RU2012557C1 - Способ получения производных алкансульфонанилида или их фармацевтически приемлемых солей - Google Patents
Способ получения производных алкансульфонанилида или их фармацевтически приемлемых солей Download PDFInfo
- Publication number
- RU2012557C1 RU2012557C1 SU884355863A SU4355863A RU2012557C1 RU 2012557 C1 RU2012557 C1 RU 2012557C1 SU 884355863 A SU884355863 A SU 884355863A SU 4355863 A SU4355863 A SU 4355863A RU 2012557 C1 RU2012557 C1 RU 2012557C1
- Authority
- RU
- Russia
- Prior art keywords
- mixture
- nujol
- spectrum
- difluorophenylthio
- infrared spectrum
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 78
- 150000003839 salts Chemical class 0.000 title claims description 18
- 230000015572 biosynthetic process Effects 0.000 title abstract 2
- 238000003786 synthesis reaction Methods 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 94
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 14
- 239000001257 hydrogen Substances 0.000 claims abstract description 14
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 6
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims abstract description 3
- 125000001589 carboacyl group Chemical group 0.000 claims abstract description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 3
- 229910052736 halogen Inorganic materials 0.000 claims abstract 4
- 150000002367 halogens Chemical class 0.000 claims abstract 3
- 238000006243 chemical reaction Methods 0.000 claims description 20
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 15
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 150000002431 hydrogen Chemical class 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 1
- -1 cyano, carboxyl Chemical group 0.000 abstract description 42
- 229940079593 drug Drugs 0.000 abstract description 5
- 239000003814 drug Substances 0.000 abstract description 5
- 230000003110 anti-inflammatory effect Effects 0.000 abstract description 4
- 230000000202 analgesic effect Effects 0.000 abstract description 3
- 230000000694 effects Effects 0.000 abstract description 3
- 239000003153 chemical reaction reagent Substances 0.000 abstract 2
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000005115 alkyl carbamoyl group Chemical group 0.000 abstract 1
- 239000000126 substance Substances 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 168
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 146
- 239000000203 mixture Substances 0.000 description 138
- 238000002329 infrared spectrum Methods 0.000 description 119
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 95
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 84
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 78
- 238000001819 mass spectrum Methods 0.000 description 60
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 51
- 239000000243 solution Substances 0.000 description 50
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 45
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 44
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 42
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 36
- 238000004519 manufacturing process Methods 0.000 description 34
- 239000013078 crystal Substances 0.000 description 29
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 26
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 22
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 22
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 21
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- 239000000284 extract Substances 0.000 description 19
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 18
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 18
- 238000010992 reflux Methods 0.000 description 18
- 239000003921 oil Substances 0.000 description 17
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 16
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 16
- 238000010898 silica gel chromatography Methods 0.000 description 16
- 239000011541 reaction mixture Substances 0.000 description 14
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 12
- 239000000706 filtrate Substances 0.000 description 12
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 11
- 239000007864 aqueous solution Substances 0.000 description 11
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 11
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 11
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- 239000007787 solid Substances 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- 239000012044 organic layer Substances 0.000 description 9
- 239000002253 acid Substances 0.000 description 8
- 235000019270 ammonium chloride Nutrition 0.000 description 8
- 239000010410 layer Substances 0.000 description 8
- 239000000843 powder Substances 0.000 description 8
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 8
- 235000017557 sodium bicarbonate Nutrition 0.000 description 8
- 239000005457 ice water Substances 0.000 description 7
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 7
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 6
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 6
- 235000019341 magnesium sulphate Nutrition 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 6
- 229910000033 sodium borohydride Inorganic materials 0.000 description 5
- 239000012279 sodium borohydride Substances 0.000 description 5
- YMCRZFDLPBADBJ-UHFFFAOYSA-N 2-(3-chloro-4-nitrophenyl)-2-methyl-1,3-dioxolane Chemical compound C=1C=C([N+]([O-])=O)C(Cl)=CC=1C1(C)OCCO1 YMCRZFDLPBADBJ-UHFFFAOYSA-N 0.000 description 4
- BGVHBCNYJBGYME-UHFFFAOYSA-N 3-(2,4-difluorophenyl)sulfanyl-4-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=C(C(Cl)=O)C=C1SC1=CC=C(F)C=C1F BGVHBCNYJBGYME-UHFFFAOYSA-N 0.000 description 4
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 230000003902 lesion Effects 0.000 description 4
- SATLETSOGGJSCU-UHFFFAOYSA-N n-[4-acetyl-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(SC=2C(=CC(F)=CC=2)F)=C1 SATLETSOGGJSCU-UHFFFAOYSA-N 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 238000006722 reduction reaction Methods 0.000 description 4
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- GLWASYDLRWSDQJ-UHFFFAOYSA-N 1-(3-chloro-4-nitrophenyl)ethanone Chemical compound CC(=O)C1=CC=C([N+]([O-])=O)C(Cl)=C1 GLWASYDLRWSDQJ-UHFFFAOYSA-N 0.000 description 3
- VDMRRUCYUGRYME-UHFFFAOYSA-N 1-[4-amino-3-(2,4-difluoroanilino)phenyl]ethanone Chemical compound CC(=O)C1=CC=C(N)C(NC=2C(=CC(F)=CC=2)F)=C1 VDMRRUCYUGRYME-UHFFFAOYSA-N 0.000 description 3
- CBJHIALPPRUTRZ-UHFFFAOYSA-N 1-[4-amino-3-(2,4-difluorophenyl)sulfanylphenyl]ethanone Chemical compound CC(=O)C1=CC=C(N)C(SC=2C(=CC(F)=CC=2)F)=C1 CBJHIALPPRUTRZ-UHFFFAOYSA-N 0.000 description 3
- HOMGDBSEVARSMI-UHFFFAOYSA-N 3-(2,4-difluoroanilino)-4-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC=C(C#N)C=C1NC1=CC=C(F)C=C1F HOMGDBSEVARSMI-UHFFFAOYSA-N 0.000 description 3
- HCOFLBBLUZLFJN-UHFFFAOYSA-N 3-(2,4-difluorophenyl)sulfanyl-4-nitrobenzoic acid Chemical compound OC(=O)C1=CC=C([N+]([O-])=O)C(SC=2C(=CC(F)=CC=2)F)=C1 HCOFLBBLUZLFJN-UHFFFAOYSA-N 0.000 description 3
- UAVMCFYFRVDHRG-UHFFFAOYSA-N 3-(2,4-difluorophenyl)sulfanyl-4-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC=C(C#N)C=C1SC1=CC=C(F)C=C1F UAVMCFYFRVDHRG-UHFFFAOYSA-N 0.000 description 3
- PAIMPYHIOHKXAT-UHFFFAOYSA-N 3-chloro-4-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC=C(C#N)C=C1Cl PAIMPYHIOHKXAT-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 3
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 3
- 239000005751 Copper oxide Substances 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 229910000431 copper oxide Inorganic materials 0.000 description 3
- 239000002198 insoluble material Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- LBTPIFQNEKOAIM-UHFFFAOYSA-N n-phenylmethanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=CC=C1 LBTPIFQNEKOAIM-UHFFFAOYSA-N 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Substances OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 235000011181 potassium carbonates Nutrition 0.000 description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 3
- 239000012258 stirred mixture Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 150000003460 sulfonic acids Chemical class 0.000 description 3
- 231100000419 toxicity Toxicity 0.000 description 3
- 230000001988 toxicity Effects 0.000 description 3
- 239000011592 zinc chloride Substances 0.000 description 3
- 235000005074 zinc chloride Nutrition 0.000 description 3
- WJJHZWMNHSRWKX-UHFFFAOYSA-N (2-amino-5-ethylphenyl)-(2,4-difluorophenyl)methanone Chemical compound CCC1=CC=C(N)C(C(=O)C=2C(=CC(F)=CC=2)F)=C1 WJJHZWMNHSRWKX-UHFFFAOYSA-N 0.000 description 2
- YVRLWDSZMUGUIF-UHFFFAOYSA-N 1-[3-(2,4-difluoroanilino)-4-nitrophenyl]ethanone Chemical compound CC(=O)C1=CC=C([N+]([O-])=O)C(NC=2C(=CC(F)=CC=2)F)=C1 YVRLWDSZMUGUIF-UHFFFAOYSA-N 0.000 description 2
- XWCBHSWVDKNJML-UHFFFAOYSA-N 1-[3-(2,4-difluorophenyl)sulfanyl-4-nitrophenyl]ethanone Chemical compound CC(=O)C1=CC=C([N+]([O-])=O)C(SC=2C(=CC(F)=CC=2)F)=C1 XWCBHSWVDKNJML-UHFFFAOYSA-N 0.000 description 2
- YMYICIYOFLPIMI-UHFFFAOYSA-N 1-[4-amino-3-(2,4-difluoro-n-methylanilino)phenyl]ethanone Chemical compound C=1C(C(C)=O)=CC=C(N)C=1N(C)C1=CC=C(F)C=C1F YMYICIYOFLPIMI-UHFFFAOYSA-N 0.000 description 2
- WTMYHYDJRMEGDT-UHFFFAOYSA-N 1-[4-amino-3-(2,4-difluorobenzoyl)phenyl]ethanone Chemical compound CC(=O)C1=CC=C(N)C(C(=O)C=2C(=CC(F)=CC=2)F)=C1 WTMYHYDJRMEGDT-UHFFFAOYSA-N 0.000 description 2
- WOVJWFWCSSUAGV-UHFFFAOYSA-N 1-[4-amino-3-chloro-5-(2,4-difluorophenyl)sulfanylphenyl]ethanone Chemical compound CC(=O)C1=CC(Cl)=C(N)C(SC=2C(=CC(F)=CC=2)F)=C1 WOVJWFWCSSUAGV-UHFFFAOYSA-N 0.000 description 2
- 125000006334 2,4-difluoro benzoyl group Chemical group [H]C1=C([H])C(C(*)=O)=C(F)C([H])=C1F 0.000 description 2
- CEPCPXLLFXPZGW-UHFFFAOYSA-N 2,4-difluoroaniline Chemical compound NC1=CC=C(F)C=C1F CEPCPXLLFXPZGW-UHFFFAOYSA-N 0.000 description 2
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 2
- UDDKYKRJPWPRMS-UHFFFAOYSA-N 3-(2,4-difluoroanilino)-4-nitrobenzoic acid Chemical compound OC(=O)C1=CC=C([N+]([O-])=O)C(NC=2C(=CC(F)=CC=2)F)=C1 UDDKYKRJPWPRMS-UHFFFAOYSA-N 0.000 description 2
- KVLZIKWDAAKHQI-UHFFFAOYSA-N 3-(2,4-difluorophenyl)sulfanyl-4-(methanesulfonamido)benzamide Chemical compound CS(=O)(=O)NC1=CC=C(C(N)=O)C=C1SC1=CC=C(F)C=C1F KVLZIKWDAAKHQI-UHFFFAOYSA-N 0.000 description 2
- BMONMWAHWCSPPI-UHFFFAOYSA-N 3-(2,4-difluorophenyl)sulfanyl-n-ethyl-4-nitrobenzamide Chemical compound CCNC(=O)C1=CC=C([N+]([O-])=O)C(SC=2C(=CC(F)=CC=2)F)=C1 BMONMWAHWCSPPI-UHFFFAOYSA-N 0.000 description 2
- JEJAPBIZMVLOAS-UHFFFAOYSA-N 3-(2,4-difluorophenyl)sulfanyl-n-methyl-4-nitrobenzamide Chemical compound CNC(=O)C1=CC=C([N+]([O-])=O)C(SC=2C(=CC(F)=CC=2)F)=C1 JEJAPBIZMVLOAS-UHFFFAOYSA-N 0.000 description 2
- DIYMLVUMMCXKIC-UHFFFAOYSA-N 4-amino-2-chloro-5-(2,4-difluorophenyl)sulfanylbenzonitrile Chemical compound NC1=CC(Cl)=C(C#N)C=C1SC1=CC=C(F)C=C1F DIYMLVUMMCXKIC-UHFFFAOYSA-N 0.000 description 2
- WUEFKTWYSTYPPS-UHFFFAOYSA-N 4-amino-3-(2,4-difluoroanilino)benzonitrile Chemical compound NC1=CC=C(C#N)C=C1NC1=CC=C(F)C=C1F WUEFKTWYSTYPPS-UHFFFAOYSA-N 0.000 description 2
- BAYSPRPESAEQFF-UHFFFAOYSA-N 4-amino-3-(2,4-difluorophenyl)sulfanylbenzamide Chemical compound NC(=O)C1=CC=C(N)C(SC=2C(=CC(F)=CC=2)F)=C1 BAYSPRPESAEQFF-UHFFFAOYSA-N 0.000 description 2
- HRXZRAXKKNUKRF-UHFFFAOYSA-N 4-ethylaniline Chemical compound CCC1=CC=C(N)C=C1 HRXZRAXKKNUKRF-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 206010010904 Convulsion Diseases 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 206010003246 arthritis Diseases 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 2
- 238000010531 catalytic reduction reaction Methods 0.000 description 2
- 230000002920 convulsive effect Effects 0.000 description 2
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 2
- 229910000396 dipotassium phosphate Inorganic materials 0.000 description 2
- 235000019797 dipotassium phosphate Nutrition 0.000 description 2
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 2
- 229910000397 disodium phosphate Inorganic materials 0.000 description 2
- 235000019800 disodium phosphate Nutrition 0.000 description 2
- VUMJZCLJQOMULZ-UHFFFAOYSA-N ethyl 3-(2,4-difluorophenyl)sulfanyl-4-nitrobenzoate Chemical compound CCOC(=O)C1=CC=C([N+]([O-])=O)C(SC=2C(=CC(F)=CC=2)F)=C1 VUMJZCLJQOMULZ-UHFFFAOYSA-N 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- XNXVOSBNFZWHBV-UHFFFAOYSA-N hydron;o-methylhydroxylamine;chloride Chemical compound Cl.CON XNXVOSBNFZWHBV-UHFFFAOYSA-N 0.000 description 2
- 229960000905 indomethacin Drugs 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 239000011259 mixed solution Substances 0.000 description 2
- MEETZRWFOKQCEK-UHFFFAOYSA-N n-[4-acetyl-2-(2,4-difluoroanilino)phenyl]methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(NC=2C(=CC(F)=CC=2)F)=C1 MEETZRWFOKQCEK-UHFFFAOYSA-N 0.000 description 2
- PHVPNAOEOWIOGV-UHFFFAOYSA-N n-[4-acetyl-2-(2,4-difluorophenyl)sulfonylphenyl]methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(S(=O)(=O)C=2C(=CC(F)=CC=2)F)=C1 PHVPNAOEOWIOGV-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 244000052769 pathogen Species 0.000 description 2
- 230000001717 pathogenic effect Effects 0.000 description 2
- 239000011736 potassium bicarbonate Substances 0.000 description 2
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 2
- 235000015497 potassium bicarbonate Nutrition 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- SMRXJFLENVHXLJ-UHFFFAOYSA-M potassium;2,4-difluorobenzenethiolate Chemical compound [K+].FC1=CC=C([S-])C(F)=C1 SMRXJFLENVHXLJ-UHFFFAOYSA-M 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 235000017550 sodium carbonate Nutrition 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 208000011580 syndromic disease Diseases 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 239000011135 tin Substances 0.000 description 2
- 229910052718 tin Inorganic materials 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- QPIUZDMLYOPLFU-UHFFFAOYSA-N (2-amino-5-nitrophenyl)-(2,4-difluorophenyl)methanone Chemical compound NC1=CC=C([N+]([O-])=O)C=C1C(=O)C1=CC=C(F)C=C1F QPIUZDMLYOPLFU-UHFFFAOYSA-N 0.000 description 1
- UEMGWPRHOOEKTA-UHFFFAOYSA-N 1,3-difluorobenzene Chemical compound FC1=CC=CC(F)=C1 UEMGWPRHOOEKTA-UHFFFAOYSA-N 0.000 description 1
- VMRRZIWYPROTKX-UHFFFAOYSA-N 1,3-difluorobenzene;hydrochloride Chemical compound Cl.FC1=CC=CC(F)=C1 VMRRZIWYPROTKX-UHFFFAOYSA-N 0.000 description 1
- YBOHLHIFLWWZBG-UHFFFAOYSA-N 1-(4-amino-3-phenylsulfanylphenyl)ethanone Chemical compound CC(=O)C1=CC=C(N)C(SC=2C=CC=CC=2)=C1 YBOHLHIFLWWZBG-UHFFFAOYSA-N 0.000 description 1
- YEVPHFIFGUWSMG-UHFFFAOYSA-N 1-(4-chloro-3-nitrophenyl)ethanone Chemical compound CC(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 YEVPHFIFGUWSMG-UHFFFAOYSA-N 0.000 description 1
- CBKCSUOGRGSRGB-UHFFFAOYSA-N 1-[3-(2,4-dichlorophenyl)sulfanyl-4-nitrophenyl]ethanone Chemical compound CC(=O)C1=CC=C([N+]([O-])=O)C(SC=2C(=CC(Cl)=CC=2)Cl)=C1 CBKCSUOGRGSRGB-UHFFFAOYSA-N 0.000 description 1
- TXSDLALXIIWAMK-UHFFFAOYSA-N 1-[3-amino-4-(2,4-difluorophenyl)sulfanylphenyl]ethanone Chemical compound NC1=CC(C(=O)C)=CC=C1SC1=CC=C(F)C=C1F TXSDLALXIIWAMK-UHFFFAOYSA-N 0.000 description 1
- VRGIHOYUTVYFAP-UHFFFAOYSA-N 1-[4-(2,4-difluorophenyl)sulfanyl-3-nitrophenyl]ethanone Chemical compound [O-][N+](=O)C1=CC(C(=O)C)=CC=C1SC1=CC=C(F)C=C1F VRGIHOYUTVYFAP-UHFFFAOYSA-N 0.000 description 1
- KOHQJOMKXUKQDJ-UHFFFAOYSA-N 1-[4-amino-3-(2,3,4,5,6-pentafluorophenyl)sulfanylphenyl]ethanone Chemical compound CC(=O)C1=CC=C(N)C(SC=2C(=C(F)C(F)=C(F)C=2F)F)=C1 KOHQJOMKXUKQDJ-UHFFFAOYSA-N 0.000 description 1
- CHFBHZAYJOEOCA-UHFFFAOYSA-N 1-[4-amino-3-(2,4-dichloroanilino)phenyl]ethanone Chemical compound CC(=O)C1=CC=C(N)C(NC=2C(=CC(Cl)=CC=2)Cl)=C1 CHFBHZAYJOEOCA-UHFFFAOYSA-N 0.000 description 1
- VENPGIMZGBWMHY-UHFFFAOYSA-N 1-[4-amino-3-(2,4-dichlorophenyl)sulfanylphenyl]ethanone Chemical compound CC(=O)C1=CC=C(N)C(SC=2C(=CC(Cl)=CC=2)Cl)=C1 VENPGIMZGBWMHY-UHFFFAOYSA-N 0.000 description 1
- GGHJALFHTNDTFQ-UHFFFAOYSA-N 1-[4-amino-3-(2-methoxyphenyl)sulfanylphenyl]ethanone Chemical compound COC1=CC=CC=C1SC1=CC(C(C)=O)=CC=C1N GGHJALFHTNDTFQ-UHFFFAOYSA-N 0.000 description 1
- KCIWLOSWUMWYKX-UHFFFAOYSA-N 1-[4-amino-3-(4-chlorophenyl)sulfanylphenyl]ethanone Chemical compound CC(=O)C1=CC=C(N)C(SC=2C=CC(Cl)=CC=2)=C1 KCIWLOSWUMWYKX-UHFFFAOYSA-N 0.000 description 1
- CBLCYDUTAOZDAU-UHFFFAOYSA-N 1-[4-amino-3-[2-(trifluoromethyl)phenyl]sulfanylphenyl]ethanone Chemical compound CC(=O)C1=CC=C(N)C(SC=2C(=CC=CC=2)C(F)(F)F)=C1 CBLCYDUTAOZDAU-UHFFFAOYSA-N 0.000 description 1
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 1
- KQCMTOWTPBNWDB-UHFFFAOYSA-N 2,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C=C1Cl KQCMTOWTPBNWDB-UHFFFAOYSA-N 0.000 description 1
- 125000004215 2,4-difluorophenyl group Chemical group [H]C1=C([H])C(*)=C(F)C([H])=C1F 0.000 description 1
- SLZZGZOMZJFWFV-UHFFFAOYSA-N 2,5-dichloro-4-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC(Cl)=C(C#N)C=C1Cl SLZZGZOMZJFWFV-UHFFFAOYSA-N 0.000 description 1
- UMARGVVXDLYDRL-UHFFFAOYSA-N 2-(2,4-difluorophenyl)sulfanyl-4-methylsulfanylaniline Chemical compound CSC1=CC=C(N)C(SC=2C(=CC(F)=CC=2)F)=C1 UMARGVVXDLYDRL-UHFFFAOYSA-N 0.000 description 1
- MWXRLQRMVZREEG-UHFFFAOYSA-N 2-(2,4-difluorophenyl)sulfanyl-4-methylsulfonylaniline Chemical compound CS(=O)(=O)C1=CC=C(N)C(SC=2C(=CC(F)=CC=2)F)=C1 MWXRLQRMVZREEG-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- QDZLIZPCBFGPTC-UHFFFAOYSA-N 2-chloro-4-methylsulfanyl-1-nitrobenzene Chemical compound CSC1=CC=C([N+]([O-])=O)C(Cl)=C1 QDZLIZPCBFGPTC-UHFFFAOYSA-N 0.000 description 1
- AAWLZYHLLVWLFO-UHFFFAOYSA-N 2-chloro-5-(2,4-difluorophenyl)sulfanyl-4-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC(Cl)=C(C#N)C=C1SC1=CC=C(F)C=C1F AAWLZYHLLVWLFO-UHFFFAOYSA-N 0.000 description 1
- VFZVMPNWYZJAMT-UHFFFAOYSA-N 3-(2,4-difluoroanilino)-4-nitrobenzamide Chemical compound NC(=O)C1=CC=C([N+]([O-])=O)C(NC=2C(=CC(F)=CC=2)F)=C1 VFZVMPNWYZJAMT-UHFFFAOYSA-N 0.000 description 1
- UISRBBOYPMJTDI-UHFFFAOYSA-N 3-(2,4-difluoroanilino)-n-methyl-4-nitrobenzamide Chemical compound CNC(=O)C1=CC=C([N+]([O-])=O)C(NC=2C(=CC(F)=CC=2)F)=C1 UISRBBOYPMJTDI-UHFFFAOYSA-N 0.000 description 1
- ASIPCQDJXNGJBL-UHFFFAOYSA-N 3-(2,4-difluorophenyl)sulfanyl-4-(methanesulfonamido)benzoic acid Chemical compound CS(=O)(=O)NC1=CC=C(C(O)=O)C=C1SC1=CC=C(F)C=C1F ASIPCQDJXNGJBL-UHFFFAOYSA-N 0.000 description 1
- YGOQIOHCAFXLMF-UHFFFAOYSA-N 3-(2,4-difluorophenyl)sulfanyl-4-nitro-n-phenylbenzamide Chemical compound [O-][N+](=O)C1=CC=C(C(=O)NC=2C=CC=CC=2)C=C1SC1=CC=C(F)C=C1F YGOQIOHCAFXLMF-UHFFFAOYSA-N 0.000 description 1
- XOTMEAZWRLWASN-UHFFFAOYSA-N 3-(2,4-difluorophenyl)sulfanyl-4-nitrobenzamide Chemical compound NC(=O)C1=CC=C([N+]([O-])=O)C(SC=2C(=CC(F)=CC=2)F)=C1 XOTMEAZWRLWASN-UHFFFAOYSA-N 0.000 description 1
- ONPWVEZGABJLCV-UHFFFAOYSA-N 3-(2,4-difluorophenyl)sulfanyl-n,n-dimethyl-4-nitrobenzamide Chemical compound CN(C)C(=O)C1=CC=C([N+]([O-])=O)C(SC=2C(=CC(F)=CC=2)F)=C1 ONPWVEZGABJLCV-UHFFFAOYSA-N 0.000 description 1
- CZOGHJNKZMAJKI-UHFFFAOYSA-N 3-(2,4-difluorophenyl)sulfanyl-n-ethyl-4-(methanesulfonamido)benzamide Chemical compound CCNC(=O)C1=CC=C(NS(C)(=O)=O)C(SC=2C(=CC(F)=CC=2)F)=C1 CZOGHJNKZMAJKI-UHFFFAOYSA-N 0.000 description 1
- CKAZFZLUVICSJR-UHFFFAOYSA-N 3-(4-acetyl-2,4-difluorocyclohexa-1,5-dien-1-yl)-3-oxo-n-phenylpropanamide Chemical compound C1=CC(C(=O)C)(F)CC(F)=C1C(=O)CC(=O)NC1=CC=CC=C1 CKAZFZLUVICSJR-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- DKTRZBWXGOPYIX-UHFFFAOYSA-N 3-chloro-4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C(Cl)=C1 DKTRZBWXGOPYIX-UHFFFAOYSA-N 0.000 description 1
- XKTYXVDYIKIYJP-UHFFFAOYSA-N 3h-dioxole Chemical compound C1OOC=C1 XKTYXVDYIKIYJP-UHFFFAOYSA-N 0.000 description 1
- FHERJJNFTCJEQR-UHFFFAOYSA-N 4-amino-3-(2,4-difluorophenyl)sulfanyl-n-ethylbenzamide Chemical compound CCNC(=O)C1=CC=C(N)C(SC=2C(=CC(F)=CC=2)F)=C1 FHERJJNFTCJEQR-UHFFFAOYSA-N 0.000 description 1
- BULRYGJMRZIAFW-UHFFFAOYSA-N 4-amino-3-(2,4-difluorophenyl)sulfanyl-n-methylbenzamide Chemical compound CNC(=O)C1=CC=C(N)C(SC=2C(=CC(F)=CC=2)F)=C1 BULRYGJMRZIAFW-UHFFFAOYSA-N 0.000 description 1
- GSVMNWHEMHDUOT-UHFFFAOYSA-N 4-amino-5-(2,4-difluorophenyl)sulfanyl-2-methylbenzonitrile Chemical compound C1=C(C#N)C(C)=CC(N)=C1SC1=CC=C(F)C=C1F GSVMNWHEMHDUOT-UHFFFAOYSA-N 0.000 description 1
- SVYBEBLNQGDRHF-UHFFFAOYSA-N 4-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide Chemical compound S1C(CC)=NN=C1NS(=O)(=O)C1=CC=C(N)C=C1 SVYBEBLNQGDRHF-UHFFFAOYSA-N 0.000 description 1
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 1
- BKLQNNJYCZWFHA-UHFFFAOYSA-N 5-(2,4-difluorophenyl)sulfanyl-2-methyl-4-nitrobenzonitrile Chemical compound C1=C(C#N)C(C)=CC([N+]([O-])=O)=C1SC1=CC=C(F)C=C1F BKLQNNJYCZWFHA-UHFFFAOYSA-N 0.000 description 1
- ZWLDWBHSLNIYRN-UHFFFAOYSA-N 5-(2-methyl-1,3-dioxolan-2-yl)-2-nitrobenzonitrile Chemical compound C=1C=C([N+]([O-])=O)C(C#N)=CC=1C1(C)OCCO1 ZWLDWBHSLNIYRN-UHFFFAOYSA-N 0.000 description 1
- PWMVOIULJMOULR-UHFFFAOYSA-N 5-acetyl-2-(methanesulfonamido)benzoic acid Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(C(O)=O)=C1 PWMVOIULJMOULR-UHFFFAOYSA-N 0.000 description 1
- 229910000761 Aluminium amalgam Inorganic materials 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RDXGXSVCTAIPBJ-UHFFFAOYSA-N ClC1=CC=CC=C1C(=O)OO.C Chemical compound ClC1=CC=CC=C1C(=O)OO.C RDXGXSVCTAIPBJ-UHFFFAOYSA-N 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 241000187479 Mycobacterium tuberculosis Species 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 235000014680 Saccharomyces cerevisiae Nutrition 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910000318 alkali metal phosphate Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 230000001760 anti-analgesic effect Effects 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- KQDDQXNVESLJNO-UHFFFAOYSA-N chloromethanesulfonyl chloride Chemical compound ClCS(Cl)(=O)=O KQDDQXNVESLJNO-UHFFFAOYSA-N 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 1
- KFSQQLFJTAVSNW-UHFFFAOYSA-N ethyl 4-amino-3-(2,4-difluorophenyl)sulfanylbenzoate Chemical compound CCOC(=O)C1=CC=C(N)C(SC=2C(=CC(F)=CC=2)F)=C1 KFSQQLFJTAVSNW-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- QFWPJPIVLCBXFJ-UHFFFAOYSA-N glymidine Chemical compound N1=CC(OCCOC)=CN=C1NS(=O)(=O)C1=CC=CC=C1 QFWPJPIVLCBXFJ-UHFFFAOYSA-N 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 210000000548 hind-foot Anatomy 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 229960001680 ibuprofen Drugs 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- YJZOWPQKPSZJKE-UHFFFAOYSA-M lithium;2-(trifluoromethyl)benzenethiolate Chemical compound [Li+].FC(F)(F)C1=CC=CC=C1[S-] YJZOWPQKPSZJKE-UHFFFAOYSA-M 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 1
- IZDROVVXIHRYMH-UHFFFAOYSA-N methanesulfonic anhydride Chemical compound CS(=O)(=O)OS(C)(=O)=O IZDROVVXIHRYMH-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- GUAWMXYQZKVRCW-UHFFFAOYSA-N n,2-dimethylaniline Chemical compound CNC1=CC=CC=C1C GUAWMXYQZKVRCW-UHFFFAOYSA-N 0.000 description 1
- VAPQTWXKZJIPSW-UHFFFAOYSA-N n-(2,4-dichlorophenyl)-5-(2-methyl-1,3-dioxolan-2-yl)-2-nitroaniline Chemical compound C=1C=C([N+]([O-])=O)C(NC=2C(=CC(Cl)=CC=2)Cl)=CC=1C1(C)OCCO1 VAPQTWXKZJIPSW-UHFFFAOYSA-N 0.000 description 1
- BWQPJLBBPOSJFH-UHFFFAOYSA-N n-(4-acetyl-2-aminophenyl)methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(N)=C1 BWQPJLBBPOSJFH-UHFFFAOYSA-N 0.000 description 1
- UQZRONGQINLSFZ-UHFFFAOYSA-N n-(4-acetyl-2-cyanophenyl)methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(C#N)=C1 UQZRONGQINLSFZ-UHFFFAOYSA-N 0.000 description 1
- PYWLPRHLHJIZKF-UHFFFAOYSA-N n-(4-acetyl-2-thiophen-2-ylsulfanylphenyl)methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(SC=2SC=CC=2)=C1 PYWLPRHLHJIZKF-UHFFFAOYSA-N 0.000 description 1
- DXKSDEYOBCPTQD-UHFFFAOYSA-N n-[2-(2,4-dichlorophenyl)sulfanyl-4-(1-hydroxyethyl)phenyl]methanesulfonamide Chemical compound CC(O)C1=CC=C(NS(C)(=O)=O)C(SC=2C(=CC(Cl)=CC=2)Cl)=C1 DXKSDEYOBCPTQD-UHFFFAOYSA-N 0.000 description 1
- DLAMJFKCEPDJMY-UHFFFAOYSA-N n-[2-(2,4-difluorophenyl)sulfanyl-4-(1-hydroxy-2-phenylethyl)phenyl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C(C(O)CC=2C=CC=CC=2)C=C1SC1=CC=C(F)C=C1F DLAMJFKCEPDJMY-UHFFFAOYSA-N 0.000 description 1
- KCXFIQWLVBVHEN-UHFFFAOYSA-N n-[2-(2,4-difluorophenyl)sulfanyl-4-(1-hydroxypropyl)phenyl]methanesulfonamide Chemical compound CCC(O)C1=CC=C(NS(C)(=O)=O)C(SC=2C(=CC(F)=CC=2)F)=C1 KCXFIQWLVBVHEN-UHFFFAOYSA-N 0.000 description 1
- BLMAGGZQTWASJP-UHFFFAOYSA-N n-[2-(2,4-difluorophenyl)sulfanyl-4-(hydroxymethyl)phenyl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C(CO)C=C1SC1=CC=C(F)C=C1F BLMAGGZQTWASJP-UHFFFAOYSA-N 0.000 description 1
- WXBIESZYFUEJKZ-UHFFFAOYSA-N n-[2-(2,4-difluorophenyl)sulfanyl-4-(n-methoxy-c-methylcarbonimidoyl)phenyl]methanesulfonamide Chemical compound CON=C(C)C1=CC=C(NS(C)(=O)=O)C(SC=2C(=CC(F)=CC=2)F)=C1 WXBIESZYFUEJKZ-UHFFFAOYSA-N 0.000 description 1
- STWTVDJDOIIZNR-UHFFFAOYSA-N n-[2-(2,4-difluorophenyl)sulfanyl-4-methylsulfonylphenyl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C(S(C)(=O)=O)C=C1SC1=CC=C(F)C=C1F STWTVDJDOIIZNR-UHFFFAOYSA-N 0.000 description 1
- DEQSMYFLPXPZMW-UHFFFAOYSA-N n-[2-(2,4-difluorophenyl)sulfanyl-4-propanoylphenyl]methanesulfonamide Chemical compound CCC(=O)C1=CC=C(NS(C)(=O)=O)C(SC=2C(=CC(F)=CC=2)F)=C1 DEQSMYFLPXPZMW-UHFFFAOYSA-N 0.000 description 1
- WJRRQWMMCLCTEA-UHFFFAOYSA-N n-[2-(2,4-difluorophenyl)sulfonyl-4-(1-hydroxyethyl)phenyl]methanesulfonamide Chemical compound CC(O)C1=CC=C(NS(C)(=O)=O)C(S(=O)(=O)C=2C(=CC(F)=CC=2)F)=C1 WJRRQWMMCLCTEA-UHFFFAOYSA-N 0.000 description 1
- JLMWYZSHJCXIPG-UHFFFAOYSA-N n-[4-(1-aminoethyl)-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide Chemical compound CC(N)C1=CC=C(NS(C)(=O)=O)C(SC=2C(=CC(F)=CC=2)F)=C1 JLMWYZSHJCXIPG-UHFFFAOYSA-N 0.000 description 1
- WSULCIJMWAZOBF-UHFFFAOYSA-N n-[4-acetyl-2-(2,4-dichloroanilino)phenyl]methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(NC=2C(=CC(Cl)=CC=2)Cl)=C1 WSULCIJMWAZOBF-UHFFFAOYSA-N 0.000 description 1
- KUYOQNVBCPISOS-UHFFFAOYSA-N n-[4-acetyl-2-(2,4-dichlorophenyl)sulfanylphenyl]methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(SC=2C(=CC(Cl)=CC=2)Cl)=C1 KUYOQNVBCPISOS-UHFFFAOYSA-N 0.000 description 1
- ZFPOTTGIOLRXPO-UHFFFAOYSA-N n-[4-acetyl-2-(2,4-difluoro-n-methylanilino)phenyl]methanesulfonamide Chemical compound C=1C(C(C)=O)=CC=C(NS(C)(=O)=O)C=1N(C)C1=CC=C(F)C=C1F ZFPOTTGIOLRXPO-UHFFFAOYSA-N 0.000 description 1
- AZCLXHYLMYLOOQ-UHFFFAOYSA-N n-[4-acetyl-2-(2,4-difluorobenzoyl)phenyl]methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(C(=O)C=2C(=CC(F)=CC=2)F)=C1 AZCLXHYLMYLOOQ-UHFFFAOYSA-N 0.000 description 1
- NOSPWKIVQREZJV-UHFFFAOYSA-N n-[4-acetyl-2-(2,4-difluorophenyl)sulfanylphenyl]-1,1,1-trifluoromethanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(=O)(=O)C(F)(F)F)C(SC=2C(=CC(F)=CC=2)F)=C1 NOSPWKIVQREZJV-UHFFFAOYSA-N 0.000 description 1
- NOKZZXCJVTXNOX-UHFFFAOYSA-N n-[4-acetyl-2-(2,4-difluorophenyl)sulfanylphenyl]-1-chloromethanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(=O)(=O)CCl)C(SC=2C(=CC(F)=CC=2)F)=C1 NOKZZXCJVTXNOX-UHFFFAOYSA-N 0.000 description 1
- AJFRISJKVMWMRN-UHFFFAOYSA-N n-[4-acetyl-2-(2,4-difluorophenyl)sulfinylphenyl]methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(S(=O)C=2C(=CC(F)=CC=2)F)=C1 AJFRISJKVMWMRN-UHFFFAOYSA-N 0.000 description 1
- WTGGPIIRJIGHND-UHFFFAOYSA-N n-[4-acetyl-2-(2-chlorophenyl)sulfanylphenyl]methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(SC=2C(=CC=CC=2)Cl)=C1 WTGGPIIRJIGHND-UHFFFAOYSA-N 0.000 description 1
- PHRVTCSWZVRHDP-UHFFFAOYSA-N n-[4-acetyl-2-(2-methoxyphenyl)sulfanylphenyl]methanesulfonamide Chemical compound COC1=CC=CC=C1SC1=CC(C(C)=O)=CC=C1NS(C)(=O)=O PHRVTCSWZVRHDP-UHFFFAOYSA-N 0.000 description 1
- OEOHDHSZGLVDRK-UHFFFAOYSA-N n-[4-acetyl-2-(4-chlorophenyl)sulfanylphenyl]methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(SC=2C=CC(Cl)=CC=2)=C1 OEOHDHSZGLVDRK-UHFFFAOYSA-N 0.000 description 1
- AGRNJQYPTSCAPZ-UHFFFAOYSA-N n-[4-acetyl-2-[2-(trifluoromethyl)phenyl]sulfanylphenyl]methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(SC=2C(=CC=CC=2)C(F)(F)F)=C1 AGRNJQYPTSCAPZ-UHFFFAOYSA-N 0.000 description 1
- HABXLNGALYLNGE-UHFFFAOYSA-N n-[4-acetyl-2-chloro-6-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide Chemical compound CC(=O)C1=CC(Cl)=C(NS(C)(=O)=O)C(SC=2C(=CC(F)=CC=2)F)=C1 HABXLNGALYLNGE-UHFFFAOYSA-N 0.000 description 1
- NIANPPKHOBQCMW-UHFFFAOYSA-N n-[4-cyano-2-(2,4-difluoroanilino)phenyl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C(C#N)C=C1NC1=CC=C(F)C=C1F NIANPPKHOBQCMW-UHFFFAOYSA-N 0.000 description 1
- MLCNFEQJEPOAMP-UHFFFAOYSA-N n-[4-cyano-2-(2,4-difluorophenyl)sulfanyl-5-methylphenyl]methanesulfonamide Chemical compound C1=C(C#N)C(C)=CC(NS(C)(=O)=O)=C1SC1=CC=C(F)C=C1F MLCNFEQJEPOAMP-UHFFFAOYSA-N 0.000 description 1
- FUHAXALKXLRWNN-UHFFFAOYSA-N n-[4-cyano-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C(C#N)C=C1SC1=CC=C(F)C=C1F FUHAXALKXLRWNN-UHFFFAOYSA-N 0.000 description 1
- RVVGQSWFKCTUBG-UHFFFAOYSA-N n-[4-cyano-2-[(2,4-difluorophenyl)-hydroxymethyl]phenyl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C(C#N)C=C1C(O)C1=CC=C(F)C=C1F RVVGQSWFKCTUBG-UHFFFAOYSA-N 0.000 description 1
- GFQBWBFYGJTLDW-UHFFFAOYSA-N n-[5-acetyl-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC(C(=O)C)=CC=C1SC1=CC=C(F)C=C1F GFQBWBFYGJTLDW-UHFFFAOYSA-N 0.000 description 1
- RWGZCWLUFNDBPE-UHFFFAOYSA-N n-[5-chloro-4-cyano-2-(2,4-difluorophenyl)sulfanylphenyl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC(Cl)=C(C#N)C=C1SC1=CC=C(F)C=C1F RWGZCWLUFNDBPE-UHFFFAOYSA-N 0.000 description 1
- FRTIQGNDINCSRS-UHFFFAOYSA-N n-benzyl-3-(2,4-difluorophenyl)sulfanyl-4-nitrobenzamide Chemical compound [O-][N+](=O)C1=CC=C(C(=O)NCC=2C=CC=CC=2)C=C1SC1=CC=C(F)C=C1F FRTIQGNDINCSRS-UHFFFAOYSA-N 0.000 description 1
- 229960000965 nimesulide Drugs 0.000 description 1
- HYWYRSMBCFDLJT-UHFFFAOYSA-N nimesulide Chemical compound CS(=O)(=O)NC1=CC=C([N+]([O-])=O)C=C1OC1=CC=CC=C1 HYWYRSMBCFDLJT-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 1
- 229940067157 phenylhydrazine Drugs 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- RPDAUEIUDPHABB-UHFFFAOYSA-N potassium ethoxide Chemical compound [K+].CC[O-] RPDAUEIUDPHABB-UHFFFAOYSA-N 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- LWIHDJKSTIGBAC-UHFFFAOYSA-K potassium phosphate Substances [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 229910001023 sodium amalgam Inorganic materials 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 229960003288 sulfaethidole Drugs 0.000 description 1
- NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical class NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 230000001562 ulcerogenic effect Effects 0.000 description 1
- 230000003313 weakening effect Effects 0.000 description 1
Images
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/06—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom
- C07D213/16—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom containing only one pyridine ring
- C07D213/20—Quaternary compounds thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/01—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms
- C07C311/02—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C311/08—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton having the nitrogen atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/04—Centrally acting analgesics, e.g. opioids
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/26—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C317/32—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/31—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
- C07C323/33—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton having at least one of the nitrogen atoms bound to a carbon atom of the same non-condensed six-membered aromatic ring
- C07C323/35—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton having at least one of the nitrogen atoms bound to a carbon atom of the same non-condensed six-membered aromatic ring the thio group being a sulfide group
- C07C323/37—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton having at least one of the nitrogen atoms bound to a carbon atom of the same non-condensed six-membered aromatic ring the thio group being a sulfide group the sulfur atom of the sulfide group being further bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/70—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/36—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/24—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D235/28—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
- C07D249/10—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D249/12—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D257/04—Five-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/06—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles
- C07D271/07—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/36—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/40—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/44—Acylated amino or imino radicals
- C07D277/46—Acylated amino or imino radicals by carboxylic acids, or sulfur or nitrogen analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/192—Radicals derived from carboxylic acids from aromatic carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/30—Hetero atoms other than halogen
- C07D333/34—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pain & Pain Management (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Biomedical Technology (AREA)
- Neurosurgery (AREA)
- Neurology (AREA)
- Rheumatology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Medicinal Preparation (AREA)
- Saccharide Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Pyridine Compounds (AREA)
- Quinoline Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8712647 | 1987-05-29 | ||
| JP8724903 | 1987-05-29 | ||
| GB878712647A GB8712647D0 (en) | 1987-05-29 | 1987-05-29 | 2'-phenoxyalkanesulfonanilide derivatives |
| JP88871 | 1987-05-29 | ||
| GB878724903A GB8724903D0 (en) | 1987-10-23 | 1987-10-23 | 2-phenoxyalkanesulfonanilide derivatives |
| GB888800871A GB8800871D0 (en) | 1988-01-15 | 1988-01-15 | New alkanesulfonanilide derivatives processes for preparation thereof & pharmaceutical composition comprising same |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| RU2012557C1 true RU2012557C1 (ru) | 1994-05-15 |
Family
ID=27263443
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU884355863A RU2012557C1 (ru) | 1987-05-29 | 1988-05-27 | Способ получения производных алкансульфонанилида или их фармацевтически приемлемых солей |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US5034417A (cg-RX-API-DMAC7.html) |
| EP (1) | EP0292979B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JPS63313765A (cg-RX-API-DMAC7.html) |
| KR (1) | KR880013886A (cg-RX-API-DMAC7.html) |
| CN (1) | CN1019388B (cg-RX-API-DMAC7.html) |
| AT (1) | ATE91682T1 (cg-RX-API-DMAC7.html) |
| DE (1) | DE3882438T2 (cg-RX-API-DMAC7.html) |
| DK (1) | DK291488A (cg-RX-API-DMAC7.html) |
| ES (1) | ES2058177T3 (cg-RX-API-DMAC7.html) |
| FI (1) | FI882477A7 (cg-RX-API-DMAC7.html) |
| HU (1) | HU204780B (cg-RX-API-DMAC7.html) |
| IL (1) | IL86462A (cg-RX-API-DMAC7.html) |
| NO (1) | NO168243C (cg-RX-API-DMAC7.html) |
| PH (1) | PH25181A (cg-RX-API-DMAC7.html) |
| PT (1) | PT87578B (cg-RX-API-DMAC7.html) |
| RU (1) | RU2012557C1 (cg-RX-API-DMAC7.html) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH02138168A (ja) * | 1988-11-18 | 1990-05-28 | Hisamitsu Pharmaceut Co Inc | スルホンアニリド誘導体 |
| WO1994019318A1 (fr) * | 1993-02-19 | 1994-09-01 | Taisho Pharmaceutical Co., Ltd. | Compose de 5-aminoacetylaminosulfonanilide |
| EP0906279B1 (en) * | 1996-05-30 | 2002-10-02 | F. Hoffmann-La Roche Ag | Pyrrole derivatives |
| US6780821B1 (en) * | 1998-07-09 | 2004-08-24 | Bayer Aktiengesellschaft | Substituted phenyl uracils |
| US6867203B2 (en) | 1998-12-29 | 2005-03-15 | Abbott Laboratories | Cell adhesion-inhibiting antiinflammatory and immune-suppressive compounds |
| AR030911A1 (es) * | 1999-07-20 | 2003-09-03 | Smithkline Beecham Corp | Uso de n-aril-2-sulfonamidobenzamidas para la manufactura de un medicamento para el tratamiento de la insuficiencia renal cronica y composiciones farmaceuticas |
| JP3921056B2 (ja) * | 2001-03-13 | 2007-05-30 | 善二郎 小柳津 | 弾性発泡砥石材及びその製造方法 |
| DE10206404A1 (de) * | 2002-02-14 | 2003-08-28 | Gruenenthal Gmbh | Synthese von substituierten Sulfonylaminen |
| BRPI0411275A (pt) * | 2003-06-10 | 2006-08-01 | Kalypsys Inc | compostos de carbonila como inibidores de histona deacetilase para tratamento de doenças; composição farmacêutica; método de modular a atividade catalìtica de hdac; método de tratar doença em um indivìduo; utilização de um composto ou composição; método de inibir hdac |
| WO2005123089A2 (en) | 2004-06-10 | 2005-12-29 | Kalypsys, Inc. | Multicyclic sulfonamide compounds as inhibitors of histone deacetylase for the treatment of disease |
| CA2609574A1 (en) * | 2005-06-09 | 2006-12-21 | Schering-Plough Ltd. | Control of parasites in animals by n-[(phenyloxy)phenyl]-1,1,1-trifluoromethanesulfonamide and n-[(phenylsulfanyl)phenyl]-1,1,1-trifluoromethanesulfonamide derivatives |
| US7868001B2 (en) * | 2007-11-02 | 2011-01-11 | Hutchison Medipharma Enterprises Limited | Cytokine inhibitors |
| GB0813403D0 (en) * | 2008-07-22 | 2008-08-27 | Lectus Therapeutics Ltd | Potassium ion channel modulators & uses thereof |
| PL3040329T3 (pl) * | 2013-08-29 | 2019-04-30 | Kyoto Pharma Ind | Związek aromatyczny i jego zastosowanie w leczeniu chorób związanych z metabolizmem kości |
| CN115667212A (zh) * | 2020-05-29 | 2023-01-31 | 富士胶片富山化学株式会社 | 高纯度的n-(5-甲氧基-2-苯氧基苯基)甲磺酰胺及其制造方法 |
Family Cites Families (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH364248A (de) * | 1957-12-24 | 1962-09-15 | Geigy Ag J R | Verfahren zur Herstellung neuer Aminobenzoesäure-Derivate |
| NL279361A (cg-RX-API-DMAC7.html) * | 1961-06-07 | 1900-01-01 | ||
| USRE29032E (en) * | 1969-06-12 | 1976-11-09 | Riker Laboratories, Inc. | 3-Benzoylfluoro-methanesulfonanilides |
| US3972926A (en) * | 1971-01-04 | 1976-08-03 | Riker Laboratories, Inc. | Substituted trifluoromethanesulfonanilides |
| US3840597A (en) * | 1971-02-24 | 1974-10-08 | Riker Laboratories Inc | Substituted 2-phenoxy alkane-sulfonanilides |
| JPS5223080B2 (cg-RX-API-DMAC7.html) * | 1971-08-16 | 1977-06-22 | ||
| US3755605A (en) * | 1972-06-13 | 1973-08-28 | Riker Laboratories Inc | Diphenylamine derivatives |
| AR206496A1 (es) * | 1972-07-03 | 1976-07-30 | Riker Laboratories Inc | Procedimiento para la preparacion de 2-fenoxi-4-nitro-alquil o haloalquilsulfonanilidas |
| US3856859A (en) * | 1973-06-08 | 1974-12-24 | Riker Laboratories Inc | Selective nitration process |
| US4349378A (en) * | 1978-07-25 | 1982-09-14 | Fbc Limited | Compounds useful as pesticides |
| DE2833202A1 (de) * | 1978-07-27 | 1980-02-14 | Schering Ag | Neue indanyl- und tetralinylamide, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische praeparate |
| DE2845997A1 (de) * | 1978-10-23 | 1980-04-30 | Bayer Ag | Pflanzenwachstumsregulierende mittel, verfahren zu ihrer herstellung und ihre verwendung zur regulierung des pflanzenwachstums |
| DE2845996A1 (de) * | 1978-10-23 | 1980-04-30 | Bayer Ag | Herbizide mittel, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von unkraeutern |
| JPS55124753A (en) * | 1979-03-19 | 1980-09-26 | Fuji Photo Film Co Ltd | Preparation of aminophenol and aminonaphthol derivative |
| US4465508A (en) * | 1979-07-18 | 1984-08-14 | Imperial Chemical Industries Plc | Diphenyl ether herbicides |
| US4780128A (en) * | 1979-07-18 | 1988-10-25 | Imperial Chemical Industries Plc | Herbicides |
| ZA804076B (en) * | 1979-07-18 | 1981-06-24 | Ici Ltd | Herbicides |
| JPS56154452A (en) * | 1980-04-11 | 1981-11-30 | Sumitomo Chem Co Ltd | Trifluoromethanesulfonanilide derivative, its salt and preparation and herbicide containing the same as active constituent |
| JPS57175154A (en) * | 1981-04-23 | 1982-10-28 | Mitsui Toatsu Chem Inc | Selective n-substitution of aromatic aminohydroxy compound |
| JPS57200340A (en) * | 1981-06-03 | 1982-12-08 | Mitsui Toatsu Chem Inc | Process for selective n-substitution of aromatic aminohydroxy compound |
| JPS5835989A (ja) * | 1981-08-28 | 1983-03-02 | Sanyo Electric Co Ltd | 非晶質光半導体装置 |
| JPS5850984A (ja) * | 1981-09-24 | 1983-03-25 | 松下電工株式会社 | 電気カミソリ |
| JPS5916871A (ja) * | 1982-07-20 | 1984-01-28 | Shionogi & Co Ltd | スルホンアミド系ベンズアミド類 |
| JPS5944311A (ja) * | 1982-09-07 | 1984-03-12 | Santen Pharmaceut Co Ltd | 徐放性顆粒およびその製造法 |
| EP0149423B1 (de) * | 1983-12-16 | 1987-10-28 | Ciba-Geigy Ag | Verfahren zum Schützen von Keratinmaterial vor dem Befall durch keratinfressende Insekten und neue Phenoxytrifluormethansulfonanilide |
| JPS6110548A (ja) * | 1984-06-27 | 1986-01-18 | Mitsui Petrochem Ind Ltd | スルホンアミド類 |
| US4675405A (en) * | 1984-09-21 | 1987-06-23 | American Home Products Corporation | Quinoline compounds as antiallergic and antithrombotic agents |
| PT86407B (pt) * | 1986-12-31 | 1990-11-20 | Fujisawa Pharmaceutical Co | Processo para a preparacao de novos derivados de alcano-sulfonanilida, e de composicoes farmaceuticas compreendendo os mesmos |
-
1988
- 1988-05-20 IL IL86462A patent/IL86462A/xx unknown
- 1988-05-24 US US07/197,966 patent/US5034417A/en not_active Expired - Fee Related
- 1988-05-25 PH PH36971A patent/PH25181A/en unknown
- 1988-05-25 PT PT87578A patent/PT87578B/pt not_active IP Right Cessation
- 1988-05-26 FI FI882477A patent/FI882477A7/fi not_active Application Discontinuation
- 1988-05-27 JP JP63130826A patent/JPS63313765A/ja active Granted
- 1988-05-27 DE DE88108455T patent/DE3882438T2/de not_active Expired - Fee Related
- 1988-05-27 RU SU884355863A patent/RU2012557C1/ru active
- 1988-05-27 HU HU882712A patent/HU204780B/hu not_active IP Right Cessation
- 1988-05-27 ES ES88108455T patent/ES2058177T3/es not_active Expired - Lifetime
- 1988-05-27 NO NO882334A patent/NO168243C/no unknown
- 1988-05-27 AT AT88108455T patent/ATE91682T1/de not_active IP Right Cessation
- 1988-05-27 DK DK291488A patent/DK291488A/da not_active Application Discontinuation
- 1988-05-27 EP EP88108455A patent/EP0292979B1/en not_active Expired - Lifetime
- 1988-05-28 KR KR1019880006342A patent/KR880013886A/ko not_active Ceased
- 1988-05-28 CN CN88103277A patent/CN1019388B/zh not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FI882477A0 (fi) | 1988-05-26 |
| NO168243C (no) | 1992-01-29 |
| DE3882438T2 (de) | 1993-12-02 |
| IL86462A0 (en) | 1988-11-15 |
| EP0292979A3 (en) | 1989-11-23 |
| KR880013886A (ko) | 1988-12-22 |
| HU204780B (en) | 1992-02-28 |
| PT87578B (pt) | 1992-09-30 |
| IL86462A (en) | 1992-12-01 |
| CN1019388B (zh) | 1992-12-09 |
| NO882334D0 (no) | 1988-05-27 |
| ES2058177T3 (es) | 1994-11-01 |
| NO168243B (no) | 1991-10-21 |
| ATE91682T1 (de) | 1993-08-15 |
| NO882334L (no) | 1988-11-30 |
| CN88103277A (zh) | 1988-12-07 |
| EP0292979A2 (en) | 1988-11-30 |
| HUT47241A (en) | 1989-02-28 |
| AU609480B2 (en) | 1991-05-02 |
| PT87578A (pt) | 1989-05-31 |
| DK291488A (da) | 1988-11-30 |
| DE3882438D1 (de) | 1993-08-26 |
| JPS63313765A (ja) | 1988-12-21 |
| DK291488D0 (da) | 1988-05-27 |
| FI882477A7 (fi) | 1988-11-30 |
| JPH0548221B2 (cg-RX-API-DMAC7.html) | 1993-07-20 |
| EP0292979B1 (en) | 1993-07-21 |
| US5034417A (en) | 1991-07-23 |
| AU1656588A (en) | 1988-12-01 |
| PH25181A (en) | 1991-03-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2012557C1 (ru) | Способ получения производных алкансульфонанилида или их фармацевтически приемлемых солей | |
| BR112018011518B1 (pt) | Método de produção de derivado de amida aromática | |
| HU200322B (en) | Process for producing new alkane sulfonanilide derivatives | |
| SU820661A3 (ru) | Способ получени производных1,2-бЕНзизОТиАзОлиНОНА-3 | |
| CH441366A (de) | Verfahren zur Herstellung von substituierten Hydrazinverbindungen | |
| US3632605A (en) | Pyrroline derivatives | |
| US4154734A (en) | Amides of 4-hydroxy-6H-thieno[2,3-b]thiopyran-5-carboxylic acid-7,7-dioxide | |
| US4046778A (en) | Processes for the preparation of 4-hydroxy-2H-1-benzothiopyran-3-carboxamide 1,1-dioxides | |
| US4007203A (en) | 4-(1-Pyrolidenyl)-2H-1-benzothiopyran-3-carboxanilide | |
| US5034410A (en) | Anthelmintically active benzenepropanamide derivatives | |
| US3294813A (en) | 2-(5-tetrazolyl)-nu-(substituted-phenyl) anilines and salts thereof | |
| DE2414613A1 (de) | 1-aryl-5-alkyliden-2,4-dioxo-imidazolidine | |
| CA2066203A1 (en) | Benzene derivatives substituted with heterocyclic ring, process for preparing same, and herbicides containing same as active ingredients | |
| RU2194705C2 (ru) | Способ получения 1,3-дизамещенных 4-оксоциклических мочевин | |
| DE1163802B (de) | Verfahren zur Herstellung von Sulfonyliminodithiokohlensaeureestern | |
| SU1754712A1 (ru) | N-(3-нитро-4-хлорфенилсульфонил)-антранилова кислота в качестве промежуточного продукта дл получени N-(4-хлорфенил)-2-[(3-нитро-4-хлорфенилсульфонил)-амино]-5-бромбензамида, обладающего противотрихоцефалезной активностью | |
| Corral et al. | Synthesis of 10‐aminophenothiazines and derivatives | |
| SU1587050A1 (ru) | Производные (7-бромбензо-2,1,3-тиадиазол-4-сульфонил)амина в качестве промежуточных продуктов в синтезе 2-[(7-бромбензо-2,1,3-тиадиазол-4-сульфонил)амино]-5-бром-N-(4-хлорфенил)бензамида, обладающего антигельминтной активностью | |
| EP0327981B1 (de) | Verfahren zur Herstellung von 2-Cyano-3-aminoacrylnitril-Derivaten | |
| EP1045848B1 (en) | Process for preparation of 2-aminothiazolecarboxamide derivatives | |
| US3828073A (en) | 4-hydroxy-2h-1-benzothiopyran-3-carboxamides and their corresponding s-oxides | |
| EP0842163B1 (de) | Benzolderivate mit einem heterocyclischen rest | |
| EP0440582A1 (de) | Verfahren zur Herstellung von O-substituierten Hydroxylaminen | |
| US3987095A (en) | N-substituted-1-(arylsulfinyl and arylsulfonyl)methanesulfonamides | |
| HU176254B (en) | Process for preparing substituted phenyl-guanidine derivatives |