ou infecções por vírus ou para combater a fungos zoopatogênicos ou humanopatogênicos |
| CN102471286B (zh) | 2009-07-08 | 2015-08-19 | 拜耳作物科学公司 | 苯基(氧基/硫基)烷醇衍生物 |
| EP2451785A2 (de) * | 2009-07-08 | 2012-05-16 | Bayer CropScience AG | Substituierte phenyl(oxy/thio)alkanol-derivate |
| BR112012001080A2 (pt) | 2009-07-16 | 2015-09-01 | Bayer Cropscience Ag | Combinações de substâncias ativas sinérgicas contendo feniltriazóis |
| WO2011026796A1 (en) | 2009-09-01 | 2011-03-10 | Basf Se | Synergistic fungicidal mixtures comprising lactylates and method for combating phytopathogenic fungi |
| WO2011076724A2 (en) * | 2009-12-23 | 2011-06-30 | Bayer Cropscience Ag | Pesticidal compound mixtures |
| WO2011140620A1 (pt) * | 2010-05-12 | 2011-11-17 | Empresa Brasileira De Pesquisa Agropecuária - Embrapa | Processo de produção, uso e composição fungicida compreendendo compostos obtidos a partir do líquido da casca da castanha de caju |
| BR112013004511A2 (pt) | 2010-08-26 | 2016-06-07 | Bayer Ip Gmbh | derivados de 5-iodotriazol. |
| BRPI1003373A2 (pt) | 2010-09-29 | 2013-01-29 | Fmc Quimica Do Brasil Ltda | combinaÇÕes sinÉrgicas de triazàis, estrobirulinas e benzimidazàis, usos, formulaÇÕes, processos de produÇço e aplicaÇÕes utilizando a mesma |
| EA023763B1 (ru) | 2010-11-30 | 2016-07-29 | Байер Интеллектчуал Проперти Гмбх | Производные пиримидина и их применение в качестве пестицидов |
| KR20130132942A (ko) | 2010-12-20 | 2013-12-05 | 바스프 에스이 | 피라졸 화합물을 포함하는 살충 활성 혼합물 |
| BR112013015623B1 (pt) | 2010-12-21 | 2021-11-16 | Bayer Cropscience Lp | Composição, seu uso, uso de células mutantes para swra, e método de tratamento de uma planta para melhorar o crescimento da planta, promover a saúde da planta ou controlar uma doença de planta |
| EP2481284A3 (en) | 2011-01-27 | 2012-10-17 | Basf Se | Pesticidal mixtures |
| WO2012127009A1 (en) | 2011-03-23 | 2012-09-27 | Basf Se | Compositions containing polymeric, ionic compounds comprising imidazolium groups |
| AR085587A1 (es) | 2011-04-13 | 2013-10-09 | Bayer Cropscience Ag | Combinaciones de compuestos activos |
| AR085588A1 (es) | 2011-04-13 | 2013-10-09 | Bayer Cropscience Ag | Combinaciones de compuestos activos |
| US20140200136A1 (en) | 2011-09-02 | 2014-07-17 | Basf Se | Agricultural mixtures comprising arylquinazolinone compounds |
| EP2755485A1 (en) | 2011-09-12 | 2014-07-23 | Bayer Cropscience LP | Methods of enhancing health and/or promoting growth of a plant and/or of improving fruit ripening |
| CA2856591A1 (en) | 2011-11-25 | 2013-05-30 | Hendrik Helmke | 2-iodoimidazole derivatives |
| ES2660132T3 (es) | 2012-06-20 | 2018-03-20 | Basf Se | Compuestos de pirazol plaguicidas |
| US20150257383A1 (en) | 2012-10-12 | 2015-09-17 | Basf Se | Method for combating phytopathogenic harmful microbes on cultivated plants or plant propagation material |
| JP6576829B2 (ja) | 2012-12-20 | 2019-09-18 | ビーエーエスエフ アグロ ベー.ブイ. | トリアゾール化合物を含む組成物 |
| EP2746258A1 (en) | 2012-12-21 | 2014-06-25 | Basf Se | Substituted [1,2,4]triazole and imidazole compounds |
| EP2746257A1 (en) | 2012-12-21 | 2014-06-25 | Basf Se | Substituted [1,2,4]triazole and imidazole compounds |
| EP2783569A1 (en) | 2013-03-28 | 2014-10-01 | Basf Se | Compositions comprising a triazole compound |
| EP2835052A1 (en) | 2013-08-07 | 2015-02-11 | Basf Se | Fungicidal mixtures comprising pyrimidine fungicides |
| EP2837287A1 (en) | 2013-08-15 | 2015-02-18 | Bayer CropScience AG | Use of prothioconazole for increasing root growth of Brassicaceae |
| EP3041355B1 (de) | 2013-09-03 | 2017-08-09 | Bayer CropScience AG | Verwendung fungizider wirkstoffe zur kontrolle von chalara fraxinea an eschenbäumen |
| CN105722833A (zh) | 2013-09-16 | 2016-06-29 | 巴斯夫欧洲公司 | 杀真菌的嘧啶化合物 |
| WO2015036059A1 (en) | 2013-09-16 | 2015-03-19 | Basf Se | Fungicidal pyrimidine compounds |
| EP2979549A1 (en) | 2014-07-31 | 2016-02-03 | Basf Se | Method for improving the health of a plant |
| CN107075712A (zh) | 2014-10-24 | 2017-08-18 | 巴斯夫欧洲公司 | 改变固体颗粒的表面电荷的非两性、可季化和水溶性聚合物 |
| EP2910126A1 (en) | 2015-05-05 | 2015-08-26 | Bayer CropScience AG | Active compound combinations having insecticidal properties |
| US20180184654A1 (en) | 2015-07-02 | 2018-07-05 | BASF Agro B.V. | Pesticidal Compositions Comprising a Triazole Compound |
| CA3003065A1 (en) | 2015-10-27 | 2017-05-04 | Bayer Cropscience Aktiengesellschaft | Composition comprising a safener, a fungicide and metalaxyl |
| CN109996789A (zh) * | 2016-09-29 | 2019-07-09 | 拜耳作物科学股份公司 | 作为作物保护的杀真菌剂的1,5-取代的咪唑衍生物 |
| PE20231302A1 (es) | 2020-07-30 | 2023-08-24 | Pi Industries Ltd | Composicion de metominostrobina, tebuconazol y propineb |
Family Cites Families (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3188324A (en) * | 1958-11-19 | 1965-06-08 | Sinclair Research Inc | Neopentyl-substituted epoxy alcohols and chlorides |
| DE1568414A1 (de) * | 1965-09-23 | 1970-04-02 | Dow Chemical Co | Verfahren zur Herstellung von Epoxyden aus Sulfoniumsalzen |
| DE1595582A1 (de) * | 1966-01-07 | 1970-04-30 | Hoechst Ag | Verfahren zur Herstellung von Polyaethern |
| US3410810A (en) * | 1966-05-03 | 1968-11-12 | Goodrich Co B F | Polymers of cyanoalkyl epoxy ethers |
| US3930835A (en) * | 1970-08-06 | 1976-01-06 | The Dow Chemical Company | Pesticidal compositions and methods employing substituted oxirane compounds |
| DE2354444A1 (de) * | 1973-10-31 | 1975-05-07 | Merck Patent Gmbh | Biphenylylaether und verfahren zu ihrer herstellung |
| US4000131A (en) * | 1974-05-10 | 1976-12-28 | Hoffmann-La Roche Inc. | Process for preparing epoxide-cyclohexyl compound and resultant compound |
| DE2423987C2 (de) * | 1974-05-17 | 1986-01-16 | Bayer Ag, 5090 Leverkusen | Metallkomplexe von Azolyläthern, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
| DE2431407C2 (de) * | 1974-06-29 | 1982-12-02 | Bayer Ag, 5090 Leverkusen | 1,2,4-Triazol-1-yl-alkanone und -alkanole, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
| EG11779A (en) * | 1974-11-19 | 1978-06-30 | Janssen Pharmaceutica Nv | Process for preparing of 1-(b-aryl-b-(r-oxy)-ethyl)imidazoles |
| US4085209A (en) * | 1975-02-05 | 1978-04-18 | Rohm And Haas Company | Preparation and safening effect of 1-substituted imidazole metal salt complexes |
| CH614201A5 (en) * | 1975-04-11 | 1979-11-15 | Hoffmann La Roche | Process for the preparation of epoxides |
| FI761174A7 (Sortimente) * | 1975-05-05 | 1976-11-06 | Erba Carlo Spa | |
| US4079143A (en) * | 1975-08-26 | 1978-03-14 | Imperial Chemical Industries Limited | Fungicidal 1H-1,2,4-triazoles |
| IE44186B1 (en) * | 1975-12-03 | 1981-09-09 | Ici Ltd | 1,2,4-triazolyl alkanols and their use as pesticides |
| DE2623129C3 (de) * | 1976-05-22 | 1980-04-10 | Nordmark-Werke Gmbh, 2000 Hamburg | U-Diphenyl-3-(imidazol-l-yl) -propan-2-ole, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel |
| FR2370432A1 (fr) * | 1976-11-16 | 1978-06-09 | Ici Ltd | Procede pour influencer la croissance des vegetaux par l'action de certains composes 1,2,4-triazoliques |
| US4123542A (en) * | 1977-01-19 | 1978-10-31 | Syntex (U.S.A.) Inc. | Derivatives of N-alkyl imidazoles |
| US4366165A (en) * | 1977-05-19 | 1982-12-28 | Rohm And Haas Company | 1 and 4-Arylcyanoalkyl-1,2,4-triazoles and fungicidal use |
| DE2736122A1 (de) * | 1977-08-11 | 1979-02-22 | Basf Ag | Fungizide |
| US4246274A (en) * | 1978-05-10 | 1981-01-20 | Bayer Aktiengesellschaft | Antimycotic hydroxypropyl-imidazoles |
| DE2851086A1 (de) * | 1978-11-25 | 1980-06-04 | Bayer Ag | Hydroxypropyl-triazole, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2908378A1 (de) * | 1979-03-03 | 1980-09-11 | Hoechst Ag | Derivate des 1,2,4-triazols |
| US4654332A (en) * | 1979-03-07 | 1987-03-31 | Imperial Chemical Industries Plc | Heterocyclic compounds |
| US4551469A (en) * | 1979-03-07 | 1985-11-05 | Imperial Chemical Industries Plc | Antifungal triazole ethanol derivatives |
| DE2920374A1 (de) * | 1979-05-19 | 1980-11-20 | Bayer Ag | Fungizide mittel, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| US4414210A (en) * | 1979-10-02 | 1983-11-08 | Rohm And Haas Company | 2-Hydroxyarylethyltriazole fungicides |
| EP0052424B2 (en) * | 1980-11-19 | 1990-02-28 | Imperial Chemical Industries Plc | Triazole compounds, a process for preparing them, their use as plant fungicides and fungicidal compositions containing them |
| US4398942A (en) * | 1980-12-22 | 1983-08-16 | Rohm And Haas Company | Herbicidally-active phenylacetonitriles |
| CA1162540A (en) * | 1980-12-24 | 1984-02-21 | Ikutaro Saji | Imidazolylpropanol compounds and their acid addition salts, and production and use thereof |
| DE3102588A1 (de) * | 1981-01-27 | 1982-08-12 | Bayer Ag, 5090 Leverkusen | Mittel zur hemmung des pflanzenwachstums |
| EP0061835B1 (en) * | 1981-03-18 | 1989-02-01 | Imperial Chemical Industries Plc | Triazole compounds, a process for preparing them, their use as plant fungicides and fungicidal compositions containing them |
| DE3111238A1 (de) * | 1981-03-21 | 1982-10-07 | Bayer Ag, 5090 Leverkusen | Substituierte triazolylmethyl-oxirane, verfahren zu ihrer herstellung sowie ihre verwendung als zwischenprodukte |
| EP0078594B1 (en) * | 1981-08-19 | 1987-01-14 | Imperial Chemical Industries Plc | Triazole derivatives, processes for preparing them, compositions containing them and processes for combating fungi and regulating plant growth |
| GB2130322B (en) * | 1982-09-17 | 1987-04-08 | Nissin Kogyo Kk | Vehicle load dependent braking |
| DE3237400A1 (de) * | 1982-10-08 | 1984-04-12 | Bayer Ag, 5090 Leverkusen | Substituierte 1-hydroxyethyl-triazolyl-derivate |
-
1981
- 1981-04-13 AU AU69456/81A patent/AU542623B2/en not_active Expired
- 1981-05-02 EP EP82108279A patent/EP0072580B1/de not_active Expired
- 1981-05-02 DE DE8181103322T patent/DE3164696D1/de not_active Expired
- 1981-05-02 AT AT81103322T patent/ATE8391T1/de active
- 1981-05-02 EP EP81103322A patent/EP0040345B1/de not_active Expired
- 1981-05-02 AT AT83101614T patent/ATE18666T1/de not_active IP Right Cessation
- 1981-05-02 EP EP83101614A patent/EP0087148B1/de not_active Expired
- 1981-05-02 AT AT82108279T patent/ATE25522T1/de not_active IP Right Cessation
- 1981-05-06 PT PT72979A patent/PT72979B/pt unknown
- 1981-05-11 PH PH25615A patent/PH17636A/en unknown
- 1981-05-12 EG EG259/81A patent/EG14836A/xx active
- 1981-05-13 IL IL75521A patent/IL75521A/xx not_active IP Right Cessation
- 1981-05-13 IL IL75519A patent/IL75519A/xx not_active IP Right Cessation
- 1981-05-13 DD DD81229911A patent/DD158847A5/de not_active IP Right Cessation
- 1981-05-13 NZ NZ207097A patent/NZ207097A/xx unknown
- 1981-05-13 FI FI861230A patent/FI861230A7/fi not_active Application Discontinuation
- 1981-05-13 NZ NZ209126A patent/NZ209126A/en unknown
- 1981-05-13 DD DD81244788A patent/DD205602A5/de not_active IP Right Cessation
- 1981-05-13 DK DK213081A patent/DK158152C/da not_active IP Right Cessation
- 1981-05-13 NZ NZ207096A patent/NZ207096A/en unknown
- 1981-05-13 IL IL62863A patent/IL62863A/xx not_active IP Right Cessation
- 1981-05-13 NZ NZ197083A patent/NZ197083A/en unknown
- 1981-05-13 FI FI811472A patent/FI73421C/fi not_active IP Right Cessation
- 1981-05-14 GR GR64959A patent/GR78229B/el unknown
- 1981-05-14 TR TR2531/84A patent/TR22400A/xx unknown
- 1981-05-14 ES ES502234A patent/ES502234A0/es active Granted
- 1981-05-14 TR TR2532/84A patent/TR22396A/xx unknown
- 1981-05-14 TR TR22042A patent/TR22042A/xx unknown
- 1981-05-14 TR TR2530/84A patent/TR22691A/xx unknown
- 1981-05-15 HU HU811362A patent/HU188092B/hu unknown
- 1981-05-15 CA CA000617114A patent/CA1341164C/en not_active Expired - Lifetime
- 1981-05-15 IE IE1093/81A patent/IE52450B1/en not_active IP Right Cessation
- 1981-05-15 HU HU842226A patent/HU191148B/hu not_active IP Right Cessation
- 1981-05-15 AR AR285338A patent/AR227310A1/es active
- 1981-05-15 IE IE958/86A patent/IE52452B1/en unknown
- 1981-05-15 OA OA57402A patent/OA06809A/xx unknown
- 1981-05-15 IE IE957/86A patent/IE52451B1/en unknown
- 1981-05-15 BR BRPI8103049-5A patent/BR8103049A/pt not_active IP Right Cessation
- 1981-05-15 HU HU842227A patent/HU191671B/hu not_active IP Right Cessation
-
1982
- 1982-05-11 AR AR289367A patent/AR229527A1/es active
- 1982-11-09 PH PH28114A patent/PH25843A/en unknown
-
1983
- 1983-05-31 PH PH28986A patent/PH25782A/en unknown
- 1983-06-06 US US06/499,679 patent/US4532341A/en not_active Expired - Lifetime
- 1983-11-08 US US06/549,867 patent/US4897107A/en not_active Expired - Lifetime
-
1984
- 1984-06-18 US US06/621,968 patent/US4723984A/en not_active Expired - Lifetime
- 1984-12-04 AU AU36293/84A patent/AU560022B2/en not_active Ceased
- 1984-12-04 AU AU36292/84A patent/AU556515B2/en not_active Ceased
-
1985
- 1985-01-28 US US06/695,610 patent/US4626595A/en not_active Expired - Lifetime
- 1985-02-06 DK DK054185A patent/DK163507C/da not_active IP Right Cessation
- 1985-02-06 DK DK54385A patent/DK54385D0/da not_active Application Discontinuation
- 1985-02-06 DK DK54285A patent/DK54285A/da not_active Application Discontinuation
- 1985-05-08 US US06/732,193 patent/US4871390A/en not_active Expired - Fee Related
- 1985-05-08 US US06/732,191 patent/US4911746A/en not_active Expired - Fee Related
- 1985-05-08 US US06/732,194 patent/US4789672A/en not_active Expired - Fee Related
- 1985-06-14 IL IL75520A patent/IL75520A0/xx not_active IP Right Cessation
- 1985-06-14 IL IL75519A patent/IL75519A0/xx unknown
- 1985-06-14 IL IL75521A patent/IL75521A0/xx unknown
-
1986
- 1986-03-21 FI FI861206A patent/FI75817C/fi not_active IP Right Cessation
-
1987
- 1987-06-05 US US07/058,479 patent/US4904298A/en not_active Expired - Lifetime
-
1989
- 1989-11-22 JP JP1302308A patent/JPH02167270A/ja active Granted
- 1989-11-22 JP JP1302307A patent/JPH02167273A/ja active Granted
-
1997
- 1997-07-24 NL NL971022C patent/NL971022I2/nl unknown
-
2005
- 2005-08-15 CA CA000377689A patent/CA1341521C/en not_active Expired - Fee Related
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1341164C (en) | 1-hydroxyethyl-azole derivatives, a process for their preparation and their use as plant growth regulators and fungicides | |
| US4990677A (en) | Fungicidal and plant growth-regulating azolylmethyl-cyclopropyl derivatives | |
| US4734126A (en) | Fungicidal and plant growth-regulating novel substituted 1-hydroxyalkyl-azolyl derivatives | |
| US5141553A (en) | Ether derivatives of substituted 1-hydroxyalkyl-azoles as fungicides and plant growth regulators | |
| US4960453A (en) | Hydroxyalkyl-azolyl derivatives as fungicides and plant growth regulators | |
| IE49397B1 (en) | 1-vinyltriazole derivatives,processes for their preparation and their use as growth regulators and fungicides | |
| US4729783A (en) | Halogenated triazolylvinyl keto and carbinol compounds and plant growth regulant and fungicidal compositions | |
| CA1185608A (en) | Azolyl-alkenones and -ols, a process for their preparation, and their use as plant-growth regulators and fungicides | |
| US4507141A (en) | Triazolylalkyl-thioether plant growth regulators and fungicides | |
| IE51123B1 (en) | Substituted triazolylmethyl-tert.-butyl-carbinols,a process for their preparation and their use as plant protection agents and as intermediate products | |
| US4515617A (en) | Benzyl-pyrimidinylalkyl-ethers as plant growth regulators and fungicides, and corresponding pyrimidinylcarbinols | |
| US4530715A (en) | Cycloalkyl (α-triazolyl-β-hydroxy)-ketones as fungicides and plant growth regulators | |
| US4888048A (en) | Fungicidal and plant growth-regulating azolyl-tetrahydropyran derivatives | |
| US4954162A (en) | Azolymethyl-cyclopropyl carbinol derivatives | |
| US4988383A (en) | Fungicidal and plant growth-regulating cyclopropyl-hydroxyethyl-azolyl-derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |
Effective date: 20180102 |