AU635842B2 - Bleaching composition - Google Patents
Bleaching composition Download PDFInfo
- Publication number
- AU635842B2 AU635842B2 AU77319/91A AU7731991A AU635842B2 AU 635842 B2 AU635842 B2 AU 635842B2 AU 77319/91 A AU77319/91 A AU 77319/91A AU 7731991 A AU7731991 A AU 7731991A AU 635842 B2 AU635842 B2 AU 635842B2
- Authority
- AU
- Australia
- Prior art keywords
- cationic
- alkyl
- group
- anion
- nitrile
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 239000000203 mixture Substances 0.000 title claims description 50
- 238000004061 bleaching Methods 0.000 title claims description 14
- -1 cationic nitrile Chemical class 0.000 claims description 84
- 239000002243 precursor Substances 0.000 claims description 41
- 239000007844 bleaching agent Substances 0.000 claims description 28
- 150000001875 compounds Chemical class 0.000 claims description 23
- 239000003599 detergent Substances 0.000 claims description 20
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 150000002978 peroxides Chemical class 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 14
- 239000004094 surface-active agent Substances 0.000 claims description 13
- 150000001450 anions Chemical class 0.000 claims description 12
- 150000002825 nitriles Chemical class 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 150000005215 alkyl ethers Chemical class 0.000 claims description 5
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 claims description 5
- 239000011149 active material Substances 0.000 claims description 4
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-M toluene-4-sulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-M 0.000 claims description 4
- 150000001335 aliphatic alkanes Chemical class 0.000 claims description 3
- 125000005011 alkyl ether group Chemical group 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- 159000000000 sodium salts Chemical class 0.000 claims description 3
- 229910021653 sulphate ion Inorganic materials 0.000 claims description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 2
- QTDIEDOANJISNP-UHFFFAOYSA-N 2-dodecoxyethyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOCCOS(O)(=O)=O QTDIEDOANJISNP-UHFFFAOYSA-N 0.000 claims description 2
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 239000012188 paraffin wax Substances 0.000 claims description 2
- 239000011872 intimate mixture Substances 0.000 claims 1
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 39
- 239000000463 material Substances 0.000 description 25
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 20
- 239000011734 sodium Substances 0.000 description 20
- KFZMGEQAYNKOFK-UHFFFAOYSA-N isopropyl alcohol Natural products CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 17
- 239000000047 product Substances 0.000 description 17
- 229910052708 sodium Inorganic materials 0.000 description 17
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 16
- 239000007787 solid Substances 0.000 description 16
- 238000005481 NMR spectroscopy Methods 0.000 description 14
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 150000004965 peroxy acids Chemical class 0.000 description 9
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical compound C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 description 8
- 239000000344 soap Substances 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 239000000654 additive Substances 0.000 description 7
- 238000003556 assay Methods 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 235000014113 dietary fatty acids Nutrition 0.000 description 7
- 239000000194 fatty acid Substances 0.000 description 7
- 229930195729 fatty acid Natural products 0.000 description 7
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical compound O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 125000000129 anionic group Chemical group 0.000 description 6
- 150000004665 fatty acids Chemical class 0.000 description 6
- 238000005342 ion exchange Methods 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- 230000000996 additive effect Effects 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 125000002091 cationic group Chemical group 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- BGRWYDHXPHLNKA-UHFFFAOYSA-N Tetraacetylethylenediamine Chemical compound CC(=O)N(C(C)=O)CCN(C(C)=O)C(C)=O BGRWYDHXPHLNKA-UHFFFAOYSA-N 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 239000011575 calcium Substances 0.000 description 4
- 229910052791 calcium Inorganic materials 0.000 description 4
- ONANWDUDFJIIGP-UHFFFAOYSA-N carbamoyl carbamoperoxoate Chemical compound NC(=O)OOC(N)=O ONANWDUDFJIIGP-UHFFFAOYSA-N 0.000 description 4
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 229960001922 sodium perborate Drugs 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- GQJKKKULUSFWSC-UHFFFAOYSA-N 2-(dimethylamino)propanenitrile Chemical compound N#CC(C)N(C)C GQJKKKULUSFWSC-UHFFFAOYSA-N 0.000 description 3
- PUAQLLVFLMYYJJ-UHFFFAOYSA-N 2-aminopropiophenone Chemical compound CC(N)C(=O)C1=CC=CC=C1 PUAQLLVFLMYYJJ-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical class C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 235000019864 coconut oil Nutrition 0.000 description 3
- 239000003240 coconut oil Substances 0.000 description 3
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 description 3
- 230000003301 hydrolyzing effect Effects 0.000 description 3
- 230000000269 nucleophilic effect Effects 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 229940045872 sodium percarbonate Drugs 0.000 description 3
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Substances CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 3
- 239000010457 zeolite Substances 0.000 description 3
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical class OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 2
- RIDGSEGTBIWFTK-UHFFFAOYSA-N 2-(dimethylamino)-2-methylpropanenitrile Chemical compound CN(C)C(C)(C)C#N RIDGSEGTBIWFTK-UHFFFAOYSA-N 0.000 description 2
- XSVSPKKXQGNHMD-UHFFFAOYSA-N 5-bromo-3-methyl-1,2-thiazole Chemical compound CC=1C=C(Br)SN=1 XSVSPKKXQGNHMD-UHFFFAOYSA-N 0.000 description 2
- 244000060011 Cocos nucifera Species 0.000 description 2
- 235000013162 Cocos nucifera Nutrition 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical class OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 239000001083 [(2R,3R,4S,5R)-1,2,4,5-tetraacetyloxy-6-oxohexan-3-yl] acetate Substances 0.000 description 2
- DNVWJWSHVBHFKS-UHFFFAOYSA-N acetonitrile N-methylmethanamine Chemical compound C(C)#N.CNC DNVWJWSHVBHFKS-UHFFFAOYSA-N 0.000 description 2
- MWCHNHCXSRTHRF-UHFFFAOYSA-N acetonitrile;trimethylazanium;chloride Chemical compound [Cl-].CC#N.C[NH+](C)C MWCHNHCXSRTHRF-UHFFFAOYSA-N 0.000 description 2
- 239000012190 activator Substances 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 239000012670 alkaline solution Substances 0.000 description 2
- 229910000323 aluminium silicate Inorganic materials 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 2
- KVNRLNFWIYMESJ-UHFFFAOYSA-N butyronitrile Chemical compound CCCC#N KVNRLNFWIYMESJ-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 2
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 2
- 238000007580 dry-mixing Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 229960001484 edetic acid Drugs 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229940088598 enzyme Drugs 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- 229940070765 laurate Drugs 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- YDSWCNNOKPMOTP-UHFFFAOYSA-N mellitic acid Chemical class OC(=O)C1=C(C(O)=O)C(C(O)=O)=C(C(O)=O)C(C(O)=O)=C1C(O)=O YDSWCNNOKPMOTP-UHFFFAOYSA-N 0.000 description 2
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 125000005342 perphosphate group Chemical group 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 230000001376 precipitating effect Effects 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 2
- 239000003352 sequestering agent Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 235000019832 sodium triphosphate Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- 239000003760 tallow Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000004711 α-olefin Substances 0.000 description 2
- CFPOJWPDQWJEMO-UHFFFAOYSA-N 2-(1,2-dicarboxyethoxy)butanedioic acid Chemical class OC(=O)CC(C(O)=O)OC(C(O)=O)CC(O)=O CFPOJWPDQWJEMO-UHFFFAOYSA-N 0.000 description 1
- PLXBWEPPAAQASG-UHFFFAOYSA-N 2-(Dimethylamino)acetonitrile Chemical compound CN(C)CC#N PLXBWEPPAAQASG-UHFFFAOYSA-N 0.000 description 1
- PAGHXXKYFBGJEH-UHFFFAOYSA-N 2-(dimethylamino)-2-phenylacetonitrile Chemical compound CN(C)C(C#N)C1=CC=CC=C1 PAGHXXKYFBGJEH-UHFFFAOYSA-N 0.000 description 1
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 1
- QDDADYIRBDHPRY-UHFFFAOYSA-N 3-(carboxymethoxy)-3-oxopropanoic acid Chemical compound OC(=O)COC(=O)CC(O)=O QDDADYIRBDHPRY-UHFFFAOYSA-N 0.000 description 1
- MTPJEFOSTIKRSS-UHFFFAOYSA-N 3-(dimethylamino)propanenitrile Chemical compound CN(C)CCC#N MTPJEFOSTIKRSS-UHFFFAOYSA-N 0.000 description 1
- BFNQEPXIHHFTOO-UHFFFAOYSA-N 4-methylbenzenesulfonate;propanenitrile;trimethylazanium Chemical compound CCC#N.C[NH+](C)C.CC1=CC=C(S([O-])(=O)=O)C=C1 BFNQEPXIHHFTOO-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 102000013142 Amylases Human genes 0.000 description 1
- 108010065511 Amylases Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 102100031102 C-C motif chemokine 4 Human genes 0.000 description 1
- WFVBUMXBBHLYOD-UHFFFAOYSA-N CC#N.CN(C)C.CCCCCCCCCCCCC1=CC=CC=C1 Chemical compound CC#N.CN(C)C.CCCCCCCCCCCCC1=CC=CC=C1 WFVBUMXBBHLYOD-UHFFFAOYSA-N 0.000 description 1
- BMDATSAUAFBAGX-UHFFFAOYSA-N CCC#N.CC1=CC=C(S(O)(=O)=O)C=C1 Chemical compound CCC#N.CC1=CC=C(S(O)(=O)=O)C=C1 BMDATSAUAFBAGX-UHFFFAOYSA-N 0.000 description 1
- 101100054773 Caenorhabditis elegans act-2 gene Proteins 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 102000005575 Cellulases Human genes 0.000 description 1
- 108010084185 Cellulases Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 101000585693 Homo sapiens Mitochondrial 2-oxodicarboxylate carrier Proteins 0.000 description 1
- 101001041245 Homo sapiens Ornithine decarboxylase Proteins 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- 239000004367 Lipase Substances 0.000 description 1
- 102000004882 Lipase Human genes 0.000 description 1
- 108090001060 Lipase Proteins 0.000 description 1
- ONNXINSZGXOWAQ-UHFFFAOYSA-N N,N-dimethylmethanamine propanenitrile Chemical compound CCC#N.CN(C)C ONNXINSZGXOWAQ-UHFFFAOYSA-N 0.000 description 1
- SUZRRICLUFMAQD-UHFFFAOYSA-N N-Methyltaurine Chemical compound CNCCS(O)(=O)=O SUZRRICLUFMAQD-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 102100021079 Ornithine decarboxylase Human genes 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- 229930182556 Polyacetal Natural products 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 239000004902 Softening Agent Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical class OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 244000269722 Thea sinensis Species 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- UAOKXEHOENRFMP-ZJIFWQFVSA-N [(2r,3r,4s,5r)-2,3,4,5-tetraacetyloxy-6-oxohexyl] acetate Chemical compound CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C=O UAOKXEHOENRFMP-ZJIFWQFVSA-N 0.000 description 1
- ZYPMNZKYVVSXOJ-YNEHKIRRSA-N [(2r,3s,4r)-2,3,4-triacetyloxy-5-oxopentyl] acetate Chemical compound CC(=O)OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C=O ZYPMNZKYVVSXOJ-YNEHKIRRSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- HFVYXBUPSBLINW-UHFFFAOYSA-N acetonitrile;4-methylbenzenesulfonate;trimethylazanium Chemical compound CC#N.C[NH+](C)C.CC1=CC=C(S([O-])(=O)=O)C=C1 HFVYXBUPSBLINW-UHFFFAOYSA-N 0.000 description 1
- GHDBLWVVUWTQCG-UHFFFAOYSA-N acetonitrile;n,n-dimethylmethanamine Chemical compound CC#N.CN(C)C GHDBLWVVUWTQCG-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000004973 alkali metal peroxides Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 229920013820 alkyl cellulose Polymers 0.000 description 1
- 235000019418 amylase Nutrition 0.000 description 1
- 229940025131 amylases Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- AQOITUVWAVXUIH-UHFFFAOYSA-N benzenesulfonyl hexaneperoxoate Chemical compound CCCCCC(=O)OOS(=O)(=O)C1=CC=CC=C1 AQOITUVWAVXUIH-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M bisulphate group Chemical group S([O-])(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- RZLMWKCPLUKMQV-UHFFFAOYSA-N butanenitrile N,N-dimethylmethanamine Chemical compound CN(C)C.CCCC#N RZLMWKCPLUKMQV-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 150000001767 cationic compounds Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 238000004851 dishwashing Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000007850 fluorescent dye Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940045996 isethionic acid Drugs 0.000 description 1
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 description 1
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 235000019421 lipase Nutrition 0.000 description 1
- 150000004668 long chain fatty acids Chemical class 0.000 description 1
- 208000020442 loss of weight Diseases 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- AIXYHMWIAPSTQG-UHFFFAOYSA-N methyl 2-dodecylbenzenesulfonate Chemical compound CCCCCCCCCCCCC1=CC=CC=C1S(=O)(=O)OC AIXYHMWIAPSTQG-UHFFFAOYSA-N 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical group [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- VVTMNCICAIKIRN-UHFFFAOYSA-N phenyl benzoate;sodium Chemical compound [Na].C=1C=CC=CC=1C(=O)OC1=CC=CC=C1 VVTMNCICAIKIRN-UHFFFAOYSA-N 0.000 description 1
- 125000005496 phosphonium group Chemical group 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- MNWBNISUBARLIT-UHFFFAOYSA-N sodium cyanide Chemical compound [Na+].N#[C-] MNWBNISUBARLIT-UHFFFAOYSA-N 0.000 description 1
- BTURAGWYSMTVOW-UHFFFAOYSA-M sodium dodecanoate Chemical compound [Na+].CCCCCCCCCCCC([O-])=O BTURAGWYSMTVOW-UHFFFAOYSA-M 0.000 description 1
- 239000004289 sodium hydrogen sulphite Substances 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 229940082004 sodium laurate Drugs 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 229940048086 sodium pyrophosphate Drugs 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 150000004685 tetrahydrates Chemical class 0.000 description 1
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 1
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- AQLJVWUFPCUVLO-UHFFFAOYSA-N urea hydrogen peroxide Chemical compound OO.NC(N)=O AQLJVWUFPCUVLO-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11C—STATIC STORES
- G11C11/00—Digital stores characterised by the use of particular electric or magnetic storage elements; Storage elements therefor
- G11C11/21—Digital stores characterised by the use of particular electric or magnetic storage elements; Storage elements therefor using electric elements
- G11C11/34—Digital stores characterised by the use of particular electric or magnetic storage elements; Storage elements therefor using electric elements using semiconductor devices
- G11C11/40—Digital stores characterised by the use of particular electric or magnetic storage elements; Storage elements therefor using electric elements using semiconductor devices using transistors
- G11C11/401—Digital stores characterised by the use of particular electric or magnetic storage elements; Storage elements therefor using electric elements using semiconductor devices using transistors forming cells needing refreshing or charge regeneration, i.e. dynamic cells
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3905—Bleach activators or bleach catalysts
- C11D3/3907—Organic compounds
- C11D3/3917—Nitrogen-containing compounds
- C11D3/3925—Nitriles; Isocyanates or quarternary ammonium nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/01—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms
- C07C255/24—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms containing cyano groups and singly-bound nitrogen atoms, not being further bound to other hetero atoms, bound to the same saturated acyclic carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/01—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms
- C07C255/24—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms containing cyano groups and singly-bound nitrogen atoms, not being further bound to other hetero atoms, bound to the same saturated acyclic carbon skeleton
- C07C255/25—Aminoacetonitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/01—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms
- C07C255/32—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms having cyano groups bound to acyclic carbon atoms of a carbon skeleton containing at least one six-membered aromatic ring
- C07C255/42—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms having cyano groups bound to acyclic carbon atoms of a carbon skeleton containing at least one six-membered aromatic ring the carbon skeleton being further substituted by singly-bound nitrogen atoms, not being further bound to other hetero atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Inorganic Chemistry (AREA)
- Wood Science & Technology (AREA)
- Microelectronics & Electronic Packaging (AREA)
- Computer Hardware Design (AREA)
- Detergent Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Power Sources (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB9012001 | 1990-05-30 | ||
| GB909012001A GB9012001D0 (en) | 1990-05-30 | 1990-05-30 | Bleaching composition |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU7731991A AU7731991A (en) | 1991-12-05 |
| AU635842B2 true AU635842B2 (en) | 1993-04-01 |
Family
ID=10676739
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU77319/91A Ceased AU635842B2 (en) | 1990-05-30 | 1991-05-27 | Bleaching composition |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US5281361A (enExample) |
| EP (1) | EP0464880B1 (enExample) |
| JP (1) | JPH0832672B2 (enExample) |
| KR (2) | KR910020164A (enExample) |
| AU (1) | AU635842B2 (enExample) |
| BR (1) | BR9102223A (enExample) |
| CA (1) | CA2043210A1 (enExample) |
| DE (1) | DE69105836D1 (enExample) |
| GB (1) | GB9012001D0 (enExample) |
| IN (1) | IN172906B (enExample) |
| NO (1) | NO912036L (enExample) |
| ZA (1) | ZA914149B (enExample) |
Families Citing this family (73)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SK278833B6 (sk) * | 1992-01-17 | 1998-03-04 | Unilever Nv | Časticová bieliaca detergentná zmes |
| SK278834B6 (sk) * | 1992-01-17 | 1998-03-04 | Unilever Nv | Časticová bieliaca detergentná zmes |
| DE4431212A1 (de) * | 1994-09-02 | 1996-03-07 | Basf Ag | Verfahren zur Herstellung von quaternierten Glycinnitrilen |
| US5599781A (en) * | 1995-07-27 | 1997-02-04 | Haeggberg; Donna J. | Automatic dishwashing detergent having bleach system comprising monopersulfate, cationic bleach activator and perborate or percarbonate |
| US6010994A (en) * | 1995-06-07 | 2000-01-04 | The Clorox Company | Liquid compositions containing N-alkyl ammonium acetonitrile salts |
| US6235218B1 (en) | 1995-06-07 | 2001-05-22 | The Clorox Company | Process for preparing N-alkyl ammonium acetonitrile compounds |
| US5888419A (en) * | 1995-06-07 | 1999-03-30 | The Clorox Company | Granular N-alkyl ammonium acetontrile compositions |
| US5739327A (en) * | 1995-06-07 | 1998-04-14 | The Clorox Company | N-alkyl ammonium acetonitrile bleach activators |
| US6183665B1 (en) | 1995-06-07 | 2001-02-06 | The Clorox Company | Granular N-alkyl ammonium acetonitrile compositions |
| US5814242A (en) * | 1995-06-07 | 1998-09-29 | The Clorox Company | Mixed peroxygen activator compositions |
| US5792218A (en) * | 1995-06-07 | 1998-08-11 | The Clorox Company | N-alkyl ammonium acetonitrile activators in dense gas cleaning and method |
| US6764613B2 (en) | 1995-06-07 | 2004-07-20 | Mid-America Commercialization Corporation | N-alkyl ammonium acetonitrile salts, methods therefor and compositions therewith |
| DE19605526A1 (de) | 1996-02-15 | 1997-08-21 | Hoechst Ag | Ammoniumnitrile und deren Verwendung als Bleichaktivatoren |
| EP0812907A1 (en) * | 1996-06-10 | 1997-12-17 | The Procter & Gamble Company | Laundry bleaching with improved safety to fabrics |
| US6019797A (en) * | 1996-06-10 | 2000-02-01 | Procter & Gamble Company | Laundry bleaching with improved safety to fabrics |
| US5850086A (en) * | 1996-06-21 | 1998-12-15 | Regents Of The University Of Minnesota | Iron complexes for bleach activation and stereospecific oxidation |
| DE69727711T2 (de) * | 1996-11-29 | 2004-07-15 | The Clorox Co., Oakland | N-alkyl-ammonium-acetonitril-salze, methoden dazu und zusammensetzungen die diese enthalten |
| DE19649375A1 (de) | 1996-11-29 | 1998-06-04 | Henkel Kgaa | Acetonitril-Derivate als Bleichaktivatoren in Reinigungsmitteln |
| US6211130B1 (en) * | 1997-08-21 | 2001-04-03 | Henkel Kommanditgesellschaft Auf Aktien | Use of quaternary acetonitrile compounds as activators for detergents |
| DE19740669A1 (de) * | 1997-09-16 | 1999-03-18 | Clariant Gmbh | Gecoatete Ammoniumnitril-Bleichaktivatorgranulate |
| DE19740671A1 (de) * | 1997-09-16 | 1999-03-18 | Clariant Gmbh | Bleichaktivator-Granulate |
| DE19807771C1 (de) * | 1998-02-24 | 1999-04-15 | Duerkopp Adler Ag | Augenknopfloch-Nähmaschine |
| JP3847955B2 (ja) * | 1998-05-25 | 2006-11-22 | Juki株式会社 | ボタン穴かがりミシン |
| DE19824687A1 (de) * | 1998-06-03 | 1999-12-09 | Henkel Kgaa | Amylase und Acetonitril-Derivate enthaltende Wasch- und Reinigungsmittel |
| DE19908069A1 (de) * | 1999-02-25 | 2000-08-31 | Henkel Kgaa | Compoundierte Acetonitril-Derivate als Bleichaktivatoren in Reinigungsmitteln |
| DE19908051A1 (de) * | 1999-02-25 | 2000-08-31 | Henkel Kgaa | Verfahren zur Herstellung compoundierter Acetonitril-Derivate |
| DE19914353A1 (de) * | 1999-03-31 | 2000-10-05 | Henkel Kgaa | Wasch- und Reinigungsmittelformkörper mit speziellen Bleichaktivatoren |
| DE19914811A1 (de) * | 1999-03-31 | 2000-10-05 | Henkel Kgaa | Enzym- und bleichaktivatorhaltige Wasch- und Reinigungsmittel |
| DE19914812A1 (de) * | 1999-03-31 | 2000-10-05 | Henkel Kgaa | Ein- oder mehrphasige Wasch- und Reinigungsmittelformkörper mit speziellen Bleichaktivatoren |
| US6602836B2 (en) | 2000-05-11 | 2003-08-05 | Unilever Home & Personal Care Usa, A Division Of Conopco, Inc. | Machine dishwashing compositions containing cationic bleaching agents and water-soluble polymers incorporating cationic groups |
| DE10038086A1 (de) * | 2000-08-04 | 2002-02-14 | Clariant Gmbh | Verfahren zur Herstellung von hydrolysestabilen Ammoniumnitrilen |
| DE10038180A1 (de) * | 2000-08-04 | 2002-02-14 | Reckitt Benckiser Nv | Verwendung eines neuartigen Bleichaktivator-Compounds in Geschirrspülmittelzusammensetzungen |
| DE10038845A1 (de) * | 2000-08-04 | 2002-02-21 | Henkel Kgaa | Teilchenförmig konfektionierte Acetonitril-Derivate als Bleichaktivatoren in festen Waschmitteln |
| DE10038844A1 (de) * | 2000-08-04 | 2002-02-21 | Henkel Kgaa | Kationischen Bleichaktivator enthaltende Wasch- und Reinigungsmittel |
| DE10038832A1 (de) * | 2000-08-04 | 2002-03-28 | Henkel Kgaa | Umhüllte Bleichaktivatoren |
| DE10057045A1 (de) | 2000-11-17 | 2002-05-23 | Clariant Gmbh | Teilchenförmige Bleichaktivatoren auf der Basis von Acetonitrilen |
| DE10064636A1 (de) * | 2000-12-22 | 2002-07-04 | Henkel Kgaa | Flüssiges Wasch-und/oder Reinigungsmittel |
| GB0106285D0 (en) | 2001-03-14 | 2001-05-02 | Unilever Plc | Air bleaching catalysts with moderating agent |
| CA2439524A1 (en) | 2001-03-14 | 2002-09-19 | Unilever Plc | Bleaching catalysts with unsaturated surfactant and antioxidants |
| DE10142124A1 (de) | 2001-08-30 | 2003-03-27 | Henkel Kgaa | Umhüllte Wirkstoffzubereitung für den Einsatz in teilchenförmigen Wasch- und Reinigungsmitteln |
| DE10159386A1 (de) | 2001-12-04 | 2003-06-12 | Henkel Kgaa | Verfahren zur Herstellung von Bleichaktivatorgranulaten |
| DE10161766A1 (de) * | 2001-12-15 | 2003-06-26 | Clariant Gmbh | Bleichaktivator-Co-Granulate |
| DE10211389A1 (de) * | 2002-03-15 | 2003-09-25 | Clariant Gmbh | Ammoniumnitrile und deren Verwendung als hydrophobe Bleichaktivatoren |
| WO2003101940A2 (de) * | 2002-05-31 | 2003-12-11 | Henkel Kommanditgesellschaft Auf Aktien | Desodorierung von kationischen ammoniumacetonitrilderivaten |
| US20040029757A1 (en) * | 2002-08-08 | 2004-02-12 | Ecolab Inc. | Hand dishwashing detergent composition and methods for manufacturing and using |
| WO2004029187A1 (de) * | 2002-09-20 | 2004-04-08 | Henkel Kommanditgesellschaft Auf Aktien | Maschinelle geschirrspülmittellzusammensetzungen (mgsm) mit speziell konfektionierten bleichaktvatoren (iii) |
| DE10314442A1 (de) * | 2003-03-31 | 2004-11-04 | Henkel Kgaa | MGSM mit speziell konfektionierten Bleichaktivatoren III |
| MXPA05006578A (es) | 2002-12-18 | 2005-08-16 | Procter & Gamble | Activador organico. |
| DE10334046A1 (de) * | 2003-07-25 | 2005-02-10 | Clariant Gmbh | Verfahren zur Herstellung von granulierten Acyloxybenzolsulfonaten oder Acyloxybenzolcarbonsäuren und deren Salze |
| DE102004012915A1 (de) * | 2004-03-17 | 2005-10-13 | Clariant Gmbh | Feste Zubereitungen enthaltend einen sensitiven Wirkstoff |
| DE102004020015A1 (de) * | 2004-04-21 | 2005-11-10 | Henkel Kgaa | Textilpflegemittel |
| DE102004028494A1 (de) * | 2004-06-11 | 2005-12-29 | Clariant Gmbh | Mischungen von Ammoniumnitril-Bleichaktivatoren und Aminosäuren |
| DE102004041760A1 (de) * | 2004-08-28 | 2006-03-02 | Clariant Gmbh | Diethylmethyl-Ammoniumnitrile und Wasch- und Reinigungsmittel, enthaltend diese Ammoniumnitrile |
| US7737102B2 (en) * | 2004-11-01 | 2010-06-15 | The Procter & Gamble Company | Ionic liquids derived from functionalized anionic surfactants |
| JP2007172716A (ja) * | 2005-12-20 | 2007-07-05 | Sony Corp | 再生装置、再生方法および再生プログラム、記録媒体およびデータ構造、ならびに、オーサリング装置、オーサリング方法およびオーサリングプログラム |
| DE102006013664A1 (de) * | 2006-03-24 | 2007-10-18 | Clariant International Limited | Verfahren zur Herstellung von Ammoniumnitrilen |
| DE102006013666A1 (de) * | 2006-03-24 | 2007-09-27 | Clariant International Limited | Verbessertes Verfahren zur Herstellung von natriumchloridfreien Ammoniumnitrilen |
| DE102006013665A1 (de) * | 2006-03-24 | 2007-09-27 | Clariant International Limited | Verbessertes Verfahren zur Herstellung von natriumchloridfreien Ammoniumnitrilen |
| DE102007028310A1 (de) | 2007-06-20 | 2008-12-24 | Clariant International Ltd. | Tensidmischungen mit synergistischen Eigenschaften |
| KR101591543B1 (ko) | 2008-04-09 | 2016-02-03 | 바스프 에스이 | 금속 히드라지드 착체 화합물의 산화 촉매로서의 용도 |
| BR112012032820A2 (pt) | 2010-06-28 | 2016-11-08 | Basf Se | uso de uma composição, composição, processo para o alvejamento de manchas ou de sujeira sobre materiais têxteis ou pratos, composição detergentes, de limpeza ou de alvejamento, grânulo, e,composto da fórmula |
| WO2012080088A1 (en) | 2010-12-13 | 2012-06-21 | Basf Se | Bleach catalysts |
| ES2643483T5 (es) | 2013-06-20 | 2021-05-04 | Catexel Tech Limited | Catalizador de blanqueamiento y oxidación |
| AU2014307707B2 (en) | 2013-08-16 | 2018-08-02 | Chemsenti Limited | Composition |
| WO2016040629A1 (en) | 2014-09-10 | 2016-03-17 | Basf Se | Encapsulated cleaning composition |
| WO2017076771A1 (en) | 2015-11-03 | 2017-05-11 | Basf Se | Bleach catalysts |
| EP3176157A1 (en) | 2015-12-01 | 2017-06-07 | Basf Se | Bleach catalysts |
| WO2017156141A1 (en) | 2016-03-09 | 2017-09-14 | Basf Se | Encapsulated laundry cleaning composition |
| WO2017182295A1 (en) | 2016-04-18 | 2017-10-26 | Basf Se | Liquid cleaning compositions |
| WO2017186480A1 (en) | 2016-04-26 | 2017-11-02 | Basf Se | Metal free bleaching composition |
| EP3372663A1 (en) | 2017-03-10 | 2018-09-12 | Basf Se | Bleach catalysts |
| CN115175944B (zh) | 2020-02-28 | 2024-03-19 | 卡特克塞尔科技有限公司 | 降解方法 |
| GB202014070D0 (en) | 2020-09-08 | 2020-10-21 | Alborz Chemicals Ltd | Polymorph |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4049814A (en) * | 1974-07-01 | 1977-09-20 | The Dow Chemical Company | Substituted phenoxyalkyl quaternary ammonium compounds as antiarrhythemic agents |
| US4420614A (en) * | 1980-10-03 | 1983-12-13 | Ici Australia Limited | Cyanophenoxybenzyl amines |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3875215A (en) * | 1971-07-19 | 1975-04-01 | Dow Chemical Co | Substituted phenoxyalkyl quaternary ammonium compounds |
| US3932664A (en) * | 1971-07-19 | 1976-01-13 | The Dow Chemical Company | Substituted phenoxyalkyl quaternary ammonium compounds as antiarrhythemic agents |
| US3882035A (en) * | 1973-03-21 | 1975-05-06 | American Cyanamid Co | Iminodiacetonitrile derivatives as peroxygen bleach activators |
| US4120809A (en) * | 1973-07-24 | 1978-10-17 | Colgate-Palmolive Company | Washing and bleaching with composition containing bleach activator and a nitrilotricarboxylic acid compound |
| US4199466A (en) * | 1978-08-21 | 1980-04-22 | Shell Oil Company | Activated bleaching process and compositions therefor |
| US4915863A (en) * | 1987-08-14 | 1990-04-10 | Kao Corporation | Bleaching composition |
| JPS6490296A (en) * | 1987-09-30 | 1989-04-06 | Kao Corp | Detergent composition |
| JP2523817B2 (ja) * | 1988-09-20 | 1996-08-14 | 花王株式会社 | 漂白剤及び漂白洗浄剤組成物 |
| JPH02131296A (ja) * | 1988-11-11 | 1990-05-21 | Hiroseseizaburou Shoten:Kk | 吸音性能を有する遮音コンクリート板 |
| GB9011618D0 (en) * | 1990-05-24 | 1990-07-11 | Unilever Plc | Bleaching composition |
-
1990
- 1990-05-30 GB GB909012001A patent/GB9012001D0/en active Pending
-
1991
- 1991-05-24 CA CA002043210A patent/CA2043210A1/en not_active Abandoned
- 1991-05-27 NO NO91912036A patent/NO912036L/no unknown
- 1991-05-27 AU AU77319/91A patent/AU635842B2/en not_active Ceased
- 1991-05-28 DE DE69105836T patent/DE69105836D1/de not_active Expired - Lifetime
- 1991-05-28 EP EP91201260A patent/EP0464880B1/en not_active Expired - Lifetime
- 1991-05-29 IN IN159BO1991 patent/IN172906B/en unknown
- 1991-05-29 BR BR919102223A patent/BR9102223A/pt unknown
- 1991-05-29 US US07/706,818 patent/US5281361A/en not_active Expired - Fee Related
- 1991-05-30 ZA ZA914149A patent/ZA914149B/xx unknown
- 1991-05-30 JP JP3228150A patent/JPH0832672B2/ja not_active Expired - Lifetime
- 1991-05-30 KR KR1019910008841A patent/KR910020164A/ko active Granted
- 1991-05-30 KR KR1019910008841A patent/KR950002601B1/ko not_active Expired - Lifetime
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4049814A (en) * | 1974-07-01 | 1977-09-20 | The Dow Chemical Company | Substituted phenoxyalkyl quaternary ammonium compounds as antiarrhythemic agents |
| US4420614A (en) * | 1980-10-03 | 1983-12-13 | Ici Australia Limited | Cyanophenoxybenzyl amines |
Also Published As
| Publication number | Publication date |
|---|---|
| NO912036L (no) | 1991-12-02 |
| CA2043210A1 (en) | 1991-12-01 |
| DE69105836D1 (de) | 1995-01-26 |
| KR950002601B1 (ko) | 1995-03-23 |
| EP0464880B1 (en) | 1994-12-14 |
| JPH04253947A (ja) | 1992-09-09 |
| KR920001524A (ko) | 1992-01-30 |
| NO912036D0 (no) | 1991-05-27 |
| GB9012001D0 (en) | 1990-07-18 |
| US5281361A (en) | 1994-01-25 |
| IN172906B (enExample) | 1994-01-01 |
| JPH0832672B2 (ja) | 1996-03-29 |
| KR910020164A (ko) | 1991-12-19 |
| AU7731991A (en) | 1991-12-05 |
| BR9102223A (pt) | 1992-01-07 |
| EP0464880A1 (en) | 1992-01-08 |
| ZA914149B (en) | 1993-01-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU635842B2 (en) | Bleaching composition | |
| AU634393B2 (en) | Bleaching composition | |
| US4904406A (en) | Quaternary ammonium compounds for use in bleaching systems | |
| EP0284132B1 (en) | Quaternary ammonium or phosphonium peroxy carbonic acid precursors and their use in detergent bleach compositions | |
| US4818426A (en) | Quaternary ammonium or phosphonium substituted peroxy carbonic acid precursors and their use in detergent bleach compositions | |
| US5106528A (en) | Bleach activation and bleaching compositions | |
| CA2014321C (en) | Bleach activation | |
| JPH09316063A (ja) | アンモニウムニトリル類及びこれを漂白活性化剤として使用する方法 | |
| GB2048930A (en) | Detergent bleaching compositions | |
| US5952282A (en) | Sulfonylimine derivatives as bleach catalysts | |
| US5877325A (en) | Quaternary ammonium compounds as bleach activators and their preparation | |
| US5360573A (en) | Bleach precursors | |
| AU607846B2 (en) | Bleach precursors and their use in bleaching and/or detergent compositions | |
| US5002687A (en) | Fabric washing compositions | |
| KR930007850B1 (ko) | 표백세제 조성물 | |
| JPH1046194A (ja) | 漂白活性化剤としてのシアノピリジニウム化合物 | |
| JP2008511701A (ja) | ジエチルメチルアンモニウムニトリルならびにこのアンモニウムニトリルを含む洗剤および清浄剤 |