AT127132B - Elektrische Leuchtröhre. - Google Patents
Elektrische Leuchtröhre.Info
- Publication number
- AT127132B AT127132B AT127132DA AT127132B AT 127132 B AT127132 B AT 127132B AT 127132D A AT127132D A AT 127132DA AT 127132 B AT127132 B AT 127132B
- Authority
- AT
- Austria
- Prior art keywords
- fluorescent tube
- tube according
- tube
- discharge path
- hydrocarbon
- Prior art date
Links
- 150000002430 hydrocarbons Chemical class 0.000 claims description 14
- 229930195733 hydrocarbon Natural products 0.000 claims description 12
- 239000004215 Carbon black (E152) Substances 0.000 claims description 11
- 239000007789 gas Substances 0.000 claims description 7
- DSSYKIVIOFKYAU-XCBNKYQSSA-N (R)-camphor Chemical compound C1C[C@@]2(C)C(=O)C[C@@H]1C2(C)C DSSYKIVIOFKYAU-XCBNKYQSSA-N 0.000 claims description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- 241000723346 Cinnamomum camphora Species 0.000 claims description 4
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 4
- 229960000846 camphor Drugs 0.000 claims description 4
- 229930008380 camphor Natural products 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 4
- 229910052756 noble gas Inorganic materials 0.000 claims description 3
- 238000007789 sealing Methods 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 229910002804 graphite Inorganic materials 0.000 claims description 2
- 239000010439 graphite Substances 0.000 claims description 2
- 150000002835 noble gases Chemical class 0.000 claims description 2
- 239000012173 sealing wax Substances 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims 2
- 239000000126 substance Substances 0.000 claims 2
- 238000011144 upstream manufacturing Methods 0.000 claims 1
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 239000001307 helium Substances 0.000 description 2
- 229910052734 helium Inorganic materials 0.000 description 2
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- -1 camphor Chemical class 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 239000011247 coating layer Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052754 neon Inorganic materials 0.000 description 1
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/24—Means for obtaining or maintaining the desired pressure within the vessel
- H01J61/28—Means for producing, introducing, or replenishing gas or vapour during operation of the lamp
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB589320X | 1930-04-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT127132B true AT127132B (de) | 1932-03-10 |
Family
ID=10482714
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT127132D AT127132B (de) | 1930-04-02 | 1931-03-27 | Elektrische Leuchtröhre. |
Country Status (3)
| Country | Link |
|---|---|
| AT (1) | AT127132B (enExample) |
| DE (1) | DE589320C (enExample) |
| NL (1) | NL35078C (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7903285A (nl) * | 1979-04-26 | 1980-10-28 | Philips Nv | Ontladingslamp. |
| NL7903286A (nl) * | 1979-04-26 | 1980-10-28 | Philips Nv | Ontladingsbuis. |
-
0
- NL NL35078D patent/NL35078C/xx active
-
1931
- 1931-02-05 DE DEP62247D patent/DE589320C/de not_active Expired
- 1931-03-27 AT AT127132D patent/AT127132B/de active
Also Published As
| Publication number | Publication date |
|---|---|
| DE589320C (de) | 1933-12-06 |
| NL35078C (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT127132B (de) | Elektrische Leuchtröhre. | |
| CH154947A (de) | Elektrische Leuchtröhre. | |
| DE537323C (de) | Elektrische Gasentladungslampe | |
| AT130417B (de) | Elektrische Leuchtröhre mit Glühelektroden und eingeschnürter Entladung. | |
| DE642327C (de) | Verfahren zur Herstellung von Quecksilberdampflampen sehr hohen Dampfdruckes | |
| AT110811B (de) | Elektrische Leuchtröhre mit Kohlensäurefüllung. | |
| DE600810C (de) | Elektrische Leuchtroehre mit zwei an den Enden angebrachten Elektroden und staendiger Nachspeisung unedler Gase | |
| DE478458C (de) | Entladungsroehre, insbesondere zum Gebrauch als UEberspannungsschutz | |
| DE484270C (de) | Elektrische Leuchtroehre | |
| DE748762C (de) | Elektrische Hochdruckentladungslampe mit flachem Entladungsrohr | |
| DE435310C (de) | Elektrische Leuchtroehre | |
| DE748239C (de) | Elektrische, ausschliesslich mit Edelgasen gefuellte Leuchtroehre mit im Roehreninnern angebrachter Luminophorschicht | |
| AT133699B (de) | Elektrische Edelgaslampe. | |
| DE651555C (de) | Verfahren zur Erzeugung und Aufrechterhaltung mehrerer der Laenge nach aneinandergereihter verschiedenfarbiger Leuchtsaeulen | |
| AT145767B (de) | Elektrische Entladungsröhre. | |
| DE600757C (de) | Elektrische Edelgaslampe mit Gluehelektroden und einem Zusatz von Quecksilberdampf | |
| AT135461B (de) | Elektrische Leuchtröhre. | |
| DE902408C (de) | Elektrische Entladungslampe mit zwei in der Ausstrahlungsrichtung hintereinander angeordneten Fluoreszenzstoffschichten | |
| AT125418B (de) | Gasgefüllte elektrische Glühlampe. | |
| DE478073C (de) | Elektrische Leuchtroehre | |
| AT112533B (de) | Insbesondere zum Gebrauch als Überspannungssicherung dienende Entladungsröhre. | |
| AT124016B (de) | Elektrische Glühlampe. | |
| AT275662B (de) | Verfahren zur Herstellung von Glühlampen mit Transportgasfüllung | |
| DE478315C (de) | Gasgefuellte elektrische Leuchtroehre | |
| DE688611C (de) | Elektrische Quecksilberhochdruckentladungslampe |