SE408794B - Forfarande for framstellning av nya (fenoxi- eller naftyloxi-)propanolamin-derivat med farmakologiska egenskaper - Google Patents
Forfarande for framstellning av nya (fenoxi- eller naftyloxi-)propanolamin-derivat med farmakologiska egenskaperInfo
- Publication number
- SE408794B SE408794B SE7316863A SE7316863A SE408794B SE 408794 B SE408794 B SE 408794B SE 7316863 A SE7316863 A SE 7316863A SE 7316863 A SE7316863 A SE 7316863A SE 408794 B SE408794 B SE 408794B
- Authority
- SE
- Sweden
- Prior art keywords
- radical
- hydrogen
- hydrogen atom
- carbon atoms
- ethyl acetate
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 44
- 238000002360 preparation method Methods 0.000 title claims description 5
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical class O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 title claims description 3
- 230000000144 pharmacologic effect Effects 0.000 title 1
- 150000003152 propanolamines Chemical class 0.000 title 1
- -1 alkylene radical Chemical class 0.000 claims description 186
- 239000000203 mixture Substances 0.000 claims description 105
- 150000001875 compounds Chemical class 0.000 claims description 57
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 52
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 48
- 239000007858 starting material Substances 0.000 claims description 44
- 229910052739 hydrogen Inorganic materials 0.000 claims description 38
- 239000001257 hydrogen Substances 0.000 claims description 38
- 125000004432 carbon atom Chemical group C* 0.000 claims description 37
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 32
- 150000003254 radicals Chemical class 0.000 claims description 31
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 26
- 150000003839 salts Chemical class 0.000 claims description 25
- 125000006239 protecting group Chemical group 0.000 claims description 23
- 239000002253 acid Substances 0.000 claims description 21
- 150000001412 amines Chemical class 0.000 claims description 19
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 17
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 239000012458 free base Substances 0.000 claims description 10
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 9
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 8
- VQTUBCCKSQIDNK-UHFFFAOYSA-N iso-butene Natural products CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 claims description 8
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 8
- 125000003342 alkenyl group Chemical group 0.000 claims description 7
- 238000007327 hydrogenolysis reaction Methods 0.000 claims description 7
- 150000001728 carbonyl compounds Chemical class 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 4
- 239000000460 chlorine Chemical group 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- JEVCWSUVFOYBFI-UHFFFAOYSA-N cyanyl Chemical compound N#[C] JEVCWSUVFOYBFI-UHFFFAOYSA-N 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 239000002243 precursor Substances 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000005277 alkyl imino group Chemical group 0.000 claims description 2
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical group [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims description 2
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 claims description 2
- 125000005702 oxyalkylene group Chemical group 0.000 claims description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims 2
- 239000007789 gas Substances 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 286
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 207
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 112
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 58
- 230000008018 melting Effects 0.000 description 58
- 238000002844 melting Methods 0.000 description 58
- 239000000243 solution Substances 0.000 description 46
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 45
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 36
- 238000002425 crystallisation Methods 0.000 description 36
- 230000008025 crystallization Effects 0.000 description 36
- 239000002904 solvent Substances 0.000 description 36
- KFZMGEQAYNKOFK-UHFFFAOYSA-N 2-propanol Substances CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 35
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 35
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 33
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 28
- 229960004592 isopropanol Drugs 0.000 description 27
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 26
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 26
- 239000007787 solid Substances 0.000 description 22
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 20
- 238000000354 decomposition reaction Methods 0.000 description 19
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 18
- 239000000706 filtrate Substances 0.000 description 17
- 238000010992 reflux Methods 0.000 description 17
- FQYUMYWMJTYZTK-UHFFFAOYSA-N Phenyl glycidyl ether Chemical compound C1OC1COC1=CC=CC=C1 FQYUMYWMJTYZTK-UHFFFAOYSA-N 0.000 description 16
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 13
- 235000006408 oxalic acid Nutrition 0.000 description 13
- 239000003208 petroleum Substances 0.000 description 13
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 11
- 239000007864 aqueous solution Substances 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 11
- 239000000284 extract Substances 0.000 description 11
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- 239000003085 diluting agent Substances 0.000 description 9
- 229960001317 isoprenaline Drugs 0.000 description 9
- 239000002585 base Substances 0.000 description 8
- 230000000903 blocking effect Effects 0.000 description 8
- 230000000747 cardiac effect Effects 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 7
- ANBZWDBEKOZNHY-UHFFFAOYSA-N ethanol;oxalic acid Chemical compound CCO.OC(=O)C(O)=O ANBZWDBEKOZNHY-UHFFFAOYSA-N 0.000 description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- WDAXFOBOLVPGLV-UHFFFAOYSA-N ethyl isobutyrate Chemical compound CCOC(=O)C(C)C WDAXFOBOLVPGLV-UHFFFAOYSA-N 0.000 description 7
- 239000000499 gel Substances 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 6
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 6
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 6
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 150000002431 hydrogen Chemical class 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- KWGRBVOPPLSCSI-WPRPVWTQSA-N (-)-ephedrine Chemical compound CN[C@@H](C)[C@H](O)C1=CC=CC=C1 KWGRBVOPPLSCSI-WPRPVWTQSA-N 0.000 description 4
- XLHUBROMZOAQMV-UHFFFAOYSA-N 1,4-benzosemiquinone Chemical group [O]C1=CC=C(O)C=C1 XLHUBROMZOAQMV-UHFFFAOYSA-N 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- UCTWMZQNUQWSLP-UHFFFAOYSA-N adrenaline Chemical compound CNCC(O)C1=CC=C(O)C(O)=C1 UCTWMZQNUQWSLP-UHFFFAOYSA-N 0.000 description 4
- 229940124630 bronchodilator Drugs 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 150000003840 hydrochlorides Chemical class 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 239000003701 inert diluent Substances 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- 239000012948 isocyanate Substances 0.000 description 4
- HYWONZSREFAXIL-UHFFFAOYSA-N n-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethyl]-2-methylpropanamide Chemical compound CC(C)C(=O)NCCNCC(O)COC1=CC=CC=C1 HYWONZSREFAXIL-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- 230000004936 stimulating effect Effects 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- ZQQSYPZAPHRXRY-UHFFFAOYSA-N 1-hydroxyazetidine Chemical class ON1CCC1 ZQQSYPZAPHRXRY-UHFFFAOYSA-N 0.000 description 3
- ZULYWHOJRVBUJU-UHFFFAOYSA-N 2-aminoethylurea Chemical compound NCCNC(N)=O ZULYWHOJRVBUJU-UHFFFAOYSA-N 0.000 description 3
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 3
- 241000282326 Felis catus Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- HKRONTUQBMLTMG-UHFFFAOYSA-N acetonitrile;oxalic acid Chemical compound CC#N.OC(=O)C(O)=O HKRONTUQBMLTMG-UHFFFAOYSA-N 0.000 description 3
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000002026 chloroform extract Substances 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- VNEBWJSWMVTSHK-UHFFFAOYSA-L disodium;3-hydroxynaphthalene-2,7-disulfonate Chemical compound [Na+].[Na+].C1=C(S([O-])(=O)=O)C=C2C=C(S([O-])(=O)=O)C(O)=CC2=C1 VNEBWJSWMVTSHK-UHFFFAOYSA-L 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 150000002513 isocyanates Chemical class 0.000 description 3
- 239000000401 methanolic extract Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 239000010453 quartz Substances 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- OPCJOXGBLDJWRM-UHFFFAOYSA-N 1,2-diamino-2-methylpropane Chemical compound CC(C)(N)CN OPCJOXGBLDJWRM-UHFFFAOYSA-N 0.000 description 2
- JLIDRDJNLAWIKT-UHFFFAOYSA-N 1,2-dimethyl-3h-benzo[e]indole Chemical compound C1=CC=CC2=C(C(=C(C)N3)C)C3=CC=C21 JLIDRDJNLAWIKT-UHFFFAOYSA-N 0.000 description 2
- YZKMURMKJCXVIE-UHFFFAOYSA-N 1-(2-aminoethyl)-3-phenylurea Chemical compound NCCNC(=O)NC1=CC=CC=C1 YZKMURMKJCXVIE-UHFFFAOYSA-N 0.000 description 2
- HCTDRZMGZRHFJV-UHFFFAOYSA-N 1-chloro-3-phenoxypropan-2-ol Chemical compound ClCC(O)COC1=CC=CC=C1 HCTDRZMGZRHFJV-UHFFFAOYSA-N 0.000 description 2
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 2
- GSLTVFIVJMCNBH-UHFFFAOYSA-N 2-isocyanatopropane Chemical compound CC(C)N=C=O GSLTVFIVJMCNBH-UHFFFAOYSA-N 0.000 description 2
- SXZMAVLCDKNPTD-UHFFFAOYSA-N 2-oxo-2-propan-2-yloxyacetic acid Chemical compound CC(C)OC(=O)C(O)=O SXZMAVLCDKNPTD-UHFFFAOYSA-N 0.000 description 2
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- MGYGFNQQGAQEON-UHFFFAOYSA-N 4-tolyl isocyanate Chemical compound CC1=CC=C(N=C=O)C=C1 MGYGFNQQGAQEON-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical group N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- DMNPVZLYSRBARL-UHFFFAOYSA-N C(C)(=O)OCC.C(C(=O)O)(=O)OC(C)C Chemical compound C(C)(=O)OCC.C(C(=O)O)(=O)OC(C)C DMNPVZLYSRBARL-UHFFFAOYSA-N 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000000150 Sympathomimetic Substances 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- DULCUDSUACXJJC-UHFFFAOYSA-N benzeneacetic acid ethyl ester Natural products CCOC(=O)CC1=CC=CC=C1 DULCUDSUACXJJC-UHFFFAOYSA-N 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- KWGRBVOPPLSCSI-UHFFFAOYSA-N d-ephedrine Natural products CNC(C)C(O)C1=CC=CC=C1 KWGRBVOPPLSCSI-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 229960002179 ephedrine Drugs 0.000 description 2
- VZULMGQWPFBTBK-UHFFFAOYSA-N ethanol 2-oxo-2-propoxyacetic acid Chemical compound C(C)O.C(C(=O)O)(=O)OCCC VZULMGQWPFBTBK-UHFFFAOYSA-N 0.000 description 2
- SHZIWNPUGXLXDT-UHFFFAOYSA-N ethyl hexanoate Chemical compound CCCCCC(=O)OCC SHZIWNPUGXLXDT-UHFFFAOYSA-N 0.000 description 2
- 150000003947 ethylamines Chemical class 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- TZIHFWKZFHZASV-UHFFFAOYSA-N methyl formate Chemical compound COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 description 2
- BHIWKHZACMWKOJ-UHFFFAOYSA-N methyl isobutyrate Chemical compound COC(=O)C(C)C BHIWKHZACMWKOJ-UHFFFAOYSA-N 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 2
- MUBZPKHOEPUJKR-UHFFFAOYSA-M oxalate(1-) Chemical compound OC(=O)C([O-])=O MUBZPKHOEPUJKR-UHFFFAOYSA-M 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 238000005192 partition Methods 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- KIDHWZJUCRJVML-UHFFFAOYSA-N putrescine Chemical compound NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 description 2
- LOUPRKONTZGTKE-LHHVKLHASA-N quinidine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@H]2[C@@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-LHHVKLHASA-N 0.000 description 2
- 239000000932 sedative agent Substances 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 230000001975 sympathomimetic effect Effects 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 2
- FBZWYFBNIGSUPS-UHFFFAOYSA-N (2-chlorophenyl) ethaneperoxoate Chemical compound CC(=O)OOC1=CC=CC=C1Cl FBZWYFBNIGSUPS-UHFFFAOYSA-N 0.000 description 1
- DNXIKVLOVZVMQF-UHFFFAOYSA-N (3beta,16beta,17alpha,18beta,20alpha)-17-hydroxy-11-methoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]-yohimban-16-carboxylic acid, methyl ester Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(C(=O)OC)C(O)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 DNXIKVLOVZVMQF-UHFFFAOYSA-N 0.000 description 1
- WWAKMFKTMLDYNU-UHFFFAOYSA-N 1,2-dichlorobenzene;ethyl acetate Chemical compound CCOC(C)=O.ClC1=CC=CC=C1Cl WWAKMFKTMLDYNU-UHFFFAOYSA-N 0.000 description 1
- QWUWMCYKGHVNAV-UHFFFAOYSA-N 1,2-dihydrostilbene Chemical group C=1C=CC=CC=1CCC1=CC=CC=C1 QWUWMCYKGHVNAV-UHFFFAOYSA-N 0.000 description 1
- CXEDYCIOUPWCLJ-UHFFFAOYSA-N 1-(2-aminoethyl)-3-butylurea;oxalic acid Chemical compound OC(=O)C(O)=O.CCCCNC(=O)NCCN CXEDYCIOUPWCLJ-UHFFFAOYSA-N 0.000 description 1
- AWZHBDDTQUVXJK-UHFFFAOYSA-N 1-(2-aminopropyl)-3-phenylurea Chemical compound CC(N)CNC(=O)NC1=CC=CC=C1 AWZHBDDTQUVXJK-UHFFFAOYSA-N 0.000 description 1
- SQKDNRNNDKUKAB-UHFFFAOYSA-N 1-(benzylamino)-3-phenoxypropan-2-ol Chemical compound C=1C=CC=CC=1OCC(O)CNCC1=CC=CC=C1 SQKDNRNNDKUKAB-UHFFFAOYSA-N 0.000 description 1
- JZEHWMUIAKALDN-UHFFFAOYSA-N 1-amino-3-phenoxypropan-2-ol Chemical compound NCC(O)COC1=CC=CC=C1 JZEHWMUIAKALDN-UHFFFAOYSA-N 0.000 description 1
- RADHRMANLKNFTC-UHFFFAOYSA-N 1-chloro-4-methylbenzene propan-2-ol Chemical compound C1(=CC=C(C=C1)Cl)C.C(C)(C)O RADHRMANLKNFTC-UHFFFAOYSA-N 0.000 description 1
- CNDHHGUSRIZDSL-UHFFFAOYSA-N 1-chlorooctane Chemical compound CCCCCCCCCl CNDHHGUSRIZDSL-UHFFFAOYSA-N 0.000 description 1
- SVUOLADPCWQTTE-UHFFFAOYSA-N 1h-1,2-benzodiazepine Chemical compound N1N=CC=CC2=CC=CC=C12 SVUOLADPCWQTTE-UHFFFAOYSA-N 0.000 description 1
- VBRAMQBOUAWEAY-UHFFFAOYSA-N 2,5-dihydroxy-n-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethyl]benzamide Chemical compound C=1C=CC=CC=1OCC(O)CNCCNC(=O)C1=CC(O)=CC=C1O VBRAMQBOUAWEAY-UHFFFAOYSA-N 0.000 description 1
- MWBXCWLRASBZFB-UHFFFAOYSA-M 2-(2,4-dimethylphenyl)acetate Chemical compound CC1=CC=C(CC([O-])=O)C(C)=C1 MWBXCWLRASBZFB-UHFFFAOYSA-M 0.000 description 1
- GBXSQWANKOUAGI-UHFFFAOYSA-N 2-(methoxymethoxy)-2-oxoacetic acid Chemical compound COCOC(=O)C(=O)O GBXSQWANKOUAGI-UHFFFAOYSA-N 0.000 description 1
- QYYCPWLLBSSFBW-UHFFFAOYSA-N 2-(naphthalen-1-yloxymethyl)oxirane Chemical compound C=1C=CC2=CC=CC=C2C=1OCC1CO1 QYYCPWLLBSSFBW-UHFFFAOYSA-N 0.000 description 1
- XFORQVOFSGYRFZ-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxy]-2-oxoacetic acid Chemical compound CC(C)(C)OC(=O)C(O)=O XFORQVOFSGYRFZ-UHFFFAOYSA-N 0.000 description 1
- RJNAMETVIBKNEQ-UHFFFAOYSA-N 2-[[3,4-bis(phenylmethoxy)phenoxy]methyl]oxirane Chemical compound C1OC1COC(C=C1OCC=2C=CC=CC=2)=CC=C1OCC1=CC=CC=C1 RJNAMETVIBKNEQ-UHFFFAOYSA-N 0.000 description 1
- YRTWBGRFODFTKA-UHFFFAOYSA-N 2-acetyloxy-2-oxoacetic acid Chemical compound CC(=O)OC(=O)C(O)=O YRTWBGRFODFTKA-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- AUSVIKIPOPDHGP-UHFFFAOYSA-N 2-cyanato-2-oxoacetic acid ethanol hydrate Chemical compound O.CCO.OC(=O)C(=O)OC#N AUSVIKIPOPDHGP-UHFFFAOYSA-N 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- XEIRGBYHMYBGJH-UHFFFAOYSA-N 2-naphthalen-1-yloxy-2-oxoacetic acid Chemical compound C1=CC=C2C(OC(=O)C(=O)O)=CC=CC2=C1 XEIRGBYHMYBGJH-UHFFFAOYSA-N 0.000 description 1
- UOBYKYZJUGYBDK-UHFFFAOYSA-N 2-naphthoic acid Chemical compound C1=CC=CC2=CC(C(=O)O)=CC=C21 UOBYKYZJUGYBDK-UHFFFAOYSA-N 0.000 description 1
- WPHUUIODWRNJLO-UHFFFAOYSA-N 2-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC=CC=C1S(Cl)(=O)=O WPHUUIODWRNJLO-UHFFFAOYSA-N 0.000 description 1
- CCZCXFHJMKINPE-UHFFFAOYSA-N 2-phenylmethoxyphenol Chemical compound OC1=CC=CC=C1OCC1=CC=CC=C1 CCZCXFHJMKINPE-UHFFFAOYSA-N 0.000 description 1
- ALKYHXVLJMQRLQ-UHFFFAOYSA-N 3-Hydroxy-2-naphthoate Chemical compound C1=CC=C2C=C(O)C(C(=O)O)=CC2=C1 ALKYHXVLJMQRLQ-UHFFFAOYSA-N 0.000 description 1
- JBYVNJSQTCGHEU-UHFFFAOYSA-N 4,5-dihydro-1h-imidazol-2-ylmethanol Chemical compound OCC1=NCCN1 JBYVNJSQTCGHEU-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- 208000019901 Anxiety disease Diseases 0.000 description 1
- 208000009079 Bronchial Spasm Diseases 0.000 description 1
- 208000014181 Bronchial disease Diseases 0.000 description 1
- 206010006482 Bronchospasm Diseases 0.000 description 1
- CZUMSROZDYQAMH-UHFFFAOYSA-N C(C(=O)O)(=O)O.O(C1=CC=CC=C1)C(C(CCC(NS(=O)(=O)C1=CC=CC=C1)C)O)N Chemical compound C(C(=O)O)(=O)O.O(C1=CC=CC=C1)C(C(CCC(NS(=O)(=O)C1=CC=CC=C1)C)O)N CZUMSROZDYQAMH-UHFFFAOYSA-N 0.000 description 1
- QNFDTUIKHNHGSO-UHFFFAOYSA-N C(C)O.C(C(=O)O)(=O)OC1CCCCC1 Chemical compound C(C)O.C(C(=O)O)(=O)OC1CCCCC1 QNFDTUIKHNHGSO-UHFFFAOYSA-N 0.000 description 1
- GVJFENKOCQYLHV-UHFFFAOYSA-N C1(CCCCC1)Cl.O.C1(CCCCC1)Cl Chemical compound C1(CCCCC1)Cl.O.C1(CCCCC1)Cl GVJFENKOCQYLHV-UHFFFAOYSA-N 0.000 description 1
- 206010007556 Cardiac failure acute Diseases 0.000 description 1
- 206010007558 Cardiac failure chronic Diseases 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- HHBDOVKQGQWEDJ-UHFFFAOYSA-N Cl.NCCNC(=O)CC1=CC=CC=C1Cl Chemical compound Cl.NCCNC(=O)CC1=CC=CC=C1Cl HHBDOVKQGQWEDJ-UHFFFAOYSA-N 0.000 description 1
- 241000208011 Digitalis Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 208000001953 Hypotension Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-L L-tartrate(2-) Chemical compound [O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O FEWJPZIEWOKRBE-JCYAYHJZSA-L 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- NPPQSCRMBWNHMW-UHFFFAOYSA-N Meprobamate Chemical compound NC(=O)OCC(C)(CCC)COC(N)=O NPPQSCRMBWNHMW-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- FIBODOLQJHSXDY-UHFFFAOYSA-N N-[2-(benzylamino)ethyl]benzenesulfonamide hydrochloride Chemical compound Cl.C=1C=CC=CC=1S(=O)(=O)NCCNCC1=CC=CC=C1 FIBODOLQJHSXDY-UHFFFAOYSA-N 0.000 description 1
- QIWKDAZBDJZUAB-UHFFFAOYSA-N O(C1=CC=CC=C1)C(C(CC(CNC(C(C)C)=O)C)O)N Chemical compound O(C1=CC=CC=C1)C(C(CC(CNC(C(C)C)=O)C)O)N QIWKDAZBDJZUAB-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 208000018737 Parkinson disease Diseases 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 239000005700 Putrescine Substances 0.000 description 1
- LCQMZZCPPSWADO-UHFFFAOYSA-N Reserpilin Natural products COC(=O)C1COCC2CN3CCc4c([nH]c5cc(OC)c(OC)cc45)C3CC12 LCQMZZCPPSWADO-UHFFFAOYSA-N 0.000 description 1
- QEVHRUUCFGRFIF-SFWBKIHZSA-N Reserpine Natural products O=C(OC)[C@@H]1[C@H](OC)[C@H](OC(=O)c2cc(OC)c(OC)c(OC)c2)C[C@H]2[C@@H]1C[C@H]1N(C2)CCc2c3c([nH]c12)cc(OC)cc3 QEVHRUUCFGRFIF-SFWBKIHZSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 208000001871 Tachycardia Diseases 0.000 description 1
- 206010044565 Tremor Diseases 0.000 description 1
- OCBFFGCSTGGPSQ-UHFFFAOYSA-N [CH2]CC Chemical compound [CH2]CC OCBFFGCSTGGPSQ-UHFFFAOYSA-N 0.000 description 1
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- PWUBONDMIMDOQY-UHFFFAOYSA-N acetonitrile;hydrochloride Chemical compound Cl.CC#N PWUBONDMIMDOQY-UHFFFAOYSA-N 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- 239000002160 alpha blocker Substances 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 230000036506 anxiety Effects 0.000 description 1
- 206010003119 arrhythmia Diseases 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical class C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 229940049706 benzodiazepine Drugs 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 239000002876 beta blocker Substances 0.000 description 1
- 229940030611 beta-adrenergic blocking agent Drugs 0.000 description 1
- 229960004980 betanidine Drugs 0.000 description 1
- NIVZHWNOUVJHKV-UHFFFAOYSA-N bethanidine Chemical compound CN\C(=N/C)NCC1=CC=CC=C1 NIVZHWNOUVJHKV-UHFFFAOYSA-N 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000000168 bronchodilator agent Substances 0.000 description 1
- 239000000496 cardiotonic agent Substances 0.000 description 1
- 230000003177 cardiotonic effect Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 150000003943 catecholamines Chemical class 0.000 description 1
- ANTSCNMPPGJYLG-UHFFFAOYSA-N chlordiazepoxide Chemical compound O=N=1CC(NC)=NC2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 ANTSCNMPPGJYLG-UHFFFAOYSA-N 0.000 description 1
- 229960004782 chlordiazepoxide Drugs 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 229960002155 chlorothiazide Drugs 0.000 description 1
- ZPEIMTDSQAKGNT-UHFFFAOYSA-N chlorpromazine Chemical compound C1=C(Cl)C=C2N(CCCN(C)C)C3=CC=CC=C3SC2=C1 ZPEIMTDSQAKGNT-UHFFFAOYSA-N 0.000 description 1
- 229960001076 chlorpromazine Drugs 0.000 description 1
- 230000002057 chronotropic effect Effects 0.000 description 1
- LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229920001577 copolymer Chemical group 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- AAOVKJBEBIDNHE-UHFFFAOYSA-N diazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 AAOVKJBEBIDNHE-UHFFFAOYSA-N 0.000 description 1
- 229960003529 diazepam Drugs 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- QFTYSVGGYOXFRQ-UHFFFAOYSA-N dodecane-1,12-diamine Chemical compound NCCCCCCCCCCCCN QFTYSVGGYOXFRQ-UHFFFAOYSA-N 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- KZXRUHCOJKDGEA-UHFFFAOYSA-N ethanol 2-ethoxy-2-oxoacetic acid Chemical compound CCO.CCOC(=O)C(O)=O KZXRUHCOJKDGEA-UHFFFAOYSA-N 0.000 description 1
- AIMCUTZXDCCWFQ-UHFFFAOYSA-N ethanol hydrate Chemical compound O.C(C)O.C(C)O.C(C)O.C(C)O AIMCUTZXDCCWFQ-UHFFFAOYSA-N 0.000 description 1
- PHJMNLZSBSXKJE-UHFFFAOYSA-N ethanol;dihydrate Chemical compound O.O.CCO PHJMNLZSBSXKJE-UHFFFAOYSA-N 0.000 description 1
- CJBSBWHRTPMXSJ-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO.CCO CJBSBWHRTPMXSJ-UHFFFAOYSA-N 0.000 description 1
- DZGCGKFAPXFTNM-UHFFFAOYSA-N ethanol;hydron;chloride Chemical compound Cl.CCO DZGCGKFAPXFTNM-UHFFFAOYSA-N 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- ZANNOFHADGWOLI-UHFFFAOYSA-N ethyl 2-hydroxyacetate Chemical compound CCOC(=O)CO ZANNOFHADGWOLI-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- LBKPGNUOUPTQKA-UHFFFAOYSA-N ethyl n-phenylcarbamate Chemical compound CCOC(=O)NC1=CC=CC=C1 LBKPGNUOUPTQKA-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000003976 glyceryl group Chemical group [H]C([*])([H])C(O[H])([H])C(O[H])([H])[H] 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 230000010247 heart contraction Effects 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- HSSFHZJIMRUXDM-UHFFFAOYSA-N hydroxy(oxo)azanium chloride Chemical compound Cl.[O-][NH+]=O HSSFHZJIMRUXDM-UHFFFAOYSA-N 0.000 description 1
- 208000021822 hypotensive Diseases 0.000 description 1
- 230000001077 hypotensive effect Effects 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000000297 inotrophic effect Effects 0.000 description 1
- 239000006207 intravenous dosage form Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- MOYKHGMNXAOIAT-JGWLITMVSA-N isosorbide dinitrate Chemical compound [O-][N+](=O)O[C@H]1CO[C@@H]2[C@H](O[N+](=O)[O-])CO[C@@H]21 MOYKHGMNXAOIAT-JGWLITMVSA-N 0.000 description 1
- 229960000201 isosorbide dinitrate Drugs 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 229960004815 meprobamate Drugs 0.000 description 1
- LMOINURANNBYCM-UHFFFAOYSA-N metaproterenol Chemical compound CC(C)NCC(O)C1=CC(O)=CC(O)=C1 LMOINURANNBYCM-UHFFFAOYSA-N 0.000 description 1
- BZCKRPHEZOHHBK-UHFFFAOYSA-N methyl 2-phenoxyacetate Chemical compound COC(=O)COC1=CC=CC=C1 BZCKRPHEZOHHBK-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N monoethyl amine Natural products CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- JFCHSQDLLFJHOA-UHFFFAOYSA-N n,n-dimethylsulfamoyl chloride Chemical compound CN(C)S(Cl)(=O)=O JFCHSQDLLFJHOA-UHFFFAOYSA-N 0.000 description 1
- IGIJDAVPCAUGCU-UHFFFAOYSA-N n-(1-aminopropan-2-yl)acetamide Chemical compound NCC(C)NC(C)=O IGIJDAVPCAUGCU-UHFFFAOYSA-N 0.000 description 1
- MAIPGIIJMVIZJY-UHFFFAOYSA-N n-(1-aminopropan-2-yl)benzenesulfonamide Chemical compound NCC(C)NS(=O)(=O)C1=CC=CC=C1 MAIPGIIJMVIZJY-UHFFFAOYSA-N 0.000 description 1
- HADMBZJXXDTJOG-UHFFFAOYSA-N n-(12-aminododecyl)benzenesulfonamide Chemical compound NCCCCCCCCCCCCNS(=O)(=O)C1=CC=CC=C1 HADMBZJXXDTJOG-UHFFFAOYSA-N 0.000 description 1
- HFYKSRDJDAYXKM-UHFFFAOYSA-N n-(2-amino-2-methylpropyl)-2-methylpropanamide Chemical compound CC(C)C(=O)NCC(C)(C)N HFYKSRDJDAYXKM-UHFFFAOYSA-N 0.000 description 1
- IKTHDUWAAWNNBS-UHFFFAOYSA-N n-(2-aminoethyl)-2,5-bis(phenylmethoxy)benzamide Chemical compound C=1C=C(OCC=2C=CC=CC=2)C(C(=O)NCCN)=CC=1OCC1=CC=CC=C1 IKTHDUWAAWNNBS-UHFFFAOYSA-N 0.000 description 1
- KMFVUBFMFJOFIN-UHFFFAOYSA-N n-(2-aminoethyl)-2-methylpropanamide Chemical compound CC(C)C(=O)NCCN KMFVUBFMFJOFIN-UHFFFAOYSA-N 0.000 description 1
- CAEALSAPHDTRRY-UHFFFAOYSA-N n-(2-aminoethyl)-2-phenoxyacetamide;hydrochloride Chemical compound Cl.NCCNC(=O)COC1=CC=CC=C1 CAEALSAPHDTRRY-UHFFFAOYSA-N 0.000 description 1
- OFNOTKBTVZPDMU-UHFFFAOYSA-N n-(2-aminoethyl)-2-phenylacetamide;hydrochloride Chemical compound Cl.NCCNC(=O)CC1=CC=CC=C1 OFNOTKBTVZPDMU-UHFFFAOYSA-N 0.000 description 1
- BCGXHHYBXMQECD-UHFFFAOYSA-N n-(2-aminoethyl)benzamide;hydrochloride Chemical compound Cl.NCCNC(=O)C1=CC=CC=C1 BCGXHHYBXMQECD-UHFFFAOYSA-N 0.000 description 1
- UMNPKLARCNEUAI-UHFFFAOYSA-N n-(2-aminoethyl)benzenesulfonamide;hydrochloride Chemical compound Cl.NCCNS(=O)(=O)C1=CC=CC=C1 UMNPKLARCNEUAI-UHFFFAOYSA-N 0.000 description 1
- WYZXJFFDMNRBEP-UHFFFAOYSA-N n-(2-aminoethyl)cyclopentanecarboxamide Chemical compound NCCNC(=O)C1CCCC1 WYZXJFFDMNRBEP-UHFFFAOYSA-N 0.000 description 1
- SFOOQDKGASYPRW-UHFFFAOYSA-N n-(2-aminoethyl)cyclopentanecarboxamide;oxalic acid Chemical compound OC(=O)C(O)=O.NCCNC(=O)C1CCCC1 SFOOQDKGASYPRW-UHFFFAOYSA-N 0.000 description 1
- DTSMHNPPSHGIAA-UHFFFAOYSA-N n-(2-aminoethyl)methanesulfonamide;oxalic acid Chemical compound OC(=O)C(O)=O.CS(=O)(=O)NCCN DTSMHNPPSHGIAA-UHFFFAOYSA-N 0.000 description 1
- JLBZBBHCZAODDD-UHFFFAOYSA-N n-(2-aminopropyl)-2-methylpropanamide Chemical compound CC(N)CNC(=O)C(C)C JLBZBBHCZAODDD-UHFFFAOYSA-N 0.000 description 1
- WHCBCOGNYOBFIL-UHFFFAOYSA-N n-(2-aminopropyl)-2-phenylacetamide Chemical compound CC(N)CNC(=O)CC1=CC=CC=C1 WHCBCOGNYOBFIL-UHFFFAOYSA-N 0.000 description 1
- OIRGFQCXUNWNRF-UHFFFAOYSA-N n-(2-aminopropyl)acetamide Chemical compound CC(N)CNC(C)=O OIRGFQCXUNWNRF-UHFFFAOYSA-N 0.000 description 1
- XETWPZRFZHJXAF-UHFFFAOYSA-N n-(2-aminopropyl)benzenesulfonamide Chemical compound CC(N)CNS(=O)(=O)C1=CC=CC=C1 XETWPZRFZHJXAF-UHFFFAOYSA-N 0.000 description 1
- QZUOKPUQPUDFNS-UHFFFAOYSA-N n-(2-oxopropyl)-2-phenylacetamide Chemical compound CC(=O)CNC(=O)CC1=CC=CC=C1 QZUOKPUQPUDFNS-UHFFFAOYSA-N 0.000 description 1
- DFZLBZMBJIUOJZ-UHFFFAOYSA-N n-(4-aminobutyl)-2-methylpropanamide Chemical compound CC(C)C(=O)NCCCCN DFZLBZMBJIUOJZ-UHFFFAOYSA-N 0.000 description 1
- IAIREXADHABZAE-UHFFFAOYSA-N n-(5-amino-4-hydroxy-2-methyl-5-phenoxypentyl)benzenesulfonamide Chemical compound C=1C=CC=CC=1OC(N)C(O)CC(C)CNS(=O)(=O)C1=CC=CC=C1 IAIREXADHABZAE-UHFFFAOYSA-N 0.000 description 1
- WRJPJZTWQTUPQK-UHFFFAOYSA-N n-(6-aminohexyl)acetamide Chemical compound CC(=O)NCCCCCCN WRJPJZTWQTUPQK-UHFFFAOYSA-N 0.000 description 1
- GYMXARDUPQTREX-UHFFFAOYSA-N n-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethyl]acetamide Chemical compound CC(=O)NCCNCC(O)COC1=CC=CC=C1 GYMXARDUPQTREX-UHFFFAOYSA-N 0.000 description 1
- RENGVVYELIHMGI-UHFFFAOYSA-N n-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethyl]benzamide Chemical compound C=1C=CC=CC=1OCC(O)CNCCNC(=O)C1=CC=CC=C1 RENGVVYELIHMGI-UHFFFAOYSA-N 0.000 description 1
- WKNWQVRIMUYOES-UHFFFAOYSA-N n-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethyl]benzamide;hydrochloride Chemical compound Cl.C=1C=CC=CC=1OCC(O)CNCCNC(=O)C1=CC=CC=C1 WKNWQVRIMUYOES-UHFFFAOYSA-N 0.000 description 1
- XSSXWVAFIYUELU-UHFFFAOYSA-N n-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethyl]benzenesulfonamide Chemical compound C=1C=CC=CC=1OCC(O)CNCCNS(=O)(=O)C1=CC=CC=C1 XSSXWVAFIYUELU-UHFFFAOYSA-N 0.000 description 1
- YPCFHXCIYKEUMI-UHFFFAOYSA-N n-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethyl]benzenesulfonamide;oxalic acid Chemical compound OC(=O)C(O)=O.C=1C=CC=CC=1OCC(O)CNCCNS(=O)(=O)C1=CC=CC=C1 YPCFHXCIYKEUMI-UHFFFAOYSA-N 0.000 description 1
- LCUIPJKTSSUGGK-UHFFFAOYSA-N n-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethyl]butanamide Chemical compound CCCC(=O)NCCNCC(O)COC1=CC=CC=C1 LCUIPJKTSSUGGK-UHFFFAOYSA-N 0.000 description 1
- SEACZQLMSXGARM-UHFFFAOYSA-N n-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethyl]formamide Chemical compound O=CNCCNCC(O)COC1=CC=CC=C1 SEACZQLMSXGARM-UHFFFAOYSA-N 0.000 description 1
- ZIYXRUIZIGGIMZ-UHFFFAOYSA-N n-[2-[(3-chloro-2-hydroxypropyl)amino]ethyl]-2-methylpropanamide Chemical compound CC(C)C(=O)NCCNCC(O)CCl ZIYXRUIZIGGIMZ-UHFFFAOYSA-N 0.000 description 1
- AKYAPABARPZOSK-UHFFFAOYSA-N n-[2-[(3-chloro-2-hydroxypropyl)amino]ethyl]-2-methylpropanamide;oxalic acid Chemical compound OC(=O)C(O)=O.CC(C)C(=O)NCCNCC(O)CCl AKYAPABARPZOSK-UHFFFAOYSA-N 0.000 description 1
- MVGQEJRHLMPMBS-UHFFFAOYSA-N n-[2-[[2-hydroxy-3-(2-methoxyphenoxy)propyl]amino]ethyl]-2-methylpropanamide Chemical compound COC1=CC=CC=C1OCC(O)CNCCNC(=O)C(C)C MVGQEJRHLMPMBS-UHFFFAOYSA-N 0.000 description 1
- IFFWJAHECUQKKW-UHFFFAOYSA-N n-[2-[[2-hydroxy-3-(3-hydroxyphenoxy)propyl]amino]ethyl]benzenesulfonamide Chemical compound C=1C=CC(O)=CC=1OCC(O)CNCCNS(=O)(=O)C1=CC=CC=C1 IFFWJAHECUQKKW-UHFFFAOYSA-N 0.000 description 1
- WIOAXEVPGLQULX-UHFFFAOYSA-N n-[2-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]ethyl]propanamide Chemical compound CCC(=O)NCCNCC(O)COC1=CC=CC=C1C#N WIOAXEVPGLQULX-UHFFFAOYSA-N 0.000 description 1
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- AMZORBZSQRUXNC-UHFFFAOYSA-N o-Tolyl acetate Chemical compound CC(=O)OC1=CC=CC=C1C AMZORBZSQRUXNC-UHFFFAOYSA-N 0.000 description 1
- 125000001209 o-nitrophenyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])[N+]([O-])=O 0.000 description 1
- 230000000414 obstructive effect Effects 0.000 description 1
- YYZUSRORWSJGET-UHFFFAOYSA-N octanoic acid ethyl ester Natural products CCCCCCCC(=O)OCC YYZUSRORWSJGET-UHFFFAOYSA-N 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 229960002657 orciprenaline Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- ZDYUUBIMAGBMPY-UHFFFAOYSA-N oxalic acid;hydrate Chemical compound O.OC(=O)C(O)=O ZDYUUBIMAGBMPY-UHFFFAOYSA-N 0.000 description 1
- 150000002917 oxazolidines Chemical class 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 1
- 229960001412 pentobarbital Drugs 0.000 description 1
- 210000005259 peripheral blood Anatomy 0.000 description 1
- 239000011886 peripheral blood Substances 0.000 description 1
- 239000000810 peripheral vasodilating agent Substances 0.000 description 1
- 229960002116 peripheral vasodilator Drugs 0.000 description 1
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 description 1
- 229960002695 phenobarbital Drugs 0.000 description 1
- MRBDMNSDAVCSSF-UHFFFAOYSA-N phentolamine Chemical compound C1=CC(C)=CC=C1N(C=1C=C(O)C=CC=1)CC1=NCCN1 MRBDMNSDAVCSSF-UHFFFAOYSA-N 0.000 description 1
- 229960001999 phentolamine Drugs 0.000 description 1
- 229940049953 phenylacetate Drugs 0.000 description 1
- LEVJVKGPFAQPOI-UHFFFAOYSA-N phenylmethanone Chemical compound O=[C]C1=CC=CC=C1 LEVJVKGPFAQPOI-UHFFFAOYSA-N 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 1
- 150000003109 potassium Chemical class 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000003223 protective agent Substances 0.000 description 1
- 229960001404 quinidine Drugs 0.000 description 1
- QEVHRUUCFGRFIF-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C(C5=CC=C(OC)C=C5N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 QEVHRUUCFGRFIF-MDEJGZGSSA-N 0.000 description 1
- 229960003147 reserpine Drugs 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 208000023504 respiratory system disease Diseases 0.000 description 1
- MDMGHDFNKNZPAU-UHFFFAOYSA-N roserpine Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(OC(C)=O)C(OC)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 MDMGHDFNKNZPAU-UHFFFAOYSA-N 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229940125723 sedative agent Drugs 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 231100000161 signs of toxicity Toxicity 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 239000010454 slate Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 230000006794 tachycardia Effects 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 210000005090 tracheal smooth muscle Anatomy 0.000 description 1
- 230000024883 vasodilation Effects 0.000 description 1
- 229940124549 vasodilator Drugs 0.000 description 1
- 239000003071 vasodilator agent Substances 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- JLYXXMFPNIAWKQ-UHFFFAOYSA-N γ Benzene hexachloride Chemical compound ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl JLYXXMFPNIAWKQ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/02—Drugs for disorders of the nervous system for peripheral neuropathies
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/10—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C271/20—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms to carbon atoms of hydrocarbon radicals substituted by nitrogen atoms not being part of nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/04—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to acyclic carbon atoms
- C07C275/06—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to acyclic carbon atoms of an acyclic and saturated carbon skeleton
- C07C275/14—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to acyclic carbon atoms of an acyclic and saturated carbon skeleton being further substituted by nitrogen atoms not being part of nitro or nitroso groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Neurosurgery (AREA)
- Biomedical Technology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Neurology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5797072 | 1972-12-15 | ||
| GB4347873A GB1455116A (en) | 1972-12-15 | 1973-09-17 | Pharmaceutical compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE408794B true SE408794B (sv) | 1979-07-09 |
Family
ID=26265164
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7316863A SE408794B (sv) | 1972-12-15 | 1973-12-13 | Forfarande for framstellning av nya (fenoxi- eller naftyloxi-)propanolamin-derivat med farmakologiska egenskaper |
Country Status (28)
| Country | Link |
|---|---|
| US (2) | US3928412A (enExample) |
| JP (1) | JPS5919090B2 (enExample) |
| AR (2) | AR213930A1 (enExample) |
| AT (3) | AT345791B (enExample) |
| BE (1) | BE808666A (enExample) |
| CA (1) | CA1031362A (enExample) |
| CH (4) | CH605666A5 (enExample) |
| CS (1) | CS187389B2 (enExample) |
| DD (1) | DD113349A5 (enExample) |
| DE (1) | DE2362568C2 (enExample) |
| DK (1) | DK158466C (enExample) |
| ES (1) | ES421538A1 (enExample) |
| FI (1) | FI61027C (enExample) |
| FR (1) | FR2210407B1 (enExample) |
| GB (1) | GB1455116A (enExample) |
| HK (1) | HK24480A (enExample) |
| HU (1) | HU169087B (enExample) |
| IE (1) | IE38602B1 (enExample) |
| IL (1) | IL43795A (enExample) |
| IN (1) | IN139418B (enExample) |
| KE (1) | KE3030A (enExample) |
| LU (1) | LU68997A1 (enExample) |
| MY (1) | MY8100035A (enExample) |
| NL (1) | NL179203C (enExample) |
| NO (1) | NO138335C (enExample) |
| SE (1) | SE408794B (enExample) |
| SU (2) | SU576917A3 (enExample) |
| YU (2) | YU40097B (enExample) |
Families Citing this family (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4038313A (en) * | 1970-01-08 | 1977-07-26 | Ciba-Geigy Corporation | Cycloalkylureido phenoxy propanolamines |
| US4171374A (en) * | 1972-12-15 | 1979-10-16 | Imperial Chemical Industries Limited | Alkanolamine derivatives |
| US4167581A (en) * | 1972-12-15 | 1979-09-11 | Imperial Chemical Industries Limited | Alkanolamine derivatives and pharmaceutical compositions and uses thereof |
| US4117157A (en) * | 1973-06-22 | 1978-09-26 | Imperial Chemical Industries Limited | Ethanolamine derivatives having β-adrenergic blocking activity |
| US4034112A (en) * | 1973-06-22 | 1977-07-05 | Imperial Chemical Industries Limited | Ethanolamine derivatives having β-adrenergic blocking activity |
| US4041074A (en) * | 1973-07-19 | 1977-08-09 | Imperial Chemical Industries Limited | 1-Hydroxyaryl-2-amidoalkylaminoethanol derivatives |
| GB1573359A (en) * | 1977-12-20 | 1980-08-20 | Ici Ltd | Alkanolamine derivatives |
| US4041075A (en) * | 1973-12-12 | 1977-08-09 | Imperial Chemical Industries Limited | Phenoxy-alkanolamine derivatives |
| AT334385B (de) * | 1973-12-20 | 1976-01-10 | Chemie Linz Ag | Verfahren zur herstellung von neuen phenoxypropylaminderivaten und deren salzen |
| GB1521471A (en) * | 1974-06-05 | 1978-08-16 | Randall & Son Ltd J | Token-deposit locks |
| US4141987A (en) * | 1974-06-05 | 1979-02-27 | Imperial Chemical Industries Limited | 1-Aryloxy-3-thenamidoalkylamino-2-propanol derivatives |
| US4162331A (en) * | 1975-06-17 | 1979-07-24 | Nippon Shinyaku Co., Ltd. | Substituted N-(carboxymethyl)-3-aminopropan-2-ol derivatives |
| GB1540463A (en) * | 1976-10-07 | 1979-02-14 | Ici Ltd | Alkanolamine derivatives |
| US4172150A (en) * | 1977-05-23 | 1979-10-23 | Imperial Chemical Industries Limited | Cardiac stimulants |
| IE47053B1 (en) * | 1977-05-23 | 1983-12-14 | Ici Ltd | Cardiac stimulants |
| US4219561A (en) * | 1977-09-22 | 1980-08-26 | Imperial Chemical Industries Limited | Alkanolamine derivatives |
| US4239700A (en) * | 1978-10-10 | 1980-12-16 | Texaco Development Corp. | Isatoic anhydride derivatives and use as chain-extenders |
| US4281189A (en) * | 1979-09-06 | 1981-07-28 | Hoffmann-La Roche Inc. | Sulfonamide intermediates for adrenergic blocking agents |
| US4301300A (en) * | 1979-09-06 | 1981-11-17 | Hoffmann-La Roche Inc. | Sulfonamide intermediates for adrenergic blocking agents |
| FR2477537A1 (fr) * | 1980-03-07 | 1981-09-11 | Francaise Sucrerie | Nouvelles guanidines acylees, urees et urees substituees, leur procede de fabrication et leur application en tant que medicaments |
| FI76551C (fi) | 1980-11-06 | 1988-11-10 | Sandoz Ag | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 3-aminopropoxifenylderivat. |
| DE3270905D1 (en) * | 1981-12-17 | 1986-06-05 | Haessle Ab | Para-substituted 3-phenoxy-1-carbonylaminoalkylamino-propan-2-ols having beta receptor blocking properties |
| US5238962A (en) * | 1983-03-03 | 1993-08-24 | Hoffmann-La Roche Inc. | Benzamide derivatives |
| CH653670A5 (de) * | 1983-03-03 | 1986-01-15 | Hoffmann La Roche | Benzamid-derivate. |
| US4593039A (en) * | 1984-04-02 | 1986-06-03 | Merck & Co., Inc. | 1-aryloxy-3-(substituted aminoalkylamino)-2-propanols |
| DE3427309A1 (de) * | 1984-07-25 | 1986-01-30 | Boehringer Ingelheim KG, 6507 Ingelheim | Neue 1-aryloxypropanolamine, verfahren zu ihrer herstellung und ihre verwendung |
| DE3512627A1 (de) * | 1985-04-06 | 1986-10-09 | Boehringer Mannheim Gmbh, 6800 Mannheim | Amino-propanol-derivate, verfahren zu deren herstellung, verwendung derselben und diese enthaltende arzneimittel |
| WO1986006717A1 (en) * | 1985-05-14 | 1986-11-20 | William John Louis | 3-aminopropyloxyphenyl derivatives their preparation and pharmaceutical compositions containing them |
| EP0207036A1 (en) * | 1985-06-20 | 1986-12-30 | Aktiebolaget Hässle | New para-substituted 3-phenoxy-1-piperidinecarbonylaminoalkylamino-propanol-2-s having beta receptor blocking properties. |
| GB8607313D0 (en) * | 1986-03-25 | 1986-04-30 | Ici Plc | Pharmaceutical compositions |
| GB8607312D0 (en) * | 1986-03-25 | 1986-04-30 | Ici Plc | Therapeutic agents |
| DE3880628T2 (de) * | 1987-11-13 | 1993-08-05 | Glaxo Group Ltd | Phenethanolamin-derivate. |
| JP2004137284A (ja) * | 1997-06-17 | 2004-05-13 | Kaken Pharmaceut Co Ltd | 2−スルファモイル安息香酸誘導体 |
| GB0417802D0 (en) * | 2004-08-10 | 2004-09-15 | Novartis Ag | Organic compounds |
| CN106977426A (zh) * | 2017-05-27 | 2017-07-25 | 哈尔滨师范大学 | 一种腰果酚苯基脲及其制备方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3459782A (en) * | 1963-08-26 | 1969-08-05 | Boehringer Sohn Ingelheim | 1-substituted phenoxy-2-hydroxy-3-isopropylamino-propanes |
| GB1199037A (en) * | 1967-09-27 | 1970-07-15 | Ici Ltd | Alkanolamine Derivatives |
| GB1285038A (en) * | 1969-02-21 | 1972-08-09 | Ici Ltd | Alkanolamine derivatives |
| BE754604A (fr) * | 1969-08-08 | 1971-02-08 | Boehringer Sohn Ingelheim | Le 1-(2-nitrilophenoxy)-2-hydroxy-3-ethyl-aminopropane et ses sels |
-
1973
- 1973-09-17 GB GB4347873A patent/GB1455116A/en not_active Expired
- 1973-12-03 IE IE2183/73A patent/IE38602B1/xx unknown
- 1973-12-04 US US421669A patent/US3928412A/en not_active Expired - Lifetime
- 1973-12-04 CA CA187,289A patent/CA1031362A/en not_active Expired
- 1973-12-06 IN IN2664/CAL/73A patent/IN139418B/en unknown
- 1973-12-10 IL IL43795A patent/IL43795A/xx unknown
- 1973-12-11 FI FI3789/73A patent/FI61027C/fi active
- 1973-12-13 LU LU68997A patent/LU68997A1/xx unknown
- 1973-12-13 SE SE7316863A patent/SE408794B/sv unknown
- 1973-12-13 NL NLAANVRAGE7317096,A patent/NL179203C/xx not_active IP Right Cessation
- 1973-12-14 YU YU3246/73A patent/YU40097B/xx unknown
- 1973-12-14 NO NO4794/73A patent/NO138335C/no unknown
- 1973-12-14 HU HUIE600A patent/HU169087B/hu unknown
- 1973-12-14 CH CH1759473A patent/CH605666A5/xx not_active IP Right Cessation
- 1973-12-14 CH CH1340177A patent/CH605667A5/xx not_active IP Right Cessation
- 1973-12-14 AR AR251531A patent/AR213930A1/es active
- 1973-12-14 BE BE138894A patent/BE808666A/xx not_active IP Right Cessation
- 1973-12-14 SU SU7301981054A patent/SU576917A3/ru active
- 1973-12-14 CH CH1340377A patent/CH611876A5/xx not_active IP Right Cessation
- 1973-12-14 CH CH1340277A patent/CH605668A5/xx not_active IP Right Cessation
- 1973-12-14 DK DK681673A patent/DK158466C/da not_active IP Right Cessation
- 1973-12-14 DD DD175410A patent/DD113349A5/xx unknown
- 1973-12-14 FR FR7344780A patent/FR2210407B1/fr not_active Expired
- 1973-12-15 JP JP48141162A patent/JPS5919090B2/ja not_active Expired
- 1973-12-15 ES ES421538A patent/ES421538A1/es not_active Expired
- 1973-12-17 CS CS738727A patent/CS187389B2/cs unknown
- 1973-12-17 AT AT581577A patent/AT345791B/de not_active IP Right Cessation
- 1973-12-17 DE DE2362568A patent/DE2362568C2/de not_active Expired
-
1975
- 1975-08-26 US US05/607,995 patent/US4010189A/en not_active Expired - Lifetime
-
1976
- 1976-04-12 AT AT266376A patent/AT344144B/de not_active IP Right Cessation
- 1976-04-21 AR AR262359A patent/AR214288A1/es active
-
1977
- 1977-07-26 SU SU772504510A patent/SU695555A3/ru active
- 1977-07-29 AT AT566077A patent/AT351557B/de not_active IP Right Cessation
-
1980
- 1980-03-03 KE KE3030A patent/KE3030A/xx unknown
- 1980-05-08 HK HK244/80A patent/HK24480A/xx unknown
- 1980-11-03 YU YU2806/80A patent/YU42539B/xx unknown
-
1981
- 1981-12-30 MY MY35/81A patent/MY8100035A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE408794B (sv) | Forfarande for framstellning av nya (fenoxi- eller naftyloxi-)propanolamin-derivat med farmakologiska egenskaper | |
| TWI337075B (en) | Novel aminobenzophenone compounds | |
| PT95148A (pt) | Processo para a preparacao de inibidores do enzima acilcoenzima a:colesterol aciltransferase (acat) e de composicoes farmaceuticas que os contem | |
| US3933911A (en) | 1-Aryl-2-amidoalkylaminoethanol derivatives | |
| CZ252090A3 (en) | Process for preparing phenylalkylene n-substituted alpha-aminocarboxamides | |
| CA2469967A1 (en) | Urea derivatives as vr1- antagonists | |
| US4083992A (en) | Alkanolamine derivatives | |
| CN1307150C (zh) | 羟基四氢-萘基脲衍生物 | |
| JP2601008B2 (ja) | ナフチルオキサゾリドン誘導体、その製法及びその合成中間体 | |
| US20050197343A1 (en) | Utilization of heteroarene carboxamide as dopamine-d3 ligands for the treatment of cns diseases | |
| US4041075A (en) | Phenoxy-alkanolamine derivatives | |
| US3959369A (en) | Alkanolamine derivatives | |
| US4131685A (en) | Pharmaceutical compositions and uses of alkanolamine derivatives | |
| FR2498596A1 (fr) | Nouvelles phenylalcoylamines, leur preparation et leur utilisation en tant que medicaments | |
| US4167581A (en) | Alkanolamine derivatives and pharmaceutical compositions and uses thereof | |
| US4034112A (en) | Ethanolamine derivatives having β-adrenergic blocking activity | |
| CN106187898A (zh) | 氨基甲酸酯衍生物及其合成方法和用途 | |
| CA2429267C (fr) | Cyclohexyl(alkyl)-propanolamines, leur preparation et compositions pharmaceutiques en contenant | |
| JP2003192660A (ja) | 尿素誘導体 | |
| CN106957290A (zh) | 一种芳香甲酰胺类化合物及其在制备抗甲型流感病毒药物中的应用 | |
| PL94580B1 (pl) | Sposob wytwarzania nowych pochodnych alkanoloaminy | |
| US4117157A (en) | Ethanolamine derivatives having β-adrenergic blocking activity | |
| Leffler et al. | Carbamate antimalarials | |
| AT345789B (de) | Verfahren zur herstellung von neuen substituierten 3-aminoalkylamino-2-hydroxy-1-phenoxypropanen und von deren saeureadditionssalzen | |
| KR101000688B1 (ko) | 히드록시 테트라히드로-나프탈레닐우레아 유도체 |