SK279221B6 - Deriváty kyseliny chinolónkarboxylovej, spôsob ich - Google Patents
Deriváty kyseliny chinolónkarboxylovej, spôsob ich Download PDFInfo
- Publication number
- SK279221B6 SK279221B6 SK2191-92A SK219192A SK279221B6 SK 279221 B6 SK279221 B6 SK 279221B6 SK 219192 A SK219192 A SK 219192A SK 279221 B6 SK279221 B6 SK 279221B6
- Authority
- SK
- Slovakia
- Prior art keywords
- group
- methyl
- hydrogen atom
- oxo
- dihydro
- Prior art date
Links
- 239000002253 acid Substances 0.000 title claims abstract description 29
- 238000000034 method Methods 0.000 title claims abstract description 17
- 238000002360 preparation method Methods 0.000 title claims abstract description 6
- 239000000543 intermediate Substances 0.000 title claims description 4
- 150000007513 acids Chemical class 0.000 title abstract 3
- 239000008177 pharmaceutical agent Substances 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 52
- 150000003839 salts Chemical class 0.000 claims abstract description 32
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 claims abstract description 14
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims abstract description 13
- 150000004677 hydrates Chemical class 0.000 claims abstract description 13
- 229910052709 silver Inorganic materials 0.000 claims abstract description 13
- 239000004332 silver Substances 0.000 claims abstract description 13
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 claims abstract description 7
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 claims abstract description 7
- 230000000844 anti-bacterial effect Effects 0.000 claims abstract description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 83
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 79
- -1 (5-methyl-2-oxo-1,3-dioxol-4-yl) methyl Chemical group 0.000 claims description 46
- 125000004432 carbon atom Chemical group C* 0.000 claims description 40
- 239000001257 hydrogen Substances 0.000 claims description 27
- 229910052739 hydrogen Inorganic materials 0.000 claims description 27
- 125000000217 alkyl group Chemical group 0.000 claims description 25
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 22
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 16
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 15
- 150000002431 hydrogen Chemical class 0.000 claims description 15
- 229910052783 alkali metal Inorganic materials 0.000 claims description 14
- 229910052731 fluorine Inorganic materials 0.000 claims description 14
- 150000001340 alkali metals Chemical class 0.000 claims description 13
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 13
- 125000005843 halogen group Chemical group 0.000 claims description 13
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 13
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 12
- 229910052801 chlorine Inorganic materials 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- 229910052736 halogen Inorganic materials 0.000 claims description 10
- 150000002367 halogens Chemical class 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 8
- 125000003277 amino group Chemical group 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 8
- 125000001153 fluoro group Chemical group F* 0.000 claims description 8
- 229920002554 vinyl polymer Polymers 0.000 claims description 8
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 7
- 239000011737 fluorine Substances 0.000 claims description 7
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 7
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 6
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 6
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 5
- 239000013543 active substance Substances 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 5
- 239000003814 drug Substances 0.000 claims description 5
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 5
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 5
- 125000004849 alkoxymethyl group Chemical group 0.000 claims description 4
- 239000011230 binding agent Substances 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 4
- 125000006534 ethyl amino methyl group Chemical group [H]N(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 230000008569 process Effects 0.000 claims description 4
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 claims description 4
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 3
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 claims description 3
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims description 3
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 claims description 2
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 claims description 2
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 2
- JDMSDXWOUURESP-UHFFFAOYSA-N 8-bromo-1-(2,4-difluorophenyl)-6,7-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(Br)C(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=C(F)C=C1F JDMSDXWOUURESP-UHFFFAOYSA-N 0.000 claims description 2
- JIPURIIUYIXSCB-UHFFFAOYSA-N 8-bromo-1-ethyl-6,7-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C(Br)=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 JIPURIIUYIXSCB-UHFFFAOYSA-N 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims description 2
- 150000001735 carboxylic acids Chemical class 0.000 claims description 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 2
- 125000006533 methyl amino methyl group Chemical group [H]N(C([H])([H])[H])C([H])([H])* 0.000 claims description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 2
- 125000005188 oxoalkyl group Chemical group 0.000 claims description 2
- 239000008194 pharmaceutical composition Substances 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- XOQQVKDBGLYPGH-UHFFFAOYSA-N 2-oxo-1h-quinoline-3-carboxylic acid Chemical class C1=CC=C2NC(=O)C(C(=O)O)=CC2=C1 XOQQVKDBGLYPGH-UHFFFAOYSA-N 0.000 claims 7
- 150000002357 guanidines Chemical class 0.000 claims 6
- YASFOLXBUALGIY-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-8-(3-methylbut-3-en-1-ynyl)-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1CN(C)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C#CC(C)=C YASFOLXBUALGIY-UHFFFAOYSA-N 0.000 claims 1
- NFGODEMQGQNUKK-UHFFFAOYSA-M [6-(diethylamino)-9-(2-octadecoxycarbonylphenyl)xanthen-3-ylidene]-diethylazanium;chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCCOC(=O)C1=CC=CC=C1C1=C2C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C21 NFGODEMQGQNUKK-UHFFFAOYSA-M 0.000 claims 1
- SYGWYBOJXOGMRU-UHFFFAOYSA-N chembl233051 Chemical compound C1=CC=C2C3=CC(C(N(CCN(C)C)C4=O)=O)=C5C4=CC=CC5=C3SC2=C1 SYGWYBOJXOGMRU-UHFFFAOYSA-N 0.000 claims 1
- 229910052751 metal Inorganic materials 0.000 abstract description 3
- 239000002184 metal Substances 0.000 abstract description 3
- 239000003674 animal food additive Substances 0.000 abstract description 2
- 239000003242 anti bacterial agent Substances 0.000 abstract description 2
- 150000002739 metals Chemical class 0.000 abstract 2
- 239000000654 additive Chemical class 0.000 abstract 1
- 230000000996 additive effect Effects 0.000 abstract 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 48
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 41
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 39
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 37
- 238000002844 melting Methods 0.000 description 32
- 230000008018 melting Effects 0.000 description 32
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- 239000011541 reaction mixture Substances 0.000 description 27
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 24
- 238000005160 1H NMR spectroscopy Methods 0.000 description 22
- 239000000203 mixture Substances 0.000 description 22
- 239000000047 product Substances 0.000 description 22
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 21
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 20
- 238000010992 reflux Methods 0.000 description 20
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 20
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 19
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 18
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 17
- 238000000354 decomposition reaction Methods 0.000 description 17
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 13
- 239000000243 solution Substances 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 239000007787 solid Substances 0.000 description 12
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 11
- 238000001816 cooling Methods 0.000 description 11
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 10
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 10
- 235000019441 ethanol Nutrition 0.000 description 10
- 229910052757 nitrogen Inorganic materials 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 8
- 125000006239 protecting group Chemical group 0.000 description 8
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 7
- 239000012362 glacial acetic acid Substances 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- 241000894006 Bacteria Species 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- MBIVSPDDSIIZOQ-UHFFFAOYSA-N ethyl 8-bromo-1-cyclopropyl-6,7-difluoro-4-oxoquinoline-3-carboxylate Chemical compound C12=C(Br)C(F)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 MBIVSPDDSIIZOQ-UHFFFAOYSA-N 0.000 description 6
- 239000012280 lithium aluminium hydride Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 239000012299 nitrogen atmosphere Substances 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 5
- HIMQTSYOOCTRHG-UHFFFAOYSA-N 1-cyclopropyl-6,7-difluoro-8-hex-1-ynyl-4-oxoquinoline-3-carboxylic acid Chemical compound C1(CC1)N1C=C(C(C2=CC(=C(C(=C12)C#CCCCC)F)F)=O)C(=O)O HIMQTSYOOCTRHG-UHFFFAOYSA-N 0.000 description 4
- OUVMXIYIIMVFQS-UHFFFAOYSA-N 1-cyclopropyl-8-ethynyl-6,7-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(C#C)C(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 OUVMXIYIIMVFQS-UHFFFAOYSA-N 0.000 description 4
- 238000006261 Adler reaction Methods 0.000 description 4
- 229920001817 Agar Polymers 0.000 description 4
- KWIUHFFTVRNATP-UHFFFAOYSA-N Betaine Natural products C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- KWIUHFFTVRNATP-UHFFFAOYSA-O N,N,N-trimethylglycinium Chemical compound C[N+](C)(C)CC(O)=O KWIUHFFTVRNATP-UHFFFAOYSA-O 0.000 description 4
- 239000008272 agar Substances 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 229960003237 betaine Drugs 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 150000002170 ethers Chemical class 0.000 description 4
- ZESBQVDNKGGIIJ-UHFFFAOYSA-N ethyl 1-cyclopropyl-6,7-difluoro-4-oxo-8-(2-trimethylsilylethynyl)quinoline-3-carboxylate Chemical compound C12=C(C#C[Si](C)(C)C)C(F)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 ZESBQVDNKGGIIJ-UHFFFAOYSA-N 0.000 description 4
- 125000004494 ethyl ester group Chemical group 0.000 description 4
- 150000004678 hydrides Chemical class 0.000 description 4
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 4
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 4
- NRKAHECMMVDYGU-UHFFFAOYSA-N n-methyl-2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-amine Chemical compound CNC1C=CCC2CNCC12 NRKAHECMMVDYGU-UHFFFAOYSA-N 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 230000002829 reductive effect Effects 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- JGOIIPRSFZFFHG-UHFFFAOYSA-N trimethyl(2-tributylstannylethynyl)silane Chemical group CCCC[Sn](CCCC)(CCCC)C#C[Si](C)(C)C JGOIIPRSFZFFHG-UHFFFAOYSA-N 0.000 description 4
- FTTATHOUSOIFOQ-UHFFFAOYSA-N 1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine Chemical compound C1NCCN2CCCC21 FTTATHOUSOIFOQ-UHFFFAOYSA-N 0.000 description 3
- DTRLPBIKMIQFEJ-UHFFFAOYSA-N 1-trimethylsilylpyrrole-2,5-dione Chemical compound C[Si](C)(C)N1C(=O)C=CC1=O DTRLPBIKMIQFEJ-UHFFFAOYSA-N 0.000 description 3
- MIMQEVRXLNVDIH-UHFFFAOYSA-N 2,2-dimethyl-n-pyrrolidin-3-ylpropan-1-imine Chemical compound CC(C)(C)C=NC1CCNC1 MIMQEVRXLNVDIH-UHFFFAOYSA-N 0.000 description 3
- UMIZTIYZNFUATK-UHFFFAOYSA-N 2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b][1,4]oxazine Chemical compound O1CCNC2CNCC21 UMIZTIYZNFUATK-UHFFFAOYSA-N 0.000 description 3
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 3
- JOMNTHCQHJPVAZ-UHFFFAOYSA-N 2-methylpiperazine Chemical compound CC1CNCCN1 JOMNTHCQHJPVAZ-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- KYVJDJADWPPZET-UHFFFAOYSA-N C12=C(C#C)C(F)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 Chemical compound C12=C(C#C)C(F)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 KYVJDJADWPPZET-UHFFFAOYSA-N 0.000 description 3
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 3
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000000304 alkynyl group Chemical group 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- BDBFPPPWXPXQKV-UHFFFAOYSA-N ethyl 1-(2,4-difluorophenyl)-6,7-difluoro-4-oxo-8-(2-trimethylsilylethynyl)quinoline-3-carboxylate Chemical compound C12=C(C#C[Si](C)(C)C)C(F)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1=CC=C(F)C=C1F BDBFPPPWXPXQKV-UHFFFAOYSA-N 0.000 description 3
- QEKAFAWTZJQNJO-UHFFFAOYSA-N ethyl 1-(2,4-difluorophenyl)-8-ethynyl-6,7-difluoro-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C#C)C(F)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1=CC=C(F)C=C1F QEKAFAWTZJQNJO-UHFFFAOYSA-N 0.000 description 3
- VCUHIKSCSZSUJW-UHFFFAOYSA-N ethyl 1-cyclopropyl-6,7-difluoro-4-oxo-8-prop-1-ynylquinoline-3-carboxylate Chemical compound CCOC(=O)c1cn(C2CC2)c2c(C#CC)c(F)c(F)cc2c1=O VCUHIKSCSZSUJW-UHFFFAOYSA-N 0.000 description 3
- SKPYGTCWGNOSFW-UHFFFAOYSA-N ethyl 1-cyclopropyl-8-ethenyl-6,7-difluoro-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C=C)C(F)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 SKPYGTCWGNOSFW-UHFFFAOYSA-N 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000001819 mass spectrum Methods 0.000 description 3
- 244000005700 microbiome Species 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- PKVRJCUKSNFIBN-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 PKVRJCUKSNFIBN-UHFFFAOYSA-N 0.000 description 3
- 238000007127 saponification reaction Methods 0.000 description 3
- DKBQOIAVVRJJJL-UHFFFAOYSA-N tert-butyl n-buta-1,3-dienylcarbamate Chemical compound CC(C)(C)OC(=O)NC=CC=C DKBQOIAVVRJJJL-UHFFFAOYSA-N 0.000 description 3
- 229910052723 transition metal Inorganic materials 0.000 description 3
- 150000003624 transition metals Chemical class 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- KSCPLKVBWDOSAI-NKWVEPMBSA-N (4as,7as)-2,3,4,4a,5,6,7,7a-octahydro-1h-pyrrolo[3,4-b]pyridine Chemical compound N1CCC[C@H]2CNC[C@H]21 KSCPLKVBWDOSAI-NKWVEPMBSA-N 0.000 description 2
- ZIVHBTPWYSNTBP-UHFFFAOYSA-N 1-cyclopropyl-8-ethenyl-6,7-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(C=C)C(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 ZIVHBTPWYSNTBP-UHFFFAOYSA-N 0.000 description 2
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 2
- XLSZMDLNRCVEIJ-UHFFFAOYSA-N 4-methylimidazole Chemical compound CC1=CNC=N1 XLSZMDLNRCVEIJ-UHFFFAOYSA-N 0.000 description 2
- BNLKJYVQFIOOTE-UHFFFAOYSA-N 5-methyl-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridine Chemical compound C1N(C)CCC2CNCC21 BNLKJYVQFIOOTE-UHFFFAOYSA-N 0.000 description 2
- COKJBXKBCXZTKY-UHFFFAOYSA-N 6-methyl-1,2,3,3a,4,5,6,6a-octahydropyrrolo[2,3-c]pyrrole Chemical compound C1CNC2C(C)NCC21 COKJBXKBCXZTKY-UHFFFAOYSA-N 0.000 description 2
- BWKNVUWKBKUASR-UHFFFAOYSA-N 8-ethynyl-2-oxo-1h-quinoline-3-carboxylic acid Chemical class C1=CC(C#C)=C2NC(=O)C(C(=O)O)=CC2=C1 BWKNVUWKBKUASR-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- 241000194032 Enterococcus faecalis Species 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- PEEHTFAAVSWFBL-UHFFFAOYSA-N Maleimide Chemical compound O=C1NC(=O)C=C1 PEEHTFAAVSWFBL-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 241000191967 Staphylococcus aureus Species 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 230000001580 bacterial effect Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- MYSWGUAQZAJSOK-UHFFFAOYSA-N ciprofloxacin Chemical compound C12=CC(N3CCNCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 MYSWGUAQZAJSOK-UHFFFAOYSA-N 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 229940032049 enterococcus faecalis Drugs 0.000 description 2
- MIQSCPWQRWROKA-UHFFFAOYSA-N ethyl 1-cyclopropyl-6,7-difluoro-8-(3-methylbut-3-en-1-ynyl)-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C#CC(C)=C)C(F)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 MIQSCPWQRWROKA-UHFFFAOYSA-N 0.000 description 2
- WJGFKSJXLDSFFC-UHFFFAOYSA-N ethyl 8-bromo-1-(2,4-difluorophenyl)-6,7-difluoro-4-oxoquinoline-3-carboxylate Chemical compound C12=C(Br)C(F)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1=CC=C(F)C=C1F WJGFKSJXLDSFFC-UHFFFAOYSA-N 0.000 description 2
- UBGCJIGIIXGAOJ-UHFFFAOYSA-N ethyl 8-bromo-1-ethyl-6,7-difluoro-4-oxoquinoline-3-carboxylate Chemical compound FC1=C(F)C=C2C(=O)C(C(=O)OCC)=CN(CC)C2=C1Br UBGCJIGIIXGAOJ-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 238000011081 inoculation Methods 0.000 description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000003446 ligand Substances 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- SFIBLXYGWQPAOY-UHFFFAOYSA-N n,7-dimethyl-2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-amine Chemical compound CNC1C=CC(C)C2CNCC12 SFIBLXYGWQPAOY-UHFFFAOYSA-N 0.000 description 2
- 239000011368 organic material Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 239000011698 potassium fluoride Substances 0.000 description 2
- 235000003270 potassium fluoride Nutrition 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 238000011321 prophylaxis Methods 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 2
- OJUYYFXYYWYJLE-UHFFFAOYSA-N tert-butyl n-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl)carbamate Chemical compound CC(C)(C)OC(=O)NC1C=CCC2C(=O)NC(=O)C12 OJUYYFXYYWYJLE-UHFFFAOYSA-N 0.000 description 2
- DIQWSFWWYVRXRO-UHFFFAOYSA-N tert-butyl n-(3-methylpyrrolidin-3-yl)carbamate Chemical compound CC(C)(C)OC(=O)NC1(C)CCNC1 DIQWSFWWYVRXRO-UHFFFAOYSA-N 0.000 description 2
- BKITXDSDJGOXPN-UHFFFAOYSA-N tert-butyl n-(4-methylpyrrolidin-3-yl)carbamate Chemical compound CC1CNCC1NC(=O)OC(C)(C)C BKITXDSDJGOXPN-UHFFFAOYSA-N 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- YWWDBCBWQNCYNR-UHFFFAOYSA-N trimethylphosphine Chemical compound CP(C)C YWWDBCBWQNCYNR-UHFFFAOYSA-N 0.000 description 2
- COIOYMYWGDAQPM-UHFFFAOYSA-N tris(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C COIOYMYWGDAQPM-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- COWPTMLRSANSMQ-OLQVQODUSA-N (2r,3s)-2,3-dimethylpiperazine Chemical compound C[C@H]1NCCN[C@H]1C COWPTMLRSANSMQ-OLQVQODUSA-N 0.000 description 1
- IFNWESYYDINUHV-OLQVQODUSA-N (2s,6r)-2,6-dimethylpiperazine Chemical compound C[C@H]1CNC[C@@H](C)N1 IFNWESYYDINUHV-OLQVQODUSA-N 0.000 description 1
- YDWTUQYNEOYKGG-UHFFFAOYSA-N (4-methyl-2,5-dihydro-1h-pyrrol-3-yl)methanamine Chemical compound CC1=C(CN)CNC1 YDWTUQYNEOYKGG-UHFFFAOYSA-N 0.000 description 1
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- HGOQIVARGHXIRS-UHFFFAOYSA-N 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-amine Chemical compound C1NCC2C(N)CCC21 HGOQIVARGHXIRS-UHFFFAOYSA-N 0.000 description 1
- ZOBDURRZNGBULZ-UHFFFAOYSA-N 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-ol Chemical compound C1NCC2C(O)CCC21 ZOBDURRZNGBULZ-UHFFFAOYSA-N 0.000 description 1
- QFCMBRXRVQRSSF-UHFFFAOYSA-N 1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrole Chemical compound C1NCC2CNCC21 QFCMBRXRVQRSSF-UHFFFAOYSA-N 0.000 description 1
- OUAALNNZQLXZKC-UHFFFAOYSA-N 1,2,3,4,5,6,7,7a-octahydrocyclopenta[c]pyridin-4a-amine Chemical compound C1NCCC2(N)C1CCC2 OUAALNNZQLXZKC-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- QVCUKHQDEZNNOC-UHFFFAOYSA-N 1,2-diazabicyclo[2.2.2]octane Chemical compound C1CC2CCN1NC2 QVCUKHQDEZNNOC-UHFFFAOYSA-N 0.000 description 1
- MIIAFOPRAQVZDS-UHFFFAOYSA-N 1,2-dimethyl-3,3a,4,5,6,6a-hexahydro-2h-pyrrolo[2,3-c]pyrrole Chemical compound C1NCC2N(C)C(C)CC21 MIIAFOPRAQVZDS-UHFFFAOYSA-N 0.000 description 1
- ARHYWWAJZDAYDJ-UHFFFAOYSA-N 1,2-dimethylpiperazine Chemical compound CC1CNCCN1C ARHYWWAJZDAYDJ-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- KYCAEEFYFFBAAP-UHFFFAOYSA-N 1,4-diazabicyclo[3.2.1]octane Chemical compound C1C2CCN1CCN2 KYCAEEFYFFBAAP-UHFFFAOYSA-N 0.000 description 1
- GNTGRFROFFKTDC-UHFFFAOYSA-N 1,6-dimethyl-3,3a,4,5,6,6a-hexahydro-2h-pyrrolo[3,4-b]pyrrole Chemical compound C1CN(C)C2C(C)NCC21 GNTGRFROFFKTDC-UHFFFAOYSA-N 0.000 description 1
- YSPLNTFHXGXSEE-UHFFFAOYSA-N 1-(2,4-difluorophenyl)-8-ethynyl-6,7-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(C#C)C(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=C(F)C=C1F YSPLNTFHXGXSEE-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- KFRUKCGXBOQGKK-UHFFFAOYSA-N 1-cyclopropyl-6,7-difluoro-4-oxo-8-prop-1-ynylquinoline-3-carboxylic acid Chemical compound C1(CC1)N1C=C(C(C2=CC(=C(C(=C12)C#CC)F)F)=O)C(=O)O KFRUKCGXBOQGKK-UHFFFAOYSA-N 0.000 description 1
- KJSKKABRACRSCN-UHFFFAOYSA-N 1-cyclopropyl-6,7-difluoro-8-(3-methoxyprop-1-ynyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1(CC1)N1C=C(C(C2=CC(=C(C(=C12)C#CCOC)F)F)=O)C(=O)O KJSKKABRACRSCN-UHFFFAOYSA-N 0.000 description 1
- COMPJZZVEWJWRC-UHFFFAOYSA-N 1-cyclopropyl-6,7-difluoro-8-(3-methylbut-3-en-1-ynyl)-4-oxoquinoline-3-carboxylic acid Chemical compound CC(=C)C#CC1=C(F)C(F)=CC(C(C(C(O)=O)=C2)=O)=C1N2C1CC1 COMPJZZVEWJWRC-UHFFFAOYSA-N 0.000 description 1
- LQDYTJUITRPUTH-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-7-[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]-4-oxo-8-prop-1-ynylquinoline-3-carboxylic acid Chemical compound C(C)(C)(C)OC(=O)NC1(CN(CC1)C1=C(C=C2C(C(=CN(C2=C1C#CC)C1CC1)C(=O)O)=O)F)C LQDYTJUITRPUTH-UHFFFAOYSA-N 0.000 description 1
- MGTDUKGBHWYGRK-UHFFFAOYSA-N 1-cyclopropyl-8-ethynyl-6,7-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid Chemical compound C1(CC1)N1C(C(C(C2=CC(=C(C(=C12)C#C)F)F)=O)=O)C(=O)O MGTDUKGBHWYGRK-UHFFFAOYSA-N 0.000 description 1
- IHAHRAVLBSKOJU-UHFFFAOYSA-N 1-cyclopropyl-8-ethynyl-6-fluoro-7-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1C2CN(C)CC2CN1C(C=1C#C)=C(F)C=C(C(C(C(O)=O)=C2)=O)C=1N2C1CC1 IHAHRAVLBSKOJU-UHFFFAOYSA-N 0.000 description 1
- PEPHMKLBRWHIDP-UHFFFAOYSA-N 1-cyclopropyl-8-ethynyl-6-fluoro-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1(CC1)N1C=C(C(C2=CC(=C(C(=C12)C#C)N1CC(NCC1)C)F)=O)C(=O)O PEPHMKLBRWHIDP-UHFFFAOYSA-N 0.000 description 1
- WYLFRUUEOJYJPV-UHFFFAOYSA-N 1-cyclopropyl-8-ethynyl-6-fluoro-7-(5-methyl-3,3a,4,6,7,7a-hexahydro-1h-pyrrolo[3,4-c]pyridin-2-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1C2CN(C)CCC2CN1C(C=1C#C)=C(F)C=C(C(C(C(O)=O)=C2)=O)C=1N2C1CC1 WYLFRUUEOJYJPV-UHFFFAOYSA-N 0.000 description 1
- HNZJIWIXRPBFAN-UHFFFAOYSA-N 1-cyclopropylpiperazine Chemical compound C1CC1N1CCNCC1 HNZJIWIXRPBFAN-UHFFFAOYSA-N 0.000 description 1
- CWLUFVAFWWNXJZ-UHFFFAOYSA-N 1-hydroxypyrrolidine Chemical compound ON1CCCC1 CWLUFVAFWWNXJZ-UHFFFAOYSA-N 0.000 description 1
- QVLUVOZDWSAEIP-UHFFFAOYSA-N 1-methyl-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine Chemical compound CN1CCCC2CNCC12 QVLUVOZDWSAEIP-UHFFFAOYSA-N 0.000 description 1
- PFZIWBWEHFZIMT-UHFFFAOYSA-N 1-methyl-3,3a,4,5,6,6a-hexahydro-2h-pyrrolo[2,3-c]pyrrole Chemical compound C1NCC2N(C)CCC21 PFZIWBWEHFZIMT-UHFFFAOYSA-N 0.000 description 1
- WHQNOBWFVDSYOK-UHFFFAOYSA-N 1-pyrrolidin-3-ylimidazole Chemical compound C1NCCC1N1C=NC=C1 WHQNOBWFVDSYOK-UHFFFAOYSA-N 0.000 description 1
- VWHSDFNFHGSPLE-UHFFFAOYSA-N 2,3,3a,4,7,7a-hexahydro-1h-indole Chemical class C1C=CCC2NCCC21 VWHSDFNFHGSPLE-UHFFFAOYSA-N 0.000 description 1
- QMNBWOHIZQXHJZ-UHFFFAOYSA-N 2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-amine Chemical compound NC1C=CCC2CNCC12 QMNBWOHIZQXHJZ-UHFFFAOYSA-N 0.000 description 1
- PADILUPDIURJJL-UHFFFAOYSA-N 2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-ol Chemical compound OC1C=CCC2CNCC12 PADILUPDIURJJL-UHFFFAOYSA-N 0.000 description 1
- KSCPLKVBWDOSAI-UHFFFAOYSA-N 2,3,4,4a,5,6,7,7a-octahydro-1h-pyrrolo[3,4-b]pyridine Chemical compound N1CCCC2CNCC21 KSCPLKVBWDOSAI-UHFFFAOYSA-N 0.000 description 1
- TUYIHOJSSJJFMO-UHFFFAOYSA-N 2,3,4,5,6,6a-hexahydro-1h-cyclopenta[c]pyrrol-3a-amine Chemical compound C1CCC2CNCC21N TUYIHOJSSJJFMO-UHFFFAOYSA-N 0.000 description 1
- QLMMUMCZZDQUNG-UHFFFAOYSA-N 2,3,4,5,6,6a-hexahydro-1h-cyclopenta[c]pyrrol-3a-ylmethanamine Chemical compound C1CCC2CNCC21CN QLMMUMCZZDQUNG-UHFFFAOYSA-N 0.000 description 1
- CEPCPXLLFXPZGW-UHFFFAOYSA-N 2,4-difluoroaniline Chemical compound NC1=CC=C(F)C=C1F CEPCPXLLFXPZGW-UHFFFAOYSA-N 0.000 description 1
- 125000004215 2,4-difluorophenyl group Chemical group [H]C1=C([H])C(*)=C(F)C([H])=C1F 0.000 description 1
- RLAUJXSEGAAKKL-UHFFFAOYSA-N 2,5-dihydro-1h-pyrrol-3-ylmethanamine Chemical compound NCC1=CCNC1 RLAUJXSEGAAKKL-UHFFFAOYSA-N 0.000 description 1
- HNVIQLPOGUDBSU-UHFFFAOYSA-N 2,6-dimethylmorpholine Chemical compound CC1CNCC(C)O1 HNVIQLPOGUDBSU-UHFFFAOYSA-N 0.000 description 1
- DDVRNOMZDQTUNS-UHFFFAOYSA-N 2,7-diazaspiro[4.4]nonane Chemical compound C1NCCC11CNCC1 DDVRNOMZDQTUNS-UHFFFAOYSA-N 0.000 description 1
- FMWBZQBMDUMOMQ-UHFFFAOYSA-N 2-(pyrrolidin-3-ylamino)ethanol Chemical compound OCCNC1CCNC1 FMWBZQBMDUMOMQ-UHFFFAOYSA-N 0.000 description 1
- MNRUCWIWKONNBR-UHFFFAOYSA-N 2-methyl-1,2,3,3a,4,5,6,6a-octahydropyrrolo[2,3-c]pyrrole Chemical compound C1NCC2NC(C)CC21 MNRUCWIWKONNBR-UHFFFAOYSA-N 0.000 description 1
- CPKLWCPJBAELNP-UHFFFAOYSA-N 2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride Chemical compound Cl.Cl.C1C2N(C)CC1NC2 CPKLWCPJBAELNP-UHFFFAOYSA-N 0.000 description 1
- RXNQETQSWLPAFU-UHFFFAOYSA-N 2-methyl-2,5-diazabicyclo[2.2.2]octane;dihydrochloride Chemical compound Cl.Cl.C1CC2N(C)CC1NC2 RXNQETQSWLPAFU-UHFFFAOYSA-N 0.000 description 1
- OQHQOOLVQDEIGL-UHFFFAOYSA-N 2-methyl-2,7-diazaspiro[4.4]nonane Chemical compound C1N(C)CCC11CNCC1 OQHQOOLVQDEIGL-UHFFFAOYSA-N 0.000 description 1
- MHNNAWXXUZQSNM-UHFFFAOYSA-N 2-methylbut-1-ene Chemical compound CCC(C)=C MHNNAWXXUZQSNM-UHFFFAOYSA-N 0.000 description 1
- JHJVBJAZKDJVGP-UHFFFAOYSA-N 2-oxo-8-(trifluoromethyl)-1h-quinoline-3-carboxylic acid Chemical class C1=CC(C(F)(F)F)=C2NC(=O)C(C(=O)O)=CC2=C1 JHJVBJAZKDJVGP-UHFFFAOYSA-N 0.000 description 1
- QXMBJNMNHCGVDT-UHFFFAOYSA-N 2-pyridin-4-ylpiperazine Chemical compound C1NCCNC1C1=CC=NC=C1 QXMBJNMNHCGVDT-UHFFFAOYSA-N 0.000 description 1
- BFVCDPJJFUPNAQ-UHFFFAOYSA-N 2-thiophen-2-ylpiperazine Chemical compound C1NCCNC1C1=CC=CS1 BFVCDPJJFUPNAQ-UHFFFAOYSA-N 0.000 description 1
- RPTSDDODVLDXGF-UHFFFAOYSA-N 3-(diethylaminomethyl)pyrrolidin-3-ol Chemical compound CCN(CC)CC1(O)CCNC1 RPTSDDODVLDXGF-UHFFFAOYSA-N 0.000 description 1
- GSUDCKYXBMHOFJ-UHFFFAOYSA-N 3-(methylaminomethyl)pyrrolidin-3-ol Chemical compound CNCC1(O)CCNC1 GSUDCKYXBMHOFJ-UHFFFAOYSA-N 0.000 description 1
- WWPGEZLKLDDXQP-UHFFFAOYSA-N 3-[(dimethylamino)methyl]pyrrolidin-3-ol Chemical compound CN(C)CC1(O)CCNC1 WWPGEZLKLDDXQP-UHFFFAOYSA-N 0.000 description 1
- YACFFSVYSPMSGS-UHFFFAOYSA-N 3-methoxyprop-1-yne Chemical compound COCC#C YACFFSVYSPMSGS-UHFFFAOYSA-N 0.000 description 1
- ZJUCOCSYMWOBPJ-UHFFFAOYSA-N 3-methyl-1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-b]pyrrole Chemical compound C1NCC2C(C)CNC21 ZJUCOCSYMWOBPJ-UHFFFAOYSA-N 0.000 description 1
- CFPCKNVBSYLJHT-UHFFFAOYSA-N 3-methyl-3,8-diazabicyclo[3.2.1]octane;dihydrochloride Chemical compound Cl.Cl.C1N(C)CC2CCC1N2 CFPCKNVBSYLJHT-UHFFFAOYSA-N 0.000 description 1
- KYINPWAJIVTFBW-UHFFFAOYSA-N 3-methylpyrrolidine Chemical compound CC1CCNC1 KYINPWAJIVTFBW-UHFFFAOYSA-N 0.000 description 1
- WGWSCTVKWVXMGD-UHFFFAOYSA-N 3a-methyl-1,2,3,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylic acid Chemical compound C1CNC2CN(C(O)=O)CC21C WGWSCTVKWVXMGD-UHFFFAOYSA-N 0.000 description 1
- VVBMVJAZPUCDRH-UHFFFAOYSA-N 4-(methylamino)pyrrolidin-3-ol Chemical compound CNC1CNCC1O VVBMVJAZPUCDRH-UHFFFAOYSA-N 0.000 description 1
- ZZLCFHIKESPLTH-UHFFFAOYSA-N 4-Methylbiphenyl Chemical compound C1=CC(C)=CC=C1C1=CC=CC=C1 ZZLCFHIKESPLTH-UHFFFAOYSA-N 0.000 description 1
- ZCZJKVCIYONNJR-UHFFFAOYSA-N 4-aminopyrrolidin-3-ol Chemical compound NC1CNCC1O ZCZJKVCIYONNJR-UHFFFAOYSA-N 0.000 description 1
- KOXOQAAJGRYADY-UHFFFAOYSA-N 4-methoxy-2-methylpyrrolidin-3-amine Chemical compound COC1CNC(C)C1N KOXOQAAJGRYADY-UHFFFAOYSA-N 0.000 description 1
- FHCMZTOUVZUHAP-UHFFFAOYSA-N 4-methoxy-n-methylpyrrolidin-3-amine Chemical compound CNC1CNCC1OC FHCMZTOUVZUHAP-UHFFFAOYSA-N 0.000 description 1
- PZUZDNGNEFEKNJ-UHFFFAOYSA-N 4-methyl-3,4a,5,6,7,7a-hexahydro-2h-pyrrolo[3,4-b][1,4]oxazine Chemical compound CN1CCOC2CNCC12 PZUZDNGNEFEKNJ-UHFFFAOYSA-N 0.000 description 1
- DEJHJEASWLGAEW-UHFFFAOYSA-N 4-methylidenepyrrolidin-3-amine Chemical compound NC1CNCC1=C DEJHJEASWLGAEW-UHFFFAOYSA-N 0.000 description 1
- FFNCEXOZZTUYQX-UHFFFAOYSA-N 4-methylmorpholin-3-amine Chemical compound CN1CCOCC1N FFNCEXOZZTUYQX-UHFFFAOYSA-N 0.000 description 1
- VBTBUCYRQSUCCE-UHFFFAOYSA-N 5-azaspiro[2.4]heptan-7-amine Chemical compound NC1CNCC11CC1 VBTBUCYRQSUCCE-UHFFFAOYSA-N 0.000 description 1
- AYYHLKRECDVVJT-UHFFFAOYSA-N 5-methyl-1,2,3,4,6,7-hexahydropyrrolo[3,4-c]pyridine Chemical compound C1N(C)CCC2=C1CNC2 AYYHLKRECDVVJT-UHFFFAOYSA-N 0.000 description 1
- DLUDAUJQMXTXGQ-UHFFFAOYSA-N 5-methyl-2,3,3a,4,6,6a-hexahydro-1h-pyrrolo[2,3-c]pyrrole Chemical compound C1CNC2CN(C)CC21 DLUDAUJQMXTXGQ-UHFFFAOYSA-N 0.000 description 1
- YQURLNGUWNDBIR-UHFFFAOYSA-N 5-methyl-2,3,3a,4,6,6a-hexahydro-1h-pyrrolo[3,4-c]pyrrole Chemical compound C1NCC2CN(C)CC21 YQURLNGUWNDBIR-UHFFFAOYSA-N 0.000 description 1
- GOCJIDGDYPLCJW-UHFFFAOYSA-N 7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-8-ethenyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(N)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C=C GOCJIDGDYPLCJW-UHFFFAOYSA-N 0.000 description 1
- DUPSZZBCFKPIJM-UHFFFAOYSA-N 7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-8-ethynyl-6-fluoro-4-oxoquinoline-3-carboxylic acid hydrate Chemical compound O.NC1CN(CC1)C1=C(C=C2C(C(=CN(C2=C1C#C)C1CC1)C(=O)O)=O)F DUPSZZBCFKPIJM-UHFFFAOYSA-N 0.000 description 1
- WNHMKPKMWPJOMW-KPZWWZAWSA-N 7-[(4as,7as)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-1-cyclopropyl-8-ethenyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(C=C)C(N3C[C@H]4NCCC[C@H]4C3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 WNHMKPKMWPJOMW-KPZWWZAWSA-N 0.000 description 1
- GXPQSAFGKATKJH-UHFFFAOYSA-N 8-(1-chloroethenyl)-2-oxo-1h-quinoline-3-carboxylic acid Chemical class C1=CC(C(Cl)=C)=C2NC(=O)C(C(=O)O)=CC2=C1 GXPQSAFGKATKJH-UHFFFAOYSA-N 0.000 description 1
- QBNSNYJPZRSJRN-UHFFFAOYSA-N 8-ethenyl-2-oxo-1H-quinoline-3-carboxylic acid Chemical class O=C1NC2=C(C=CC=C2C=C1C(=O)O)C=C QBNSNYJPZRSJRN-UHFFFAOYSA-N 0.000 description 1
- AZYNIFYXHZUMGE-UHFFFAOYSA-N 8-ethynyl-6,7-difluoro-4-oxo-1H-quinoline-3-carboxylic acid Chemical compound C(#C)C=1C(=C(C=C2C(C(=CNC=12)C(=O)O)=O)F)F AZYNIFYXHZUMGE-UHFFFAOYSA-N 0.000 description 1
- LPDAGTNGXYMBLZ-UHFFFAOYSA-N 8-methyl-2-oxo-1h-quinoline-3-carboxylic acid Chemical class C1=C(C(O)=O)C(=O)NC2=C1C=CC=C2C LPDAGTNGXYMBLZ-UHFFFAOYSA-N 0.000 description 1
- XNZIHVKLRKGFBS-UHFFFAOYSA-N 8-methyl-3,8-diazabicyclo[3.2.1]octane;dihydrochloride Chemical compound Cl.Cl.C1NCC2CCC1N2C XNZIHVKLRKGFBS-UHFFFAOYSA-N 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- 208000035143 Bacterial infection Diseases 0.000 description 1
- UPTLPUXAZHUMIJ-UHFFFAOYSA-N C(C)(C)(C)OC(=O)NC1(CN=CC=C1)C Chemical compound C(C)(C)(C)OC(=O)NC1(CN=CC=C1)C UPTLPUXAZHUMIJ-UHFFFAOYSA-N 0.000 description 1
- QBNLELLLRCIVPJ-UHFFFAOYSA-N C1(CC1)N1C(=C(C(C2=CC(=C(C=C12)N1CCN(CC1)C)F)=O)C(=O)O)C#CC Chemical compound C1(CC1)N1C(=C(C(C2=CC(=C(C=C12)N1CCN(CC1)C)F)=O)C(=O)O)C#CC QBNLELLLRCIVPJ-UHFFFAOYSA-N 0.000 description 1
- JONRRIJMOKJKJN-UHFFFAOYSA-N C1C(NC(=O)OC(C)(C)C)(C)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C#C Chemical compound C1C(NC(=O)OC(C)(C)C)(C)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C#C JONRRIJMOKJKJN-UHFFFAOYSA-N 0.000 description 1
- 229930186147 Cephalosporin Natural products 0.000 description 1
- 229910021580 Cobalt(II) chloride Inorganic materials 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 241000305071 Enterobacterales Species 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- IAJILQKETJEXLJ-UHFFFAOYSA-N Galacturonsaeure Natural products O=CC(O)C(O)C(O)C(O)C(O)=O IAJILQKETJEXLJ-UHFFFAOYSA-N 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 206010061201 Helminthic infection Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 229930182555 Penicillin Natural products 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical class [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- WXYKJIYEJCIDIX-UHFFFAOYSA-N [4-(methylamino)pyrrolidin-3-yl]methanol Chemical compound CNC1CNCC1CO WXYKJIYEJCIDIX-UHFFFAOYSA-N 0.000 description 1
- JEDZLBFUGJTJGQ-UHFFFAOYSA-N [Na].COCCO[AlH]OCCOC Chemical compound [Na].COCCO[AlH]OCCOC JEDZLBFUGJTJGQ-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- IAJILQKETJEXLJ-RSJOWCBRSA-N aldehydo-D-galacturonic acid Chemical compound O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O IAJILQKETJEXLJ-RSJOWCBRSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical group 0.000 description 1
- 229940126575 aminoglycoside Drugs 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- FDPKMJDUXJFKOI-UHFFFAOYSA-N azetidin-3-amine Chemical compound NC1CNC1 FDPKMJDUXJFKOI-UHFFFAOYSA-N 0.000 description 1
- 208000022362 bacterial infectious disease Diseases 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- YNHIGQDRGKUECZ-UHFFFAOYSA-L bis(triphenylphosphine)palladium(ii) dichloride Chemical compound [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 1
- INLLPKCGLOXCIV-UHFFFAOYSA-N bromoethene Chemical class BrC=C INLLPKCGLOXCIV-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- 150000001780 cephalosporins Chemical class 0.000 description 1
- 238000000262 chemical ionisation mass spectrometry Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 229960003405 ciprofloxacin Drugs 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- GVPFVAHMJGGAJG-UHFFFAOYSA-L cobalt dichloride Chemical compound [Cl-].[Cl-].[Co+2] GVPFVAHMJGGAJG-UHFFFAOYSA-L 0.000 description 1
- 230000001332 colony forming effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 125000004212 difluorophenyl group Chemical group 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- LAFZVFHNCWIFLX-UHFFFAOYSA-N ethyl 2-(3-bromo-2,4,5-trifluorobenzoyl)-3-(2,4-difluoroanilino)prop-2-enoate Chemical compound C=1C(F)=C(F)C(Br)=C(F)C=1C(=O)C(C(=O)OCC)=CNC1=CC=C(F)C=C1F LAFZVFHNCWIFLX-UHFFFAOYSA-N 0.000 description 1
- BCKAYYQQKILFDS-UHFFFAOYSA-N ethyl 2-(3-bromo-2,4,5-trifluorobenzoyl)-3-(ethylamino)prop-2-enoate Chemical compound CCNC=C(C(=O)OCC)C(=O)C1=CC(F)=C(F)C(Br)=C1F BCKAYYQQKILFDS-UHFFFAOYSA-N 0.000 description 1
- NUBFPWXUKJGZNA-UHFFFAOYSA-N ethyl 8-chloro-1-cyclopropyl-6,7-difluoro-4-oxoquinoline-3-carboxylate Chemical compound C12=C(Cl)C(F)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 NUBFPWXUKJGZNA-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- GHXZPUGJZVBLGC-UHFFFAOYSA-N iodoethene Chemical class IC=C GHXZPUGJZVBLGC-UHFFFAOYSA-N 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 235000015110 jellies Nutrition 0.000 description 1
- 230000002147 killing effect Effects 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- WGOPGODQLGJZGL-UHFFFAOYSA-N lithium;butane Chemical compound [Li+].CC[CH-]C WGOPGODQLGJZGL-UHFFFAOYSA-N 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- OTCKOJUMXQWKQG-UHFFFAOYSA-L magnesium bromide Chemical compound [Mg+2].[Br-].[Br-] OTCKOJUMXQWKQG-UHFFFAOYSA-L 0.000 description 1
- 229910001623 magnesium bromide Inorganic materials 0.000 description 1
- AUHZEENZYGFFBQ-UHFFFAOYSA-N mesitylene Substances CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 1
- 125000001827 mesitylenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1C([H])([H])[H])C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- OXYALYJRWGRVAM-UHFFFAOYSA-N morpholin-2-ylmethanamine Chemical compound NCC1CNCCO1 OXYALYJRWGRVAM-UHFFFAOYSA-N 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- XYTMARUCVDTGKP-UHFFFAOYSA-N n,2-dimethylpyrrolidin-3-amine Chemical compound CNC1CCNC1C XYTMARUCVDTGKP-UHFFFAOYSA-N 0.000 description 1
- ZGHCGRBMRYSXEI-UHFFFAOYSA-N n,5-dimethyl-2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-amine Chemical compound C1C=C(C)C(NC)C2CNCC21 ZGHCGRBMRYSXEI-UHFFFAOYSA-N 0.000 description 1
- YMIGDZKZDDAGJE-UHFFFAOYSA-N n,5-dimethylpyrrolidin-3-amine Chemical compound CNC1CNC(C)C1 YMIGDZKZDDAGJE-UHFFFAOYSA-N 0.000 description 1
- UQOQSDFUSIRLCU-UHFFFAOYSA-N n,6,7-trimethyl-2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-amine Chemical compound CNC1C=C(C)C(C)C2CNCC12 UQOQSDFUSIRLCU-UHFFFAOYSA-N 0.000 description 1
- PPNDPGDWMJJOSY-UHFFFAOYSA-N n,6-dimethyl-2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-amine Chemical compound CNC1C=C(C)CC2CNCC12 PPNDPGDWMJJOSY-UHFFFAOYSA-N 0.000 description 1
- DIEWEMZWQWGRNU-UHFFFAOYSA-N n,7a-dimethyl-1,2,3,3a,4,7-hexahydroisoindol-4-amine Chemical compound CNC1C=CCC2(C)CNCC12 DIEWEMZWQWGRNU-UHFFFAOYSA-N 0.000 description 1
- KNCQHMMKDOIHRT-UHFFFAOYSA-N n,n-dimethyl-1-morpholin-2-ylmethanamine Chemical compound CN(C)CC1CNCCO1 KNCQHMMKDOIHRT-UHFFFAOYSA-N 0.000 description 1
- BUQMHUKZYMREQT-UHFFFAOYSA-N n-(pyrrolidin-3-ylmethyl)ethanamine Chemical compound CCNCC1CCNC1 BUQMHUKZYMREQT-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- OSZKJPGPCAAACZ-UHFFFAOYSA-N n-ethyl-2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-amine Chemical compound CCNC1C=CCC2CNCC12 OSZKJPGPCAAACZ-UHFFFAOYSA-N 0.000 description 1
- HMIOFHWVBNNKPR-UHFFFAOYSA-N n-methyl-1-morpholin-2-ylmethanamine Chemical compound CNCC1CNCCO1 HMIOFHWVBNNKPR-UHFFFAOYSA-N 0.000 description 1
- JVODWNWKCOVKTO-UHFFFAOYSA-N n-methyl-1-pyrrolidin-3-ylmethanamine Chemical compound CNCC1CCNC1 JVODWNWKCOVKTO-UHFFFAOYSA-N 0.000 description 1
- XBDPVNKGUTWIMJ-UHFFFAOYSA-N n-methyl-2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-amine;dihydrochloride Chemical compound Cl.Cl.CNC1C=CCC2CNCC12 XBDPVNKGUTWIMJ-UHFFFAOYSA-N 0.000 description 1
- NGZYRKGJWYJGRS-UHFFFAOYSA-N n-methylpyrrolidin-3-amine Chemical compound CNC1CCNC1 NGZYRKGJWYJGRS-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000002816 nickel compounds Chemical class 0.000 description 1
- ZBRJXVVKPBZPAN-UHFFFAOYSA-L nickel(2+);triphenylphosphane;dichloride Chemical compound [Cl-].[Cl-].[Ni+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 ZBRJXVVKPBZPAN-UHFFFAOYSA-L 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- WLJNZVDCPSBLRP-UHFFFAOYSA-N pamoic acid Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=C(C=3O)C(=O)O)=C(O)C(C(O)=O)=CC2=C1 WLJNZVDCPSBLRP-UHFFFAOYSA-N 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 150000002960 penicillins Chemical class 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000004321 preservation Methods 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- NGXSWUFDCSEIOO-UHFFFAOYSA-N pyrrolidin-3-amine Chemical compound NC1CCNC1 NGXSWUFDCSEIOO-UHFFFAOYSA-N 0.000 description 1
- JHHZLHWJQPUNKB-UHFFFAOYSA-N pyrrolidin-3-ol Chemical compound OC1CCNC1 JHHZLHWJQPUNKB-UHFFFAOYSA-N 0.000 description 1
- OQCUGPQOZNYIMV-UHFFFAOYSA-N pyrrolidin-3-ylmethanamine Chemical compound NCC1CCNC1 OQCUGPQOZNYIMV-UHFFFAOYSA-N 0.000 description 1
- QOTUIIJRVXKSJU-UHFFFAOYSA-N pyrrolidin-3-ylmethanol Chemical compound OCC1CCNC1 QOTUIIJRVXKSJU-UHFFFAOYSA-N 0.000 description 1
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical class C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 description 1
- DJXNJVFEFSWHLY-UHFFFAOYSA-N quinoline-3-carboxylic acid Chemical compound C1=CC=CC2=CC(C(=O)O)=CN=C21 DJXNJVFEFSWHLY-UHFFFAOYSA-N 0.000 description 1
- KVROVDQWRUAIID-UHFFFAOYSA-N quinoline-3-carboxylic acid;hydrochloride Chemical compound Cl.C1=CC=CC2=CC(C(=O)O)=CN=C21 KVROVDQWRUAIID-UHFFFAOYSA-N 0.000 description 1
- 229910052705 radium Inorganic materials 0.000 description 1
- HCWPIIXVSYCSAN-UHFFFAOYSA-N radium atom Chemical compound [Ra] HCWPIIXVSYCSAN-UHFFFAOYSA-N 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 150000003378 silver Chemical class 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000012419 sodium bis(2-methoxyethoxy)aluminum hydride Substances 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- OPECEBCCQJYQFG-UHFFFAOYSA-N tert-butyl 1,2,3,4,6,7-hexahydropyrrolo[3,4-c]pyridine-5-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC2=C1CNC2 OPECEBCCQJYQFG-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- LXXPLHYWFLINDJ-UHFFFAOYSA-N tert-butyl n-(2-methylazetidin-3-yl)carbamate Chemical compound CC1NCC1NC(=O)OC(C)(C)C LXXPLHYWFLINDJ-UHFFFAOYSA-N 0.000 description 1
- PIGDOXPNNMFBNA-UHFFFAOYSA-N tert-butyl n-(4-methoxypyrrolidin-3-yl)carbamate Chemical compound COC1CNCC1NC(=O)OC(C)(C)C PIGDOXPNNMFBNA-UHFFFAOYSA-N 0.000 description 1
- HBFRNKXGNAOUDC-UHFFFAOYSA-N tert-butyl n-(5-methylpyrrolidin-3-yl)carbamate Chemical compound CC1CC(NC(=O)OC(C)(C)C)CN1 HBFRNKXGNAOUDC-UHFFFAOYSA-N 0.000 description 1
- NEMXVXVJGXZDRR-UHFFFAOYSA-N tert-butyl n-(azetidin-3-yl)carbamate Chemical compound CC(C)(C)OC(=O)NC1CNC1 NEMXVXVJGXZDRR-UHFFFAOYSA-N 0.000 description 1
- MOLUHRBHXXGWDP-UHFFFAOYSA-N tert-butyl n-(azetidin-3-ylmethyl)carbamate Chemical compound CC(C)(C)OC(=O)NCC1CNC1 MOLUHRBHXXGWDP-UHFFFAOYSA-N 0.000 description 1
- WIEJVMZWPIUWHO-UHFFFAOYSA-N tert-butyl n-(pyrrolidin-3-ylmethyl)carbamate Chemical compound CC(C)(C)OC(=O)NCC1CCNC1 WIEJVMZWPIUWHO-UHFFFAOYSA-N 0.000 description 1
- SMJNSXWVOQHMLD-UHFFFAOYSA-N tert-butyl n-[(3-methoxypyrrolidin-3-yl)methyl]carbamate Chemical compound CC(C)(C)OC(=O)NCC1(OC)CCNC1 SMJNSXWVOQHMLD-UHFFFAOYSA-N 0.000 description 1
- TYWCCFAGALHZPI-UHFFFAOYSA-N tert-butyl n-[(4-chloropyrrolidin-3-yl)methyl]carbamate Chemical compound CC(C)(C)OC(=O)NCC1CNCC1Cl TYWCCFAGALHZPI-UHFFFAOYSA-N 0.000 description 1
- XUKALTRSOXMVKA-UHFFFAOYSA-N tert-butyl n-penta-1,3-dienylcarbamate Chemical compound CC=CC=CNC(=O)OC(C)(C)C XUKALTRSOXMVKA-UHFFFAOYSA-N 0.000 description 1
- DQQJBEAXSOOCPG-UHFFFAOYSA-N tert-butyl n-pyrrolidin-3-ylcarbamate Chemical compound CC(C)(C)OC(=O)NC1CCNC1 DQQJBEAXSOOCPG-UHFFFAOYSA-N 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 150000003623 transition metal compounds Chemical class 0.000 description 1
- GVFBCPZHVQBUIG-UHFFFAOYSA-N tributyl(3,3-dimethylbut-1-ynyl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C#CC(C)(C)C GVFBCPZHVQBUIG-UHFFFAOYSA-N 0.000 description 1
- QIWRFOJWQSSRJZ-UHFFFAOYSA-N tributyl(ethenyl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C=C QIWRFOJWQSSRJZ-UHFFFAOYSA-N 0.000 description 1
- KCQJLTOSSVXOCC-UHFFFAOYSA-N tributyl(prop-1-ynyl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C#CC KCQJLTOSSVXOCC-UHFFFAOYSA-N 0.000 description 1
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 1
- DTQVDTLACAAQTR-DYCDLGHISA-N trifluoroacetic acid-d1 Chemical compound [2H]OC(=O)C(F)(F)F DTQVDTLACAAQTR-DYCDLGHISA-N 0.000 description 1
- DLQYXUGCCKQSRJ-UHFFFAOYSA-N tris(furan-2-yl)phosphane Chemical compound C1=COC(P(C=2OC=CC=2)C=2OC=CC=2)=C1 DLQYXUGCCKQSRJ-UHFFFAOYSA-N 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
- C07D215/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3 with oxygen atoms in position 4
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P33/00—Antiparasitic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P33/00—Antiparasitic agents
- A61P33/02—Antiprotozoals, e.g. for leishmaniasis, trichomoniasis, toxoplasmosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P33/00—Antiparasitic agents
- A61P33/10—Anthelmintics
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/08—Bridged systems
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Tropical Medicine & Parasitology (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Quinoline Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Peptides Or Proteins (AREA)
- Indole Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Pyridine Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Paints Or Removers (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4123918A DE4123918A1 (de) | 1991-07-19 | 1991-07-19 | 8-vinyl- und 8-ethinyl-chinoloncarbonsaeuren |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SK219192A3 SK219192A3 (en) | 1998-08-05 |
| SK279221B6 true SK279221B6 (sk) | 1998-08-05 |
Family
ID=6436512
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SK2191-92A SK279221B6 (sk) | 1991-07-19 | 1992-07-13 | Deriváty kyseliny chinolónkarboxylovej, spôsob ich |
Country Status (22)
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4121214A1 (de) * | 1991-06-27 | 1993-01-14 | Bayer Ag | 7-azaisoindolinyl-chinolon- und -naphthyridoncarbonsaeure-derivate |
| DE4230804A1 (de) * | 1992-09-15 | 1994-03-17 | Bayer Ag | 7-Isoindolinyl-chinolon- und -naphthyridon-Derivate |
| DE4303657A1 (de) * | 1993-02-09 | 1994-08-11 | Bayer Ag | Neue Chinolon- und Naphthyridoncarbonsäurederivate |
| KR950018003A (ko) * | 1993-12-09 | 1995-07-22 | 스미스클라인 비참 피엘씨 | 신규한 퀴놀론 유도체 및 그의 제조 방법 |
| DE4418510A1 (de) * | 1994-05-27 | 1995-11-30 | Bayer Ag | 1,9-überbrückte Thiazolol[3,4-a]chinolinderivate |
| DE4425659A1 (de) * | 1994-07-20 | 1996-01-25 | Bayer Ag | Neue N1-diverse 6-Fluor-8-difluormethoxy substituierte Chinoloncarbonsäuren |
| DE4427530A1 (de) * | 1994-08-04 | 1996-02-08 | Bayer Ag | Chinolon- und Naphthyridoncarbonsäure-Derivate |
| CA2247020C (en) * | 1996-02-23 | 2005-11-08 | Bayer Aktiengesellschaft | Possibly substituted 8-cyano-1-cyclopropyl-7-(2,8-diazabicyclo-[4.3.0]-nonan-8-yl)-6-fluoro-1,4-dihydro-4-oxo-3-quinolin carboxylic acids and their derivatives |
| DK0897919T3 (da) | 1996-04-19 | 2004-09-27 | Wakunaga Pharma Co Ltd | Nye pyridoncarboxylsyrederivater eller salte deraf samt antibakterielle midler indeholdende disse som den aktive bestanddel |
| AU1040597A (en) * | 1996-12-04 | 1998-06-29 | Daiichi Pharmaceutical Co., Ltd. | Substituted aminomethylpyrrolidine derivatives |
| CN1264837C (zh) | 1997-09-15 | 2006-07-19 | 普罗克特和甘保尔公司 | 喹诺酮抗微生物剂、其组合物和应用 |
| JP4639149B2 (ja) | 2003-09-10 | 2011-02-23 | 杏林製薬株式会社 | 7−(4−置換−3−シクロプロピルアミノメチル−1−ピロリジニル)キノロンカルボン酸誘導体 |
| US7563805B2 (en) * | 2005-05-19 | 2009-07-21 | Daiichi Pharmaceutical Co., Ltd. | Tri-, tetra-substituted-3-aminopyrrolidine derivative |
| RU2420524C2 (ru) * | 2005-05-19 | 2011-06-10 | Дайити Санкио Компани, Лимитед | Производные три- или тетра-замещенного-3-аминопирролидина |
| WO2007037303A1 (ja) * | 2005-09-28 | 2007-04-05 | Daiichi Sankyo Company, Limited | テトラ置換-5-アザスピロ[2.4]へプタン誘導体の製法およびその光学活性中間体 |
| SI2001862T1 (sl) | 2006-03-28 | 2011-10-28 | Warner Chilcott Co Llc | Soli malatov in polimorfi (3S, 5S)-7-(3-amino-5-metil-piperidinil)-1-ciklopropil-1,4-dihidro-8-metoksi- 4-okso-3-kinolinkarboksline kisline |
| KR20110082635A (ko) | 2006-03-28 | 2011-07-19 | 워너 칠콧 컴퍼니 엘엘씨 | 퀴놀론 중간체를 제조하기 위한 커플링 방법 |
| CA2688008A1 (en) | 2007-05-24 | 2008-11-27 | Kyorin Pharmaceutical Co., Ltd. | Mutilin derivative having heterocyclic aromatic ring carboxylic acid structure in substituent at 14-position |
| PT3790874T (pt) * | 2018-05-09 | 2023-05-31 | Bayer Animal Health Gmbh | Derivados de quinolina antelmínticos |
| RU2757741C1 (ru) * | 2021-03-01 | 2021-10-21 | Федеральное государственное бюджетное учреждение науки Институт химической биологии и фундаментальной медицины Сибирского отделения Российской академии наук (ИХБФМ СО РАН) | Производное ципрофлоксацина, обладающее антибактериальной активностью в отношении антибиотикоустойчивых штаммов микроорганизмов |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4123536A (en) * | 1977-12-14 | 1978-10-31 | Warner-Lambert Company | Dialkyl ({[3-(alkoxycarbonyl)-1,4-dihydro-4-oxo-8-quinolinyl]amino}methylene)propanedioates |
| DE3705621C2 (de) * | 1986-02-25 | 1997-01-09 | Otsuka Pharma Co Ltd | Heterocyclisch substituierte Chinoloncarbonsäurederivate |
| JPS62215572A (ja) * | 1986-03-17 | 1987-09-22 | Kyorin Pharmaceut Co Ltd | キノロンカルボン酸誘導体 |
| US5047538A (en) * | 1990-04-12 | 1991-09-10 | Warner-Lambert Company | Quinolinecarboxylic acid antibacterial agents |
-
1991
- 1991-07-19 DE DE4123918A patent/DE4123918A1/de not_active Withdrawn
-
1992
- 1992-06-26 TW TW081105031A patent/TW201309B/zh active
- 1992-07-03 NO NO922639A patent/NO302886B1/no not_active IP Right Cessation
- 1992-07-06 DE DE59207880T patent/DE59207880D1/de not_active Expired - Fee Related
- 1992-07-06 AT AT92111454T patent/ATE147733T1/de not_active IP Right Cessation
- 1992-07-06 ES ES92111454T patent/ES2097835T3/es not_active Expired - Lifetime
- 1992-07-06 DK DK92111454.2T patent/DK0523512T3/da active
- 1992-07-06 EP EP92111454A patent/EP0523512B1/de not_active Expired - Lifetime
- 1992-07-13 CZ CS922191A patent/CZ282037B6/cs not_active IP Right Cessation
- 1992-07-13 SK SK2191-92A patent/SK279221B6/sk unknown
- 1992-07-14 MX MX9204110A patent/MX9204110A/es not_active IP Right Cessation
- 1992-07-14 AU AU19663/92A patent/AU658901B2/en not_active Ceased
- 1992-07-16 CA CA002073993A patent/CA2073993A1/en not_active Abandoned
- 1992-07-16 IL IL102520A patent/IL102520A/xx not_active IP Right Cessation
- 1992-07-16 FI FI923268A patent/FI103043B1/fi active IP Right Grant
- 1992-07-17 HU HU9202349A patent/HU219910B/hu not_active IP Right Cessation
- 1992-07-17 PL PL92295331A patent/PL171910B1/pl unknown
- 1992-07-17 IE IE922348A patent/IE80557B1/en not_active IP Right Cessation
- 1992-07-17 RU SU925052410A patent/RU2077533C1/ru active
- 1992-07-17 ZA ZA925351A patent/ZA925351B/xx unknown
- 1992-07-17 JP JP21245092A patent/JP3174405B2/ja not_active Expired - Fee Related
- 1992-07-18 KR KR1019920012826A patent/KR100240608B1/ko not_active Expired - Fee Related
-
1997
- 1997-01-16 GR GR970400065T patent/GR3022305T3/el unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SK279221B6 (sk) | Deriváty kyseliny chinolónkarboxylovej, spôsob ich | |
| RU2114832C1 (ru) | Производные хинолон- и нафтиридон-карбоновой кислоты в виде смеси изомеров или отдельных изомеров, их соли | |
| SK190192A3 (en) | Quinoline carboxylic and naphthyridone carboxylic acid derivatives | |
| CZ192892A3 (en) | Derivatives of 7-azaisoindolinyl-quinolonecarboxylic and naphthyridonecarboxylic acids | |
| CZ396692A3 (en) | Quinolonecarboxylic and naphthyridonecarboxylic acids derivatives | |
| AU689189B2 (en) | 5-vinyl- and 5-ethinyl-quinolone- carboxylic acids | |
| HUT66376A (en) | Quinolone-carboxylic acids | |
| US4840954A (en) | 6,7-disubstituted 1-cycloproply-1,4-dihydro-4-oxo-1,8-naphthyridine-3-carboxylic acids | |
| US5468742A (en) | 8-vinyl- and 9-ethinyl-quinolone-carboxylic acids | |
| JPH04282384A (ja) | 7−(2,7−ジアザビシクロ〔3.3.0〕オクチル)−3−キノロン及びナフチリドンカルボン酸誘導体 | |
| Al-Qawasmeh et al. | Synthesis and antibacterial activity of 9-cyclopropyl-4-fluoro-6-oxo-6, 9-dihydro-[1, 2, 5] thiadiazolo [3, 4-h] quinoline-7-carboxylic acid and its ethyl ester. | |
| NZ250005A (en) | 4-amino-hexahydroisoindoles as process intermediates |