CA1202030A - N-imidazolyl derivatives of bicyclic compounds and process for their preparation - Google Patents
N-imidazolyl derivatives of bicyclic compounds and process for their preparationInfo
- Publication number
- CA1202030A CA1202030A CA000431748A CA431748A CA1202030A CA 1202030 A CA1202030 A CA 1202030A CA 000431748 A CA000431748 A CA 000431748A CA 431748 A CA431748 A CA 431748A CA 1202030 A CA1202030 A CA 1202030A
- Authority
- CA
- Canada
- Prior art keywords
- imidazolyl
- hydrogen
- dihydro
- carboxy
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 193
- 238000000034 method Methods 0.000 title claims abstract description 72
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 title abstract description 6
- 238000002360 preparation method Methods 0.000 title abstract description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 73
- 239000001257 hydrogen Substances 0.000 claims description 69
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 57
- -1 5-tetrazolyl Chemical group 0.000 claims description 49
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 39
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 36
- 150000003839 salts Chemical class 0.000 claims description 28
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 25
- 150000002431 hydrogen Chemical group 0.000 claims description 24
- 239000000460 chlorine Chemical group 0.000 claims description 20
- 239000002253 acid Substances 0.000 claims description 19
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 16
- 239000000203 mixture Substances 0.000 claims description 15
- DQEDSIVMYUUZCK-UHFFFAOYSA-N 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxylic acid Chemical compound C=1C2=CC(C(=O)O)=CC=C2CCC=1N1C=CN=C1 DQEDSIVMYUUZCK-UHFFFAOYSA-N 0.000 claims description 14
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 13
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 13
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 10
- 229960000583 acetic acid Drugs 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 238000004519 manufacturing process Methods 0.000 claims description 10
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 8
- 125000004076 pyridyl group Chemical group 0.000 claims description 8
- 125000001424 substituent group Chemical group 0.000 claims description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 7
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 claims description 7
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 7
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 150000002367 halogens Chemical class 0.000 claims description 7
- 229910052705 radium Inorganic materials 0.000 claims description 7
- 239000000126 substance Substances 0.000 claims description 7
- 235000011149 sulphuric acid Nutrition 0.000 claims description 7
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 6
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims description 6
- 229910052701 rubidium Inorganic materials 0.000 claims description 6
- 125000000204 (C2-C4) acyl group Chemical group 0.000 claims description 5
- SDDDOAYMFJZBCK-UHFFFAOYSA-N 7-imidazol-1-yl-5,6-dihydronaphthalen-2-ol Chemical compound C=1C2=CC(O)=CC=C2CCC=1N1C=CN=C1 SDDDOAYMFJZBCK-UHFFFAOYSA-N 0.000 claims description 5
- WDHWKRIHZFKPAB-UHFFFAOYSA-N 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxamide Chemical compound C=1C2=CC(C(=O)N)=CC=C2CCC=1N1C=CN=C1 WDHWKRIHZFKPAB-UHFFFAOYSA-N 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 239000012362 glacial acetic acid Substances 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 5
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 claims description 5
- 239000001117 sulphuric acid Substances 0.000 claims description 5
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 4
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 4
- 125000004442 acylamino group Chemical group 0.000 claims description 4
- 229910021529 ammonia Inorganic materials 0.000 claims description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 claims description 3
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- YDSOJJUBCARCDS-UHFFFAOYSA-N ethyl 2-[(7-imidazol-1-yl-5,6-dihydronaphthalen-2-yl)oxy]-2-methylpropanoate Chemical compound C=1C2=CC(OC(C)(C)C(=O)OCC)=CC=C2CCC=1N1C=CN=C1 YDSOJJUBCARCDS-UHFFFAOYSA-N 0.000 claims description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 2
- VVFFIGADLXLSFZ-UHFFFAOYSA-N 2-imidazol-1-yl-7-methoxy-1,2,3,4-tetrahydronaphthalen-1-ol Chemical compound OC1C2=CC(OC)=CC=C2CCC1N1C=CN=C1 VVFFIGADLXLSFZ-UHFFFAOYSA-N 0.000 claims 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims 3
- MTUOBMXOZSBCGV-UHFFFAOYSA-N 8-hydroxy-7-imidazol-1-yl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid Chemical compound C1CC2=CC=C(C(O)=O)C=C2C(O)C1N1C=CN=C1 MTUOBMXOZSBCGV-UHFFFAOYSA-N 0.000 claims 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 2
- XXSPGBOGLXKMDU-UHFFFAOYSA-N 2-bromo-2-methylpropanoic acid Chemical compound CC(C)(Br)C(O)=O XXSPGBOGLXKMDU-UHFFFAOYSA-N 0.000 claims 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 claims 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- IOLQWGVDEFWYNP-UHFFFAOYSA-N ethyl 2-bromo-2-methylpropanoate Chemical compound CCOC(=O)C(C)(C)Br IOLQWGVDEFWYNP-UHFFFAOYSA-N 0.000 claims 1
- QJQYPZZUKLQGGT-UHFFFAOYSA-N methyl hypobromite Chemical group COBr QJQYPZZUKLQGGT-UHFFFAOYSA-N 0.000 claims 1
- DSNBHJFQCNUKMA-SCKDECHMSA-N thromboxane A2 Chemical compound OC(=O)CCC\C=C/C[C@@H]1[C@@H](/C=C/[C@@H](O)CCCCC)O[C@@H]2O[C@H]1C2 DSNBHJFQCNUKMA-SCKDECHMSA-N 0.000 abstract description 24
- 230000015572 biosynthetic process Effects 0.000 abstract description 15
- 238000003786 synthesis reaction Methods 0.000 abstract description 12
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N indane Chemical compound C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 abstract description 6
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical compound C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 abstract description 5
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 4
- KYNSBQPICQTCGU-UHFFFAOYSA-N Benzopyrane Chemical compound C1=CC=C2C=CCOC2=C1 KYNSBQPICQTCGU-UHFFFAOYSA-N 0.000 abstract description 3
- 229940124639 Selective inhibitor Drugs 0.000 abstract description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 abstract description 3
- KEIFWROAQVVDBN-UHFFFAOYSA-N 1,2-dihydronaphthalene Chemical compound C1=CC=C2C=CCCC2=C1 KEIFWROAQVVDBN-UHFFFAOYSA-N 0.000 abstract description 2
- 230000000055 hyoplipidemic effect Effects 0.000 abstract description 2
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 144
- 235000013350 formula milk Nutrition 0.000 description 95
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 50
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 35
- 239000002904 solvent Substances 0.000 description 33
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 30
- 238000006243 chemical reaction Methods 0.000 description 29
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 26
- 229940075566 naphthalene Drugs 0.000 description 23
- 238000011282 treatment Methods 0.000 description 20
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 19
- 239000000243 solution Substances 0.000 description 19
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 17
- 238000000921 elemental analysis Methods 0.000 description 17
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 14
- 230000000694 effects Effects 0.000 description 13
- 238000004458 analytical method Methods 0.000 description 12
- 235000019441 ethanol Nutrition 0.000 description 12
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 12
- 238000010992 reflux Methods 0.000 description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- YZXBAPSDXZZRGB-DOFZRALJSA-N arachidonic acid Chemical compound CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(O)=O YZXBAPSDXZZRGB-DOFZRALJSA-N 0.000 description 10
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 10
- 210000002966 serum Anatomy 0.000 description 10
- 101150041968 CDC13 gene Proteins 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 125000002883 imidazolyl group Chemical group 0.000 description 9
- KAQKFAOMNZTLHT-OZUDYXHBSA-N prostaglandin I2 Chemical compound O1\C(=C/CCCC(O)=O)C[C@@H]2[C@@H](/C=C/[C@@H](O)CCCCC)[C@H](O)C[C@@H]21 KAQKFAOMNZTLHT-OZUDYXHBSA-N 0.000 description 9
- 230000002829 reductive effect Effects 0.000 description 9
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 8
- 101000862089 Clarkia lewisii Glucose-6-phosphate isomerase, cytosolic 1A Proteins 0.000 description 8
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 8
- 229940074995 bromine Drugs 0.000 description 8
- 229910052794 bromium Inorganic materials 0.000 description 8
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 8
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 7
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 125000002252 acyl group Chemical group 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 7
- 235000012000 cholesterol Nutrition 0.000 description 7
- 230000000875 corresponding effect Effects 0.000 description 7
- 125000006239 protecting group Chemical group 0.000 description 7
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- 102000003960 Ligases Human genes 0.000 description 6
- 108090000364 Ligases Proteins 0.000 description 6
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 6
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- QTMDXZNDVAMKGV-UHFFFAOYSA-L copper(ii) bromide Chemical compound [Cu+2].[Br-].[Br-] QTMDXZNDVAMKGV-UHFFFAOYSA-L 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 6
- 125000005843 halogen group Chemical group 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 229940114079 arachidonic acid Drugs 0.000 description 5
- 235000021342 arachidonic acid Nutrition 0.000 description 5
- 238000000338 in vitro Methods 0.000 description 5
- 239000003112 inhibitor Substances 0.000 description 5
- 230000035484 reaction time Effects 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- 102000008186 Collagen Human genes 0.000 description 4
- 108010035532 Collagen Proteins 0.000 description 4
- 229920002261 Corn starch Polymers 0.000 description 4
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- 229920002472 Starch Polymers 0.000 description 4
- 238000005903 acid hydrolysis reaction Methods 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 150000001299 aldehydes Chemical class 0.000 description 4
- 150000001340 alkali metals Chemical class 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 229920001436 collagen Polymers 0.000 description 4
- 239000008120 corn starch Substances 0.000 description 4
- 230000007423 decrease Effects 0.000 description 4
- 229960004132 diethyl ether Drugs 0.000 description 4
- SIPUZPBQZHNSDW-UHFFFAOYSA-N diisobutylaluminium hydride Substances CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 4
- 235000019698 starch Nutrition 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 150000003626 triacylglycerols Chemical class 0.000 description 4
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical class C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 3
- CRAMMDHXKKDBIB-UHFFFAOYSA-N 1-(7-methoxy-3,4-dihydronaphthalen-2-yl)imidazole Chemical compound C=1C2=CC(OC)=CC=C2CCC=1N1C=CN=C1 CRAMMDHXKKDBIB-UHFFFAOYSA-N 0.000 description 3
- HJNWDTQJCFSHPP-UHFFFAOYSA-N 2-imidazol-1-yl-1h-indene-5-carboxylic acid Chemical compound C=1C2=CC(C(=O)O)=CC=C2CC=1N1C=CN=C1 HJNWDTQJCFSHPP-UHFFFAOYSA-N 0.000 description 3
- APPBPUKXEANXCJ-UHFFFAOYSA-N 6-imidazol-1-yl-7,8-dihydronaphthalene-1-carboxylic acid Chemical compound C1CC=2C(C(=O)O)=CC=CC=2C=C1N1C=CN=C1 APPBPUKXEANXCJ-UHFFFAOYSA-N 0.000 description 3
- 201000001320 Atherosclerosis Diseases 0.000 description 3
- 229910021590 Copper(II) bromide Inorganic materials 0.000 description 3
- 206010020772 Hypertension Diseases 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229930006000 Sucrose Natural products 0.000 description 3
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 3
- 208000007536 Thrombosis Diseases 0.000 description 3
- 206010047139 Vasoconstriction Diseases 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 235000005911 diet Nutrition 0.000 description 3
- 230000037213 diet Effects 0.000 description 3
- 235000013681 dietary sucrose Nutrition 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 125000004185 ester group Chemical group 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Substances [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 238000012261 overproduction Methods 0.000 description 3
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 3
- 210000002381 plasma Anatomy 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 150000003180 prostaglandins Chemical class 0.000 description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 3
- 238000006722 reduction reaction Methods 0.000 description 3
- 235000015424 sodium Nutrition 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 229940032147 starch Drugs 0.000 description 3
- 229960004793 sucrose Drugs 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- 238000002560 therapeutic procedure Methods 0.000 description 3
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 3
- 229940086542 triethylamine Drugs 0.000 description 3
- 230000025033 vasoconstriction Effects 0.000 description 3
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 2
- WRMDZKWCUFEOTK-UHFFFAOYSA-N (7-imidazol-1-yl-5,6-dihydronaphthalen-2-yl)methanol Chemical compound C=1C2=CC(CO)=CC=C2CCC=1N1C=CN=C1 WRMDZKWCUFEOTK-UHFFFAOYSA-N 0.000 description 2
- RAIOHQDCXSHSDF-UHFFFAOYSA-N 1-(1,2,3,4-tetrahydronaphthalen-2-yl)imidazole Chemical compound C1CC2=CC=CC=C2CC1N1C=CN=C1 RAIOHQDCXSHSDF-UHFFFAOYSA-N 0.000 description 2
- QCYNUFZLGCZBFL-UHFFFAOYSA-N 1-(5-methoxy-3,4-dihydronaphthalen-2-yl)imidazole Chemical compound C1CC=2C(OC)=CC=CC=2C=C1N1C=CN=C1 QCYNUFZLGCZBFL-UHFFFAOYSA-N 0.000 description 2
- IVPAQQLAILLFOT-UHFFFAOYSA-N 1-(6-methoxy-2h-chromen-3-yl)imidazole Chemical compound C=1C2=CC(OC)=CC=C2OCC=1N1C=CN=C1 IVPAQQLAILLFOT-UHFFFAOYSA-N 0.000 description 2
- MQEMKMXSOMLZBI-UHFFFAOYSA-N 1-(6-methoxy-3,4-dihydronaphthalen-2-yl)imidazole Chemical compound C1CC2=CC(OC)=CC=C2C=C1N1C=CN=C1 MQEMKMXSOMLZBI-UHFFFAOYSA-N 0.000 description 2
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 2
- RZPFVRFSYMUDJO-UHFFFAOYSA-N 2h-naphthalen-1-one Chemical compound C1=CC=C2C(=O)CC=CC2=C1 RZPFVRFSYMUDJO-UHFFFAOYSA-N 0.000 description 2
- LMXCVIOUGIVOIA-UHFFFAOYSA-N 3-(3-imidazol-1-yl-2-methyl-2h-chromen-6-yl)prop-2-enoic acid Chemical compound CC1OC2=CC=C(C=CC(O)=O)C=C2C=C1N1C=CN=C1 LMXCVIOUGIVOIA-UHFFFAOYSA-N 0.000 description 2
- OFIWLPONOIDMRO-UHFFFAOYSA-N 3-imidazol-1-yl-2-methyl-2h-chromene-6-carboxylic acid Chemical compound CC1OC2=CC=C(C(O)=O)C=C2C=C1N1C=CN=C1 OFIWLPONOIDMRO-UHFFFAOYSA-N 0.000 description 2
- GIHHIFXJQAXAFH-UHFFFAOYSA-N 3-imidazol-1-yl-2-methyl-2h-chromene-7-carboxylic acid Chemical compound CC1OC2=CC(C(O)=O)=CC=C2C=C1N1C=CN=C1 GIHHIFXJQAXAFH-UHFFFAOYSA-N 0.000 description 2
- CEOXHWRGSADPJO-UHFFFAOYSA-N 3-tert-butyl-6-imidazol-1-yl-7,8-dihydronaphthalen-2-ol Chemical compound C1CC=2C=C(O)C(C(C)(C)C)=CC=2C=C1N1C=CN=C1 CEOXHWRGSADPJO-UHFFFAOYSA-N 0.000 description 2
- FMCUUGMWUKGYRJ-UHFFFAOYSA-N 6-chloro-3-imidazol-1-yl-2,3-dihydrochromen-4-one Chemical compound O=C1C2=CC(Cl)=CC=C2OCC1N1C=CN=C1 FMCUUGMWUKGYRJ-UHFFFAOYSA-N 0.000 description 2
- ZDSBZDKEOGSOHL-UHFFFAOYSA-N 6-chloro-3-imidazol-1-yl-3,4-dihydro-2h-chromen-4-ol Chemical compound C1OC2=CC=C(Cl)C=C2C(O)C1N1C=CN=C1 ZDSBZDKEOGSOHL-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- 206010002383 Angina Pectoris Diseases 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 2
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 238000006546 Horner-Wadsworth-Emmons reaction Methods 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- WSMYVTOQOOLQHP-UHFFFAOYSA-N Malondialdehyde Chemical compound O=CCC=O WSMYVTOQOOLQHP-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 208000019695 Migraine disease Diseases 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- 229910017974 NH40H Inorganic materials 0.000 description 2
- VPXZTLZPRKZBOL-UHFFFAOYSA-N N[AlH]N Chemical class N[AlH]N VPXZTLZPRKZBOL-UHFFFAOYSA-N 0.000 description 2
- 241000283973 Oryctolagus cuniculus Species 0.000 description 2
- 241000786363 Rhampholeon spectrum Species 0.000 description 2
- 229910006124 SOCl2 Inorganic materials 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 235000010443 alginic acid Nutrition 0.000 description 2
- 229920000615 alginic acid Polymers 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 230000002744 anti-aggregatory effect Effects 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 235000001465 calcium Nutrition 0.000 description 2
- 229960005069 calcium Drugs 0.000 description 2
- 235000010418 carrageenan Nutrition 0.000 description 2
- 229920001525 carrageenan Polymers 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- WRJWRGBVPUUDLA-UHFFFAOYSA-N chlorosulfonyl isocyanate Chemical compound ClS(=O)(=O)N=C=O WRJWRGBVPUUDLA-UHFFFAOYSA-N 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 206010012601 diabetes mellitus Diseases 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 229960001031 glucose Drugs 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000023597 hemostasis Effects 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 238000010253 intravenous injection Methods 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 235000010445 lecithin Nutrition 0.000 description 2
- 239000000787 lecithin Substances 0.000 description 2
- 229940067606 lecithin Drugs 0.000 description 2
- 150000002632 lipids Chemical class 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 229940118019 malondialdehyde Drugs 0.000 description 2
- 230000004060 metabolic process Effects 0.000 description 2
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- 229960002900 methylcellulose Drugs 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 206010027599 migraine Diseases 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 230000008506 pathogenesis Effects 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 210000004623 platelet-rich plasma Anatomy 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 102000004196 processed proteins & peptides Human genes 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 2
- 108010064377 prostacyclin synthetase Proteins 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 2
- 239000008279 sol Substances 0.000 description 2
- 238000007619 statistical method Methods 0.000 description 2
- 239000008223 sterile water Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 210000002784 stomach Anatomy 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 230000002792 vascular Effects 0.000 description 2
- 230000000304 vasodilatating effect Effects 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 description 1
- CTWUNVCSQARVEA-UHFFFAOYSA-N 1,2,3,4-tetrahydronaphthalene Chemical compound C1=C=C[C]2CCCCC2=C1 CTWUNVCSQARVEA-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- OFNHWPIMMBBASA-UHFFFAOYSA-N 1-(2-methyl-2h-chromen-3-yl)imidazole Chemical compound CC1OC2=CC=CC=C2C=C1N1C=CN=C1 OFNHWPIMMBBASA-UHFFFAOYSA-N 0.000 description 1
- CFYUQXNGWZNTQA-UHFFFAOYSA-N 1-(2-propan-2-ylphenyl)imidazole Chemical class CC(C)C1=CC=CC=C1N1C=NC=C1 CFYUQXNGWZNTQA-UHFFFAOYSA-N 0.000 description 1
- ZNTZYZTUMRXBMY-UHFFFAOYSA-N 1-(2h-chromen-3-yl)imidazole Chemical compound C1OC2=CC=CC=C2C=C1N1C=CN=C1 ZNTZYZTUMRXBMY-UHFFFAOYSA-N 0.000 description 1
- DHUCLDOIXQGVDQ-UHFFFAOYSA-N 1-(3,4-dihydronaphthalen-2-yl)imidazole Chemical compound C1CC2=CC=CC=C2C=C1N1C=CN=C1 DHUCLDOIXQGVDQ-UHFFFAOYSA-N 0.000 description 1
- MROWQRSJGJBKPW-UHFFFAOYSA-N 1-(5-methoxy-1h-inden-2-yl)imidazole Chemical compound C=1C2=CC(OC)=CC=C2CC=1N1C=CN=C1 MROWQRSJGJBKPW-UHFFFAOYSA-N 0.000 description 1
- JZSHLKQIFFKSJF-UHFFFAOYSA-N 1-(6-bromo-3,4-dihydronaphthalen-2-yl)imidazole Chemical compound C1CC2=CC(Br)=CC=C2C=C1N1C=CN=C1 JZSHLKQIFFKSJF-UHFFFAOYSA-N 0.000 description 1
- NFLGDNYMXYMYPC-UHFFFAOYSA-N 1-(6-bromo-7-methoxy-3,4-dihydronaphthalen-2-yl)imidazole Chemical compound C1CC=2C=C(Br)C(OC)=CC=2C=C1N1C=CN=C1 NFLGDNYMXYMYPC-UHFFFAOYSA-N 0.000 description 1
- VRPFRBMPFHPSSX-UHFFFAOYSA-N 1-(6-chloro-2h-chromen-3-yl)imidazole Chemical compound C=1C2=CC(Cl)=CC=C2OCC=1N1C=CN=C1 VRPFRBMPFHPSSX-UHFFFAOYSA-N 0.000 description 1
- ZPEJLBFXQCBDGK-UHFFFAOYSA-N 1-(6-methoxy-2-methyl-2h-chromen-3-yl)imidazole Chemical compound C=1C2=CC(OC)=CC=C2OC(C)C=1N1C=CN=C1 ZPEJLBFXQCBDGK-UHFFFAOYSA-N 0.000 description 1
- HNFTVJORZUDJMW-UHFFFAOYSA-N 1-(6-methoxy-3,4-dihydro-2h-chromen-3-yl)imidazole Chemical compound C1C2=CC(OC)=CC=C2OCC1N1C=CN=C1 HNFTVJORZUDJMW-UHFFFAOYSA-N 0.000 description 1
- MQSABNQTUJJOKD-UHFFFAOYSA-N 1-(7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)imidazole Chemical compound C1C2=CC(OC)=CC=C2CCC1N1C=CN=C1 MQSABNQTUJJOKD-UHFFFAOYSA-N 0.000 description 1
- DLOPSCACWWJZRV-UHFFFAOYSA-N 1-(7-methoxy-3,4-dihydronaphthalen-2-yl)imidazole;hydrochloride Chemical compound Cl.C=1C2=CC(OC)=CC=C2CCC=1N1C=CN=C1 DLOPSCACWWJZRV-UHFFFAOYSA-N 0.000 description 1
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- LNETULKMXZVUST-UHFFFAOYSA-N 1-naphthoic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1 LNETULKMXZVUST-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- NKXDNHJMERZZMP-UHFFFAOYSA-N 2-[(2-imidazol-1-yl-2,3-dihydro-1h-inden-5-yl)oxy]acetic acid Chemical compound C1C2=CC(OCC(=O)O)=CC=C2CC1N1C=CN=C1 NKXDNHJMERZZMP-UHFFFAOYSA-N 0.000 description 1
- VIVDZIPZPLHLPZ-UHFFFAOYSA-N 2-[(7-imidazol-1-yl-5,6-dihydronaphthalen-2-yl)oxy]acetic acid Chemical compound C=1C2=CC(OCC(=O)O)=CC=C2CCC=1N1C=CN=C1 VIVDZIPZPLHLPZ-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- KNCZETSBRBRXLF-UHFFFAOYSA-N 2-cyclopropyl-3-imidazol-1-yl-2h-chromene-6-carboxylic acid Chemical compound C1=CN=CN1C1=CC2=CC(C(=O)O)=CC=C2OC1C1CC1 KNCZETSBRBRXLF-UHFFFAOYSA-N 0.000 description 1
- ZAGQVVNCFZAQJT-UHFFFAOYSA-N 2-imidazol-1-yl-2,3-dihydro-1h-indene-5-carboxylic acid Chemical compound C1C2=CC(C(=O)O)=CC=C2CC1N1C=CN=C1 ZAGQVVNCFZAQJT-UHFFFAOYSA-N 0.000 description 1
- YJKMDICXRKMSFW-UHFFFAOYSA-N 2-imidazol-1-yl-7-methoxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1C2=CC(OC)=CC=C2CCC1N1C=CN=C1 YJKMDICXRKMSFW-UHFFFAOYSA-N 0.000 description 1
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 1
- COADDVBGAOHHFJ-UHFFFAOYSA-N 3-(2-imidazol-1-yl-1h-inden-5-yl)prop-2-enoic acid Chemical compound C=1C2=CC(C=CC(=O)O)=CC=C2CC=1N1C=CN=C1 COADDVBGAOHHFJ-UHFFFAOYSA-N 0.000 description 1
- KWUUGBJNTORPCV-UHFFFAOYSA-N 3-(3-imidazol-1-yl-2-methyl-3,4-dihydro-2h-chromen-6-yl)prop-2-enoic acid Chemical compound CC1OC2=CC=C(C=CC(O)=O)C=C2CC1N1C=CN=C1 KWUUGBJNTORPCV-UHFFFAOYSA-N 0.000 description 1
- CEHDFUSNZLYWHF-UHFFFAOYSA-N 3-(3-imidazol-1-yl-2h-chromen-6-yl)prop-2-enoic acid Chemical compound C=1C2=CC(C=CC(=O)O)=CC=C2OCC=1N1C=CN=C1 CEHDFUSNZLYWHF-UHFFFAOYSA-N 0.000 description 1
- LHUPTKLHJBGAPA-UHFFFAOYSA-N 3-(7-imidazol-1-yl-5,6,7,8-tetrahydronaphthalen-2-yl)prop-2-enoic acid Chemical compound C1C2=CC(C=CC(=O)O)=CC=C2CCC1N1C=CN=C1 LHUPTKLHJBGAPA-UHFFFAOYSA-N 0.000 description 1
- QEWXZYAUMLAMPW-UHFFFAOYSA-N 3-(7-imidazol-1-yl-5,6-dihydronaphthalen-2-yl)prop-2-enoic acid Chemical compound C=1C2=CC(C=CC(=O)O)=CC=C2CCC=1N1C=CN=C1 QEWXZYAUMLAMPW-UHFFFAOYSA-N 0.000 description 1
- IERYATJRJNUQAX-UHFFFAOYSA-N 3-hydroxy-6-imidazol-1-yl-7,8-dihydronaphthalene-2-carboxylic acid Chemical compound C=1C=2C=C(O)C(C(=O)O)=CC=2CCC=1N1C=CN=C1 IERYATJRJNUQAX-UHFFFAOYSA-N 0.000 description 1
- GSPMNVZMXOFVJY-UHFFFAOYSA-N 3-imidazol-1-yl-2-methyl-2h-chromen-6-ol Chemical compound CC1OC2=CC=C(O)C=C2C=C1N1C=CN=C1 GSPMNVZMXOFVJY-UHFFFAOYSA-N 0.000 description 1
- PDUGFBHOIRYMLN-UHFFFAOYSA-N 3-imidazol-1-yl-2-propan-2-yl-2h-chromene-6-carboxylic acid Chemical compound CC(C)C1OC2=CC=C(C(O)=O)C=C2C=C1N1C=CN=C1 PDUGFBHOIRYMLN-UHFFFAOYSA-N 0.000 description 1
- XWSLXCYRXGBMCW-UHFFFAOYSA-N 3-imidazol-1-yl-2-pyridin-3-yl-2h-chromene-6-carboxylic acid Chemical compound C=1C2=CC(C(=O)O)=CC=C2OC(C=2C=NC=CC=2)C=1N1C=CN=C1 XWSLXCYRXGBMCW-UHFFFAOYSA-N 0.000 description 1
- ALFMWQNLXCPSLV-UHFFFAOYSA-N 3-imidazol-1-yl-2h-chromen-6-ol Chemical compound C=1C2=CC(O)=CC=C2OCC=1N1C=CN=C1 ALFMWQNLXCPSLV-UHFFFAOYSA-N 0.000 description 1
- GJBUEKZGWCKKDD-UHFFFAOYSA-N 3-imidazol-1-yl-2h-chromene-6-carboxylic acid Chemical compound C=1C2=CC(C(=O)O)=CC=C2OCC=1N1C=CN=C1 GJBUEKZGWCKKDD-UHFFFAOYSA-N 0.000 description 1
- FQDIVKBGDLPJIA-UHFFFAOYSA-N 3-imidazol-1-yl-3,4-dihydro-2h-chromene-6-carboxylic acid Chemical compound C1C2=CC(C(=O)O)=CC=C2OCC1N1C=CN=C1 FQDIVKBGDLPJIA-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- LLTDYHFVIVSQPJ-UHFFFAOYSA-N 6-chloro-2,3-dihydrochromen-4-one Chemical compound O1CCC(=O)C2=CC(Cl)=CC=C21 LLTDYHFVIVSQPJ-UHFFFAOYSA-N 0.000 description 1
- FJVRBJBZDWTUKQ-UHFFFAOYSA-N 6-imidazol-1-yl-7,8-dihydronaphthalene-2-carbonitrile Chemical compound C1CC2=CC(C#N)=CC=C2C=C1N1C=CN=C1 FJVRBJBZDWTUKQ-UHFFFAOYSA-N 0.000 description 1
- LUUULRLWYJEWOZ-UHFFFAOYSA-N 6-imidazol-1-yl-7,8-dihydronaphthalene-2-carboxylic acid Chemical compound C1CC2=CC(C(=O)O)=CC=C2C=C1N1C=CN=C1 LUUULRLWYJEWOZ-UHFFFAOYSA-N 0.000 description 1
- LKQTVBDJBXJHCA-UHFFFAOYSA-N 7-imidazol-1-yl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid;hydrochloride Chemical compound Cl.C1C2=CC(C(=O)O)=CC=C2CCC1N1C=CN=C1 LKQTVBDJBXJHCA-UHFFFAOYSA-N 0.000 description 1
- GGEAYUIEJNPPOU-UHFFFAOYSA-N 7-imidazol-1-yl-5,6-dihydronaphthalene-1-carboxamide Chemical compound C=1C=2C(C(=O)N)=CC=CC=2CCC=1N1C=CN=C1 GGEAYUIEJNPPOU-UHFFFAOYSA-N 0.000 description 1
- XGVXOHMLRRNEEO-UHFFFAOYSA-N 7-imidazol-1-yl-5,6-dihydronaphthalene-1-carboxylic acid Chemical compound C=1C=2C(C(=O)O)=CC=CC=2CCC=1N1C=CN=C1 XGVXOHMLRRNEEO-UHFFFAOYSA-N 0.000 description 1
- HXYNRJYOQMKMPK-UHFFFAOYSA-N 7-imidazol-1-yl-8-oxo-6,7-dihydro-5h-naphthalene-2-carboxylic acid Chemical compound O=C1C2=CC(C(=O)O)=CC=C2CCC1N1C=CN=C1 HXYNRJYOQMKMPK-UHFFFAOYSA-N 0.000 description 1
- NZBNORDTBKGVQM-UHFFFAOYSA-N 8-oxo-6,7-dihydro-5h-naphthalene-2-carboxylic acid Chemical compound C1CCC(=O)C2=CC(C(=O)O)=CC=C21 NZBNORDTBKGVQM-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 229910000497 Amalgam Inorganic materials 0.000 description 1
- 200000000007 Arterial disease Diseases 0.000 description 1
- 238000000846 Bartlett's test Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- YXNNSWYDFRWCBQ-UHFFFAOYSA-N C(C)(=O)O.P(O)(O)=O Chemical compound C(C)(=O)O.P(O)(O)=O YXNNSWYDFRWCBQ-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 206010054044 Diabetic microangiopathy Diseases 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 238000001061 Dunnett's test Methods 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 206010018691 Granuloma Diseases 0.000 description 1
- 206010019233 Headaches Diseases 0.000 description 1
- 208000032843 Hemorrhage Diseases 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 229910010082 LiAlH Inorganic materials 0.000 description 1
- 229910010084 LiAlH4 Inorganic materials 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical class ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- YHUNOQHBJREGAE-UHFFFAOYSA-N O=C1C(C=CC2=CC=CC=C12)C(=O)O Chemical compound O=C1C(C=CC2=CC=CC=C12)C(=O)O YHUNOQHBJREGAE-UHFFFAOYSA-N 0.000 description 1
- 208000001132 Osteoporosis Diseases 0.000 description 1
- 229910019213 POCl3 Inorganic materials 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 208000008469 Peptic Ulcer Diseases 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 201000001068 Prinzmetal angina Diseases 0.000 description 1
- 229910019020 PtO2 Inorganic materials 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 241000219061 Rheum Species 0.000 description 1
- 238000006280 Rosenmund reaction Methods 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- 244000299461 Theobroma cacao Species 0.000 description 1
- 235000009470 Theobroma cacao Nutrition 0.000 description 1
- 208000025865 Ulcer Diseases 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 208000009325 Variant Angina Pectoris Diseases 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- HSKKWGIPDGZJBL-UHFFFAOYSA-N [PH5].CC(O)=O Chemical compound [PH5].CC(O)=O HSKKWGIPDGZJBL-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 229940023476 agar Drugs 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- QGLZXHRNAYXIBU-WEVVVXLNSA-N aldicarb Chemical compound CNC(=O)O\N=C\C(C)(C)SC QGLZXHRNAYXIBU-WEVVVXLNSA-N 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005079 alkoxycarbonylmethyl group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N alpha-methyl toluene Natural products CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 1
- 229910000091 aluminium hydride Inorganic materials 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000000879 anti-atherosclerotic effect Effects 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 230000000259 anti-tumor effect Effects 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 210000001367 artery Anatomy 0.000 description 1
- 208000028922 artery disease Diseases 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- AEMOLEFTQBMNLQ-DTEWXJGMSA-N beta-D-galacturonic acid Chemical compound O[C@@H]1O[C@H](C(O)=O)[C@H](O)[C@H](O)[C@H]1O AEMOLEFTQBMNLQ-DTEWXJGMSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- AZWXAPCAJCYGIA-UHFFFAOYSA-N bis(2-methylpropyl)alumane Chemical compound CC(C)C[AlH]CC(C)C AZWXAPCAJCYGIA-UHFFFAOYSA-N 0.000 description 1
- DCRYRRSMQNVZCL-UHFFFAOYSA-N bis(4-methylpiperazin-1-yl)alumane Chemical compound C1CN(C)CCN1[AlH]N1CCN(C)CC1 DCRYRRSMQNVZCL-UHFFFAOYSA-N 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 230000036770 blood supply Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910010277 boron hydride Inorganic materials 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 235000014121 butter Nutrition 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Substances ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 229960001701 chloroform Drugs 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000004891 communication Methods 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000002596 correlated effect Effects 0.000 description 1
- WZHCOOQXZCIUNC-UHFFFAOYSA-N cyclandelate Chemical compound C1C(C)(C)CC(C)CC1OC(=O)C(O)C1=CC=CC=C1 WZHCOOQXZCIUNC-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 201000009101 diabetic angiopathy Diseases 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- FPAFDBFIGPHWGO-UHFFFAOYSA-N dioxosilane;oxomagnesium;hydrate Chemical compound O.[Mg]=O.[Mg]=O.[Mg]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O FPAFDBFIGPHWGO-UHFFFAOYSA-N 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- MWEQTWJABOLLOS-UHFFFAOYSA-L disodium;[[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-oxidophosphoryl] hydrogen phosphate;trihydrate Chemical compound O.O.O.[Na+].[Na+].C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP([O-])(=O)OP(O)([O-])=O)C(O)C1O MWEQTWJABOLLOS-UHFFFAOYSA-L 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical class CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000007876 drug discovery Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 210000002889 endothelial cell Anatomy 0.000 description 1
- 229960001123 epoprostenol Drugs 0.000 description 1
- YQWPRSDFGFHKQQ-UHFFFAOYSA-N ethyl 2-[(7-imidazol-1-yl-5,6-dihydronaphthalen-2-yl)oxy]acetate Chemical compound C=1C2=CC(OCC(=O)OCC)=CC=C2CCC=1N1C=CN=C1 YQWPRSDFGFHKQQ-UHFFFAOYSA-N 0.000 description 1
- FXXFLIOCTHZELS-UHFFFAOYSA-N ethyl 3-(7-imidazol-1-yl-5,6-dihydronaphthalen-2-yl)prop-2-enoate Chemical compound C=1C2=CC(C=CC(=O)OCC)=CC=C2CCC=1N1C=CN=C1 FXXFLIOCTHZELS-UHFFFAOYSA-N 0.000 description 1
- PHYFLYXCOVWIAK-UHFFFAOYSA-N ethyl 3-imidazol-1-yl-2-methyl-2h-chromene-6-carboxylate Chemical compound C=1C2=CC(C(=O)OCC)=CC=C2OC(C)C=1N1C=CN=C1 PHYFLYXCOVWIAK-UHFFFAOYSA-N 0.000 description 1
- HUZBRJVXYZZTRG-UHFFFAOYSA-N ethyl 7-imidazol-1-yl-5,6-dihydronaphthalene-2-carboxylate Chemical compound C=1C2=CC(C(=O)OCC)=CC=C2CCC=1N1C=CN=C1 HUZBRJVXYZZTRG-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- 229940035423 ethyl ether Drugs 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000013401 experimental design Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000007888 film coating Substances 0.000 description 1
- 238000009501 film coating Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-N formic acid Substances OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 238000003304 gavage Methods 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 231100000869 headache Toxicity 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 125000001145 hydrido group Chemical group *[H] 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical group O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 1
- 230000000260 hypercholesteremic effect Effects 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000000302 ischemic effect Effects 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 229960001375 lactose Drugs 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 229960004393 lidocaine hydrochloride Drugs 0.000 description 1
- YECIFGHRMFEPJK-UHFFFAOYSA-N lidocaine hydrochloride monohydrate Chemical compound O.[Cl-].CC[NH+](CC)CC(=O)NC1=C(C)C=CC=C1C YECIFGHRMFEPJK-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- HTBVGZAVHBZXMS-UHFFFAOYSA-N lithium;tris[(2-methylpropan-2-yl)oxy]alumane Chemical compound [Li].[Al+3].CC(C)(C)[O-].CC(C)(C)[O-].CC(C)(C)[O-] HTBVGZAVHBZXMS-UHFFFAOYSA-N 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 239000002207 metabolite Substances 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- JGOAZQAXRONCCI-UHFFFAOYSA-N n-(benzylideneamino)aniline Chemical compound C=1C=CC=CC=1NN=CC1=CC=CC=C1 JGOAZQAXRONCCI-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 229940099990 ogen Drugs 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N p-toluenesulfonyl chloride Substances CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229960000292 pectin Drugs 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229940068917 polyethylene glycols Drugs 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 208000001685 postmenopausal osteoporosis Diseases 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229940093956 potassium carbonate Drugs 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 230000000328 pro-aggregatory effect Effects 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000000197 pyrolysis Methods 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical group 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 239000012048 reactive intermediate Substances 0.000 description 1
- 230000000306 recurrent effect Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- IOVGROKTTNBUGK-SJCJKPOMSA-N ritodrine Chemical compound N([C@@H](C)[C@H](O)C=1C=CC(O)=CC=1)CCC1=CC=C(O)C=C1 IOVGROKTTNBUGK-SJCJKPOMSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 150000003870 salicylic acids Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229940080313 sodium starch Drugs 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 235000000891 standard diet Nutrition 0.000 description 1
- 238000000528 statistical test Methods 0.000 description 1
- 230000002311 subsequent effect Effects 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 238000009495 sugar coating Methods 0.000 description 1
- QAHVHSLSRLSVGS-UHFFFAOYSA-N sulfamoyl chloride Chemical compound NS(Cl)(=O)=O QAHVHSLSRLSVGS-UHFFFAOYSA-N 0.000 description 1
- 150000003461 sulfonyl halides Chemical class 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 210000001179 synovial fluid Anatomy 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 125000005490 tosylate group Chemical group 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 230000001131 transforming effect Effects 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- DBGVGMSCBYYSLD-UHFFFAOYSA-N tributylstannane Chemical compound CCCC[SnH](CCCC)CCCC DBGVGMSCBYYSLD-UHFFFAOYSA-N 0.000 description 1
- DTQVDTLACAAQTR-DYCDLGHISA-N trifluoroacetic acid-d1 Chemical compound [2H]OC(=O)C(F)(F)F DTQVDTLACAAQTR-DYCDLGHISA-N 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000004614 tumor growth Effects 0.000 description 1
- 230000003639 vasoconstrictive effect Effects 0.000 description 1
- 239000005526 vasoconstrictor agent Substances 0.000 description 1
- 230000024883 vasodilation Effects 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/04—Drugs for disorders of the alimentary tract or the digestive system for ulcers, gastritis or reflux esophagitis, e.g. antacids, inhibitors of acid secretion, mucosal protectants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/04—Centrally acting analgesics, e.g. opioids
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/06—Antimigraine agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/06—Antihyperlipidemics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Engineering & Computer Science (AREA)
- Hematology (AREA)
- Heart & Thoracic Surgery (AREA)
- Cardiology (AREA)
- Pain & Pain Management (AREA)
- Diabetes (AREA)
- Biomedical Technology (AREA)
- Obesity (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Vascular Medicine (AREA)
- Rheumatology (AREA)
- Urology & Nephrology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8219412 | 1982-07-05 | ||
| GB8219412 | 1982-07-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1202030A true CA1202030A (en) | 1986-03-18 |
Family
ID=10531484
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000431748A Expired CA1202030A (en) | 1982-07-05 | 1983-07-04 | N-imidazolyl derivatives of bicyclic compounds and process for their preparation |
Country Status (33)
| Country | Link |
|---|---|
| US (2) | US4510149A (enExample) |
| JP (1) | JPS5927874A (enExample) |
| KR (1) | KR910000414B1 (enExample) |
| AT (1) | AT386201B (enExample) |
| AU (1) | AU557304B2 (enExample) |
| BE (1) | BE897207A (enExample) |
| CA (1) | CA1202030A (enExample) |
| CH (1) | CH655102A5 (enExample) |
| CS (1) | CS273310B2 (enExample) |
| CZ (1) | CZ413491A3 (enExample) |
| DE (1) | DE3324069C2 (enExample) |
| DK (1) | DK163359C (enExample) |
| ES (1) | ES523609A0 (enExample) |
| FI (1) | FI74466C (enExample) |
| FR (1) | FR2529547B1 (enExample) |
| GR (1) | GR77577B (enExample) |
| HK (1) | HK101187A (enExample) |
| HU (1) | HU193529B (enExample) |
| IE (1) | IE55894B1 (enExample) |
| IL (1) | IL69152A0 (enExample) |
| IT (1) | IT1163641B (enExample) |
| LU (1) | LU84895A1 (enExample) |
| MY (1) | MY104376A (enExample) |
| NL (1) | NL8302347A (enExample) |
| NO (1) | NO161439C (enExample) |
| NZ (1) | NZ204802A (enExample) |
| PH (1) | PH21115A (enExample) |
| PT (1) | PT76979B (enExample) |
| SE (1) | SE461791B (enExample) |
| SG (1) | SG73487G (enExample) |
| SU (1) | SU1342414A3 (enExample) |
| YU (1) | YU43545B (enExample) |
| ZA (1) | ZA834865B (enExample) |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH062745B2 (ja) * | 1984-07-16 | 1994-01-12 | 第一製薬株式会社 | インダン誘導体 |
| PH22076A (en) * | 1983-08-25 | 1988-05-20 | Daiichi Seiyaku Co | Benzocycloalkane derivative |
| US4659730A (en) * | 1984-06-18 | 1987-04-21 | Eli Lilly And Company | Aromatase inhibiting imidazole derivatives |
| GB2167408B (en) * | 1984-11-23 | 1988-05-25 | Farmos Oy | Substituted imidazole derivatives and their preparation and use |
| GB8612796D0 (en) * | 1986-05-27 | 1986-07-02 | Fbc Ltd | Fungicides |
| GB2205240B (en) * | 1987-06-03 | 1991-01-09 | Erba Carlo Spa | N-imidazolyl derivatives of bicyclic compounds useful in medicine |
| US4992465A (en) * | 1988-09-27 | 1991-02-12 | Ciba-Geigy Corporation | 3-amino-dihydro-(1)-benzopyrans |
| IL91542A0 (en) * | 1988-10-06 | 1990-04-29 | Erba Carlo Spa | N-imidazolyl-and n-imidazolyl-methyl derivatives of substituted bicyclic compounds,their preparation and pharmaceutical compositions containing them |
| GB9025848D0 (en) * | 1990-11-28 | 1991-01-09 | Erba Carlo Spa | Imidazol-2-yl derivatives of substituted bicyclic compounds and process for their preparation |
| GB9102862D0 (en) * | 1991-02-11 | 1991-03-27 | Erba Carlo Spa | N-imidazolyl derivatives of substituted or alkoxymino tetrahydronaphthalenes and chromans |
| GB9127050D0 (en) * | 1991-12-20 | 1992-02-19 | Orion Yhtymae Oy | Substituted imidazole derivatives and their preparation and use |
| GB9127430D0 (en) * | 1991-12-27 | 1992-02-19 | Scras | Benzofuranylimidazole derivatives |
| US5837702A (en) * | 1993-10-07 | 1998-11-17 | Bristol-Myers Squibb Co. | 4-arylamino-benzopyran and related compounds |
| CA2182101C (en) * | 1994-01-31 | 1999-08-03 | Todd W. Butler | Neuroprotective compounds |
| US5559248A (en) * | 1995-04-05 | 1996-09-24 | Bristol-Myers Squibb Co. | Retinoid-like heterocycles |
| US5612323A (en) * | 1995-06-07 | 1997-03-18 | Bristol-Myers Squibb Company | Phosphinic ester substituted benzopyran derivatives |
| US5869478A (en) * | 1995-06-07 | 1999-02-09 | Bristol-Myers Squibb Company | Sulfonamido substituted benzopyran derivatives |
| US5612370A (en) * | 1995-06-07 | 1997-03-18 | Bristol-Myers Squibb Company | Phenylglycine and phenylalaninen amido benzopyran derivatives |
| US5629429A (en) * | 1995-06-07 | 1997-05-13 | Bristol-Myers Squibb Company | Process for preparing 4-arylamino-benzopyran and related compounds |
| GB9520150D0 (en) | 1995-10-03 | 1995-12-06 | Orion Yhtymae Oy | New imidazole derivatives |
| GC0000177A (en) * | 1998-12-17 | 2006-03-29 | Smithkline Beecham | Thrombopoietin mimetics |
| CY2010012I2 (el) * | 2000-05-25 | 2020-05-29 | Novartis Ag | Μιμητικα θρομβοποιητινης |
| US20110212054A1 (en) * | 2000-05-25 | 2011-09-01 | Glaxosmithkline Llc. | Thrombopoietin mimetics |
| DE10054639B4 (de) * | 2000-11-03 | 2004-05-06 | Jenapharm Gmbh & Co. Kg | Verwendung von RanBPM als Co-Modulator von Steroidhormonrezeptoren |
| JP2004527541A (ja) | 2001-03-01 | 2004-09-09 | スミスクライン・ビーチャム・コーポレイション | トロンボポエチン模倣物 |
| MY142390A (en) * | 2002-05-22 | 2010-11-30 | Glaxosmithkline Llc | 3' - [(2z)-[1-(3,4-dimethylphenyl)-1,5- dihydro-3- methyl-5-0xo-4h-pyrazol-4- ylidene]hydrazino]-2' -hydroxy -[1,1' -biphenyl]-3-carboxylic acid bis-(monoethanolamine) |
| WO2004092141A1 (en) * | 2003-04-16 | 2004-10-28 | Huntsman Advanced Materials (Switzerland) Gmbh | 1-imidazolymethyl-substituted-2-naphtols and their use as accelerators for low-temperature curing |
| TW200526638A (en) * | 2003-10-22 | 2005-08-16 | Smithkline Beecham Corp | 2-(3,4-dimethylphenyl)-4-{[2-hydroxy-3'-(1H-tetrazol-5-yl)biphenyl-3-yl]-hydrazono}-5-methyl-2,4-dihydropyrazol-3-one choline |
| US9271963B2 (en) * | 2005-03-03 | 2016-03-01 | Universitat Des Saarlandes | Selective inhibitors of human corticosteroid synthases |
| AU2007333904A1 (en) * | 2006-12-18 | 2008-06-26 | Novartis Ag | 1-substituted imidazole derivatives and their use as aldosterone synthase inhibitors |
| ECSP077628A (es) * | 2007-05-03 | 2008-12-30 | Smithkline Beechman Corp | Nueva composición farmacéutica |
| KR20120015355A (ko) | 2009-05-29 | 2012-02-21 | 글락소스미스클라인 엘엘씨 | 트롬보포이에틴 효능제 화합물의 투여 방법 |
| EP3177282B1 (en) * | 2014-08-08 | 2021-10-06 | Merck Sharp & Dohme Corp. | Antidiabetic bicyclic compounds |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2443671A (en) * | 1942-12-03 | 1948-06-22 | Westinghouse Electric Corp | Arc welding system |
| US3485917A (en) * | 1966-04-14 | 1969-12-23 | Janssen Pharmaceutica Nv | Composition and method for combating fungus with imidazole carboxylates |
| US3541109A (en) * | 1968-06-25 | 1970-11-17 | Du Pont | 1-substituted imidazoles useful in acth reserve assay |
| US3637731A (en) * | 1968-07-18 | 1972-01-25 | Du Pont | 1-(alkylsubstituted phenyl)imidazoles useful in acth reserve assay |
| IE40911B1 (en) * | 1974-04-11 | 1979-09-12 | Schering Ag | Imidazole derivatives and process for their manufacture |
| DE2418502C3 (de) * | 1974-04-11 | 1980-04-24 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Dichlorbenzyl- [2-( a -imidazolylbutyl)-phenyl] -äther und -thioäther, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel |
| US4284641A (en) * | 1977-08-26 | 1981-08-18 | Burroughs Wellcome Co. | Pharmaceutically active imidazole derivatives |
| JPS55313A (en) * | 1978-06-13 | 1980-01-05 | Kissei Pharmaceut Co Ltd | Imidazole derivative |
| JPS5681566A (en) * | 1979-12-05 | 1981-07-03 | Yoshitomi Pharmaceut Ind Ltd | Imidazole derivative |
| IE54936B1 (en) * | 1980-02-14 | 1990-03-28 | Sandoz Ltd | A method for the total synthesis of cyclosporins, novel cyclosporins and novel intermediates and methods for their production |
| ZA81980B (en) * | 1980-03-04 | 1982-02-24 | Erba Farmitalia | N-imidazolyl derivatives of 1-chroman and process for their preparation |
| US4342775A (en) * | 1980-03-04 | 1982-08-03 | Farmitalia Carlo Erba S.P.A. | 3-(1-Imidazolyl)-derivatives of 2,3-dihydro-4H-1-benzopyran |
| GB2071655B (en) * | 1980-03-04 | 1983-06-22 | Erba Farmitalia | N-amidazolyl derivatives of1-chroman and process for their preparation |
| IL66242A0 (en) * | 1981-07-23 | 1982-11-30 | Erba Farmitalia | N-imidazolyl derivatives of 1,2,3,4-tetrahydro-naphthalene,indan and 2-substituted-1-chroman,their preparation and pharmaceutical compositions containing them |
| ZA825142B (en) * | 1981-07-23 | 1983-04-27 | Erba Farmitalia | N-imidazolyl derivatives of 1,2,3,j-tetrahydro-naphthalene, indan and 2-substituted-1-chroman, and process for their preparation |
| ZA825413B (en) * | 1981-08-26 | 1983-06-29 | Pfizer | Thromboxane synthetase inhibitors, processes for their production, and pharmaceutical compositions comprising them |
| JPS6081566A (ja) * | 1983-10-07 | 1985-05-09 | Nissan Motor Co Ltd | ロツクアツプトルクコンバ−タのスリツプ制御装置 |
-
1983
- 1983-06-27 ES ES523609A patent/ES523609A0/es active Granted
- 1983-07-01 IT IT21886/83A patent/IT1163641B/it active
- 1983-07-01 FI FI832420A patent/FI74466C/fi not_active IP Right Cessation
- 1983-07-01 GR GR71829A patent/GR77577B/el unknown
- 1983-07-01 PH PH29170A patent/PH21115A/en unknown
- 1983-07-01 YU YU1442/83A patent/YU43545B/xx unknown
- 1983-07-01 NL NL8302347A patent/NL8302347A/nl not_active Application Discontinuation
- 1983-07-01 US US06/510,358 patent/US4510149A/en not_active Expired - Fee Related
- 1983-07-04 BE BE0/211113A patent/BE897207A/fr not_active IP Right Cessation
- 1983-07-04 HU HU832413A patent/HU193529B/hu not_active IP Right Cessation
- 1983-07-04 LU LU84895A patent/LU84895A1/fr unknown
- 1983-07-04 DK DK307983A patent/DK163359C/da not_active IP Right Cessation
- 1983-07-04 NO NO832437A patent/NO161439C/no unknown
- 1983-07-04 JP JP58120440A patent/JPS5927874A/ja active Granted
- 1983-07-04 PT PT76979A patent/PT76979B/pt unknown
- 1983-07-04 AU AU16540/83A patent/AU557304B2/en not_active Ceased
- 1983-07-04 FR FR8311098A patent/FR2529547B1/fr not_active Expired
- 1983-07-04 IE IE1564/83A patent/IE55894B1/en not_active IP Right Cessation
- 1983-07-04 ZA ZA834865A patent/ZA834865B/xx unknown
- 1983-07-04 SU SU833622805A patent/SU1342414A3/ru active
- 1983-07-04 CH CH3666/83A patent/CH655102A5/de not_active IP Right Cessation
- 1983-07-04 IL IL69152A patent/IL69152A0/xx not_active IP Right Cessation
- 1983-07-04 CA CA000431748A patent/CA1202030A/en not_active Expired
- 1983-07-04 DE DE3324069A patent/DE3324069C2/de not_active Expired - Fee Related
- 1983-07-04 NZ NZ204802A patent/NZ204802A/en unknown
- 1983-07-04 SE SE8303824A patent/SE461791B/sv not_active IP Right Cessation
- 1983-07-05 CS CS509483A patent/CS273310B2/cs unknown
- 1983-07-05 AT AT0247383A patent/AT386201B/de not_active IP Right Cessation
- 1983-07-05 KR KR1019830003067A patent/KR910000414B1/ko not_active Expired
-
1984
- 1984-11-21 US US06/673,722 patent/US4602022A/en not_active Expired - Fee Related
-
1987
- 1987-09-03 SG SG734/87A patent/SG73487G/en unknown
- 1987-12-31 HK HK1011/87A patent/HK101187A/xx unknown
-
1988
- 1988-12-30 MY MYPI88001593A patent/MY104376A/en unknown
-
1991
- 1991-12-30 CZ CS914134A patent/CZ413491A3/cs unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1202030A (en) | N-imidazolyl derivatives of bicyclic compounds and process for their preparation | |
| US5001240A (en) | Process for preparing optically active hydantoins | |
| US4916148A (en) | Naphtho(2,1-b) furan derivatives | |
| NZ205559A (en) | Leukotriene antagonists, pharmaceutical compositions, and intermediates | |
| US4665203A (en) | Substituted dihydrobenzopyrans useful as leukotriene D4 inhibitors | |
| EP0255980A2 (en) | Coumarin intermediates for preparation of pharmaceuticals | |
| GB2122997A (en) | Imidazoles | |
| BG100070A (bg) | Инхибитори на 5-липоксигеназата | |
| US4545993A (en) | 1,2-Benzopyran-6-yl acetic acid compound and pharmaceutical compositions containing said compounds | |
| US4347251A (en) | Novel 3-substituted amino-1-substituted heteroaryl-2-pyrazolines | |
| US3972994A (en) | Disubstituted azabicycloalkanes | |
| CA1163999A (en) | N-imidazolyl derivatives of 1-chroman and process for their preparation | |
| CA1192198A (en) | Quinolylacetic acid compounds, process for producing thereof and pharmaceutical compositions containing them | |
| US4432991A (en) | Therapeutically active 3-amino-1-phenyl(and substituted phenyl)-2-pyrazolines | |
| GB2071655A (en) | N-imidazolyl derivatives of 1- chroman and process for their preparation | |
| US4284644A (en) | Spirobenzofuranone compounds | |
| GB2141705A (en) | Imidazoles | |
| US4985573A (en) | Hydantoin derivatives for treating complications of diabetes | |
| CA1150287A (en) | Spirobenzofuranones, their production and use | |
| GB2161801A (en) | N-Imidazolyl derivatives and process for their preparation | |
| IE42462B1 (en) | 1-methyl-2-nitro-imidazole-5-methanol derivatives | |
| US4042598A (en) | Disubstituted azabicycloalkanes | |
| JPS63112576A (ja) | 2−フエニル−1−ベンズオキセピン誘導体の製造法 | |
| JPS597169A (ja) | カルボスチリル誘導体 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |