BG60347B2 - Метод за получаване на 3-заместени 2-оксиндол-1-карбоксамиди - Google Patents
Метод за получаване на 3-заместени 2-оксиндол-1-карбоксамиди Download PDFInfo
- Publication number
- BG60347B2 BG60347B2 BG069278A BG6927885A BG60347B2 BG 60347 B2 BG60347 B2 BG 60347B2 BG 069278 A BG069278 A BG 069278A BG 6927885 A BG6927885 A BG 6927885A BG 60347 B2 BG60347 B2 BG 60347B2
- Authority
- BG
- Bulgaria
- Prior art keywords
- carbon atoms
- oxindole
- formula
- alkyl
- thienyl
- Prior art date
Links
- -1 3-substituted-2-oxindole-1-carboxamides Chemical class 0.000 title claims abstract description 113
- 238000000034 method Methods 0.000 title claims abstract description 72
- 238000002360 preparation method Methods 0.000 title claims description 37
- 150000001875 compounds Chemical class 0.000 claims abstract description 92
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 34
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 19
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 19
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims abstract description 18
- 239000001257 hydrogen Substances 0.000 claims abstract description 17
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims abstract description 13
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 11
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 7
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 claims abstract description 6
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims abstract description 6
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 6
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims abstract description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 5
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims abstract description 3
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims abstract description 3
- 125000001589 carboacyl group Chemical group 0.000 claims abstract description 3
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 claims abstract description 3
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229930192474 thiophene Natural products 0.000 claims abstract description 3
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 claims abstract 2
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 64
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 50
- 238000006243 chemical reaction Methods 0.000 claims description 36
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 33
- 125000004432 carbon atom Chemical group C* 0.000 claims description 33
- WVKPYYLOFMTDHB-UHFFFAOYSA-N 2-norbornyl radical Chemical group C1CC2[CH]CC1C2 WVKPYYLOFMTDHB-UHFFFAOYSA-N 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 20
- 150000003839 salts Chemical class 0.000 claims description 16
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 239000003795 chemical substances by application Substances 0.000 claims description 9
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- 239000000460 chlorine Chemical group 0.000 claims description 7
- 125000001424 substituent group Chemical group 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 239000011737 fluorine Chemical group 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 6
- 125000005359 phenoxyalkyl group Chemical group 0.000 claims description 6
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 claims description 5
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 4
- 150000008065 acid anhydrides Chemical class 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- 125000002541 furyl group Chemical group 0.000 claims description 3
- UGUHFDPGDQDVGX-UHFFFAOYSA-N 1,2,3-thiadiazole Chemical compound C1=CSN=N1 UGUHFDPGDQDVGX-UHFFFAOYSA-N 0.000 claims description 2
- UDGKZGLPXCRRAM-UHFFFAOYSA-N 1,2,5-thiadiazole Chemical compound C=1C=NSN=1 UDGKZGLPXCRRAM-UHFFFAOYSA-N 0.000 claims description 2
- JNYLMODTPLSLIF-UHFFFAOYSA-N 6-(trifluoromethyl)pyridine-3-carboxylic acid Chemical group OC(=O)C1=CC=C(C(F)(F)F)N=C1 JNYLMODTPLSLIF-UHFFFAOYSA-N 0.000 claims description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims description 2
- 239000003880 polar aprotic solvent Substances 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 150000008064 anhydrides Chemical class 0.000 claims 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims 1
- 125000000168 pyrrolyl group Chemical group 0.000 claims 1
- 125000001302 tertiary amino group Chemical group 0.000 claims 1
- 102000003820 Lipoxygenases Human genes 0.000 abstract description 17
- 108090000128 Lipoxygenases Proteins 0.000 abstract description 17
- UYINJAQCJCYCGO-UHFFFAOYSA-N 2-oxo-3h-indole-1-carboxamide Chemical class C1=CC=C2N(C(=O)N)C(=O)CC2=C1 UYINJAQCJCYCGO-UHFFFAOYSA-N 0.000 abstract description 13
- 102000004005 Prostaglandin-endoperoxide synthases Human genes 0.000 abstract description 7
- 108090000459 Prostaglandin-endoperoxide synthases Proteins 0.000 abstract description 7
- 239000000730 antalgic agent Substances 0.000 abstract description 5
- 239000003814 drug Substances 0.000 abstract description 4
- 150000002431 hydrogen Chemical group 0.000 abstract description 4
- 230000000694 effects Effects 0.000 abstract description 3
- 239000003112 inhibitor Substances 0.000 abstract description 3
- 229910052736 halogen Inorganic materials 0.000 abstract 2
- 150000002367 halogens Chemical group 0.000 abstract 2
- 229940035676 analgesics Drugs 0.000 abstract 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 82
- 239000000243 solution Substances 0.000 description 64
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 60
- 239000007787 solid Substances 0.000 description 57
- 239000000203 mixture Substances 0.000 description 56
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 53
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 51
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 45
- 239000000047 product Substances 0.000 description 45
- 238000001914 filtration Methods 0.000 description 39
- 239000011541 reaction mixture Substances 0.000 description 37
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 36
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 36
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 27
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 25
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 25
- 238000003756 stirring Methods 0.000 description 25
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- WRJWRGBVPUUDLA-UHFFFAOYSA-N chlorosulfonyl isocyanate Chemical compound ClS(=O)(=O)N=C=O WRJWRGBVPUUDLA-UHFFFAOYSA-N 0.000 description 22
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 22
- 230000007062 hydrolysis Effects 0.000 description 22
- 238000006460 hydrolysis reaction Methods 0.000 description 22
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 22
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 19
- 229960000583 acetic acid Drugs 0.000 description 19
- 238000004458 analytical method Methods 0.000 description 19
- 239000002904 solvent Substances 0.000 description 19
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 16
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 16
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 16
- JYGFTBXVXVMTGB-UHFFFAOYSA-N indolin-2-one Chemical compound C1=CC=C2NC(=O)CC2=C1 JYGFTBXVXVMTGB-UHFFFAOYSA-N 0.000 description 16
- 235000011054 acetic acid Nutrition 0.000 description 14
- 238000000354 decomposition reaction Methods 0.000 description 14
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 14
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 12
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 238000001704 evaporation Methods 0.000 description 12
- 230000008020 evaporation Effects 0.000 description 12
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 12
- 239000010802 sludge Substances 0.000 description 12
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 11
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 11
- 239000002244 precipitate Substances 0.000 description 11
- 238000001953 recrystallisation Methods 0.000 description 11
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 10
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 9
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 9
- 208000002193 Pain Diseases 0.000 description 9
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 9
- 230000003110 anti-inflammatory effect Effects 0.000 description 9
- 239000013078 crystal Substances 0.000 description 9
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 9
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 9
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 8
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 8
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 8
- 230000000202 analgesic effect Effects 0.000 description 8
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 8
- 235000019341 magnesium sulphate Nutrition 0.000 description 8
- 239000012071 phase Substances 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 239000000284 extract Substances 0.000 description 7
- 239000002002 slurry Substances 0.000 description 7
- 229910052938 sodium sulfate Inorganic materials 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000012267 brine Substances 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 6
- 150000005623 oxindoles Chemical class 0.000 description 6
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 6
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 6
- 238000010561 standard procedure Methods 0.000 description 6
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 5
- 125000006495 3-trifluoromethyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])*)C(F)(F)F 0.000 description 5
- HSYFISNDMZKGRS-UHFFFAOYSA-N 4-chloro-1h-indole-2,3-dione Chemical compound ClC1=CC=CC2=C1C(=O)C(=O)N2 HSYFISNDMZKGRS-UHFFFAOYSA-N 0.000 description 5
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 5
- 241000124008 Mammalia Species 0.000 description 5
- 241000700159 Rattus Species 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 5
- 239000012362 glacial acetic acid Substances 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000000155 melt Substances 0.000 description 5
- 230000003647 oxidation Effects 0.000 description 5
- 238000007254 oxidation reaction Methods 0.000 description 5
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 5
- WGRHBRAKCHCGER-UHFFFAOYSA-N 5-chloro-2-oxo-3h-indole-1-carboxamide Chemical compound ClC1=CC=C2N(C(=O)N)C(=O)CC2=C1 WGRHBRAKCHCGER-UHFFFAOYSA-N 0.000 description 4
- JARRYVQFBQVOBE-UHFFFAOYSA-N 6-bromo-1,3-dihydroindol-2-one Chemical compound BrC1=CC=C2CC(=O)NC2=C1 JARRYVQFBQVOBE-UHFFFAOYSA-N 0.000 description 4
- RVXLBLSGEPQBIO-UHFFFAOYSA-N 6-chloro-1h-indole-2,3-dione Chemical compound ClC1=CC=C2C(=O)C(=O)NC2=C1 RVXLBLSGEPQBIO-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 206010030113 Oedema Diseases 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 4
- 239000011260 aqueous acid Substances 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 229920001525 carrageenan Polymers 0.000 description 4
- 235000010418 carrageenan Nutrition 0.000 description 4
- RNFNDJAIBTYOQL-UHFFFAOYSA-N chloral hydrate Chemical compound OC(O)C(Cl)(Cl)Cl RNFNDJAIBTYOQL-UHFFFAOYSA-N 0.000 description 4
- 229960002327 chloral hydrate Drugs 0.000 description 4
- 238000007796 conventional method Methods 0.000 description 4
- 238000003306 harvesting Methods 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 238000007363 ring formation reaction Methods 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- LWJLOHZFRVEQPM-UHFFFAOYSA-N 2-[2-(carbamoylamino)phenyl]acetic acid Chemical compound NC(=O)NC1=CC=CC=C1CC(O)=O LWJLOHZFRVEQPM-UHFFFAOYSA-N 0.000 description 3
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 3
- VZIRCHXYMBFNFD-IWQZZHSRSA-N 3-(2-furanyl)-2-propenal Chemical group O=C\C=C/C1=CC=CO1 VZIRCHXYMBFNFD-IWQZZHSRSA-N 0.000 description 3
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 description 3
- XNSPDJAXCBZCRV-UHFFFAOYSA-N 4-chloro-1,3-dihydroindol-2-one Chemical compound ClC1=CC=CC2=C1CC(=O)N2 XNSPDJAXCBZCRV-UHFFFAOYSA-N 0.000 description 3
- JIQWNLUFSNXDGO-UHFFFAOYSA-N 5-amino-2-oxo-3h-indole-1-carboxamide Chemical compound NC1=CC=C2N(C(=O)N)C(=O)CC2=C1 JIQWNLUFSNXDGO-UHFFFAOYSA-N 0.000 description 3
- CENVPIZOTHULGJ-UHFFFAOYSA-N 6-chloro-1,3-dihydroindol-2-one Chemical compound ClC1=CC=C2CC(=O)NC2=C1 CENVPIZOTHULGJ-UHFFFAOYSA-N 0.000 description 3
- FDUXWVHCBHIAEQ-UHFFFAOYSA-N 6-methyl-2-oxo-3h-indole-1-carbothioamide Chemical compound CC1=CC=C2CC(=O)N(C(N)=S)C2=C1 FDUXWVHCBHIAEQ-UHFFFAOYSA-N 0.000 description 3
- LSDLWEPTMDDXGX-UHFFFAOYSA-N 6-oxo-7h-[1,3]dioxolo[4,5-f]indole-5-carboxamide Chemical compound C1=C2N(C(=O)N)C(=O)CC2=CC2=C1OCO2 LSDLWEPTMDDXGX-UHFFFAOYSA-N 0.000 description 3
- BRTXRFCARXOWJV-UHFFFAOYSA-N 6-phenyl-1,3-dihydroindol-2-one Chemical compound C1=C2NC(=O)CC2=CC=C1C1=CC=CC=C1 BRTXRFCARXOWJV-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 208000017667 Chronic Disease Diseases 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 241000699666 Mus <mouse, genus> Species 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 230000003187 abdominal effect Effects 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 230000008602 contraction Effects 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 3
- 229910052753 mercury Inorganic materials 0.000 description 3
- 230000001590 oxidative effect Effects 0.000 description 3
- 239000012429 reaction media Substances 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 208000024891 symptom Diseases 0.000 description 3
- IXZDIALLLMRYOU-UHFFFAOYSA-N tert-butyl hypochlorite Chemical compound CC(C)(C)OCl IXZDIALLLMRYOU-UHFFFAOYSA-N 0.000 description 3
- 125000004512 1,2,3-thiadiazol-4-yl group Chemical group S1N=NC(=C1)* 0.000 description 2
- 125000004518 1,2,5-thiadiazol-3-yl group Chemical group S1N=C(C=N1)* 0.000 description 2
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 2
- TVPAHVAHFPSRPN-UHFFFAOYSA-N 2-[2-(carbamoylamino)-5-chlorophenyl]acetic acid Chemical compound NC(=O)NC1=CC=C(Cl)C=C1CC(O)=O TVPAHVAHFPSRPN-UHFFFAOYSA-N 0.000 description 2
- DJPAQYXQRCWKEH-UHFFFAOYSA-N 2-chloro-n-(3-chloro-4-fluorophenyl)acetamide Chemical compound FC1=CC=C(NC(=O)CCl)C=C1Cl DJPAQYXQRCWKEH-UHFFFAOYSA-N 0.000 description 2
- OFTKFKYVSBNYEC-UHFFFAOYSA-N 2-furoyl chloride Chemical compound ClC(=O)C1=CC=CO1 OFTKFKYVSBNYEC-UHFFFAOYSA-N 0.000 description 2
- DOLQYFPDPKPQSS-UHFFFAOYSA-N 3,4-dimethylaniline Chemical compound CC1=CC=C(N)C=C1C DOLQYFPDPKPQSS-UHFFFAOYSA-N 0.000 description 2
- DCWSRBDYLSWXIS-UHFFFAOYSA-N 4,5-dimethyl-1,3-dihydroindol-2-one Chemical compound CC1=CC=C2NC(=O)CC2=C1C DCWSRBDYLSWXIS-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- SJIANDNABPJQQW-UHFFFAOYSA-N 5,6-dimethyl-1,3-dihydroindol-2-one Chemical compound C1=C(C)C(C)=CC2=C1NC(=O)C2 SJIANDNABPJQQW-UHFFFAOYSA-N 0.000 description 2
- BRWIXNVFRUVHEU-UHFFFAOYSA-N 5,6-dimethyl-1h-indole-2,3-dione Chemical compound C1=C(C)C(C)=CC2=C1C(=O)C(=O)N2 BRWIXNVFRUVHEU-UHFFFAOYSA-N 0.000 description 2
- HRMQSJQDTTZJPC-UHFFFAOYSA-N 5-acetyl-1,3-dihydroindol-2-one Chemical compound CC(=O)C1=CC=C2NC(=O)CC2=C1 HRMQSJQDTTZJPC-UHFFFAOYSA-N 0.000 description 2
- WWJLCYHYLZZXBE-UHFFFAOYSA-N 5-chloro-1,3-dihydroindol-2-one Chemical compound ClC1=CC=C2NC(=O)CC2=C1 WWJLCYHYLZZXBE-UHFFFAOYSA-N 0.000 description 2
- IGPDWKCUDHIIRL-UHFFFAOYSA-N 5-chloro-2-oxo-3-[oxo(thiophen-2-yl)methyl]-3H-indole-1-carboxamide Chemical compound C12=CC(Cl)=CC=C2N(C(=O)N)C(=O)C1C(=O)C1=CC=CS1 IGPDWKCUDHIIRL-UHFFFAOYSA-N 0.000 description 2
- FXAKOSWIPNPAME-UHFFFAOYSA-N 5-chloro-n-(2-methylpropanoyl)-2-oxo-3h-indole-1-carboxamide Chemical compound ClC1=CC=C2N(C(=O)NC(=O)C(C)C)C(=O)CC2=C1 FXAKOSWIPNPAME-UHFFFAOYSA-N 0.000 description 2
- DYTNNGQPYKZMNF-UHFFFAOYSA-N 5-ethoxy-1,3-dihydroindol-2-one Chemical compound CCOC1=CC=C2NC(=O)CC2=C1 DYTNNGQPYKZMNF-UHFFFAOYSA-N 0.000 description 2
- DDIIYGHHUMKDGI-UHFFFAOYSA-N 5-fluoro-1,3-dihydroindol-2-one Chemical compound FC1=CC=C2NC(=O)CC2=C1 DDIIYGHHUMKDGI-UHFFFAOYSA-N 0.000 description 2
- FIWADZAJMKCAHJ-UHFFFAOYSA-N 5-fluoro-3-methyl-1,3-dihydroindole-2-thione Chemical compound C1=C(F)C=C2C(C)C(=S)NC2=C1 FIWADZAJMKCAHJ-UHFFFAOYSA-N 0.000 description 2
- DFGZEOUBIHLXFD-UHFFFAOYSA-N 5-methoxy-1,3-dihydroindol-2-one Chemical compound COC1=CC=C2NC(=O)CC2=C1 DFGZEOUBIHLXFD-UHFFFAOYSA-N 0.000 description 2
- QDUXBJGXHPPFJG-UHFFFAOYSA-N 6-chloro-5-fluoro-1,3-dihydroindol-2-one Chemical compound C1=C(Cl)C(F)=CC2=C1NC(=O)C2 QDUXBJGXHPPFJG-UHFFFAOYSA-N 0.000 description 2
- KWXPDYCLJCAFSN-UHFFFAOYSA-N 6-fluoro-5-methyl-1,3-dihydroindol-2-one Chemical compound C1=C(F)C(C)=CC2=C1NC(=O)C2 KWXPDYCLJCAFSN-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- BWJOPAPSSXUXQZ-UHFFFAOYSA-N CC1=CC=CC2=C1CC(=O)N2C(N)=S Chemical compound CC1=CC=CC2=C1CC(=O)N2C(N)=S BWJOPAPSSXUXQZ-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- MDIAKIHKBBNYHF-UHFFFAOYSA-N Ethyl 2-(methylthio)acetate Chemical compound CCOC(=O)CSC MDIAKIHKBBNYHF-UHFFFAOYSA-N 0.000 description 2
- 206010061218 Inflammation Diseases 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical class OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 2
- GJEAMHAFPYZYDE-UHFFFAOYSA-N [C].[S] Chemical compound [C].[S] GJEAMHAFPYZYDE-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 229940121363 anti-inflammatory agent Drugs 0.000 description 2
- 239000002260 anti-inflammatory agent Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 239000000679 carrageenan Substances 0.000 description 2
- 229940113118 carrageenan Drugs 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 230000001684 chronic effect Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 238000010908 decantation Methods 0.000 description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- NJAONFWUEGWOPG-UHFFFAOYSA-N dimethyl 2-(4-bromo-2-nitrophenyl)propanedioate Chemical compound COC(=O)C(C(=O)OC)C1=CC=C(Br)C=C1[N+]([O-])=O NJAONFWUEGWOPG-UHFFFAOYSA-N 0.000 description 2
- BEPAFCGSDWSTEL-UHFFFAOYSA-N dimethyl malonate Chemical compound COC(=O)CC(=O)OC BEPAFCGSDWSTEL-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 125000002587 enol group Chemical group 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 230000004054 inflammatory process Effects 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 208000014674 injury Diseases 0.000 description 2
- 238000007918 intramuscular administration Methods 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- JXDYKVIHCLTXOP-UHFFFAOYSA-N isatin Chemical compound C1=CC=C2C(=O)C(=O)NC2=C1 JXDYKVIHCLTXOP-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- KHXUTOLCCFWPDH-UHFFFAOYSA-N methyl 2-(4-bromo-2-nitrophenyl)acetate Chemical compound COC(=O)CC1=CC=C(Br)C=C1[N+]([O-])=O KHXUTOLCCFWPDH-UHFFFAOYSA-N 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- XHWYMRSHIHIABJ-UHFFFAOYSA-N n-(cyclohexanecarbonyl)-2-oxo-3h-indole-1-carboxamide Chemical compound O=C1CC2=CC=CC=C2N1C(=O)NC(=O)C1CCCCC1 XHWYMRSHIHIABJ-UHFFFAOYSA-N 0.000 description 2
- 201000008482 osteoarthritis Diseases 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 201000003068 rheumatic fever Diseases 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 238000000638 solvent extraction Methods 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- 238000001356 surgical procedure Methods 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 230000008733 trauma Effects 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- UHVMMEOXYDMDKI-JKYCWFKZSA-L zinc;1-(5-cyanopyridin-2-yl)-3-[(1s,2s)-2-(6-fluoro-2-hydroxy-3-propanoylphenyl)cyclopropyl]urea;diacetate Chemical compound [Zn+2].CC([O-])=O.CC([O-])=O.CCC(=O)C1=CC=C(F)C([C@H]2[C@H](C2)NC(=O)NC=2N=CC(=CC=2)C#N)=C1O UHVMMEOXYDMDKI-JKYCWFKZSA-L 0.000 description 2
- IBRBMZRLVYKVRF-UHFFFAOYSA-N 1,2,4-trichloro-5-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(Cl)=C(Cl)C=C1Cl IBRBMZRLVYKVRF-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 1
- WRGKKASJBOREMB-UHFFFAOYSA-N 1,4-dibromo-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(Br)=CC=C1Br WRGKKASJBOREMB-UHFFFAOYSA-N 0.000 description 1
- LXBGCARVUPRYLA-UHFFFAOYSA-N 1-(ethoxymethyl)-2-nitrobenzene Chemical compound CCOCC1=CC=CC=C1[N+]([O-])=O LXBGCARVUPRYLA-UHFFFAOYSA-N 0.000 description 1
- SSUNBCWMOHUMAX-UHFFFAOYSA-N 1-propylindole-2,3-dione Chemical compound C1=CC=C2N(CCC)C(=O)C(=O)C2=C1 SSUNBCWMOHUMAX-UHFFFAOYSA-N 0.000 description 1
- NIXBYYISFAXGLX-UHFFFAOYSA-N 2,3,6,8-tetrahydro-[1,4]dioxino[2,3-f]indol-7-one Chemical compound O1CCOC2=C1C=C1CC(=O)NC1=C2 NIXBYYISFAXGLX-UHFFFAOYSA-N 0.000 description 1
- KWVPFECTOKLOBL-KTKRTIGZSA-N 2-[(z)-octadec-9-enoxy]ethanol Chemical compound CCCCCCCC\C=C/CCCCCCCCOCCO KWVPFECTOKLOBL-KTKRTIGZSA-N 0.000 description 1
- KMMODUZPTOWVLF-UHFFFAOYSA-N 2-chloro-n-(3-fluoro-4-methylphenyl)acetamide Chemical compound CC1=CC=C(NC(=O)CCl)C=C1F KMMODUZPTOWVLF-UHFFFAOYSA-N 0.000 description 1
- FPLOWVVRVZFWNW-UHFFFAOYSA-N 2-oxo-3-(2-thiophen-2-ylacetyl)-5-(trifluoromethyl)-3h-indole-1-carboxamide Chemical compound C12=CC(C(F)(F)F)=CC=C2N(C(=O)N)C(=O)C1C(=O)CC1=CC=CS1 FPLOWVVRVZFWNW-UHFFFAOYSA-N 0.000 description 1
- JOIMMTCVFICSRN-UHFFFAOYSA-N 2-oxo-6-(trifluoromethyl)-3h-indole-1-carboxamide Chemical compound C1=C(C(F)(F)F)C=C2N(C(=O)N)C(=O)CC2=C1 JOIMMTCVFICSRN-UHFFFAOYSA-N 0.000 description 1
- DOOGLKBITHHNEY-UHFFFAOYSA-N 2-oxo-6-phenyl-3h-indole-1-carboxamide Chemical compound C1=C2N(C(=O)N)C(=O)CC2=CC=C1C1=CC=CC=C1 DOOGLKBITHHNEY-UHFFFAOYSA-N 0.000 description 1
- JDLDHRUFULZMMW-UHFFFAOYSA-N 2-oxo-N-(thiophene-2-carbonyl)-3H-indole-1-carboxamide Chemical compound OC(C=1SC=CC=1)=NC(=O)N1C(CC2=CC=CC=C12)=O JDLDHRUFULZMMW-UHFFFAOYSA-N 0.000 description 1
- FOTITZRWZUAVPH-UHFFFAOYSA-N 2-phenylpropanoyl chloride Chemical compound ClC(=O)C(C)C1=CC=CC=C1 FOTITZRWZUAVPH-UHFFFAOYSA-N 0.000 description 1
- AXNUZKSSQHTNPZ-UHFFFAOYSA-N 3,4-difluoroaniline Chemical compound NC1=CC=C(F)C(F)=C1 AXNUZKSSQHTNPZ-UHFFFAOYSA-N 0.000 description 1
- SGWARXIRNQTLND-UHFFFAOYSA-N 3-(2-phenoxyacetyl)-1,3-dihydroindol-2-one Chemical compound O=C1NC2=CC=CC=C2C1C(=O)COC1=CC=CC=C1 SGWARXIRNQTLND-UHFFFAOYSA-N 0.000 description 1
- XWLIAACTIOFOOA-UHFFFAOYSA-N 3-(2-thiophen-2-ylacetyl)-1,3-dihydroindol-2-one Chemical compound O=C1NC2=CC=CC=C2C1C(=O)CC1=CC=CS1 XWLIAACTIOFOOA-UHFFFAOYSA-N 0.000 description 1
- MVZPGVKQORMMNZ-UHFFFAOYSA-N 3-(furan-2-carbonyl)-1,3-dihydroindol-2-one Chemical compound O=C1NC2=CC=CC=C2C1C(=O)C1=CC=CO1 MVZPGVKQORMMNZ-UHFFFAOYSA-N 0.000 description 1
- BZNRLFBUTXSYHJ-UHFFFAOYSA-N 3-(furan-3-carbonyl)-1,3-dihydroindol-2-one Chemical compound O=C1NC2=CC=CC=C2C1C(=O)C=1C=COC=1 BZNRLFBUTXSYHJ-UHFFFAOYSA-N 0.000 description 1
- JUPOEJXDARZUBY-UHFFFAOYSA-N 3-(thiophene-2-carbonyl)-1,3-dihydroindol-2-one Chemical compound O=C1NC2=CC=CC=C2C1C(=O)C1=CC=CS1 JUPOEJXDARZUBY-UHFFFAOYSA-N 0.000 description 1
- AROWMXMFGCAVGV-UHFFFAOYSA-N 3-acetyl-5-chloro-2-oxo-3h-indole-1-carboxamide Chemical compound C1=C(Cl)C=C2C(C(=O)C)C(=O)N(C(N)=O)C2=C1 AROWMXMFGCAVGV-UHFFFAOYSA-N 0.000 description 1
- YSEMCVGMNUUNRK-UHFFFAOYSA-N 3-chloro-4-fluoroaniline Chemical compound NC1=CC=C(F)C(Cl)=C1 YSEMCVGMNUUNRK-UHFFFAOYSA-N 0.000 description 1
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 1
- KCHLDNLIJVSRPK-UHFFFAOYSA-N 3-methylsulfanylaniline Chemical compound CSC1=CC=CC(N)=C1 KCHLDNLIJVSRPK-UHFFFAOYSA-N 0.000 description 1
- UZQSNRWCIFIUSJ-UHFFFAOYSA-N 4,5-dimethyl-1h-indole-2,3-dione Chemical compound CC1=CC=C2NC(=O)C(=O)C2=C1C UZQSNRWCIFIUSJ-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 1
- OGIQUQKNJJTLSZ-UHFFFAOYSA-N 4-butylaniline Chemical compound CCCCC1=CC=C(N)C=C1 OGIQUQKNJJTLSZ-UHFFFAOYSA-N 0.000 description 1
- LPOAFPIPCHFMQF-UHFFFAOYSA-N 4-butylsulfanylaniline Chemical compound CCCCSC1=CC=C(N)C=C1 LPOAFPIPCHFMQF-UHFFFAOYSA-N 0.000 description 1
- PJTZNVWIFVMORN-UHFFFAOYSA-N 4-chloro-5-fluoro-1,3-dihydroindol-2-one Chemical compound FC1=CC=C2NC(=O)CC2=C1Cl PJTZNVWIFVMORN-UHFFFAOYSA-N 0.000 description 1
- LPBWEMHFJIWLDB-UHFFFAOYSA-N 4-cycloheptylaniline Chemical compound C1=CC(N)=CC=C1C1CCCCCC1 LPBWEMHFJIWLDB-UHFFFAOYSA-N 0.000 description 1
- UBXDNWVNEZBDBN-UHFFFAOYSA-N 4-cyclopropylaniline Chemical compound C1=CC(N)=CC=C1C1CC1 UBXDNWVNEZBDBN-UHFFFAOYSA-N 0.000 description 1
- BXMRWUIRVNVUBM-UHFFFAOYSA-N 4-ethoxy-2-methyl-1-nitrobenzene Chemical compound CCOC1=CC=C([N+]([O-])=O)C(C)=C1 BXMRWUIRVNVUBM-UHFFFAOYSA-N 0.000 description 1
- KRZCOLNOCZKSDF-UHFFFAOYSA-N 4-fluoroaniline Chemical compound NC1=CC=C(F)C=C1 KRZCOLNOCZKSDF-UHFFFAOYSA-N 0.000 description 1
- RTZOGYCMIMOVHU-UHFFFAOYSA-N 4-methoxy-2-methyl-1-nitrobenzene Chemical compound COC1=CC=C([N+]([O-])=O)C(C)=C1 RTZOGYCMIMOVHU-UHFFFAOYSA-N 0.000 description 1
- SMBCXANIHQEDKM-UHFFFAOYSA-N 4-methylsulfinyl-2-oxo-3h-indole-1-carboxamide Chemical compound CS(=O)C1=CC=CC2=C1CC(=O)N2C(N)=O SMBCXANIHQEDKM-UHFFFAOYSA-N 0.000 description 1
- PIIZYNQECPTVEO-UHFFFAOYSA-N 4-nitro-m-cresol Chemical compound CC1=CC(O)=CC=C1[N+]([O-])=O PIIZYNQECPTVEO-UHFFFAOYSA-N 0.000 description 1
- ODGIMMLDVSWADK-UHFFFAOYSA-N 4-trifluoromethylaniline Chemical compound NC1=CC=C(C(F)(F)F)C=C1 ODGIMMLDVSWADK-UHFFFAOYSA-N 0.000 description 1
- ADDAYZCZQHOPJX-UHFFFAOYSA-N 5,6-dichloro-1,3-dihydroindol-2-one Chemical compound C1=C(Cl)C(Cl)=CC2=C1NC(=O)C2 ADDAYZCZQHOPJX-UHFFFAOYSA-N 0.000 description 1
- MSOLDJZABLHVER-UHFFFAOYSA-N 5,6-difluoro-1,3-dihydroindol-2-one Chemical compound C1=C(F)C(F)=CC2=C1NC(=O)C2 MSOLDJZABLHVER-UHFFFAOYSA-N 0.000 description 1
- FQIJOGDQWRLSQW-UHFFFAOYSA-N 5,6-difluoro-1h-indole-2,3-dione Chemical compound C1=C(F)C(F)=CC2=C1C(=O)C(=O)N2 FQIJOGDQWRLSQW-UHFFFAOYSA-N 0.000 description 1
- YUVNTBICDDRBFP-UHFFFAOYSA-N 5,6-dimethoxy-1,3-dihydroindol-2-one Chemical compound C1=C(OC)C(OC)=CC2=C1NC(=O)C2 YUVNTBICDDRBFP-UHFFFAOYSA-N 0.000 description 1
- VMHZOMPATBJFLM-UHFFFAOYSA-N 5,6-dimethoxy-2-oxo-3h-indole-1-carboxamide Chemical compound C1=C(OC)C(OC)=CC2=C1N(C(N)=O)C(=O)C2 VMHZOMPATBJFLM-UHFFFAOYSA-N 0.000 description 1
- RVFZMXCPHCAUQH-UHFFFAOYSA-N 5,7-dihydro-[1,3]dioxolo[4,5-f]indol-6-one Chemical compound C1=C2NC(=O)CC2=CC2=C1OCO2 RVFZMXCPHCAUQH-UHFFFAOYSA-N 0.000 description 1
- SVRPSHDWQRINRH-UHFFFAOYSA-N 5-(butanoylamino)-2-oxo-3h-indole-1-carboxamide Chemical compound CCCC(=O)NC1=CC=C2N(C(N)=O)C(=O)CC2=C1 SVRPSHDWQRINRH-UHFFFAOYSA-N 0.000 description 1
- DJUVRTVJSHICLO-UHFFFAOYSA-N 5-(thiophene-2-carbonyl)-1,3-dihydroindol-2-one Chemical compound C=1C=C2NC(=O)CC2=CC=1C(=O)C1=CC=CS1 DJUVRTVJSHICLO-UHFFFAOYSA-N 0.000 description 1
- RANTVMNWZIWPNR-UHFFFAOYSA-N 5-(trifluoromethyl)-1,3-dihydroindol-2-one Chemical compound FC(F)(F)C1=CC=C2NC(=O)CC2=C1 RANTVMNWZIWPNR-UHFFFAOYSA-N 0.000 description 1
- XHDJYQWGFIBCEP-UHFFFAOYSA-N 5-Chloro-1H-indole-2,3-dione Chemical compound ClC1=CC=C2NC(=O)C(=O)C2=C1 XHDJYQWGFIBCEP-UHFFFAOYSA-N 0.000 description 1
- ZTWKDUXLMZRVIP-UHFFFAOYSA-N 5-acetamido-2-oxo-3h-indole-1-carboxamide Chemical compound CC(=O)NC1=CC=C2N(C(N)=O)C(=O)CC2=C1 ZTWKDUXLMZRVIP-UHFFFAOYSA-N 0.000 description 1
- UDKDRHMZYSHXPG-UHFFFAOYSA-N 5-acetyl-2-oxo-3h-indole-1-carboxamide Chemical compound CC(=O)C1=CC=C2N(C(N)=O)C(=O)CC2=C1 UDKDRHMZYSHXPG-UHFFFAOYSA-N 0.000 description 1
- DZNAJEDQDMDIEL-UHFFFAOYSA-N 5-benzoyl-1,3-dihydroindol-2-one Chemical compound C=1C=C2NC(=O)CC2=CC=1C(=O)C1=CC=CC=C1 DZNAJEDQDMDIEL-UHFFFAOYSA-N 0.000 description 1
- QINDXNJHWFVYKA-UHFFFAOYSA-N 5-benzoyl-2-oxo-3h-indole-1-carboxamide Chemical compound C=1C=C2N(C(=O)N)C(=O)CC2=CC=1C(=O)C1=CC=CC=C1 QINDXNJHWFVYKA-UHFFFAOYSA-N 0.000 description 1
- VIMNAEVMZXIKFL-UHFFFAOYSA-N 5-bromo-1,3-dihydroindol-2-one Chemical compound BrC1=CC=C2NC(=O)CC2=C1 VIMNAEVMZXIKFL-UHFFFAOYSA-N 0.000 description 1
- DYYQFOLXWSGDTB-UHFFFAOYSA-N 5-butoxy-1,3-dihydroindol-2-one Chemical compound CCCCOC1=CC=C2NC(=O)CC2=C1 DYYQFOLXWSGDTB-UHFFFAOYSA-N 0.000 description 1
- JSUXWKVCRKZYRP-UHFFFAOYSA-N 5-butyl-1,3-dihydroindol-2-one Chemical compound CCCCC1=CC=C2NC(=O)CC2=C1 JSUXWKVCRKZYRP-UHFFFAOYSA-N 0.000 description 1
- WIEJKTTWCGNQHH-UHFFFAOYSA-N 5-butyl-1h-indole-2,3-dione Chemical compound CCCCC1=CC=C2NC(=O)C(=O)C2=C1 WIEJKTTWCGNQHH-UHFFFAOYSA-N 0.000 description 1
- WKGXYCVVQBRTBJ-UHFFFAOYSA-N 5-chloro-3-hydrazinylindol-2-one Chemical compound C1=C(Cl)C=C2C(=NN)C(=O)NC2=C1 WKGXYCVVQBRTBJ-UHFFFAOYSA-N 0.000 description 1
- YZYLXNPSGVLBST-UHFFFAOYSA-N 5-cycloheptyl-1,3-dihydroindol-2-one Chemical compound C=1C=C2NC(=O)CC2=CC=1C1CCCCCC1 YZYLXNPSGVLBST-UHFFFAOYSA-N 0.000 description 1
- AJZMZMYIAKKFOG-UHFFFAOYSA-N 5-cyclopropyl-1,3-dihydroindol-2-one Chemical compound C=1C=C2NC(=O)CC2=CC=1C1CC1 AJZMZMYIAKKFOG-UHFFFAOYSA-N 0.000 description 1
- FYGKPUITCUFXLV-UHFFFAOYSA-N 5-cyclopropyl-1h-indole-2,3-dione Chemical compound C1=C2C(=O)C(=O)NC2=CC=C1C1CC1 FYGKPUITCUFXLV-UHFFFAOYSA-N 0.000 description 1
- VAJCSPZKMVQIAP-UHFFFAOYSA-N 5-methyl-1h-indole-2,3-dione Chemical compound CC1=CC=C2NC(=O)C(=O)C2=C1 VAJCSPZKMVQIAP-UHFFFAOYSA-N 0.000 description 1
- YFBXTDAYOYBAJI-UHFFFAOYSA-N 5-methylindol-2-one Chemical compound C1=C(C)C=CC2=NC(=O)C=C21 YFBXTDAYOYBAJI-UHFFFAOYSA-N 0.000 description 1
- JQCGHRDKVZPCRO-UHFFFAOYSA-N 5-nitro-1,3-dihydroindol-2-one Chemical compound [O-][N+](=O)C1=CC=C2NC(=O)CC2=C1 JQCGHRDKVZPCRO-UHFFFAOYSA-N 0.000 description 1
- NCPKYLVJWGEWOH-UHFFFAOYSA-N 5-nitro-2-oxo-3h-indole-1-carboxamide Chemical compound [O-][N+](=O)C1=CC=C2N(C(=O)N)C(=O)CC2=C1 NCPKYLVJWGEWOH-UHFFFAOYSA-N 0.000 description 1
- LZPKWQOLOCLSBO-UHFFFAOYSA-N 6-(trifluoromethyl)-1,3-dihydroindol-2-one Chemical compound FC(F)(F)C1=CC=C2CC(=O)NC2=C1 LZPKWQOLOCLSBO-UHFFFAOYSA-N 0.000 description 1
- AVYXBQDFMLQUPH-UHFFFAOYSA-N 6-chloro-5-fluoro-2-oxo-3-(2-phenylacetyl)-3h-indole-1-carboxamide Chemical compound C12=CC(F)=C(Cl)C=C2N(C(=O)N)C(=O)C1C(=O)CC1=CC=CC=C1 AVYXBQDFMLQUPH-UHFFFAOYSA-N 0.000 description 1
- PKQNTFAOZIVXCE-UHFFFAOYSA-N 6-fluoro-1,3-dihydroindol-2-one Chemical compound FC1=CC=C2CC(=O)NC2=C1 PKQNTFAOZIVXCE-UHFFFAOYSA-N 0.000 description 1
- NRRNWSKVTZYIEO-UHFFFAOYSA-N 6-fluoro-2-oxo-3-(2-phenylacetyl)-3h-indole-1-carboxamide Chemical compound C12=CC=C(F)C=C2N(C(=O)N)C(=O)C1C(=O)CC1=CC=CC=C1 NRRNWSKVTZYIEO-UHFFFAOYSA-N 0.000 description 1
- WTLPTQGQDPDZTO-UHFFFAOYSA-N 6-fluoro-3-(furan-2-carbonyl)-1,3-dihydroindol-2-one Chemical compound O=C1NC2=CC(F)=CC=C2C1C(=O)C1=CC=CO1 WTLPTQGQDPDZTO-UHFFFAOYSA-N 0.000 description 1
- ZVFBNRGDTVHIRZ-UHFFFAOYSA-N 6-fluoro-3-(furan-2-carbonyl)-2-oxo-3h-indole-1-carboxamide Chemical compound C12=CC=C(F)C=C2N(C(=O)N)C(=O)C1C(=O)C1=CC=CO1 ZVFBNRGDTVHIRZ-UHFFFAOYSA-N 0.000 description 1
- YJLVZLKDIYVSPX-UHFFFAOYSA-N 6-fluoro-5-methyl-2-oxo-3h-indole-1-carboxamide Chemical compound C1=C(F)C(C)=CC2=C1N(C(N)=O)C(=O)C2 YJLVZLKDIYVSPX-UHFFFAOYSA-N 0.000 description 1
- OXOQGUGIJKUSRP-UHFFFAOYSA-N 6-methoxy-1,3-dihydroindol-2-one Chemical compound COC1=CC=C2CC(=O)NC2=C1 OXOQGUGIJKUSRP-UHFFFAOYSA-N 0.000 description 1
- YCSRYPJGUGUNGB-UHFFFAOYSA-N 6-methyl-1,3-dihydroindole-2-thione Chemical compound CC1=CC=C2CC(=S)NC2=C1 YCSRYPJGUGUNGB-UHFFFAOYSA-N 0.000 description 1
- DHNNEZDFLQUDAW-UHFFFAOYSA-N 6-methylsulfonyl-2-oxo-3h-indole-1-carboxamide Chemical compound CS(=O)(=O)C1=CC=C2CC(=O)N(C(N)=O)C2=C1 DHNNEZDFLQUDAW-UHFFFAOYSA-N 0.000 description 1
- FPDLUAACCNVSQA-UHFFFAOYSA-N 7-chloro-1,3-dihydroindol-2-one Chemical compound ClC1=CC=CC2=C1NC(=O)C2 FPDLUAACCNVSQA-UHFFFAOYSA-N 0.000 description 1
- 206010000060 Abdominal distension Diseases 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- FFKJOZSQMHNJRF-UHFFFAOYSA-N CCCCC1=CC=C2NC(=S)CC2=C1 Chemical compound CCCCC1=CC=C2NC(=S)CC2=C1 FFKJOZSQMHNJRF-UHFFFAOYSA-N 0.000 description 1
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- LOFDXZJSDVCYAS-UHFFFAOYSA-N Ethyl 3-furoate Chemical compound CCOC(=O)C=1C=COC=1 LOFDXZJSDVCYAS-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 208000023178 Musculoskeletal disease Diseases 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- 240000001090 Papaver somniferum Species 0.000 description 1
- 235000008753 Papaver somniferum Nutrition 0.000 description 1
- SCKXCAADGDQQCS-UHFFFAOYSA-N Performic acid Chemical compound OOC=O SCKXCAADGDQQCS-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 208000005298 acute pain Diseases 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 1
- 125000005134 alkynylsulfinyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000003857 carboxamides Chemical group 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- OBDABCRPZWESIL-UHFFFAOYSA-N cyclohexanecarbonyl isocyanate Chemical compound O=C=NC(=O)C1CCCCC1 OBDABCRPZWESIL-UHFFFAOYSA-N 0.000 description 1
- 230000003226 decolorizating effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001647 drug administration Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- FCZCIXQGZOUIDN-UHFFFAOYSA-N ethyl 2-diethoxyphosphinothioyloxyacetate Chemical compound CCOC(=O)COP(=S)(OCC)OCC FCZCIXQGZOUIDN-UHFFFAOYSA-N 0.000 description 1
- YMAWHLWKSJTZPH-UHFFFAOYSA-N ethyl 2-oxo-6-phenyl-3h-indole-1-carboxylate Chemical compound C1=C2N(C(=O)OCC)C(=O)CC2=CC=C1C1=CC=CC=C1 YMAWHLWKSJTZPH-UHFFFAOYSA-N 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000002483 medication Methods 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- DGEYTDCFMQMLTH-UHFFFAOYSA-N methanol;propan-2-ol Chemical compound OC.CC(C)O DGEYTDCFMQMLTH-UHFFFAOYSA-N 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- JNCFYJHIPGISLS-UHFFFAOYSA-N n-(2-oxo-3h-indole-1-carbonyl)sulfamoyl chloride Chemical compound C1=CC=C2N(C(=O)NS(=O)(=O)Cl)C(=O)CC2=C1 JNCFYJHIPGISLS-UHFFFAOYSA-N 0.000 description 1
- MDZULUPIIRBWJO-UHFFFAOYSA-N n-[5-chloro-2-oxo-3-(thiophene-2-carbonyl)-3h-indole-1-carbonyl]sulfamoyl chloride Chemical compound C12=CC(Cl)=CC=C2N(C(=O)NS(Cl)(=O)=O)C(=O)C1C(=O)C1=CC=CS1 MDZULUPIIRBWJO-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 229940100691 oral capsule Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 238000011176 pooling Methods 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- LTUDISCZKZHRMJ-UHFFFAOYSA-N potassium;hydrate Chemical compound O.[K] LTUDISCZKZHRMJ-UHFFFAOYSA-N 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 150000003864 primary ammonium salts Chemical class 0.000 description 1
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 150000003865 secondary ammonium salts Chemical class 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000010183 spectrum analysis Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 150000003866 tertiary ammonium salts Chemical class 0.000 description 1
- 150000007970 thio esters Chemical class 0.000 description 1
- QIQITDHWZYEEPA-UHFFFAOYSA-N thiophene-2-carbonyl chloride Chemical compound ClC(=O)C1=CC=CS1 QIQITDHWZYEEPA-UHFFFAOYSA-N 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/04—Centrally acting analgesics, e.g. opioids
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/30—Indoles; Hydrogenated indoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to carbon atoms of the hetero ring
- C07D209/32—Oxygen atoms
- C07D209/34—Oxygen atoms in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/30—Indoles; Hydrogenated indoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to carbon atoms of the hetero ring
- C07D209/42—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D407/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00
- C07D407/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings
- C07D407/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Pain & Pain Management (AREA)
- Public Health (AREA)
- Rheumatology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US59065984A | 1984-03-19 | 1984-03-19 | |
| US06/684,634 US4556672A (en) | 1984-03-19 | 1984-12-21 | 3-Substituted 2-oxindole-1-carboxamides as analgesic and anti-inflammatory agents |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| BG60347B2 true BG60347B2 (bg) | 1994-09-30 |
Family
ID=27080909
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BG069278A BG60347B2 (bg) | 1984-03-19 | 1985-03-18 | Метод за получаване на 3-заместени 2-оксиндол-1-карбоксамиди |
Country Status (36)
| Country | Link |
|---|---|
| US (1) | US4556672A (da) |
| EP (1) | EP0156603B1 (da) |
| JP (1) | JPH04235165A (da) |
| KR (1) | KR860001873B1 (da) |
| AT (1) | ATE45731T1 (da) |
| AU (1) | AU549927B2 (da) |
| BG (1) | BG60347B2 (da) |
| CA (2) | CA1251441A (da) |
| CS (1) | CS249539B2 (da) |
| CY (1) | CY1668A (da) |
| DE (1) | DE3572481D1 (da) |
| DK (1) | DK162090C (da) |
| EG (1) | EG17795A (da) |
| ES (1) | ES8603408A1 (da) |
| FI (2) | FI82042C (da) |
| GR (1) | GR850668B (da) |
| HK (1) | HK78392A (da) |
| HU (1) | HU196178B (da) |
| IE (1) | IE57743B1 (da) |
| IL (3) | IL85130A (da) |
| LV (1) | LV5618A3 (da) |
| MA (1) | MA20380A1 (da) |
| MY (1) | MY101987A (da) |
| NL (1) | NL940025I2 (da) |
| NO (1) | NO165799C (da) |
| NZ (2) | NZ224134A (da) |
| OA (1) | OA07966A (da) |
| PH (2) | PH21323A (da) |
| PL (1) | PL145951B1 (da) |
| PT (1) | PT80117B (da) |
| RO (1) | RO90952B (da) |
| SI (1) | SI8510440A8 (da) |
| SU (1) | SU1445556A3 (da) |
| UA (1) | UA6343A1 (da) |
| YU (1) | YU43870B (da) |
| ZW (1) | ZW4785A1 (da) |
Families Citing this family (66)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ATE63543T1 (de) * | 1984-02-07 | 1991-06-15 | Pfizer | 2-oxindolzwischenprodukte. |
| US4686224A (en) * | 1984-10-31 | 1987-08-11 | Pfizer Inc. | Oxindole antiinflammatory agents |
| EP0208510B1 (en) * | 1985-07-09 | 1991-09-11 | Pfizer Inc. | 1-substituted oxindole-3-carboxamines as antiinflammatory and analgesic agents |
| US4678802A (en) * | 1985-07-09 | 1987-07-07 | Pfizer Inc. | 1-acylcarbamoyloxindole-3-carboxamides as antiinflammatory agents |
| GB8623819D0 (en) * | 1986-10-03 | 1986-11-05 | Glaxo Group Ltd | Heterocyclic compounds |
| RO105052B1 (en) * | 1987-02-02 | 1994-12-01 | Pfizer | Producing process for the crystalline sodium salt, anhydre, of 5-chlorine-3-(2-tenoil)-2-oxindol-1-carboxamide |
| US4885370A (en) * | 1987-03-11 | 1989-12-05 | Pfizer Inc. | Synthetic method for indol-2(3H)-ones |
| US4761485A (en) * | 1987-03-11 | 1988-08-02 | Pfizer Inc. | Synthetic method for indol-2(3H)-ones |
| GB8720693D0 (en) * | 1987-09-03 | 1987-10-07 | Glaxo Group Ltd | Chemical compounds |
| DE3803775A1 (de) * | 1988-02-09 | 1989-08-17 | Boehringer Mannheim Gmbh | Neue substituierte lactame, verfahren zu ihrer herstellung und arzneimittel, die diese verbindungen enthalten |
| US4853409A (en) * | 1988-04-13 | 1989-08-01 | Pfizer Inc. | 3-substituted-2-oxindole-1-carboxamides for suppressing T-cell function |
| US4861794A (en) * | 1988-04-13 | 1989-08-29 | Pfizer Inc. | 3-substituted-2-oxindole-1-carboxamides as inhibitors of interleukin-1 biosynthesis |
| SK590689A3 (en) * | 1988-10-18 | 1996-03-06 | Pfizer | 3-aryl-2-oxindole-1-carboxamides and method of their preparation |
| DE68923673T2 (de) * | 1988-10-18 | 1996-01-18 | Pfizer | Prodrogen von antiinflammatorischen 3-Acyl-2-oxindol-1-carboxamiden. |
| HU215112B (hu) * | 1989-01-10 | 1998-12-28 | Pfizer Inc. | Eljárás gyulladáscsökkentő 1-heteroaril-3-acil-2-oxindol-származékok előállítására |
| US5047554A (en) * | 1989-04-18 | 1991-09-10 | Pfizer Inc. | 3-substituted-2-oxindole derivatives |
| US5300655A (en) * | 1989-04-18 | 1994-04-05 | Pfizer Inc. | 2-carboxy-thiophene derivatives |
| US5059693A (en) * | 1989-10-06 | 1991-10-22 | Pfizer Inc. | Process for making 3-aroyl-2-oxindole-1-carboxamides |
| IL95880A (en) * | 1989-10-13 | 1995-12-31 | Pfizer | Use of 3-Transformed History of 2-Oxindole for the Preparation of Pharmaceuticals for Inhibition of Interlaukio-1 Biosynthesis |
| WO1991009598A1 (en) * | 1990-01-05 | 1991-07-11 | Pfizer Inc. | Azaoxindole derivatives |
| US5008283A (en) * | 1990-03-19 | 1991-04-16 | Pfizer Inc. | Use of tenidap to inhibit activation of collagenase and to inhibit the activity of myeloperoxidase |
| US5006547A (en) * | 1990-03-19 | 1991-04-09 | Pfizer Inc. | Tenidap as an inhibitor of the release of elastase by neutrophils |
| US5064851A (en) * | 1990-07-24 | 1991-11-12 | Pfizer Inc. | 3-(1-substituted-pyrazoyl)-2-oxindole derivatives, compositions and use |
| US5095031A (en) * | 1990-08-20 | 1992-03-10 | Abbott Laboratories | Indole derivatives which inhibit leukotriene biosynthesis |
| US5122534A (en) * | 1991-02-08 | 1992-06-16 | Pfizer Inc. | Use of tenidap to reduce total serum cholesterol, ldl cholesterol and triglycerides |
| DE4111305C2 (de) * | 1991-04-08 | 1994-12-01 | Mack Chem Pharm | Pharmazeutische Zubereitung zur rektalen Applikation, die ein 2-Oxindol-l-carboxamid-derivat enthält |
| DE4111306C2 (de) * | 1991-04-08 | 1994-06-01 | Mack Chem Pharm | Pharmazeutische Zubereitungen, die ein 2-Oxindol-l-carboxamid-derivat enthalten und zur Injektion bestimmt sind |
| US5166401A (en) * | 1991-06-25 | 1992-11-24 | Pfizer Inc | Intermediates for 5-fluoro-6-chlorooxindole |
| US5210212A (en) * | 1991-06-25 | 1993-05-11 | Pfizer Inc | Process for 5-fluoro-6-chlorooxindole |
| TW438798B (en) * | 1992-10-07 | 2001-06-07 | Pfizer | 3-substituted 2-oxindole-1-carboxamide pharmaceutical compositions |
| US5288743A (en) * | 1992-11-20 | 1994-02-22 | Abbott Laboratories | Indole carboxylate derivatives which inhibit leukotriene biosynthesis |
| US5298522A (en) * | 1993-01-22 | 1994-03-29 | Pfizer Inc. | 6-chloro-5-fluoro-3-(2-thenoyl)-2-oxindole-1-carboxamide as an analgesic and anti-inflammatory agent while maintaining a normal urine protein/creatinine ratio |
| CN1116822A (zh) * | 1993-01-22 | 1996-02-14 | 美国辉瑞有限公司 | 6-氯-5-氟-3-(2-噻吩甲酰)-2-羟吲哚-1-羰酰胺的赖氨酸盐 |
| US5270331A (en) * | 1993-01-26 | 1993-12-14 | Pfizer, Inc. | Prodrugs of antiinflammatory 3-acyl-2-oxindole-1-carboxamides |
| ATE145206T1 (de) * | 1993-02-09 | 1996-11-15 | Pfizer | Oxindol 1-(n-(alkoxycarbonyl)>carboxamide und 1- (n-carboxamido>carboxamide als antiinflammatorische wirkstoffe |
| ES2076106B1 (es) * | 1993-08-26 | 1996-06-16 | Pfizer | Composiciones farmaceuticas a base de 2-oxindol-1-carboxamidas 3-sustituidas |
| US5449788A (en) * | 1994-01-28 | 1995-09-12 | Catalytica, Inc. | Process for preparing 2-oxindole-1-carboxamides |
| EP0679396A1 (en) * | 1994-03-02 | 1995-11-02 | Pfizer Inc. | Use of 3-substituted-2-oxidole-1-carboxamides for the manufacture of a medicament in the treatment and prevention of ischemia induced myocardial injury and cytokine mediated myocardial injury |
| US6469181B1 (en) | 1995-01-30 | 2002-10-22 | Catalytica, Inc. | Process for preparing 2-oxindoles and N-hydroxy-2-oxindoles |
| US5545656A (en) * | 1995-04-05 | 1996-08-13 | Pfizer Inc. | 2-Oxidole-1-carboxamide pharmaceutical agents for the treatment of alzheimer's disease |
| US6043232A (en) * | 1997-07-23 | 2000-03-28 | Nitromed, Inc. | Nitroso esters of beta-oxo-amides and aryl propionic acid derivatives of non-steroidal antiinflammatory drugs |
| US6051588A (en) * | 1995-04-19 | 2000-04-18 | Nitromed Inc | Nitroso esters of β-oxo-amides and aryl propionic acid derivatives of non-steroidal antiinflammatory drugs |
| US5703073A (en) * | 1995-04-19 | 1997-12-30 | Nitromed, Inc. | Compositions and methods to prevent toxicity induced by nonsteroidal antiinflammatory drugs |
| WO1997022605A1 (en) * | 1995-12-19 | 1997-06-26 | Pfizer Inc. | Stable, long acting salts of indole derivatives for the treatment of joint diseases |
| HUP9600855A3 (en) * | 1996-04-03 | 1998-04-28 | Egyt Gyogyszervegyeszeti Gyar | Process for producing tenidap |
| EP0826685A1 (en) * | 1996-08-21 | 1998-03-04 | Pfizer Inc. | Stable, long acting salts of carboxamides for the treatment of joint disease |
| EP1126838A4 (en) | 1998-10-30 | 2005-02-16 | Nitromed Inc | NITROSIS AND NITROSYAL NON-STEROID ANTI-INFLAMMATORY COMPOUNDS, COMPOSITIONS AND METHODS OF USE |
| US6153634A (en) * | 1998-12-17 | 2000-11-28 | Hoffmann-La Roche Inc. | 4,5-azolo-oxindoles |
| DK1157019T3 (da) * | 1998-12-17 | 2003-07-14 | Hoffmann La Roche | 4-alkenyl- (og alkynyl-)oxindoler som inhibitorer af cyklinafhængige kinaser, især CDK2 |
| AU760039B2 (en) | 1998-12-17 | 2003-05-08 | F. Hoffmann-La Roche Ag | 4-aryloxindoles as inhibitors of JNK protein kinases |
| WO2000035921A1 (en) | 1998-12-17 | 2000-06-22 | F. Hoffmann-La Roche Ag | 4,5-pyrazinoxindoles as protein kinase inhibitors |
| IT1308633B1 (it) | 1999-03-02 | 2002-01-09 | Nicox Sa | Nitrossiderivati. |
| JP2003512396A (ja) * | 1999-10-26 | 2003-04-02 | ザ・ユニバーシティ・オブ・テキサス・サウスウエスタン・メディカル・センター | インドリン化合物を投与することを含む脱毛症の処置方法 |
| US6313310B1 (en) | 1999-12-15 | 2001-11-06 | Hoffmann-La Roche Inc. | 4-and 5-alkynyloxindoles and 4-and 5-alkenyloxindoles |
| IT1318673B1 (it) * | 2000-08-08 | 2003-08-27 | Nicox Sa | Farmaci per le disfunzioni sessuali. |
| IT1318674B1 (it) * | 2000-08-08 | 2003-08-27 | Nicox Sa | Faramaci per l'incontinenza. |
| DE60234057D1 (de) | 2001-07-25 | 2009-11-26 | Raptor Pharmaceutical Inc | Zusammensetzungen und verfahren zur modulation des transports durch die blut-hirn-schranke |
| EP2392258B1 (en) | 2005-04-28 | 2014-10-08 | Proteus Digital Health, Inc. | Pharma-informatics system |
| US8795627B2 (en) | 2007-03-21 | 2014-08-05 | Raptor Pharmaceuticals Inc. | Treatment of liver disorders by administration of RAP conjugates |
| AU2010216512B2 (en) | 2009-02-20 | 2016-06-30 | 2-Bbb Medicines B.V. | Glutathione-based drug delivery system |
| WO2010129819A2 (en) | 2009-05-06 | 2010-11-11 | Laboratory Skin Care, Inc. | Dermal delivery compositions comprising active agent-calcium phosphate particle complexes and methods of using the same |
| US20120077778A1 (en) | 2010-09-29 | 2012-03-29 | Andrea Bourdelais | Ladder-Frame Polyether Conjugates |
| CN102911105B (zh) * | 2012-11-12 | 2013-12-04 | 辽宁科技大学 | 一种3-芳酰基吲哚化合物的合成方法 |
| CA2981066A1 (en) * | 2015-03-31 | 2016-10-06 | Monsanto Technology Llc | Processes for the preparation of 2-thiophenecarbonyl chloride |
| US10537552B2 (en) | 2015-05-05 | 2020-01-21 | Carafe Drug Innovation, Llc | Substituted 5-hydroxyoxindoles and their use as analgesics and fever reducers |
| AU2017238056A1 (en) | 2016-03-24 | 2018-10-04 | Monsanto Technology Llc | Processes for the preparation of heteroaryl carboxylic acids |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL125443C (da) * | 1963-06-06 | |||
| US3462450A (en) * | 1966-06-29 | 1969-08-19 | Merck & Co Inc | Chemical compounds |
| GB1158532A (en) * | 1967-01-05 | 1969-07-16 | Centre Nat Rech Scient | 2-Oxoindoline-3-Carboxylic Acids and Esters thereof |
| US3519592A (en) * | 1967-04-18 | 1970-07-07 | Smithkline Corp | Indole compounds |
| US3631177A (en) * | 1967-04-18 | 1971-12-28 | Smith Kline French Lab | 3-phenacyl-2-oxoindolines |
| BE714717A (da) * | 1967-05-12 | 1968-09-30 | ||
| FR7337M (da) * | 1968-01-11 | 1969-10-13 | ||
| BE756447A (fr) * | 1969-10-15 | 1971-03-22 | Pfizer | Oxindolecarboxamides |
| US3767653A (en) * | 1971-06-28 | 1973-10-23 | Squibb & Sons Inc | Thiazines |
| US3749731A (en) * | 1971-07-08 | 1973-07-31 | Warner Lambert Co | 2-oxo-n-(2-thiazolyl)-3-indoline-carboxamide |
| DE2306374A1 (de) * | 1973-02-09 | 1974-08-15 | Bayer Ag | Neue 3-substituierte 2-oxo-4-hydroxy1,2,3,4-tetrahydrochinazolin-4-carbonsaeureamide |
| US4012394A (en) * | 1973-02-16 | 1977-03-15 | Labaz | Indole derivatives |
| DE2314242A1 (de) * | 1973-03-22 | 1974-09-26 | Bayer Ag | Neue 3-substituierte 2-oxo-4-hydroxy1,2,3,4-tetrahydrochinazolin-4-carbonsaeurehydrazide |
| US3975531A (en) * | 1973-10-02 | 1976-08-17 | A. H. Robins Company, Incorporated | 4-(5- And 7-)benzoylindolin-2-ones and pharmaceutical uses thereof |
-
1984
- 1984-12-21 US US06/684,634 patent/US4556672A/en not_active Expired - Lifetime
-
1985
- 1985-03-15 DE DE8585301808T patent/DE3572481D1/de not_active Expired
- 1985-03-15 CA CA000476605A patent/CA1251441A/en not_active Expired
- 1985-03-15 PT PT80117A patent/PT80117B/pt unknown
- 1985-03-15 IE IE684/85A patent/IE57743B1/en not_active IP Right Cessation
- 1985-03-15 EP EP85301808A patent/EP0156603B1/en not_active Expired
- 1985-03-15 AT AT85301808T patent/ATE45731T1/de not_active IP Right Cessation
- 1985-03-15 GR GR850668A patent/GR850668B/el unknown
- 1985-03-17 EG EG174/85A patent/EG17795A/xx active
- 1985-03-18 KR KR1019850001746A patent/KR860001873B1/ko not_active IP Right Cessation
- 1985-03-18 SU SU853869754A patent/SU1445556A3/ru active
- 1985-03-18 BG BG069278A patent/BG60347B2/bg unknown
- 1985-03-18 UA UA3869754A patent/UA6343A1/uk unknown
- 1985-03-18 IL IL85130A patent/IL85130A/xx not_active IP Right Cessation
- 1985-03-18 PH PH32001A patent/PH21323A/en unknown
- 1985-03-18 ES ES541372A patent/ES8603408A1/es not_active Expired
- 1985-03-18 PL PL1985252434A patent/PL145951B1/pl unknown
- 1985-03-18 IL IL74631A patent/IL74631A/xx not_active IP Right Cessation
- 1985-03-18 AU AU40059/85A patent/AU549927B2/en not_active Expired
- 1985-03-18 NO NO851054A patent/NO165799C/no not_active IP Right Cessation
- 1985-03-18 MA MA20604A patent/MA20380A1/fr unknown
- 1985-03-18 HU HU85992A patent/HU196178B/hu unknown
- 1985-03-18 FI FI851069A patent/FI82042C/fi not_active IP Right Cessation
- 1985-03-18 ZW ZW47/85A patent/ZW4785A1/xx unknown
- 1985-03-18 DK DK121385A patent/DK162090C/da not_active IP Right Cessation
- 1985-03-18 NZ NZ224134A patent/NZ224134A/xx unknown
- 1985-03-18 NZ NZ211486A patent/NZ211486A/xx unknown
- 1985-03-19 SI SI8510440A patent/SI8510440A8/sl unknown
- 1985-03-19 RO RO118055A patent/RO90952B/ro unknown
- 1985-03-19 YU YU440/85A patent/YU43870B/xx unknown
- 1985-03-19 CS CS851920A patent/CS249539B2/cs unknown
- 1985-03-19 OA OA58541A patent/OA07966A/xx unknown
-
1986
- 1986-02-21 PH PH33439A patent/PH21470A/en unknown
-
1987
- 1987-08-17 MY MYPI87001358A patent/MY101987A/en unknown
-
1988
- 1988-01-19 IL IL85130A patent/IL85130A0/xx unknown
- 1988-07-07 CA CA000571475A patent/CA1288422C/en not_active Expired - Fee Related
-
1989
- 1989-09-26 FI FI894540A patent/FI82449C/fi not_active IP Right Cessation
-
1991
- 1991-06-04 JP JP3132826A patent/JPH04235165A/ja active Granted
-
1992
- 1992-10-15 HK HK783/92A patent/HK78392A/xx not_active IP Right Cessation
-
1993
- 1993-05-14 CY CY1668A patent/CY1668A/xx unknown
- 1993-11-11 LV LV931200A patent/LV5618A3/xx unknown
-
1994
- 1994-12-15 NL NL940025C patent/NL940025I2/nl unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| BG60347B2 (bg) | Метод за получаване на 3-заместени 2-оксиндол-1-карбоксамиди | |
| CA1255658A (en) | N, 3-disubstituted 2-oxindole-1-carboxamides as analgesic and antiinflammatory agents | |
| EP0175551B1 (en) | Analgesic and antiinflammatory 1,3-diacyl-2-oxindole compounds | |
| US4721712A (en) | 1,3-disubstituted 2-oxindoles as analgesic and anti-inflammatory agents | |
| FI85265B (fi) | Foerfarande foer framstaellning av 2- oxindol-1-karboxamider och vid foerfarandet anvaenda mellanprodukter. | |
| EP0153818A2 (en) | 1,3-Disubstituted 2-oxindoles as analgesic and anti-inflammatory agents | |
| US4665194A (en) | Process for making 2-oxindole-1-carboxamides and intermediates therefor | |
| DD232039A5 (de) | Verfahren zur herstellung einer 2-oxinidol-1-carboxamid-verbindung | |
| US4652658A (en) | Process for making 2-oxindole-1-carboxamides and intermediates therefor | |
| BG60375B2 (bg) | Заместени на 3-то място 2-оксиндол-1-карбоксамиди като аналгетични и противовъзпалителни вещества | |
| CA1287626C (en) | N-substituted 2-ixindole-1-carboxamides useful as intermediates for producing analgesic and antiinflammatory agents | |
| HU194165B (en) | Process for preparing 1,3-oxyacyl-2-oxindole derivatives | |
| CA1255657A (en) | 1,3-disubstituted 2-oxindoles as analgesic and anti- inflammatory agents | |
| CA1289556C (en) | 1- or 3-monosubstituted 2-oxindole compound intermediates useful for the production of analgesic and anti-inflammatory agents | |
| NO163132B (no) | Analogifremgangsmaate for fremstilling av en terapeutisk aktiv 2-oksindol-1-karboksamid-forbindelse og mellomproduktfor fremstilling derav. | |
| CA1253490A (en) | Process for making 2-oxindole-1-carboxamides | |
| IE850288L (en) | Analgesic oxindoles. |