CA1094545A - Cephalosporin antibiotics - Google Patents
Cephalosporin antibioticsInfo
- Publication number
- CA1094545A CA1094545A CA271,637A CA271637A CA1094545A CA 1094545 A CA1094545 A CA 1094545A CA 271637 A CA271637 A CA 271637A CA 1094545 A CA1094545 A CA 1094545A
- Authority
- CA
- Canada
- Prior art keywords
- formula
- fur
- cefuroxime
- ceph
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003242 anti bacterial agent Substances 0.000 title abstract description 8
- 229940088710 antibiotic agent Drugs 0.000 title abstract description 8
- 229930186147 Cephalosporin Natural products 0.000 title description 4
- 229940124587 cephalosporin Drugs 0.000 title description 4
- 150000001780 cephalosporins Chemical class 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 29
- JFPVXVDWJQMJEE-IZRZKJBUSA-N cefuroxime Chemical class N([C@@H]1C(N2C(=C(COC(N)=O)CS[C@@H]21)C(O)=O)=O)C(=O)\C(=N/OC)C1=CC=CO1 JFPVXVDWJQMJEE-IZRZKJBUSA-N 0.000 claims abstract description 28
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 10
- 229960001668 cefuroxime Drugs 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 13
- 238000002360 preparation method Methods 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 9
- 239000007858 starting material Substances 0.000 claims description 8
- 239000002585 base Substances 0.000 claims description 7
- JFPVXVDWJQMJEE-SWWZKJRFSA-N 55268-75-2 Chemical compound N([C@@H]1C(N2C(=C(COC(N)=O)CS[C@@H]21)C(O)=O)=O)C(=O)/C(=N/OC)C1=CC=CO1 JFPVXVDWJQMJEE-SWWZKJRFSA-N 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052740 iodine Chemical group 0.000 claims description 3
- 239000011630 iodine Chemical group 0.000 claims description 3
- ZNQCEVIJOQZWLO-VURMDHGXSA-N (2z)-2-(furan-2-yl)-2-methoxyiminoacetic acid Chemical compound CO\N=C(/C(O)=O)C1=CC=CO1 ZNQCEVIJOQZWLO-VURMDHGXSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical group 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- 230000003115 biocidal effect Effects 0.000 abstract description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 37
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 32
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 22
- 150000002148 esters Chemical class 0.000 description 22
- 239000000243 solution Substances 0.000 description 22
- 239000000203 mixture Substances 0.000 description 21
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 15
- 239000007787 solid Substances 0.000 description 13
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- 235000019439 ethyl acetate Nutrition 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- -1 ester derivatives of (6R,7R)-3-carbamoyloxymethyl-7-[(Z)-2-(fur-2-yl)-2-methoxyiminoacetamido]ceph-3-em-4-carboxylic acid Chemical class 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 238000001228 spectrum Methods 0.000 description 8
- 238000010521 absorption reaction Methods 0.000 description 7
- 238000005917 acylation reaction Methods 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- GKIRPKYJQBWNGO-OCEACIFDSA-N clomifene Chemical compound C1=CC(OCCN(CC)CC)=CC=C1C(\C=1C=CC=CC=1)=C(\Cl)C1=CC=CC=C1 GKIRPKYJQBWNGO-OCEACIFDSA-N 0.000 description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- 230000010933 acylation Effects 0.000 description 6
- 239000006260 foam Substances 0.000 description 6
- 108090000371 Esterases Proteins 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 150000008064 anhydrides Chemical class 0.000 description 5
- 238000004128 high performance liquid chromatography Methods 0.000 description 5
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 5
- 210000002966 serum Anatomy 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229960000723 ampicillin Drugs 0.000 description 3
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 210000001035 gastrointestinal tract Anatomy 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- GNMWLAVIBURDHJ-FQFBDBCASA-M C(N)(=O)OC=1C(S[C@H]2N(C=1C(=O)[O-])C([C@H]2NC(\C(=N/OC)\C=1OC=CC=1)=O)=O)C.[K+] Chemical compound C(N)(=O)OC=1C(S[C@H]2N(C=1C(=O)[O-])C([C@H]2NC(\C(=N/OC)\C=1OC=CC=1)=O)=O)C.[K+] GNMWLAVIBURDHJ-FQFBDBCASA-M 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 241000237858 Gastropoda Species 0.000 description 2
- 229930182555 Penicillin Natural products 0.000 description 2
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- FXXACINHVKSMDR-UHFFFAOYSA-N acetyl bromide Chemical compound CC(Br)=O FXXACINHVKSMDR-UHFFFAOYSA-N 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 235000010980 cellulose Nutrition 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 239000000787 lecithin Substances 0.000 description 2
- 235000010445 lecithin Nutrition 0.000 description 2
- 229940067606 lecithin Drugs 0.000 description 2
- 210000004185 liver Anatomy 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229940049954 penicillin Drugs 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 229920003109 sodium starch glycolate Polymers 0.000 description 2
- 239000008109 sodium starch glycolate Substances 0.000 description 2
- 229940079832 sodium starch glycolate Drugs 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- XBHXKLVFFPMQEC-BJUYYEFKSA-N (5S,6R,7R)-3-(carbamoyloxymethyl)-7-[[(2Z)-2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-5,8-dioxo-5lambda4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound N([C@@H]1C(N2[C@@H]1[S@](CC(COC(N)=O)=C2C(O)=O)=O)=O)C(=O)\C(=N/OC)C1=CC=CO1 XBHXKLVFFPMQEC-BJUYYEFKSA-N 0.000 description 1
- FZEVMBJWXHDLDB-ZCFIWIBFSA-N (6r)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical compound S1CC=CN2C(=O)C[C@H]21 FZEVMBJWXHDLDB-ZCFIWIBFSA-N 0.000 description 1
- SXBDXXFTJVHSAF-ZCFIWIBFSA-N (6r)-5-thia-1-azabicyclo[4.2.0]oct-3-en-8-one Chemical class S1C=CCN2C(=O)C[C@H]21 SXBDXXFTJVHSAF-ZCFIWIBFSA-N 0.000 description 1
- GEVXSHRXRWZKNZ-UHFFFAOYSA-N 1-bromobutyl acetate Chemical compound CCCC(Br)OC(C)=O GEVXSHRXRWZKNZ-UHFFFAOYSA-N 0.000 description 1
- MIQVBIPMKVXPQU-UHFFFAOYSA-N 1-bromopropyl acetate Chemical compound CCC(Br)OC(C)=O MIQVBIPMKVXPQU-UHFFFAOYSA-N 0.000 description 1
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 1
- JECYNCQXXKQDJN-UHFFFAOYSA-N 2-(2-methylhexan-2-yloxymethyl)oxirane Chemical compound CCCCC(C)(C)OCC1CO1 JECYNCQXXKQDJN-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- GLVYLTSKTCWWJR-UHFFFAOYSA-N 2-carbonoperoxoylbenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1C(O)=O GLVYLTSKTCWWJR-UHFFFAOYSA-N 0.000 description 1
- LBXKQIWKQYEXRO-UHFFFAOYSA-N 3-methylbutanoyl bromide Chemical compound CC(C)CC(Br)=O LBXKQIWKQYEXRO-UHFFFAOYSA-N 0.000 description 1
- WEQPBCSPRXFQQS-UHFFFAOYSA-N 4,5-dihydro-1,2-oxazole Chemical class C1CC=NO1 WEQPBCSPRXFQQS-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- GKQLYSROISKDLL-UHFFFAOYSA-N EEDQ Chemical compound C1=CC=C2N(C(=O)OCC)C(OCC)C=CC2=C1 GKQLYSROISKDLL-UHFFFAOYSA-N 0.000 description 1
- 241000792859 Enema Species 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 241000400611 Eucalyptus deanei Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- ATTZFSUZZUNHBP-UHFFFAOYSA-N Piperonyl sulfoxide Chemical compound CCCCCCCCS(=O)C(C)CC1=CC=C2OCOC2=C1 ATTZFSUZZUNHBP-UHFFFAOYSA-N 0.000 description 1
- 229920003110 Primojel Polymers 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000003782 beta lactam antibiotic agent Substances 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 150000003983 crown ethers Chemical class 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 238000007907 direct compression Methods 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000007920 enema Substances 0.000 description 1
- 229940079360 enema for constipation Drugs 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 238000004452 microanalysis Methods 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- 239000007968 orange flavor Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- WSHJJCPTKWSMRR-RXMQYKEDSA-N penam group Chemical group S1CCN2[C@H]1CC2=O WSHJJCPTKWSMRR-RXMQYKEDSA-N 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical class OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 150000003017 phosphorus Chemical class 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229940059096 powder for oral suspension Drugs 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000009490 roller compaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000009491 slugging Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 239000004296 sodium metabisulphite Substances 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000007916 tablet composition Substances 0.000 description 1
- IXZDIALLLMRYOU-UHFFFAOYSA-N tert-butyl hypochlorite Chemical compound CC(C)(C)OCl IXZDIALLLMRYOU-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 230000002485 urinary effect Effects 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/26—Methylene radicals, substituted by oxygen atoms; Lactones thereof with the 2-carboxyl group
- C07D501/34—Methylene radicals, substituted by oxygen atoms; Lactones thereof with the 2-carboxyl group with the 7-amino radical acylated by carboxylic acids containing hetero rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB6009/76A GB1571683A (en) | 1976-02-16 | 1976-02-16 | Ester derivatives of cefuroxime |
| GB6009/76 | 1976-02-16 | ||
| GB2730276 | 1976-06-30 | ||
| GB27302/76 | 1976-06-30 | ||
| GB27301/76 | 1976-06-30 | ||
| GB2730176 | 1976-06-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1094545A true CA1094545A (en) | 1981-01-27 |
Family
ID=27254745
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA271,637A Expired CA1094545A (en) | 1976-02-16 | 1977-02-11 | Cephalosporin antibiotics |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4267320A (OSRAM) |
| JP (1) | JPS52100494A (OSRAM) |
| AT (1) | AT358727B (OSRAM) |
| AU (1) | AU514236B2 (OSRAM) |
| CA (1) | CA1094545A (OSRAM) |
| CH (2) | CH628901A5 (OSRAM) |
| CY (1) | CY1181A (OSRAM) |
| DE (1) | DE2706413C2 (OSRAM) |
| DK (1) | DK149062C (OSRAM) |
| FR (1) | FR2340950A1 (OSRAM) |
| HK (1) | HK17185A (OSRAM) |
| IL (1) | IL51450A (OSRAM) |
| KE (1) | KE3260A (OSRAM) |
| NL (2) | NL185209C (OSRAM) |
| SE (1) | SE431986B (OSRAM) |
| YU (1) | YU40977B (OSRAM) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1093549A (en) * | 1976-02-16 | 1981-01-13 | Michael Gregson | Cephalosporin antibiotics |
| GB1598568A (en) * | 1977-04-19 | 1981-09-23 | Glaxo Lab Ltd | Esters of(6r,7r)-3-carbamoyloxymethyl-7-((z)-2-(fur-2-yl)-2-methoxyiminoacetamido)-ceph-3-em-4-carboxylic acid |
| GB1602736A (en) * | 1977-08-12 | 1981-11-18 | Glaxo Operations Ltd | A-acetoxyethyl esters of 3-carbamoyloxymethyl-7-(2-(fur-2-yl)-2-methoxyiminoacetamido)ceph-3-em-4-carboxylic acids |
| YU44680B (en) * | 1982-07-30 | 1990-12-31 | Glaxo Lab Ltd | Process for obtaining very pure amorphous form of cephuroxim axetile |
| GB8320521D0 (en) * | 1983-07-29 | 1983-09-01 | Glaxo Group Ltd | Chemical process |
| JPS60190783A (ja) * | 1983-12-21 | 1985-09-28 | Sumitomo Seiyaku Kk | セフエム系化合物 |
| GB8400024D0 (en) * | 1984-01-03 | 1984-02-08 | Glaxo Group Ltd | Cephalosporin antibiotics |
| GB8524001D0 (en) * | 1985-09-30 | 1985-11-06 | Glaxo Group Ltd | Pharmaceutical composition |
| GB8810394D0 (en) * | 1988-05-03 | 1988-06-08 | Glaxo Group Ltd | Chemical process |
| GB8810393D0 (en) * | 1988-05-03 | 1988-06-08 | Glaxo Group Ltd | Chemical process |
| JPH0586375U (ja) * | 1991-07-11 | 1993-11-22 | 田中食品機械株式会社 | ゴルフ練習用マット |
| JPH0541572U (ja) * | 1991-11-15 | 1993-06-08 | コナミ株式会社 | 遊戯機器用起伏形成装置 |
| IT1277426B1 (it) * | 1995-08-03 | 1997-11-10 | Acs Dobfar Spa | Forma cristallina biodisponibile del cefuroxima axetil |
| CN1111537C (zh) * | 1997-05-15 | 2003-06-18 | 第一制糖株式会社 | 高纯晶形头孢呋辛1-乙酰氧乙酯的制备方法 |
| IN186539B (OSRAM) | 1997-09-29 | 2001-09-29 | Ranbaxy Lab Ltd | |
| PT937727E (pt) * | 1998-02-20 | 2002-07-31 | Fako Ilaclari A S | Processo para a producao de cefuroxima azetil cristalina soluvel |
| US6384213B1 (en) | 1998-10-23 | 2002-05-07 | Ranbaxy Laboratories Limited | Process for preparing a pure, pharmacopoeial grade amorphous form of cefuroxime axetil |
| IN190831B (OSRAM) | 1999-03-19 | 2003-08-23 | Ranbaxy Lab Ltd | |
| EP1165051B1 (en) | 1999-03-19 | 2003-07-09 | Ranbaxy Laboratories, Ltd. | Process for the preparation of a bioavailable oral dosage form of cefuroxime axetil |
| CA2280925A1 (en) | 1999-07-29 | 2001-01-29 | Bernard Charles Sherman | Stabilized cefuroxime axetil |
| IN190849B (OSRAM) | 2000-07-17 | 2003-08-23 | Ranbaxy Lab Ltd | |
| AT411996B (de) * | 2000-09-11 | 2004-08-26 | Sandoz Ag | Verfahren zur herstellung von cefuroxim in der form seines n-butylammoniumsalzes |
| US7064198B2 (en) * | 2001-07-25 | 2006-06-20 | Lupin Limited | Method for preparation of cefuroxime axetil |
| ITMI20011763A1 (it) * | 2001-08-10 | 2003-02-10 | Antibioticos Spa | Processo di preparazione di cefuroxime axelite ad elevata purezza |
| HRP20020923A2 (en) * | 2001-11-23 | 2003-10-31 | Glaxo Group Ltd | Pharmaceutical composition |
| KR100552567B1 (ko) * | 2003-08-23 | 2006-02-15 | 한국유나이티드제약 주식회사 | 수분 흡수에 안정하고 빠르게 붕해되는 세푸록심 악세틸을포함하는 정제의 조성물 및 제조 방법 |
| CN1295234C (zh) * | 2004-11-15 | 2007-01-17 | 中山大学 | 一种头孢呋辛酯非对映异构体的分离方法 |
| DE102005019458A1 (de) | 2005-04-25 | 2006-10-26 | Grünenthal GmbH | Darreichungsform mit verbesserter Freisetzung von Cefuroximaxetil |
| DE102006019619A1 (de) * | 2006-04-25 | 2007-10-31 | Grünenthal GmbH | Kristalline Modifikation von Cefuroximaxetil |
| WO2013038323A1 (en) | 2011-09-13 | 2013-03-21 | Unimark Remedies Ltd. | Taste masked pharmaceutical compositions of cefuroxime axetil |
| CN111732599A (zh) * | 2020-07-08 | 2020-10-02 | 江苏正大清江制药有限公司 | 一种合成头孢呋辛酯二聚体的方法 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1310642A (en) | 1970-11-09 | 1973-03-21 | Pfizer | Alpha-sulfo-and alpha-sulfoalkylacylcephalosporins |
| US3870713A (en) * | 1970-12-07 | 1975-03-11 | Pfizer | Phosphono substituted alkylcephalosporins |
| CA996929A (en) * | 1971-04-05 | 1976-09-14 | Kohzi Nakano | Acyloxyalkyl ester derivatives of penicillin |
| US3974153A (en) * | 1971-05-14 | 1976-08-10 | Glaxo Laboratories Limited | 7-Hydrocarbonoxy imino-acetamido-3-carbamoyloxy methylceph-3-em-4 carboxylic acids |
| BE794844A (fr) * | 1972-02-24 | 1973-08-01 | Pfizer | Alpha-carboxy-2-thienylmethylpenicilline et alpha-carboxy-2-thienylmethylcephalosporine,leurs esters et leurs sels |
| PL98296B1 (pl) | 1973-02-07 | 1978-04-29 | Politechnika Gdanskapo | Sposob otrzymywania estrow acetoksymetylowych cefalosporyn |
| US3962227A (en) * | 1973-02-23 | 1976-06-08 | Eli Lilly And Company | 3-halo cephalosporins |
| AR207148A1 (es) * | 1974-05-02 | 1976-09-15 | Rhone Poulenc Ind | Procedimiento para la preparacion de un nuevo derivado de la cefalosporina |
-
1977
- 1977-02-11 CA CA271,637A patent/CA1094545A/en not_active Expired
- 1977-02-15 DK DK63877A patent/DK149062C/da not_active IP Right Cessation
- 1977-02-15 DE DE2706413A patent/DE2706413C2/de not_active Expired
- 1977-02-15 NL NLAANVRAGE7701568,A patent/NL185209C/xx not_active IP Right Cessation
- 1977-02-15 SE SE7701668A patent/SE431986B/xx not_active IP Right Cessation
- 1977-02-15 CH CH187477A patent/CH628901A5/de not_active IP Right Cessation
- 1977-02-15 YU YU411/77A patent/YU40977B/xx unknown
- 1977-02-15 CY CY1181A patent/CY1181A/xx unknown
- 1977-02-15 AU AU22288/77A patent/AU514236B2/en not_active Expired
- 1977-02-15 IL IL51450A patent/IL51450A/xx unknown
- 1977-02-15 AT AT100677A patent/AT358727B/de active Protection Beyond IP Right Term
- 1977-02-15 JP JP1602077A patent/JPS52100494A/ja active Granted
- 1977-02-16 FR FR7704339A patent/FR2340950A1/fr active Granted
-
1979
- 1979-07-27 US US06/061,260 patent/US4267320A/en not_active Expired - Lifetime
-
1982
- 1982-03-05 CH CH137382A patent/CH634328A5/de not_active IP Right Cessation
-
1983
- 1983-02-05 KE KE3260A patent/KE3260A/xx unknown
-
1985
- 1985-03-14 HK HK171/85A patent/HK17185A/xx unknown
-
1993
- 1993-06-14 NL NL930073C patent/NL930073I2/nl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL930073I1 (nl) | 1993-09-16 |
| US4267320A (en) | 1981-05-12 |
| DE2706413C2 (de) | 1986-08-28 |
| CH634328A5 (de) | 1983-01-31 |
| DK149062C (da) | 1986-06-16 |
| JPS52100494A (en) | 1977-08-23 |
| NL7701568A (nl) | 1977-08-18 |
| ATA100677A (de) | 1980-02-15 |
| FR2340950B1 (OSRAM) | 1980-02-01 |
| NL930073I2 (nl) | 1993-11-01 |
| JPS633868B2 (OSRAM) | 1988-01-26 |
| NL185209C (nl) | 1990-02-16 |
| SE7701668L (sv) | 1977-08-17 |
| DK149062B (da) | 1986-01-06 |
| AT358727B (de) | 1980-09-25 |
| CH628901A5 (de) | 1982-03-31 |
| SE431986B (sv) | 1984-03-12 |
| FR2340950A1 (fr) | 1977-09-09 |
| CY1181A (en) | 1983-10-07 |
| AU514236B2 (en) | 1981-01-29 |
| YU41177A (en) | 1982-06-30 |
| HK17185A (en) | 1985-03-22 |
| DK63877A (da) | 1977-08-17 |
| NL185209B (nl) | 1989-09-18 |
| IL51450A0 (en) | 1977-04-29 |
| AU2228877A (en) | 1978-08-24 |
| YU40977B (en) | 1986-10-31 |
| KE3260A (en) | 1983-03-25 |
| IL51450A (en) | 1980-11-30 |
| DE2706413A1 (de) | 1977-08-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1094545A (en) | Cephalosporin antibiotics | |
| GB1571683A (en) | Ester derivatives of cefuroxime | |
| IE53177B1 (en) | Cephalosporin derivatives,their preparation and compositions containing them | |
| CA1093068A (en) | Cephalosporin antibiotics | |
| JPS6011917B2 (ja) | 新規なセファロスポリン化合物 | |
| JP2556722B2 (ja) | 新規なスルホンアミド化合物 | |
| US4559349A (en) | Carboxamides | |
| CH642662A5 (de) | Cephalosporine und verfahren zu deren herstellung. | |
| US4066762A (en) | Derivatives of 7-(2-substituted-2-hydroxyiminoacetamido)-3-(1-substituted tetrazol-5-ylthiomethyl-3-cephem-4-carboxylic acid | |
| DK174730B1 (da) | Diastereomer af 7-[2-(2-aminothiazol-4-yl)-2-(Z)-hydroxyiminoacetamido]-3-(methoxymethyl)-3-cephem-4-carboxylsyre-[alfa-(2,2-dimethylptopionyloxy)-ethyl]-ester, fremgangsmåde til fremstilling deraf, et lægemiddel indeholdende den nævnte diastereomer, | |
| US5081116A (en) | Cephalosporin derivatives | |
| US4918068A (en) | Cephem compounds | |
| US4935508A (en) | Process for cephem prodrug esters | |
| US4446317A (en) | Cephalosporin antibiotics | |
| JPH0131502B2 (OSRAM) | ||
| US4051129A (en) | Process for preparing 7-methoxycephalosporin compounds | |
| AT391319B (de) | Verfahren zur herstellung von neuen cephalosporinverbindungen | |
| PT92890A (pt) | Processo para a preparacao de derivados de cefalosporina e de composicoes farmaceuticas que os contem | |
| US4500709A (en) | Thiinyl and oxothiolyl derivatives | |
| KR830001543B1 (ko) | 세파로스포린 항생물질의 제조방법 | |
| US4278670A (en) | 7-Alpha-oxyiminoacylcephalosporins | |
| GB1572993A (en) | Ester derivatives of cefuroxime | |
| US4242510A (en) | Cephalosporin compounds and processes for the preparation thereof | |
| US4126745A (en) | 7-Methoxycephalosporin derivatives | |
| US4297369A (en) | Certain muscle relaxant 3-methyl-2-benzofuran acetamides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |