CA1119198A - Manufacture of para-nitrodiphenylamines - Google Patents
Manufacture of para-nitrodiphenylaminesInfo
- Publication number
- CA1119198A CA1119198A CA000320630A CA320630A CA1119198A CA 1119198 A CA1119198 A CA 1119198A CA 000320630 A CA000320630 A CA 000320630A CA 320630 A CA320630 A CA 320630A CA 1119198 A CA1119198 A CA 1119198A
- Authority
- CA
- Canada
- Prior art keywords
- group
- reaction
- improved process
- recited
- hydrogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000004519 manufacturing process Methods 0.000 title abstract 2
- 238000000034 method Methods 0.000 claims abstract description 63
- 230000008569 process Effects 0.000 claims abstract description 58
- 238000006243 chemical reaction Methods 0.000 claims abstract description 50
- 239000002904 solvent Substances 0.000 claims abstract description 43
- 229920000570 polyether Polymers 0.000 claims abstract description 24
- 230000006872 improvement Effects 0.000 claims abstract description 6
- 230000002194 synthesizing effect Effects 0.000 claims abstract description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 42
- DYDNPESBYVVLBO-UHFFFAOYSA-N formanilide Chemical compound O=CNC1=CC=CC=C1 DYDNPESBYVVLBO-UHFFFAOYSA-N 0.000 claims description 37
- 229920001223 polyethylene glycol Polymers 0.000 claims description 34
- 239000002202 Polyethylene glycol Substances 0.000 claims description 23
- -1 nitrogen-containing aromatic compound Chemical class 0.000 claims description 23
- 150000003839 salts Chemical class 0.000 claims description 23
- 150000001875 compounds Chemical class 0.000 claims description 19
- 239000001257 hydrogen Substances 0.000 claims description 19
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- 239000000203 mixture Substances 0.000 claims description 19
- 239000003054 catalyst Substances 0.000 claims description 16
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 16
- 150000003142 primary aromatic amines Chemical class 0.000 claims description 12
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 10
- 239000003795 chemical substances by application Substances 0.000 claims description 10
- 230000003472 neutralizing effect Effects 0.000 claims description 10
- 150000002431 hydrogen Chemical class 0.000 claims description 9
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 229910052802 copper Inorganic materials 0.000 claims description 8
- 239000010949 copper Substances 0.000 claims description 8
- 150000001412 amines Chemical class 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 239000007795 chemical reaction product Substances 0.000 claims description 6
- 150000002170 ethers Chemical class 0.000 claims description 6
- 238000001914 filtration Methods 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 229920000768 polyamine Polymers 0.000 claims description 4
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 claims description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 3
- 150000001879 copper Chemical class 0.000 claims description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 3
- VFTFKUDGYRBSAL-UHFFFAOYSA-N 15-crown-5 Chemical compound C1COCCOCCOCCOCCO1 VFTFKUDGYRBSAL-UHFFFAOYSA-N 0.000 claims description 2
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 claims description 2
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 claims description 2
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical compound OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 2
- 150000001298 alcohols Chemical class 0.000 claims description 2
- 150000003973 alkyl amines Chemical class 0.000 claims description 2
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 claims description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 2
- 150000001491 aromatic compounds Chemical class 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- FNEPSTUXZLEUCK-UHFFFAOYSA-N benzo-15-crown-5 Chemical compound O1CCOCCOCCOCCOC2=CC=CC=C21 FNEPSTUXZLEUCK-UHFFFAOYSA-N 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- YSSSPARMOAYJTE-UHFFFAOYSA-N dibenzo-18-crown-6 Chemical compound O1CCOCCOC2=CC=CC=C2OCCOCCOC2=CC=CC=C21 YSSSPARMOAYJTE-UHFFFAOYSA-N 0.000 claims description 2
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- 235000005985 organic acids Nutrition 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 229910052717 sulfur Chemical group 0.000 claims description 2
- 239000011593 sulfur Chemical group 0.000 claims description 2
- 150000003512 tertiary amines Chemical class 0.000 claims description 2
- 229940039407 aniline Drugs 0.000 claims 3
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims 2
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 229940052651 anticholinergic tertiary amines Drugs 0.000 claims 1
- 238000005119 centrifugation Methods 0.000 claims 1
- 238000010977 unit operation Methods 0.000 claims 1
- 230000008901 benefit Effects 0.000 abstract description 7
- 239000006227 byproduct Substances 0.000 abstract description 3
- 239000002253 acid Substances 0.000 abstract description 2
- 150000001448 anilines Chemical class 0.000 abstract 1
- 150000004982 aromatic amines Chemical class 0.000 abstract 1
- 125000004122 cyclic group Chemical group 0.000 abstract 1
- 238000010348 incorporation Methods 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 239000012429 reaction media Substances 0.000 abstract 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 60
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 45
- 230000003197 catalytic effect Effects 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 238000010626 work up procedure Methods 0.000 description 14
- 239000000047 product Substances 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- CZGCEKJOLUNIFY-UHFFFAOYSA-N 4-Chloronitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C=C1 CZGCEKJOLUNIFY-UHFFFAOYSA-N 0.000 description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000010410 layer Substances 0.000 description 9
- 238000003756 stirring Methods 0.000 description 8
- 239000007788 liquid Substances 0.000 description 7
- 239000012074 organic phase Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 239000008346 aqueous phase Substances 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- 230000036647 reaction Effects 0.000 description 5
- 230000035484 reaction time Effects 0.000 description 5
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- 239000011269 tar Substances 0.000 description 4
- 239000003039 volatile agent Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 238000013019 agitation Methods 0.000 description 3
- ZDGLQYKCZMGQMP-UHFFFAOYSA-N aniline toluene Chemical compound CC1=CC=CC=C1.NC1=CC=CC=C1.NC1=CC=CC=C1 ZDGLQYKCZMGQMP-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000012535 impurity Substances 0.000 description 3
- 210000003739 neck Anatomy 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 2
- 150000003983 crown ethers Chemical class 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 229960001484 edetic acid Drugs 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 238000005086 pumping Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 238000005063 solubilization Methods 0.000 description 2
- 230000007928 solubilization Effects 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- XFRVVPUIAFSTFO-UHFFFAOYSA-N 1-Tridecanol Chemical compound CCCCCCCCCCCCCO XFRVVPUIAFSTFO-UHFFFAOYSA-N 0.000 description 1
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethanol Chemical compound COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- OVOUKWFJRHALDD-UHFFFAOYSA-N 2-[2-(2-acetyloxyethoxy)ethoxy]ethyl acetate Chemical compound CC(=O)OCCOCCOCCOC(C)=O OVOUKWFJRHALDD-UHFFFAOYSA-N 0.000 description 1
- BLXVTZPGEOGTGG-UHFFFAOYSA-N 2-[2-(4-nonylphenoxy)ethoxy]ethanol Chemical compound CCCCCCCCCC1=CC=C(OCCOCCO)C=C1 BLXVTZPGEOGTGG-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- MNWSGMTUGXNYHJ-UHFFFAOYSA-N 2-methoxybenzamide Chemical compound COC1=CC=CC=C1C(N)=O MNWSGMTUGXNYHJ-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- FJNCXZZQNBKEJT-UHFFFAOYSA-N 8beta-hydroxymarrubiin Natural products O1C(=O)C2(C)CCCC3(C)C2C1CC(C)(O)C3(O)CCC=1C=COC=1 FJNCXZZQNBKEJT-UHFFFAOYSA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- SUAKHGWARZSWIH-UHFFFAOYSA-N N,N‐diethylformamide Chemical compound CCN(CC)C=O SUAKHGWARZSWIH-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 1
- 239000004280 Sodium formate Substances 0.000 description 1
- 229920002359 Tetronic® Polymers 0.000 description 1
- 230000037374 absorbed through the skin Effects 0.000 description 1
- 229960001413 acetanilide Drugs 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 1
- 230000000875 corresponding effect Effects 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- JRBPAEWTRLWTQC-UHFFFAOYSA-N dodecylamine Chemical compound CCCCCCCCCCCCN JRBPAEWTRLWTQC-UHFFFAOYSA-N 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 229940013688 formic acid Drugs 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 239000000383 hazardous chemical Substances 0.000 description 1
- 231100000206 health hazard Toxicity 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- XPJRQAIZZQMSCM-UHFFFAOYSA-N heptaethylene glycol Polymers OCCOCCOCCOCCOCCOCCOCCO XPJRQAIZZQMSCM-UHFFFAOYSA-N 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 230000002101 lytic effect Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000001603 reducing effect Effects 0.000 description 1
- 150000003873 salicylate salts Chemical class 0.000 description 1
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 1
- 235000019254 sodium formate Nutrition 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- UWHCKJMYHZGTIT-UHFFFAOYSA-N tetraethylene glycol Chemical compound OCCOCCOCCOCCO UWHCKJMYHZGTIT-UHFFFAOYSA-N 0.000 description 1
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 229940087291 tridecyl alcohol Drugs 0.000 description 1
- YFNKIDBQEZZDLK-UHFFFAOYSA-N triglyme Chemical compound COCCOCCOCCOC YFNKIDBQEZZDLK-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/04—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups
- C07C209/06—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups by substitution of halogen atoms
- C07C209/10—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups by substitution of halogen atoms with formation of amino groups bound to carbon atoms of six-membered aromatic rings or from amines having nitrogen atoms bound to carbon atoms of six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/884,502 US4155936A (en) | 1978-03-08 | 1978-03-08 | Para-nitrodiphenylamines synthesis using Polyethers and macrocyclic esters as solubilizing agents |
| US884,502 | 1978-03-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1119198A true CA1119198A (en) | 1982-03-02 |
Family
ID=25384762
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000320630A Expired CA1119198A (en) | 1978-03-08 | 1979-01-31 | Manufacture of para-nitrodiphenylamines |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4155936A (enExample) |
| JP (1) | JPS54125622A (enExample) |
| BR (1) | BR7901339A (enExample) |
| CA (1) | CA1119198A (enExample) |
| DE (1) | DE2908804C2 (enExample) |
| FR (1) | FR2419277A1 (enExample) |
| GB (1) | GB2015992B (enExample) |
| IT (1) | IT1114460B (enExample) |
| MX (1) | MX150947A (enExample) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4304939A (en) * | 1978-11-02 | 1981-12-08 | Uop Inc. | Preparation of N-phenyl-N-alkylphenylenediamines |
| US4391992A (en) * | 1979-08-24 | 1983-07-05 | American Cyanamid Company | N-Denitration of N,2,6-trinitroanilines with phase transfer catalysts |
| FR2501676A1 (fr) * | 1981-03-11 | 1982-09-17 | Rhone Poulenc Spec Chim | Procede de n-alkylation de composes organiques azotes |
| US4521622A (en) * | 1983-02-15 | 1985-06-04 | Japan Synthetic Rubber Co., Ltd. | Process for producing aromatic amine |
| DE3308658A1 (de) * | 1983-03-11 | 1984-09-13 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 4-nitrodiphenylaminen |
| DE3443679A1 (de) * | 1984-11-30 | 1986-06-05 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 4-nitrodiphenylaminen |
| US4683332A (en) * | 1985-05-20 | 1987-07-28 | The Goodyear Tire & Rubber Company | Para-nitrodiphenylamine synthesis |
| DE3924092C1 (enExample) * | 1989-07-20 | 1990-11-29 | Hoechst Ag, 6230 Frankfurt, De | |
| US5252737A (en) * | 1992-05-22 | 1993-10-12 | Monsanto Company | Process for preparing N-aliphatic substituted p-phenylenediamines |
| US5331099A (en) * | 1992-05-22 | 1994-07-19 | Monsanto Company | Process for preparing p-nitroaromatic amides and products thereof |
| US5552531A (en) * | 1992-05-22 | 1996-09-03 | Monsanto Company | Process for preparing substituted aromatic azo compounds |
| US5233010A (en) * | 1992-10-15 | 1993-08-03 | Monsanto Company | Process for preparing isocyanate and carbamate ester products |
| US5451702A (en) * | 1993-04-26 | 1995-09-19 | Monsanto Company | Process for preparing substituted aromatic amines |
| US5380946A (en) * | 1993-07-30 | 1995-01-10 | Monsanto Company | Process for preparing p-nitroaromatic amides and products thereof |
| US5382691A (en) * | 1993-11-05 | 1995-01-17 | Monsanto Company | Process for preparing substituted aromatic amines |
| US5574187A (en) * | 1994-10-06 | 1996-11-12 | Uniroyal Chemical Company, Inc. | Process of preparing para substituted phenylamines |
| US5420354A (en) * | 1994-10-06 | 1995-05-30 | Uniroyal Chemical Company, Inc. | Process of preparing para phenylamines |
| RU2131411C1 (ru) * | 1997-11-20 | 1999-06-10 | Институт химической физики РАН в Черноголовке | Способ получения смеси олиготрифениламинов, способ получения 3-(4-бифенилил)-4- (4-трет-бутилфенил)-5-(4-диметиламинофенил)-1,2,4-триазола и электролюминесцентное устройство |
| US5840982A (en) * | 1998-06-04 | 1998-11-24 | Uniroyal Chemical Company, Inc. | Process for preparing para-phenylenediamine derivatives |
| DE10025756C2 (de) * | 2000-05-25 | 2003-02-20 | Cognis Deutschland Gmbh | Lösungsvermittler |
| US6495723B1 (en) | 2000-06-21 | 2002-12-17 | Flexsys America | Zeolite support loaded with a base material for use in the coupling of aniline and nitrobenzene |
| DE102005033732B4 (de) * | 2005-05-27 | 2014-02-13 | Grünenthal GmbH | Trennung stereoisomerer N,N-Dialkylamino-2-alkyl-3-hydroxy-3-phenyl-alkane |
| US7683017B2 (en) * | 2007-06-20 | 2010-03-23 | Chevron Oronite Company Llc | Synergistic lubricating oil composition containing a mixture of a nitro-substituted diarylamine and a diarylamine |
| IN2014KN01593A (enExample) | 2012-03-07 | 2015-10-23 | Nocil Ltd | |
| US20240124683A1 (en) | 2022-09-28 | 2024-04-18 | The Goodyear Tire & Rubber Company | Rubber - forming additives from biomass through syngas production |
| US20240117149A1 (en) | 2022-09-28 | 2024-04-11 | The Goodyear Tire & Rubber Company | Rubber - forming additives from end of life tires through syngas production |
| US20250163236A1 (en) | 2023-11-21 | 2025-05-22 | The Goodyear Tire & Rubber Company | Production of rubber compositions from end of life tires |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1056619B (de) * | 1956-11-29 | 1959-05-06 | Bayer Ag | Verfahren zur Herstellung von 4-Nitro-diarylaminen |
| US3055940A (en) * | 1957-11-05 | 1962-09-25 | Us Rubber Co | Preparation of nitrodiphenylamines by catalyzed condensation |
| GB834510A (en) * | 1958-03-31 | 1960-05-11 | Goodyear Tire & Rubber | Condensation of an aromatic amine with a halonitrobenzene to provide a nitrophenyl amine |
| FR1208123A (fr) * | 1959-02-17 | 1960-02-22 | Bayer Ag | Procédé de préparation de 4-nitro-diarylamines |
| US3313854A (en) * | 1961-11-20 | 1967-04-11 | Universal Oil Prod Co | Preparation of para-nitrodiphenylamines utilizing a copper oxide catalyst |
| DE2534851C3 (de) * | 1975-08-05 | 1984-10-18 | Studiengesellschaft Kohle mbH, 4330 Mülheim | Verfahren zum Löslichmachen von anorganischen oder organischen Alkalimetallsalzen in organischen Lösungsmitteln durch Komplexbildung mit Polyäthylenglykoldiäthern und deren Verwendung |
| DE2633811C2 (de) * | 1976-07-28 | 1983-11-10 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Nitrodiphenylaminen |
| DE2719365A1 (de) * | 1977-04-30 | 1978-11-02 | Technochemie Gmbh | Verfahren zur herstellung von dialkylamino-alkylchlorid-hydrochloriden |
| DE2814860A1 (de) * | 1978-04-06 | 1979-10-11 | Bayer Ag | Verfahren zur herstellung von aromatischen aminen |
-
1978
- 1978-03-08 US US05/884,502 patent/US4155936A/en not_active Expired - Lifetime
-
1979
- 1979-01-31 CA CA000320630A patent/CA1119198A/en not_active Expired
- 1979-02-22 GB GB7906302A patent/GB2015992B/en not_active Expired
- 1979-02-23 MX MX176712A patent/MX150947A/es unknown
- 1979-03-05 IT IT48214/79A patent/IT1114460B/it active
- 1979-03-06 BR BR7901339A patent/BR7901339A/pt unknown
- 1979-03-07 DE DE2908804A patent/DE2908804C2/de not_active Expired
- 1979-03-08 JP JP2724579A patent/JPS54125622A/ja active Granted
- 1979-03-08 FR FR7905935A patent/FR2419277A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US4155936A (en) | 1979-05-22 |
| GB2015992A (en) | 1979-09-19 |
| IT7948214A0 (it) | 1979-03-05 |
| FR2419277B1 (enExample) | 1985-03-22 |
| JPS6227060B2 (enExample) | 1987-06-12 |
| MX150947A (es) | 1984-08-24 |
| JPS54125622A (en) | 1979-09-29 |
| FR2419277A1 (fr) | 1979-10-05 |
| BR7901339A (pt) | 1979-10-09 |
| DE2908804C2 (de) | 1987-01-15 |
| IT1114460B (it) | 1986-01-27 |
| DE2908804A1 (de) | 1979-09-13 |
| GB2015992B (en) | 1982-07-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1119198A (en) | Manufacture of para-nitrodiphenylamines | |
| CA1225100A (en) | Making nitrodiarylamines | |
| WO2000034219A1 (en) | Cardanol derivative and method of making the cardanol derivative | |
| KR102080782B1 (ko) | 이소시아네이토 실란의 제조 | |
| JPS61286357A (ja) | N−α−アルコキシ−エチル−ホルムアミドの製法 | |
| CN110804001A (zh) | 一种3,4-二氟苯腈工艺生产方法 | |
| KR101368101B1 (ko) | 아미노오가노실란을 제조하는 방법 | |
| US4946996A (en) | Preparation of an allyl amine and quaternary diallyl ammonium compounds therefrom | |
| JPH0120151B2 (enExample) | ||
| EP0150055B1 (en) | Novel substituted trifluorooxetane and preparation thereof | |
| CN1325470C (zh) | 水溶性β-羟基腈的生产方法 | |
| KR19980042748A (ko) | 아실옥시실란의 연속적인 제조방법 | |
| JP2004051556A (ja) | オキセタン誘導体の製造方法 | |
| EP0148145B1 (en) | Process for making nitrodiarylamines | |
| EP0452960B1 (en) | Method for preparing hexamethyl cyclotrisilazane | |
| KR830001986B1 (ko) | 폴리페놀의 글리시딜 폴리에테르류의 제조 방법 | |
| KR100757700B1 (ko) | 안티몬 촉매 조성물의 제조방법, 당해 방법으로 제조한 안티몬 촉매 조성물 및 당해 안티몬 촉매 조성물을 사용하는 활성 수소 함유 유기 화합물의 알콕시화 방법 | |
| WO2006121111A1 (ja) | ポリエーテルポリオールの製造方法 | |
| JPH0977762A (ja) | 2−アリロキシメチル−1,4−ジオキサンの製造方法 | |
| JP2618714B2 (ja) | β―ヒドロキシアミノ化合物の精製方法 | |
| CA1070332A (en) | Anhydrous catalyst for manufacture of glycol ethers | |
| JPS59134743A (ja) | m−フエノキシトルエンの製造法 | |
| US20060089515A1 (en) | Process for continuously preparing alkylene glycol diethers | |
| KR0130623B1 (ko) | 2',3'-디클로로-4-에톡시메톡시벤즈아닐리드의 제조 방법 | |
| JP3998873B2 (ja) | ジヒドロキシアミノ化合物の製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |