PT1441734E - Di-hidroxipirimidinocarboxamidas inibidoras da integrase do vih - Google Patents
Di-hidroxipirimidinocarboxamidas inibidoras da integrase do vih Download PDFInfo
- Publication number
- PT1441734E PT1441734E PT02801949T PT02801949T PT1441734E PT 1441734 E PT1441734 E PT 1441734E PT 02801949 T PT02801949 T PT 02801949T PT 02801949 T PT02801949 T PT 02801949T PT 1441734 E PT1441734 E PT 1441734E
- Authority
- PT
- Portugal
- Prior art keywords
- alkyl
- carboxamide
- fluorobenzyl
- dihydroxy
- dihydroxypyrimidine
- Prior art date
Links
- 239000003112 inhibitor Substances 0.000 title claims abstract description 13
- 108010002459 HIV Integrase Proteins 0.000 title claims abstract description 11
- ZMCUTBQASJVWRX-UHFFFAOYSA-N 4-hydroxy-6-oxo-1H-pyrimidine-2-carboxamide Chemical compound OC1=CC(=NC(=N1)C(=O)N)O ZMCUTBQASJVWRX-UHFFFAOYSA-N 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 284
- 208000030507 AIDS Diseases 0.000 claims abstract description 91
- 150000003839 salts Chemical class 0.000 claims abstract description 80
- 208000031886 HIV Infections Diseases 0.000 claims abstract description 70
- 208000037357 HIV infectious disease Diseases 0.000 claims abstract description 68
- 208000033519 human immunodeficiency virus infectious disease Diseases 0.000 claims abstract description 68
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 14
- 239000003443 antiviral agent Substances 0.000 claims abstract description 9
- 230000002265 prevention Effects 0.000 claims abstract description 9
- 208000015181 infectious disease Diseases 0.000 claims abstract description 6
- -1 methylenedioxy Chemical group 0.000 claims description 565
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 claims description 248
- 125000001424 substituent group Chemical group 0.000 claims description 233
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 193
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 184
- 125000000217 alkyl group Chemical group 0.000 claims description 141
- 125000003118 aryl group Chemical group 0.000 claims description 122
- 125000005842 heteroatom Chemical group 0.000 claims description 120
- 229910052717 sulfur Inorganic materials 0.000 claims description 110
- 229910052760 oxygen Inorganic materials 0.000 claims description 108
- 229910052736 halogen Inorganic materials 0.000 claims description 107
- 150000002367 halogens Chemical class 0.000 claims description 102
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 102
- 125000000623 heterocyclic group Chemical group 0.000 claims description 99
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 95
- 125000001072 heteroaryl group Chemical group 0.000 claims description 89
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 68
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 67
- 125000004043 oxo group Chemical group O=* 0.000 claims description 59
- HKSQZEGSMBFHGC-UHFFFAOYSA-N pyrimidine-4-carboxamide Chemical compound NC(=O)C1=CC=NC=N1 HKSQZEGSMBFHGC-UHFFFAOYSA-N 0.000 claims description 59
- 125000002618 bicyclic heterocycle group Chemical group 0.000 claims description 57
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 54
- 229920006395 saturated elastomer Polymers 0.000 claims description 44
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 40
- 125000004432 carbon atom Chemical group C* 0.000 claims description 38
- 229910052757 nitrogen Inorganic materials 0.000 claims description 38
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 37
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 33
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 33
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 32
- 125000001246 bromo group Chemical group Br* 0.000 claims description 32
- 125000002619 bicyclic group Chemical group 0.000 claims description 29
- 125000001624 naphthyl group Chemical group 0.000 claims description 28
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 23
- 125000001153 fluoro group Chemical group F* 0.000 claims description 22
- 125000002950 monocyclic group Chemical group 0.000 claims description 18
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 18
- 125000004122 cyclic group Chemical group 0.000 claims description 17
- 125000001188 haloalkyl group Chemical group 0.000 claims description 17
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 16
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 15
- 125000004574 piperidin-2-yl group Chemical group N1C(CCCC1)* 0.000 claims description 15
- 125000006705 (C5-C7) cycloalkyl group Chemical group 0.000 claims description 13
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 13
- 229910052799 carbon Inorganic materials 0.000 claims description 13
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 12
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 11
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims description 11
- 102100034343 Integrase Human genes 0.000 claims description 11
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 11
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000003419 rna directed dna polymerase inhibitor Substances 0.000 claims description 10
- 239000003814 drug Substances 0.000 claims description 9
- 229910052701 rubidium Inorganic materials 0.000 claims description 9
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 claims description 8
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 8
- 230000000840 anti-viral effect Effects 0.000 claims description 8
- 150000001721 carbon Chemical group 0.000 claims description 8
- 125000000262 haloalkenyl group Chemical group 0.000 claims description 8
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 7
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 7
- 230000002401 inhibitory effect Effects 0.000 claims description 7
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 claims description 6
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 claims description 6
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 claims description 6
- 230000005764 inhibitory process Effects 0.000 claims description 6
- 125000002911 monocyclic heterocycle group Chemical group 0.000 claims description 6
- UWJXLUKXNKKSGD-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-5-hydroxy-2-(7-methyl-7-azabicyclo[2.2.1]heptan-4-yl)-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CN1C(CC2)CCC12C(N=1)=NC(O)=C(O)C=1C(=O)NCC1=CC=C(F)C=C1 UWJXLUKXNKKSGD-UHFFFAOYSA-N 0.000 claims description 6
- 239000002777 nucleoside Substances 0.000 claims description 6
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 6
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 claims description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 125000004429 atom Chemical group 0.000 claims description 5
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 5
- 150000003833 nucleoside derivatives Chemical class 0.000 claims description 5
- 229910052705 radium Inorganic materials 0.000 claims description 5
- JILMJJOGIMQFHV-UHFFFAOYSA-N 2-(1-benzoyl-2,3-dihydroindol-2-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound OC=1C(O)=NC(C2N(C3=CC=CC=C3C2)C(=O)C=2C=CC=CC=2)=NC=1C(=O)NCC1=CC=C(F)C=C1 JILMJJOGIMQFHV-UHFFFAOYSA-N 0.000 claims description 4
- LDIOKBUAEJYCKA-UHFFFAOYSA-N 2-[2-(cyclohexylmethylamino)-1-methoxypropan-2-yl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=NC=1C(C)(COC)NCC1CCCCC1 LDIOKBUAEJYCKA-UHFFFAOYSA-N 0.000 claims description 4
- 108010078851 HIV Reverse Transcriptase Proteins 0.000 claims description 4
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- 239000003937 drug carrier Substances 0.000 claims description 4
- 239000004030 hiv protease inhibitor Substances 0.000 claims description 4
- LFEJBNSZPNQXNF-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound OC1=NC=NC(C(=O)NCC=2C=CC(F)=CC=2)=C1O LFEJBNSZPNQXNF-UHFFFAOYSA-N 0.000 claims description 4
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 claims description 3
- GOEWCGSZKQDJSY-UHFFFAOYSA-N 2-(3-acetyl-1,3-thiazolidin-2-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CC(=O)N1CCSC1C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 GOEWCGSZKQDJSY-UHFFFAOYSA-N 0.000 claims description 3
- SRCNEXKTBGMIJT-UHFFFAOYSA-N 2-[4-(diethylaminomethyl)phenyl]-n-[(2,3-dimethoxyphenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound C1=CC(CN(CC)CC)=CC=C1C1=NC(O)=C(O)C(C(=O)NCC=2C(=C(OC)C=CC=2)OC)=N1 SRCNEXKTBGMIJT-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- UYPPRFUPWGFUSM-UHFFFAOYSA-N n-[(2-chlorophenyl)methyl]-2-[2-(dimethylamino)propan-2-yl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CN(C)C(C)(C)C1=NC(O)=C(O)C(C(=O)NCC=2C(=CC=CC=2)Cl)=N1 UYPPRFUPWGFUSM-UHFFFAOYSA-N 0.000 claims description 3
- OZIOVYNGGNOHJN-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-5-hydroxy-2-(2-morpholin-4-ylpropan-2-yl)-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=NC=1C(C)(C)N1CCOCC1 OZIOVYNGGNOHJN-UHFFFAOYSA-N 0.000 claims description 3
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 2
- 125000006650 (C2-C4) alkynyl group Chemical group 0.000 claims description 2
- 125000006569 (C5-C6) heterocyclic group Chemical group 0.000 claims description 2
- BPSJQMWOCFUFNY-UHFFFAOYSA-N 2-(1-acetamido-2-methoxyethyl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound COCC(NC(C)=O)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 BPSJQMWOCFUFNY-UHFFFAOYSA-N 0.000 claims description 2
- YYFXVAQXNVQXRY-UHFFFAOYSA-N 2-(1-acetamidocyclohexyl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=NC=1C1(NC(=O)C)CCCCC1 YYFXVAQXNVQXRY-UHFFFAOYSA-N 0.000 claims description 2
- ZJNVQCQCAACIOY-UHFFFAOYSA-N 2-(1-acetyl-2,4-dimethylpiperazin-2-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound C1N(C)CCN(C(C)=O)C1(C)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 ZJNVQCQCAACIOY-UHFFFAOYSA-N 0.000 claims description 2
- OZQLTBGFEMVVPY-UHFFFAOYSA-N 2-(1-acetyl-2-methylpiperidin-2-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CC(=O)N1CCCCC1(C)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 OZQLTBGFEMVVPY-UHFFFAOYSA-N 0.000 claims description 2
- FNHSMRCCFZZPOM-UHFFFAOYSA-N 2-(1-acetyl-4-phenylmethoxypiperidin-2-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CC(=O)N1CCC(OCC=2C=CC=CC=2)CC1C(N=1)=NC(O)=C(O)C=1C(=O)NCC1=CC=C(F)C=C1 FNHSMRCCFZZPOM-UHFFFAOYSA-N 0.000 claims description 2
- QMVDQPYTAXMPMU-UHFFFAOYSA-N 2-(1-amino-2-methoxyethyl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound COCC(N)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 QMVDQPYTAXMPMU-UHFFFAOYSA-N 0.000 claims description 2
- IWCXYNGHLQKISB-UHFFFAOYSA-N 2-(1-amino-2-phenylethyl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=NC=1C(N)CC1=CC=CC=C1 IWCXYNGHLQKISB-UHFFFAOYSA-N 0.000 claims description 2
- GPOXEULGYOPJPH-UHFFFAOYSA-N 2-(1-aminocyclopentyl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=NC=1C1(N)CCCC1 GPOXEULGYOPJPH-UHFFFAOYSA-N 0.000 claims description 2
- RXUSCVUJWNXOBJ-UHFFFAOYSA-N 2-(1-aminocyclopropyl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=NC=1C1(N)CC1 RXUSCVUJWNXOBJ-UHFFFAOYSA-N 0.000 claims description 2
- ONVKTXFUNUDZCR-UHFFFAOYSA-N 2-(1-benzoyl-3,4-dihydro-2h-quinolin-2-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound OC=1C(O)=NC(C2N(C3=CC=CC=C3CC2)C(=O)C=2C=CC=CC=2)=NC=1C(=O)NCC1=CC=C(F)C=C1 ONVKTXFUNUDZCR-UHFFFAOYSA-N 0.000 claims description 2
- FDVINLRMZUFLME-UHFFFAOYSA-N 2-(1-benzoyl-4-methylpiperazin-2-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound C1N(C)CCN(C(=O)C=2C=CC=CC=2)C1C(N=1)=NC(O)=C(O)C=1C(=O)NCC1=CC=C(F)C=C1 FDVINLRMZUFLME-UHFFFAOYSA-N 0.000 claims description 2
- WIPKOECLXGDYLS-UHFFFAOYSA-N 2-(1-benzoylpiperidin-2-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound OC=1C(O)=NC(C2N(CCCC2)C(=O)C=2C=CC=CC=2)=NC=1C(=O)NCC1=CC=C(F)C=C1 WIPKOECLXGDYLS-UHFFFAOYSA-N 0.000 claims description 2
- JGTQENIZDSKSJL-UHFFFAOYSA-N 2-(1-benzoylpyrrolidin-2-yl)-n-[(2,3-dimethoxyphenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound COC1=CC=CC(CNC(=O)C=2C(=C(O)N=C(N=2)C2N(CCC2)C(=O)C=2C=CC=CC=2)O)=C1OC JGTQENIZDSKSJL-UHFFFAOYSA-N 0.000 claims description 2
- GCKLTKKFPAOKQL-UHFFFAOYSA-N 2-(1-benzoylpyrrolidin-2-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound OC=1C(O)=NC(C2N(CCC2)C(=O)C=2C=CC=CC=2)=NC=1C(=O)NCC1=CC=C(F)C=C1 GCKLTKKFPAOKQL-UHFFFAOYSA-N 0.000 claims description 2
- GQIGTZDPGNPIAA-UHFFFAOYSA-N 2-(1-benzylpiperidin-2-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound OC=1C(O)=NC(C2N(CCCC2)CC=2C=CC=CC=2)=NC=1C(=O)NCC1=CC=C(F)C=C1 GQIGTZDPGNPIAA-UHFFFAOYSA-N 0.000 claims description 2
- SOENVEQCDQWQKD-UHFFFAOYSA-N 2-(1-ethyl-4-methylpiperazin-2-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CCN1CCN(C)CC1C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 SOENVEQCDQWQKD-UHFFFAOYSA-N 0.000 claims description 2
- CCIDCSNKRNVVRH-UHFFFAOYSA-N 2-(1-ethylpiperidin-2-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CCN1CCCCC1C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 CCIDCSNKRNVVRH-UHFFFAOYSA-N 0.000 claims description 2
- LRDYUVZWEPOABJ-UHFFFAOYSA-N 2-(2-aminopropan-2-yl)-n-[(4-fluoro-2-methylsulfonylphenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CC(C)(N)C1=NC(O)=C(O)C(C(=O)NCC=2C(=CC(F)=CC=2)S(C)(=O)=O)=N1 LRDYUVZWEPOABJ-UHFFFAOYSA-N 0.000 claims description 2
- ZUSYMDKLSWHVGX-UHFFFAOYSA-N 2-(2-benzamidopropan-2-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=NC=1C(C)(C)NC(=O)C1=CC=CC=C1 ZUSYMDKLSWHVGX-UHFFFAOYSA-N 0.000 claims description 2
- XXHQSISROYNPGC-UHFFFAOYSA-N 2-(2-benzoyl-3,4-dihydro-1h-isoquinolin-3-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound OC=1C(O)=NC(C2N(CC3=CC=CC=C3C2)C(=O)C=2C=CC=CC=2)=NC=1C(=O)NCC1=CC=C(F)C=C1 XXHQSISROYNPGC-UHFFFAOYSA-N 0.000 claims description 2
- LIVLQOXYCYKQEQ-UHFFFAOYSA-N 2-(4-acetyl-1,2-dimethylpiperazin-2-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CN1CCN(C(C)=O)CC1(C)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 LIVLQOXYCYKQEQ-UHFFFAOYSA-N 0.000 claims description 2
- UNPJAMIEBDZGNF-UHFFFAOYSA-N 2-(4-benzyl-1-methylpiperazin-2-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound C1C(C=2N=C(C(O)=C(O)N=2)C(=O)NCC=2C=CC(F)=CC=2)N(C)CCN1CC1=CC=CC=C1 UNPJAMIEBDZGNF-UHFFFAOYSA-N 0.000 claims description 2
- SBIYYVJSOYQJRM-UHFFFAOYSA-N 2-(4-benzylmorpholin-3-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound OC=1C(O)=NC(C2N(CCOC2)CC=2C=CC=CC=2)=NC=1C(=O)NCC1=CC=C(F)C=C1 SBIYYVJSOYQJRM-UHFFFAOYSA-N 0.000 claims description 2
- RBCJAIJCBUFFCN-UHFFFAOYSA-N 2-(7-acetyl-7-azabicyclo[2.2.1]heptan-4-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CC(=O)N1C(CC2)CCC12C(N=1)=NC(O)=C(O)C=1C(=O)NCC1=CC=C(F)C=C1 RBCJAIJCBUFFCN-UHFFFAOYSA-N 0.000 claims description 2
- VSANFJNPTKNGGX-IBGZPJMESA-N 2-[(2s)-1-acetyl-2-methylpyrrolidin-2-yl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CC(=O)N1CCC[C@@]1(C)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 VSANFJNPTKNGGX-IBGZPJMESA-N 0.000 claims description 2
- ZAGAWYAOXNLTNW-RPWUZVMVSA-N 2-[(2s,4r)-1-benzoyl-4-phenylmethoxypyrrolidin-2-yl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound OC=1C(O)=NC([C@H]2N(C[C@@H](C2)OCC=2C=CC=CC=2)C(=O)C=2C=CC=CC=2)=NC=1C(=O)NCC1=CC=C(F)C=C1 ZAGAWYAOXNLTNW-RPWUZVMVSA-N 0.000 claims description 2
- SSAYTRLKHCRIJC-UHFFFAOYSA-N 2-[1-(3-chlorobenzoyl)-4-methylpiperazin-2-yl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound C1N(C)CCN(C(=O)C=2C=C(Cl)C=CC=2)C1C(N=1)=NC(O)=C(O)C=1C(=O)NCC1=CC=C(F)C=C1 SSAYTRLKHCRIJC-UHFFFAOYSA-N 0.000 claims description 2
- LHWLKXHFOJYHTR-UHFFFAOYSA-N 2-[1-(dimethylamino)-2-methoxyethyl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound COCC(N(C)C)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 LHWLKXHFOJYHTR-UHFFFAOYSA-N 0.000 claims description 2
- MDBZIQZRFLMPQL-UHFFFAOYSA-N 2-[1-(dimethylamino)-2-phenylethyl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=NC=1C(N(C)C)CC1=CC=CC=C1 MDBZIQZRFLMPQL-UHFFFAOYSA-N 0.000 claims description 2
- ORROWUDOULVDMN-UHFFFAOYSA-N 2-[1-(dimethylamino)cyclohexyl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=NC=1C1(N(C)C)CCCCC1 ORROWUDOULVDMN-UHFFFAOYSA-N 0.000 claims description 2
- XOXCGQGZROKGSE-UHFFFAOYSA-N 2-[1-(dimethylamino)cyclopentyl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=NC=1C1(N(C)C)CCCC1 XOXCGQGZROKGSE-UHFFFAOYSA-N 0.000 claims description 2
- RDEJAKABTUFKCC-UHFFFAOYSA-N 2-[1-(dimethylamino)cyclopropyl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=NC=1C1(N(C)C)CC1 RDEJAKABTUFKCC-UHFFFAOYSA-N 0.000 claims description 2
- YNHCPFIPUYWTMF-UHFFFAOYSA-N 2-[1-[2-(dimethylamino)acetyl]piperidin-2-yl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CN(C)CC(=O)N1CCCCC1C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 YNHCPFIPUYWTMF-UHFFFAOYSA-N 0.000 claims description 2
- VFMFLUJKDPHHOJ-UHFFFAOYSA-N 2-[1-benzoyl-4-[2-(dimethylamino)acetyl]piperazin-2-yl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound C1N(C(=O)CN(C)C)CCN(C(=O)C=2C=CC=CC=2)C1C(N=1)=NC(O)=C(O)C=1C(=O)NCC1=CC=C(F)C=C1 VFMFLUJKDPHHOJ-UHFFFAOYSA-N 0.000 claims description 2
- HJVVPRFMGAXBBU-UHFFFAOYSA-N 2-[2,4-dimethyl-1-(pyrazine-2-carbonyl)piperazin-2-yl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=NC=1C1(C)CN(C)CCN1C(=O)C1=CN=CC=N1 HJVVPRFMGAXBBU-UHFFFAOYSA-N 0.000 claims description 2
- RRCRJINQPBQCTE-UHFFFAOYSA-N 2-[2-(benzylamino)propan-2-yl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=NC=1C(C)(C)NCC1=CC=CC=C1 RRCRJINQPBQCTE-UHFFFAOYSA-N 0.000 claims description 2
- XVMDRYMHVXBQJJ-UHFFFAOYSA-N 2-[2-(diethylamino)propan-2-yl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CCN(CC)C(C)(C)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 XVMDRYMHVXBQJJ-UHFFFAOYSA-N 0.000 claims description 2
- KGQNIYANRJZBMK-UHFFFAOYSA-N 2-[2-(dimethylamino)-1-methoxypropan-2-yl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound COCC(C)(N(C)C)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 KGQNIYANRJZBMK-UHFFFAOYSA-N 0.000 claims description 2
- AYVJOZSHFYTOFL-UHFFFAOYSA-N 2-[2-(dimethylamino)propan-2-yl]-n-[(2-ethoxyphenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CCOC1=CC=CC=C1CNC(=O)C1=NC(C(C)(C)N(C)C)=NC(O)=C1O AYVJOZSHFYTOFL-UHFFFAOYSA-N 0.000 claims description 2
- FFSPADXXZZKMRW-UHFFFAOYSA-N 2-[2-(dimethylamino)propan-2-yl]-n-[(4-fluoro-2-methylsulfonylphenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CN(C)C(C)(C)C1=NC(O)=C(O)C(C(=O)NCC=2C(=CC(F)=CC=2)S(C)(=O)=O)=N1 FFSPADXXZZKMRW-UHFFFAOYSA-N 0.000 claims description 2
- LISAKYCVZZAOKQ-UHFFFAOYSA-N 2-[2-(ethylcarbamoylamino)propan-2-yl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CCNC(=O)NC(C)(C)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 LISAKYCVZZAOKQ-UHFFFAOYSA-N 0.000 claims description 2
- BXJHDHIQZFYDQA-UHFFFAOYSA-N 2-[2-[2-(dimethylamino)acetyl]-3,4-dihydro-1h-isoquinolin-3-yl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CN(C)CC(=O)N1CC2=CC=CC=C2CC1C(N=1)=NC(O)=C(O)C=1C(=O)NCC1=CC=C(F)C=C1 BXJHDHIQZFYDQA-UHFFFAOYSA-N 0.000 claims description 2
- JJKYFXHNCNXYTG-UHFFFAOYSA-N 2-[2-[benzyl(methyl)amino]propan-2-yl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=NC=1C(C)(C)N(C)CC1=CC=CC=C1 JJKYFXHNCNXYTG-UHFFFAOYSA-N 0.000 claims description 2
- BYAYOQKXFJUFRC-UHFFFAOYSA-N 2-[4-(dimethylamino)oxan-4-yl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=NC=1C1(N(C)C)CCOCC1 BYAYOQKXFJUFRC-UHFFFAOYSA-N 0.000 claims description 2
- UZLXRTMZCDWLSY-UHFFFAOYSA-N 4-oxo-1h-pyrimidine-6-carboxamide Chemical compound NC(=O)C1=CC(=O)NC=N1 UZLXRTMZCDWLSY-UHFFFAOYSA-N 0.000 claims description 2
- 108010092799 RNA-directed DNA polymerase Proteins 0.000 claims description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 2
- 230000036436 anti-hiv Effects 0.000 claims description 2
- JMFVWNKPLURQMI-UHFFFAOYSA-N cyclopentyl carbamate Chemical compound NC(=O)OC1CCCC1 JMFVWNKPLURQMI-UHFFFAOYSA-N 0.000 claims description 2
- AKXQXLDIVXPBFH-UHFFFAOYSA-N n-[(2,3-dimethoxyphenyl)methyl]-2-(1,2-dimethylpiperidin-2-yl)-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound COC1=CC=CC(CNC(=O)C=2C(=C(O)N=C(N=2)C2(C)N(CCCC2)C)O)=C1OC AKXQXLDIVXPBFH-UHFFFAOYSA-N 0.000 claims description 2
- VLQHHECTQBNDOQ-UHFFFAOYSA-N n-[(2,3-dimethoxyphenyl)methyl]-2-[1-[2-(dimethylamino)acetyl]piperidin-2-yl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound COC1=CC=CC(CNC(=O)C=2C(=C(O)N=C(N=2)C2N(CCCC2)C(=O)CN(C)C)O)=C1OC VLQHHECTQBNDOQ-UHFFFAOYSA-N 0.000 claims description 2
- ZLXIKTBVSSRIBK-UHFFFAOYSA-N n-[(3-bromo-4-fluorophenyl)methyl]-2-[2-(dimethylamino)propan-2-yl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CN(C)C(C)(C)C1=NC(O)=C(O)C(C(=O)NCC=2C=C(Br)C(F)=CC=2)=N1 ZLXIKTBVSSRIBK-UHFFFAOYSA-N 0.000 claims description 2
- PLKRHIVQWVWLER-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-2-(1-formamido-2-methoxyethyl)-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound COCC(NC=O)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 PLKRHIVQWVWLER-UHFFFAOYSA-N 0.000 claims description 2
- JNAAWILZJQMWIF-UXHICEINSA-N n-[(4-fluorophenyl)methyl]-5-hydroxy-2-[(2s,4r)-1-methyl-4-phenylmethoxypiperidin-2-yl]-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C([C@@H]2C[C@@H](CCN2C)OCC=2C=CC=CC=2)=NC(O)=C(O)C=1C(=O)NCC1=CC=C(F)C=C1 JNAAWILZJQMWIF-UXHICEINSA-N 0.000 claims description 2
- PYPHGZUHAPCWCP-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-2-[1-(phenylcarbamoyl)piperidin-2-yl]-1h-pyrimidine-6-carboxamide Chemical compound OC=1C(O)=NC(C2N(CCCC2)C(=O)NC=2C=CC=CC=2)=NC=1C(=O)NCC1=CC=C(F)C=C1 PYPHGZUHAPCWCP-UHFFFAOYSA-N 0.000 claims description 2
- JZZYHJZLQMOBDJ-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-2-thiomorpholin-3-yl-1h-pyrimidine-6-carboxamide Chemical compound OC=1C(O)=NC(C2NCCSC2)=NC=1C(=O)NCC1=CC=C(F)C=C1 JZZYHJZLQMOBDJ-UHFFFAOYSA-N 0.000 claims description 2
- GGNWYGMXUCMOTP-UHFFFAOYSA-N tert-butyl n-[1-[6-[(4-fluorophenyl)methylcarbamoyl]-5-hydroxy-4-oxo-1h-pyrimidin-2-yl]-2-methoxyethyl]carbamate Chemical compound CC(C)(C)OC(=O)NC(COC)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 GGNWYGMXUCMOTP-UHFFFAOYSA-N 0.000 claims description 2
- HMDRFBDRCNKGFM-UHFFFAOYSA-N tert-butyl n-[2-[6-[(4-fluorophenyl)methylcarbamoyl]-5-hydroxy-4-oxo-1h-pyrimidin-2-yl]-1-methoxypropan-2-yl]carbamate Chemical compound CC(C)(C)OC(=O)NC(C)(COC)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 HMDRFBDRCNKGFM-UHFFFAOYSA-N 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 2
- DWCBYHSUKCYVPJ-UHFFFAOYSA-N 2-(1,2-dimethylpiperidin-2-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CN1CCCCC1(C)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 DWCBYHSUKCYVPJ-UHFFFAOYSA-N 0.000 claims 1
- SZPJOJZYYJQFHE-UHFFFAOYSA-N 2-(2-acetamidopropan-2-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CC(=O)NC(C)(C)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 SZPJOJZYYJQFHE-UHFFFAOYSA-N 0.000 claims 1
- CFELPQKWHKBOBV-UHFFFAOYSA-N 2-(2-amino-1-methoxypropan-2-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound COCC(C)(N)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 CFELPQKWHKBOBV-UHFFFAOYSA-N 0.000 claims 1
- KCVVTCKVFNVRNY-UHFFFAOYSA-N 2-[1-[[2-(dimethylamino)acetyl]amino]-2-phenylethyl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=NC=1C(NC(=O)CN(C)C)CC1=CC=CC=C1 KCVVTCKVFNVRNY-UHFFFAOYSA-N 0.000 claims 1
- GEPHWOLICGIQLC-UHFFFAOYSA-N 2-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propan-2-yl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=NC=1C(C)(C)N(CC1)CCC21OCCO2 GEPHWOLICGIQLC-UHFFFAOYSA-N 0.000 claims 1
- WDIHLPRBTQAXPZ-UHFFFAOYSA-N 2-[2-[4-(dimethylamino)piperidin-1-yl]propan-2-yl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound C1CC(N(C)C)CCN1C(C)(C)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 WDIHLPRBTQAXPZ-UHFFFAOYSA-N 0.000 claims 1
- XQLOUFZQHGRQRR-UHFFFAOYSA-N 2-[2-[acetyl(methyl)amino]-1-methoxypropan-2-yl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound COCC(C)(N(C)C(C)=O)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 XQLOUFZQHGRQRR-UHFFFAOYSA-N 0.000 claims 1
- HVPAJBSOGTVLTI-UHFFFAOYSA-N 2-[2-[cyclohexylmethyl(methyl)amino]-1-methoxypropan-2-yl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=NC=1C(C)(COC)N(C)CC1CCCCC1 HVPAJBSOGTVLTI-UHFFFAOYSA-N 0.000 claims 1
- 125000004438 haloalkoxy group Chemical group 0.000 claims 1
- OPLQOMFKCXWVET-UHFFFAOYSA-N n-[(2,3-dimethoxyphenyl)methyl]-2-[2-(dimethylamino)propan-2-yl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound COC1=CC=CC(CNC(=O)C=2C(=C(O)N=C(N=2)C(C)(C)N(C)C)O)=C1OC OPLQOMFKCXWVET-UHFFFAOYSA-N 0.000 claims 1
- 125000003835 nucleoside group Chemical group 0.000 claims 1
- 238000000034 method Methods 0.000 abstract description 53
- 230000010076 replication Effects 0.000 abstract description 8
- 239000004615 ingredient Substances 0.000 abstract description 6
- 239000002955 immunomodulating agent Substances 0.000 abstract description 5
- 229960005486 vaccine Drugs 0.000 abstract description 5
- 229940121354 immunomodulator Drugs 0.000 abstract description 4
- UAMMIALSNIFKRY-UHFFFAOYSA-N 5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical class NC(=O)C1=NC=NC(O)=C1O UAMMIALSNIFKRY-UHFFFAOYSA-N 0.000 abstract description 3
- 239000003242 anti bacterial agent Substances 0.000 abstract description 2
- 229940088710 antibiotic agent Drugs 0.000 abstract description 2
- 229940042443 other antivirals in atc Drugs 0.000 abstract description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 206
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 143
- 239000000243 solution Substances 0.000 description 95
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 87
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 74
- 238000004949 mass spectrometry Methods 0.000 description 59
- 206010001513 AIDS related complex Diseases 0.000 description 58
- 239000000203 mixture Substances 0.000 description 50
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 49
- 239000007787 solid Substances 0.000 description 49
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 47
- 238000005481 NMR spectroscopy Methods 0.000 description 45
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 44
- 241000725303 Human immunodeficiency virus Species 0.000 description 39
- BXDZOYLPNAIDOC-UHFFFAOYSA-N N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-1-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethyl]piperidine-4-carboxamide Chemical compound CC(C)(C)c1cnc(CSc2cnc(NC(=O)C3CCN(CC(=O)NCCOCCOCCOCCNc4cccc5C(=O)N(C6CCC(=O)NC6=O)C(=O)c45)CC3)s2)o1 BXDZOYLPNAIDOC-UHFFFAOYSA-N 0.000 description 32
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 31
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 31
- 235000019439 ethyl acetate Nutrition 0.000 description 29
- 239000000047 product Substances 0.000 description 29
- 238000005160 1H NMR spectroscopy Methods 0.000 description 28
- 239000011541 reaction mixture Substances 0.000 description 28
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 27
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 26
- 238000002360 preparation method Methods 0.000 description 26
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 25
- 238000006243 chemical reaction Methods 0.000 description 22
- 239000002904 solvent Substances 0.000 description 22
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 21
- 229910001868 water Inorganic materials 0.000 description 21
- 239000012043 crude product Substances 0.000 description 20
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical group CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 19
- VFQXVTODMYMSMJ-UHFFFAOYSA-N isonicotinamide Chemical compound NC(=O)C1=CC=NC=C1 VFQXVTODMYMSMJ-UHFFFAOYSA-N 0.000 description 19
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 17
- 238000001704 evaporation Methods 0.000 description 17
- 230000008020 evaporation Effects 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- IIFVWLUQBAIPMJ-UHFFFAOYSA-N (4-fluorophenyl)methanamine Chemical compound NCC1=CC=C(F)C=C1 IIFVWLUQBAIPMJ-UHFFFAOYSA-N 0.000 description 16
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 16
- 239000012267 brine Substances 0.000 description 16
- 238000001914 filtration Methods 0.000 description 16
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 16
- 230000015572 biosynthetic process Effects 0.000 description 15
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 13
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 13
- 239000003480 eluent Substances 0.000 description 13
- VFRSADQPWYCXDG-LEUCUCNGSA-N ethyl (2s,5s)-5-methylpyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CCOC(=O)[C@@H]1CC[C@H](C)N1 VFRSADQPWYCXDG-LEUCUCNGSA-N 0.000 description 13
- 125000003709 fluoroalkyl group Chemical group 0.000 description 13
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 13
- 150000001412 amines Chemical class 0.000 description 12
- 239000003208 petroleum Substances 0.000 description 12
- 239000003795 chemical substances by application Substances 0.000 description 11
- 238000003818 flash chromatography Methods 0.000 description 11
- 125000000714 pyrimidinyl group Chemical group 0.000 description 11
- 238000004007 reversed phase HPLC Methods 0.000 description 11
- 238000003786 synthesis reaction Methods 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- 150000001408 amides Chemical class 0.000 description 10
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 10
- 125000004076 pyridyl group Chemical group 0.000 description 10
- 239000011734 sodium Substances 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- HBOMLICNUCNMMY-XLPZGREQSA-N zidovudine Chemical compound O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](CO)[C@@H](N=[N+]=[N-])C1 HBOMLICNUCNMMY-XLPZGREQSA-N 0.000 description 10
- 108010061833 Integrases Proteins 0.000 description 9
- SECXISVLQFMRJM-UHFFFAOYSA-N NMP Substances CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 9
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 9
- 239000012044 organic layer Substances 0.000 description 9
- 239000000843 powder Substances 0.000 description 9
- 239000003039 volatile agent Substances 0.000 description 9
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 8
- 239000002253 acid Substances 0.000 description 8
- VHILMKFSCRWWIJ-UHFFFAOYSA-N dimethyl acetylenedicarboxylate Chemical compound COC(=O)C#CC(=O)OC VHILMKFSCRWWIJ-UHFFFAOYSA-N 0.000 description 8
- 150000003840 hydrochlorides Chemical class 0.000 description 8
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 7
- 125000006509 3,4-difluorobenzyl group Chemical group [H]C1=C(F)C(F)=C([H])C(=C1[H])C([H])([H])* 0.000 description 7
- 125000006497 3-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 description 7
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 7
- 238000007792 addition Methods 0.000 description 7
- 238000003556 assay Methods 0.000 description 7
- 150000003857 carboxamides Chemical class 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 7
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 7
- 125000000842 isoxazolyl group Chemical group 0.000 description 7
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 7
- 125000006239 protecting group Chemical group 0.000 description 7
- 159000000000 sodium salts Chemical class 0.000 description 7
- 229960002555 zidovudine Drugs 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 6
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 6
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- WREGKURFCTUGRC-POYBYMJQSA-N Zalcitabine Chemical compound O=C1N=C(N)C=CN1[C@@H]1O[C@H](CO)CC1 WREGKURFCTUGRC-POYBYMJQSA-N 0.000 description 6
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 6
- 125000004193 piperazinyl group Chemical group 0.000 description 6
- 125000003386 piperidinyl group Chemical group 0.000 description 6
- 238000002953 preparative HPLC Methods 0.000 description 6
- 238000000746 purification Methods 0.000 description 6
- 125000003373 pyrazinyl group Chemical group 0.000 description 6
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 125000000335 thiazolyl group Chemical group 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- 229910004809 Na2 SO4 Inorganic materials 0.000 description 5
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 5
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- 229960005475 antiinfective agent Drugs 0.000 description 5
- 201000010099 disease Diseases 0.000 description 5
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 5
- XPOQHMRABVBWPR-ZDUSSCGKSA-N efavirenz Chemical compound C([C@]1(C2=CC(Cl)=CC=C2NC(=O)O1)C(F)(F)F)#CC1CC1 XPOQHMRABVBWPR-ZDUSSCGKSA-N 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 125000005843 halogen group Chemical group 0.000 description 5
- 125000002632 imidazolidinyl group Chemical group 0.000 description 5
- 125000002883 imidazolyl group Chemical group 0.000 description 5
- 125000001041 indolyl group Chemical group 0.000 description 5
- 125000001786 isothiazolyl group Chemical group 0.000 description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 5
- 125000002757 morpholinyl group Chemical group 0.000 description 5
- 125000002971 oxazolyl group Chemical group 0.000 description 5
- 229910052763 palladium Inorganic materials 0.000 description 5
- 125000000168 pyrrolyl group Chemical group 0.000 description 5
- 230000002829 reductive effect Effects 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 125000001113 thiadiazolyl group Chemical group 0.000 description 5
- 125000001544 thienyl group Chemical group 0.000 description 5
- 125000001425 triazolyl group Chemical group 0.000 description 5
- ZBNZAJFNDPPMDT-UHFFFAOYSA-N 1h-imidazole-5-carboxamide Chemical compound NC(=O)C1=CNC=N1 ZBNZAJFNDPPMDT-UHFFFAOYSA-N 0.000 description 4
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 4
- IQEPRBDBRZZHBI-UHFFFAOYSA-N 2-[2-(dimethylamino)propan-2-yl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CN(C)C(C)(C)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 IQEPRBDBRZZHBI-UHFFFAOYSA-N 0.000 description 4
- 125000002927 2-methoxybenzyl group Chemical group [H]C1=C([H])C([H])=C(C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 description 4
- OTCGLOYIDBJUNY-UHFFFAOYSA-N 2-o-ethyl 6-o-methyl 5-hydroxy-4-oxo-1h-pyrimidine-2,6-dicarboxylate Chemical compound CCOC(=O)C1=NC(O)=C(O)C(C(=O)OC)=N1 OTCGLOYIDBJUNY-UHFFFAOYSA-N 0.000 description 4
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 4
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 4
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 4
- 125000004195 4-methylpiperazin-1-yl group Chemical group [H]C([H])([H])N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 4
- 239000005711 Benzoic acid Substances 0.000 description 4
- 206010048843 Cytomegalovirus chorioretinitis Diseases 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- 239000007832 Na2SO4 Substances 0.000 description 4
- 229940122313 Nucleoside reverse transcriptase inhibitor Drugs 0.000 description 4
- XNKLLVCARDGLGL-JGVFFNPUSA-N Stavudine Chemical compound O=C1NC(=O)C(C)=CN1[C@H]1C=C[C@@H](CO)O1 XNKLLVCARDGLGL-JGVFFNPUSA-N 0.000 description 4
- 108020005202 Viral DNA Proteins 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 125000003342 alkenyl group Chemical group 0.000 description 4
- YMARZQAQMVYCKC-OEMFJLHTSA-N amprenavir Chemical compound C([C@@H]([C@H](O)CN(CC(C)C)S(=O)(=O)C=1C=CC(N)=CC=1)NC(=O)O[C@@H]1COCC1)C1=CC=CC=C1 YMARZQAQMVYCKC-OEMFJLHTSA-N 0.000 description 4
- 239000004599 antimicrobial Substances 0.000 description 4
- AXRYRYVKAWYZBR-GASGPIRDSA-N atazanavir Chemical compound C([C@H](NC(=O)[C@@H](NC(=O)OC)C(C)(C)C)[C@@H](O)CN(CC=1C=CC(=CC=1)C=1N=CC=CC=1)NC(=O)[C@@H](NC(=O)OC)C(C)(C)C)C1=CC=CC=C1 AXRYRYVKAWYZBR-GASGPIRDSA-N 0.000 description 4
- 235000010233 benzoic acid Nutrition 0.000 description 4
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 description 4
- 230000037396 body weight Effects 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 210000004027 cell Anatomy 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 239000013058 crude material Substances 0.000 description 4
- 239000010779 crude oil Substances 0.000 description 4
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 4
- 208000001763 cytomegalovirus retinitis Diseases 0.000 description 4
- MLILORUFDVLTSP-UHFFFAOYSA-N emivirine Chemical compound O=C1NC(=O)N(COCC)C(CC=2C=CC=CC=2)=C1C(C)C MLILORUFDVLTSP-UHFFFAOYSA-N 0.000 description 4
- 125000002541 furyl group Chemical group 0.000 description 4
- YCOFIMLTTJWGAA-UHFFFAOYSA-N methyl 2-[1,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-2-yl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxylate Chemical compound OC1=C(O)C(C(=O)OC)=NC(C2(C)N(CCN(C2)C(=O)OC(C)(C)C)C)=N1 YCOFIMLTTJWGAA-UHFFFAOYSA-N 0.000 description 4
- DLIFRYZDDRKYOQ-UHFFFAOYSA-N methyl 5,6-dibenzoyloxy-2-benzylpyrimidine-4-carboxylate Chemical compound N=1C(OC(=O)C=2C=CC=CC=2)=C(OC(=O)C=2C=CC=CC=2)C(C(=O)OC)=NC=1CC1=CC=CC=C1 DLIFRYZDDRKYOQ-UHFFFAOYSA-N 0.000 description 4
- 150000004702 methyl esters Chemical class 0.000 description 4
- DXASQZJWWGZNSF-UHFFFAOYSA-N n,n-dimethylmethanamine;sulfur trioxide Chemical group CN(C)C.O=S(=O)=O DXASQZJWWGZNSF-UHFFFAOYSA-N 0.000 description 4
- 125000001715 oxadiazolyl group Chemical group 0.000 description 4
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 4
- 239000001103 potassium chloride Substances 0.000 description 4
- 235000011164 potassium chloride Nutrition 0.000 description 4
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 4
- 125000003226 pyrazolyl group Chemical group 0.000 description 4
- 125000002098 pyridazinyl group Chemical group 0.000 description 4
- KOKRNJHOIOQUES-UHFFFAOYSA-N pyrimidine-4-carboxamide hydrochloride Chemical compound Cl.N1=CN=C(C=C1)C(=O)N KOKRNJHOIOQUES-UHFFFAOYSA-N 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 4
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 4
- 125000003831 tetrazolyl group Chemical group 0.000 description 4
- 125000001984 thiazolidinyl group Chemical group 0.000 description 4
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 4
- 239000008096 xylene Substances 0.000 description 4
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 3
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 3
- DTLWDWDGLWHAST-UHFFFAOYSA-N 2-(1,2-dimethylpiperazin-2-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CN1CCNCC1(C)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 DTLWDWDGLWHAST-UHFFFAOYSA-N 0.000 description 3
- ZQWFCGQRFFJNCU-UHFFFAOYSA-N 2-[4-(dimethylamino)oxan-4-yl]-n-[(4-fluoro-2-methylsulfonylphenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C(O)=C(O)C(C(=O)NCC=2C(=CC(F)=CC=2)S(C)(=O)=O)=NC=1C1(N(C)C)CCOCC1 ZQWFCGQRFFJNCU-UHFFFAOYSA-N 0.000 description 3
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 3
- 125000002774 3,4-dimethoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 3
- 125000006185 3,4-dimethyl benzyl group Chemical group [H]C1=C(C([H])=C(C(=C1[H])C([H])([H])[H])C([H])([H])[H])C([H])([H])* 0.000 description 3
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 3
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 3
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 3
- UBNDVWFVCJDAMO-UHFFFAOYSA-N 7-phenylmethoxycarbonyl-7-azabicyclo[2.2.1]heptane-4-carboxylic acid Chemical compound C1CC2(C(=O)O)CCC1N2C(=O)OCC1=CC=CC=C1 UBNDVWFVCJDAMO-UHFFFAOYSA-N 0.000 description 3
- 108010019625 Atazanavir Sulfate Proteins 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 206010011831 Cytomegalovirus infection Diseases 0.000 description 3
- 208000007766 Kaposi sarcoma Diseases 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- SUJUHGSWHZTSEU-UHFFFAOYSA-N Tipranavir Natural products C1C(O)=C(C(CC)C=2C=C(NS(=O)(=O)C=3N=CC(=CC=3)C(F)(F)F)C=CC=2)C(=O)OC1(CCC)CCC1=CC=CC=C1 SUJUHGSWHZTSEU-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 230000002924 anti-infective effect Effects 0.000 description 3
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 3
- CYYHCGHYPIAOAC-UHFFFAOYSA-N benzyl 4-carbamoyl-7-azabicyclo[2.2.1]heptane-7-carboxylate Chemical compound C1CC2(C(=O)N)CCC1N2C(=O)OCC1=CC=CC=C1 CYYHCGHYPIAOAC-UHFFFAOYSA-N 0.000 description 3
- ISKDIPCMWJSYSI-UHFFFAOYSA-N benzyl 4-cyano-7-azabicyclo[2.2.1]heptane-7-carboxylate Chemical compound C1CC2CCC1(C#N)N2C(=O)OCC1=CC=CC=C1 ISKDIPCMWJSYSI-UHFFFAOYSA-N 0.000 description 3
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 3
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000002837 carbocyclic group Chemical group 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 238000010511 deprotection reaction Methods 0.000 description 3
- 229960003804 efavirenz Drugs 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- 230000002519 immonomodulatory effect Effects 0.000 description 3
- CBVCZFGXHXORBI-PXQQMZJSSA-N indinavir Chemical compound C([C@H](N(CC1)C[C@@H](O)C[C@@H](CC=2C=CC=CC=2)C(=O)N[C@H]2C3=CC=CC=C3C[C@H]2O)C(=O)NC(C)(C)C)N1CC1=CC=CN=C1 CBVCZFGXHXORBI-PXQQMZJSSA-N 0.000 description 3
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 3
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 3
- ZCYLLBJHUPLVJT-UHFFFAOYSA-N methyl 5,6-dibenzoyloxy-2-[bromo(phenyl)methyl]pyrimidine-4-carboxylate Chemical compound C=1C=CC=CC=1C(=O)OC=1C(C(=O)OC)=NC(C(Br)C=2C=CC=CC=2)=NC=1OC(=O)C1=CC=CC=C1 ZCYLLBJHUPLVJT-UHFFFAOYSA-N 0.000 description 3
- GDTUYPLRWKBDGN-UHFFFAOYSA-N methyl 5-benzoyloxy-2-[2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-2-yl]-4-oxo-1h-pyrimidine-6-carboxylate Chemical compound COC(=O)C1=NC(C2(C)NCCN(C2)C(=O)OC(C)(C)C)=NC(O)=C1OC(=O)C1=CC=CC=C1 GDTUYPLRWKBDGN-UHFFFAOYSA-N 0.000 description 3
- CJPYBGCBOLHJGS-UHFFFAOYSA-N methyl 5-benzoyloxy-4-oxo-2-pyrrolidin-2-yl-1h-pyrimidine-6-carboxylate Chemical compound COC(=O)C1=NC(C2NCCC2)=NC(O)=C1OC(=O)C1=CC=CC=C1 CJPYBGCBOLHJGS-UHFFFAOYSA-N 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- QAGYKUNXZHXKMR-HKWSIXNMSA-N nelfinavir Chemical compound CC1=C(O)C=CC=C1C(=O)N[C@H]([C@H](O)CN1[C@@H](C[C@@H]2CCCC[C@@H]2C1)C(=O)NC(C)(C)C)CSC1=CC=CC=C1 QAGYKUNXZHXKMR-HKWSIXNMSA-N 0.000 description 3
- NQDJXKOVJZTUJA-UHFFFAOYSA-N nevirapine Chemical compound C12=NC=CC=C2C(=O)NC=2C(C)=CC=NC=2N1C1CC1 NQDJXKOVJZTUJA-UHFFFAOYSA-N 0.000 description 3
- 229940042402 non-nucleoside reverse transcriptase inhibitor Drugs 0.000 description 3
- 239000002726 nonnucleoside reverse transcriptase inhibitor Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 230000001566 pro-viral effect Effects 0.000 description 3
- 229940002612 prodrug Drugs 0.000 description 3
- 239000000651 prodrug Substances 0.000 description 3
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 3
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- GFMHNORFBIULNJ-UHFFFAOYSA-N tert-butyl n-(4-cyanooxan-4-yl)carbamate Chemical compound CC(C)(C)OC(=O)NC1(C#N)CCOCC1 GFMHNORFBIULNJ-UHFFFAOYSA-N 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 3
- 229960000838 tipranavir Drugs 0.000 description 3
- SUJUHGSWHZTSEU-FYBSXPHGSA-N tipranavir Chemical compound C([C@@]1(CCC)OC(=O)C([C@H](CC)C=2C=C(NS(=O)(=O)C=3N=CC(=CC=3)C(F)(F)F)C=CC=2)=C(O)C1)CC1=CC=CC=C1 SUJUHGSWHZTSEU-FYBSXPHGSA-N 0.000 description 3
- 238000012546 transfer Methods 0.000 description 3
- 229960000523 zalcitabine Drugs 0.000 description 3
- LVMPWFJVYMXSNY-UHFFFAOYSA-N (2,3-dimethoxyphenyl)methanamine Chemical compound COC1=CC=CC(CN)=C1OC LVMPWFJVYMXSNY-UHFFFAOYSA-N 0.000 description 2
- KYRSNWPSSXSNEP-ZRTHHSRSSA-N (4r,5s,6s,7r)-1,3-bis[(3-aminophenyl)methyl]-4,7-dibenzyl-5,6-dihydroxy-1,3-diazepan-2-one Chemical compound NC1=CC=CC(CN2C(N(CC=3C=C(N)C=CC=3)[C@H](CC=3C=CC=CC=3)[C@H](O)[C@@H](O)[C@H]2CC=2C=CC=CC=2)=O)=C1 KYRSNWPSSXSNEP-ZRTHHSRSSA-N 0.000 description 2
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 2
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 2
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- RLYGGHSVIQHIRZ-UHFFFAOYSA-N 2-(1,4-dimethylpiperazin-2-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound C1N(C)CCN(C)C1C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 RLYGGHSVIQHIRZ-UHFFFAOYSA-N 0.000 description 2
- 125000002995 2-(trifluoromethyl)benzoyl group Chemical group FC(C1=C(C(=O)*)C=CC=C1)(F)F 0.000 description 2
- RUBHAOAJRSDKHD-UHFFFAOYSA-N 2-[dimethylamino(phenyl)methyl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=NC=1C(N(C)C)C1=CC=CC=C1 RUBHAOAJRSDKHD-UHFFFAOYSA-N 0.000 description 2
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 2
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 2
- NECMIXDTENBWRG-UHFFFAOYSA-N 2h-pyrazine-1-carboxylic acid Chemical compound OC(=O)N1CC=NC=C1 NECMIXDTENBWRG-UHFFFAOYSA-N 0.000 description 2
- LPCQBTAOTIZGAE-UHFFFAOYSA-N 2h-pyrimidine-1-carboxamide Chemical compound NC(=O)N1CN=CC=C1 LPCQBTAOTIZGAE-UHFFFAOYSA-N 0.000 description 2
- 125000006512 3,4-dichlorobenzyl group Chemical group [H]C1=C(Cl)C(Cl)=C([H])C(=C1[H])C([H])([H])* 0.000 description 2
- HAEQAUJYNHQVHV-UHFFFAOYSA-N 3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxy-N-phenylbenzamide Chemical compound NCC1=CC(=NC(=C1)C(F)(F)F)OC=1C=C(C(=O)NC2=CC=CC=C2)C=CC=1 HAEQAUJYNHQVHV-UHFFFAOYSA-N 0.000 description 2
- 125000000984 3-chloro-4-fluorobenzyl group Chemical group [H]C1=C(F)C(Cl)=C([H])C(=C1[H])C([H])([H])* 0.000 description 2
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 description 2
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 2
- MKXMXZZARNRMMQ-UHFFFAOYSA-N 4-[(2-methylpropan-2-yl)oxycarbonyl]-1-phenylmethoxycarbonylpiperazine-2-carboxylic acid Chemical compound OC(=O)C1CN(C(=O)OC(C)(C)C)CCN1C(=O)OCC1=CC=CC=C1 MKXMXZZARNRMMQ-UHFFFAOYSA-N 0.000 description 2
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 description 2
- 125000003143 4-hydroxybenzyl group Chemical group [H]C([*])([H])C1=C([H])C([H])=C(O[H])C([H])=C1[H] 0.000 description 2
- 102000002260 Alkaline Phosphatase Human genes 0.000 description 2
- 108020004774 Alkaline Phosphatase Proteins 0.000 description 2
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 2
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 description 2
- AXRYRYVKAWYZBR-UHFFFAOYSA-N Atazanavir Natural products C=1C=C(C=2N=CC=CC=2)C=CC=1CN(NC(=O)C(NC(=O)OC)C(C)(C)C)CC(O)C(NC(=O)C(NC(=O)OC)C(C)(C)C)CC1=CC=CC=C1 AXRYRYVKAWYZBR-UHFFFAOYSA-N 0.000 description 2
- 102100035875 C-C chemokine receptor type 5 Human genes 0.000 description 2
- 101710149870 C-C chemokine receptor type 5 Proteins 0.000 description 2
- QAGYKUNXZHXKMR-UHFFFAOYSA-N CPD000469186 Natural products CC1=C(O)C=CC=C1C(=O)NC(C(O)CN1C(CC2CCCCC2C1)C(=O)NC(C)(C)C)CSC1=CC=CC=C1 QAGYKUNXZHXKMR-UHFFFAOYSA-N 0.000 description 2
- BXZVVICBKDXVGW-NKWVEPMBSA-N Didanosine Chemical compound O1[C@H](CO)CC[C@@H]1N1C(NC=NC2=O)=C2N=C1 BXZVVICBKDXVGW-NKWVEPMBSA-N 0.000 description 2
- XPOQHMRABVBWPR-UHFFFAOYSA-N Efavirenz Natural products O1C(=O)NC2=CC=C(Cl)C=C2C1(C(F)(F)F)C#CC1CC1 XPOQHMRABVBWPR-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- 229940126656 GS-4224 Drugs 0.000 description 2
- 108010010369 HIV Protease Proteins 0.000 description 2
- 229940099797 HIV integrase inhibitor Drugs 0.000 description 2
- 208000009889 Herpes Simplex Diseases 0.000 description 2
- HCUARRIEZVDMPT-UHFFFAOYSA-N Indole-2-carboxylic acid Chemical compound C1=CC=C2NC(C(=O)O)=CC2=C1 HCUARRIEZVDMPT-UHFFFAOYSA-N 0.000 description 2
- 108010047761 Interferon-alpha Proteins 0.000 description 2
- 102000006992 Interferon-alpha Human genes 0.000 description 2
- KJHKTHWMRKYKJE-SUGCFTRWSA-N Kaletra Chemical compound N1([C@@H](C(C)C)C(=O)N[C@H](C[C@H](O)[C@H](CC=2C=CC=CC=2)NC(=O)COC=2C(=CC=CC=2C)C)CC=2C=CC=CC=2)CCCNC1=O KJHKTHWMRKYKJE-SUGCFTRWSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- NCDNCNXCDXHOMX-UHFFFAOYSA-N Ritonavir Natural products C=1C=CC=CC=1CC(NC(=O)OCC=1SC=NC=1)C(O)CC(CC=1C=CC=CC=1)NC(=O)C(C(C)C)NC(=O)N(C)CC1=CSC(C(C)C)=N1 NCDNCNXCDXHOMX-UHFFFAOYSA-N 0.000 description 2
- 101100386054 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) CYS3 gene Proteins 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- IQFYYKKMVGJFEH-XLPZGREQSA-N Thymidine Chemical compound O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](CO)[C@@H](O)C1 IQFYYKKMVGJFEH-XLPZGREQSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- ABAQSUUDTFLUEF-UHFFFAOYSA-N [4-[(4-fluoro-2-methylsulfonylphenyl)methylcarbamoyl]-5-hydroxy-6-oxo-1H-pyrimidin-2-yl] N-(oxan-4-yl)carbamate Chemical compound O1CCC(CC1)NC(OC1=NC(=C(C(=N1)C(=O)NCC1=C(C=C(C=C1)F)S(=O)(=O)C)O)O)=O ABAQSUUDTFLUEF-UHFFFAOYSA-N 0.000 description 2
- 229960004748 abacavir Drugs 0.000 description 2
- WMHSRBZIJNQHKT-FFKFEZPRSA-N abacavir sulfate Chemical compound OS(O)(=O)=O.C=12N=CN([C@H]3C=C[C@@H](CO)C3)C2=NC(N)=NC=1NC1CC1.C=12N=CN([C@H]3C=C[C@@H](CO)C3)C2=NC(N)=NC=1NC1CC1 WMHSRBZIJNQHKT-FFKFEZPRSA-N 0.000 description 2
- LAGCKLUEPAYDPJ-UHFFFAOYSA-N acetic acid 4-hydroxy-1H-pyrimidin-6-one Chemical compound CC(=O)O.OC1=CC(=NC=N1)O LAGCKLUEPAYDPJ-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- WOZSCQDILHKSGG-UHFFFAOYSA-N adefovir depivoxil Chemical compound N1=CN=C2N(CCOCP(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C)C=NC2=C1N WOZSCQDILHKSGG-UHFFFAOYSA-N 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- 150000001413 amino acids Chemical group 0.000 description 2
- 235000012538 ammonium bicarbonate Nutrition 0.000 description 2
- 239000001099 ammonium carbonate Substances 0.000 description 2
- 229960001830 amprenavir Drugs 0.000 description 2
- 229960003277 atazanavir Drugs 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 125000003725 azepanyl group Chemical group 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- YQXCVAGCMNFUMQ-UHFFFAOYSA-N capravirine Chemical compound C=1C(Cl)=CC(Cl)=CC=1SC1=C(C(C)C)N=C(COC(N)=O)N1CC1=CC=NC=C1 YQXCVAGCMNFUMQ-UHFFFAOYSA-N 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 150000001793 charged compounds Chemical class 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- MGNZXYYWBUKAII-UHFFFAOYSA-N cyclohexa-1,3-diene Chemical compound C1CC=CC=C1 MGNZXYYWBUKAII-UHFFFAOYSA-N 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- WHBIGIKBNXZKFE-UHFFFAOYSA-N delavirdine Chemical compound CC(C)NC1=CC=CN=C1N1CCN(C(=O)C=2NC3=CC=C(NS(C)(=O)=O)C=C3C=2)CC1 WHBIGIKBNXZKFE-UHFFFAOYSA-N 0.000 description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical class OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229950002002 emivirine Drugs 0.000 description 2
- PEASPLKKXBYDKL-FXEVSJAOSA-N enfuvirtide Chemical compound C([C@@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(N)=O)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(C)=O)[C@@H](C)O)[C@@H](C)CC)C1=CN=CN1 PEASPLKKXBYDKL-FXEVSJAOSA-N 0.000 description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 239000003084 hiv integrase inhibitor Substances 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 229960001936 indinavir Drugs 0.000 description 2
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 description 2
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 125000002346 iodo group Chemical group I* 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- TWBYWOBDOCUKOW-UHFFFAOYSA-N isonicotinic acid Chemical compound OC(=O)C1=CC=NC=C1 TWBYWOBDOCUKOW-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000004628 isothiazolidinyl group Chemical group S1N(CCC1)* 0.000 description 2
- JTEGQNOMFQHVDC-NKWVEPMBSA-N lamivudine Chemical compound O=C1N=C(N)C=CN1[C@H]1O[C@@H](CO)SC1 JTEGQNOMFQHVDC-NKWVEPMBSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- ZVRBLDKFKYAVQK-UHFFFAOYSA-N methyl 2-benzyl-5-[(2-methylpropan-2-yl)oxycarbonyloxy]-4-oxo-1h-pyrimidine-6-carboxylate Chemical compound OC1=C(OC(=O)OC(C)(C)C)C(C(=O)OC)=NC(CC=2C=CC=CC=2)=N1 ZVRBLDKFKYAVQK-UHFFFAOYSA-N 0.000 description 2
- MGZAUOBOIKCIEW-UHFFFAOYSA-N methyl 2-benzyl-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxylate Chemical compound OC1=C(O)C(C(=O)OC)=NC(CC=2C=CC=CC=2)=N1 MGZAUOBOIKCIEW-UHFFFAOYSA-N 0.000 description 2
- QZNAOLMQVYKMFD-UHFFFAOYSA-N methyl 5-benzoyloxy-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]-4-oxo-1h-pyrimidine-6-carboxylate Chemical compound COC(=O)C1=NC(C2N(CCC2)C(=O)OC(C)(C)C)=NC(O)=C1OC(=O)C1=CC=CC=C1 QZNAOLMQVYKMFD-UHFFFAOYSA-N 0.000 description 2
- QOIXZZYLORXQFY-UHFFFAOYSA-N methyl 5-benzoyloxy-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]oxan-4-yl]-4-oxo-1h-pyrimidine-6-carboxylate Chemical compound COC(=O)C1=NC(C2(CCOCC2)NC(=O)OC(C)(C)C)=NC(O)=C1OC(=O)C1=CC=CC=C1 QOIXZZYLORXQFY-UHFFFAOYSA-N 0.000 description 2
- GXVPHPOAYVJOLB-UHFFFAOYSA-N methyl 5-hydroxy-4-oxo-1h-pyrimidine-6-carboxylate Chemical compound COC(=O)C1=NC=NC(O)=C1O GXVPHPOAYVJOLB-UHFFFAOYSA-N 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- UNBDDZDKBWPHAX-UHFFFAOYSA-N n,n-di(propan-2-yl)formamide Chemical compound CC(C)N(C=O)C(C)C UNBDDZDKBWPHAX-UHFFFAOYSA-N 0.000 description 2
- BGXZYEOFLCTRQZ-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-5-hydroxy-2-(4-methylmorpholin-3-yl)-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CN1CCOCC1C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 BGXZYEOFLCTRQZ-UHFFFAOYSA-N 0.000 description 2
- OKLYWXAJDGCACQ-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-2-thiophen-2-yl-1h-pyrimidine-6-carboxamide Chemical compound OC=1C(O)=NC(C=2SC=CC=2)=NC=1C(=O)NCC1=CC=C(F)C=C1 OKLYWXAJDGCACQ-UHFFFAOYSA-N 0.000 description 2
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229960000884 nelfinavir Drugs 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 239000012038 nucleophile Substances 0.000 description 2
- 230000000269 nucleophilic effect Effects 0.000 description 2
- 239000002773 nucleotide Substances 0.000 description 2
- 125000003729 nucleotide group Chemical group 0.000 description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000000160 oxazolidinyl group Chemical group 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 2
- 239000000137 peptide hydrolase inhibitor Substances 0.000 description 2
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 2
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 2
- DNUTZBZXLPWRJG-UHFFFAOYSA-M piperidine-1-carboxylate Chemical compound [O-]C(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-M 0.000 description 2
- 108700004029 pol Genes Proteins 0.000 description 2
- 101150088264 pol gene Proteins 0.000 description 2
- 125000003367 polycyclic group Chemical group 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 2
- 125000006514 pyridin-2-ylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 2
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 2
- ZFCHNZDUMIOWFV-UHFFFAOYSA-N pyrimidine-2-carboxylic acid Chemical compound OC(=O)C1=NC=CC=N1 ZFCHNZDUMIOWFV-UHFFFAOYSA-N 0.000 description 2
- YPOXGDJGKBXRFP-UHFFFAOYSA-N pyrimidine-4-carboxylic acid Chemical compound OC(=O)C1=CC=NC=N1 YPOXGDJGKBXRFP-UHFFFAOYSA-N 0.000 description 2
- 150000003230 pyrimidines Chemical class 0.000 description 2
- 238000005932 reductive alkylation reaction Methods 0.000 description 2
- 238000006268 reductive amination reaction Methods 0.000 description 2
- 229940064914 retrovir Drugs 0.000 description 2
- ATEBXHFBFRCZMA-VXTBVIBXSA-N rifabutin Chemical compound O([C@](C1=O)(C)O/C=C/[C@@H]([C@H]([C@@H](OC(C)=O)[C@H](C)[C@H](O)[C@H](C)[C@@H](O)[C@@H](C)\C=C\C=C(C)/C(=O)NC(=C2N3)C(=O)C=4C(O)=C5C)C)OC)C5=C1C=4C2=NC13CCN(CC(C)C)CC1 ATEBXHFBFRCZMA-VXTBVIBXSA-N 0.000 description 2
- 229960000311 ritonavir Drugs 0.000 description 2
- NCDNCNXCDXHOMX-XGKFQTDJSA-N ritonavir Chemical compound N([C@@H](C(C)C)C(=O)N[C@H](C[C@H](O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1SC=NC=1)CC=1C=CC=CC=1)C(=O)N(C)CC1=CSC(C(C)C)=N1 NCDNCNXCDXHOMX-XGKFQTDJSA-N 0.000 description 2
- 229960001852 saquinavir Drugs 0.000 description 2
- QWAXKHKRTORLEM-UGJKXSETSA-N saquinavir Chemical compound C([C@@H]([C@H](O)CN1C[C@H]2CCCC[C@H]2C[C@H]1C(=O)NC(C)(C)C)NC(=O)[C@H](CC(N)=O)NC(=O)C=1N=C2C=CC=CC2=CC=1)C1=CC=CC=C1 QWAXKHKRTORLEM-UGJKXSETSA-N 0.000 description 2
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 2
- 101150035983 str1 gene Proteins 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 229960002317 succinimide Drugs 0.000 description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 2
- VCMJCVGFSROFHV-WZGZYPNHSA-N tenofovir disoproxil fumarate Chemical compound OC(=O)\C=C\C(O)=O.N1=CN=C2N(C[C@@H](C)OCP(=O)(OCOC(=O)OC(C)C)OCOC(=O)OC(C)C)C=NC2=C1N VCMJCVGFSROFHV-WZGZYPNHSA-N 0.000 description 2
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 2
- BEUUJDAEPJZWHM-COROXYKFSA-N tert-butyl n-[(2s,3s,5r)-3-hydroxy-6-[[(2s)-1-(2-methoxyethylamino)-3-methyl-1-oxobutan-2-yl]amino]-6-oxo-1-phenyl-5-[(2,3,4-trimethoxyphenyl)methyl]hexan-2-yl]carbamate Chemical compound C([C@@H]([C@@H](O)C[C@H](C(=O)N[C@H](C(=O)NCCOC)C(C)C)CC=1C(=C(OC)C(OC)=CC=1)OC)NC(=O)OC(C)(C)C)C1=CC=CC=C1 BEUUJDAEPJZWHM-COROXYKFSA-N 0.000 description 2
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 2
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- 238000006276 transfer reaction Methods 0.000 description 2
- 241001430294 unidentified retrovirus Species 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- IXZYCIFRVZKVRJ-RKKDRKJOSA-N (2s)-n-[(2s,3r)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-2-[[2-[(3-fluorophenyl)methylamino]acetyl]amino]-3,3-dimethylbutanamide Chemical compound C([C@@H]([C@H](O)CN(CC(C)C)S(=O)(=O)C=1C=CC(N)=CC=1)NC(=O)[C@@H](NC(=O)CNCC=1C=C(F)C=CC=1)C(C)(C)C)C1=CC=CC=C1 IXZYCIFRVZKVRJ-RKKDRKJOSA-N 0.000 description 1
- XOYXESIZZFUVRD-UVSAJTFZSA-N (2s,3s,4r,5s,6s)-6-[(2r,3r,4r,5s,6r)-6-[(2r,3s,4r,5s,6r)-5-acetamido-6-[(2r,3r,4r,5s,6r)-4-acetyloxy-6-[(2r,3r,4r,5s,6r)-4-acetyloxy-6-[(2r,3r,4r,5s,6s)-4-acetyloxy-5-hydroxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl]oxy-5-hydroxy-2-(hydroxymethyl)oxan-3-yl]ox Chemical compound CC(=O)O[C@@H]1[C@H](O)[C@@H](OC)O[C@H](CO)[C@H]1O[C@@H]1[C@@H](O)[C@@H](OC(C)=O)[C@H](O[C@@H]2[C@H]([C@@H](OC(C)=O)[C@H](O[C@@H]3[C@H]([C@@H](O)[C@H](O[C@@H]4[C@H]([C@@H](OC(C)=O)[C@H](O[C@@H]5[C@H]([C@@H](OC(C)=O)[C@H](O[C@@H]6[C@H]([C@@H](OC(C)=O)[C@H](O[C@@H]7[C@H]([C@@H](OC(C)=O)[C@H](OC)[C@@H](CO)O7)O)[C@@H](CO)O6)O)[C@H](O5)C(O)=O)O)[C@@H](CO)O4)O)[C@@H](CO)O3)NC(C)=O)[C@@H](CO)O2)O)[C@@H](CO)O1 XOYXESIZZFUVRD-UVSAJTFZSA-N 0.000 description 1
- WELIAPHSOWCGMT-UHFFFAOYSA-N (4-fluoro-2-methylsulfonylphenyl)methanamine Chemical compound CS(=O)(=O)C1=CC(F)=CC=C1CN WELIAPHSOWCGMT-UHFFFAOYSA-N 0.000 description 1
- CUFQBQOBLVLKRF-RZDMPUFOSA-N (4r)-3-[(2s,3s)-2-hydroxy-3-[(3-hydroxy-2-methylbenzoyl)amino]-4-phenylbutanoyl]-5,5-dimethyl-n-[(2-methylphenyl)methyl]-1,3-thiazolidine-4-carboxamide Chemical compound CC1=CC=CC=C1CNC(=O)[C@@H]1C(C)(C)SCN1C(=O)[C@@H](O)[C@@H](NC(=O)C=1C(=C(O)C=CC=1)C)CC1=CC=CC=C1 CUFQBQOBLVLKRF-RZDMPUFOSA-N 0.000 description 1
- JJWJSIAJLBEMEN-ZDUSSCGKSA-N (4s)-6-chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1,3-dihydroquinazolin-2-one Chemical compound C([C@]1(C2=CC(Cl)=CC=C2NC(=O)N1)C(F)(F)F)#CC1CC1 JJWJSIAJLBEMEN-ZDUSSCGKSA-N 0.000 description 1
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 description 1
- 125000002733 (C1-C6) fluoroalkyl group Chemical group 0.000 description 1
- 125000006592 (C2-C3) alkenyl group Chemical group 0.000 description 1
- 125000006593 (C2-C3) alkynyl group Chemical group 0.000 description 1
- 125000006729 (C2-C5) alkenyl group Chemical group 0.000 description 1
- 125000006730 (C2-C5) alkynyl group Chemical group 0.000 description 1
- GWKIPRVERALPRD-ZDUSSCGKSA-N (s)-4-isopropoxycarbonyl-6-methoxy-3-methylthiomethyl-3,4-dihydroquinoxalin-2(1h)-thione Chemical compound N1C(=S)[C@H](CSC)N(C(=O)OC(C)C)C2=CC(OC)=CC=C21 GWKIPRVERALPRD-ZDUSSCGKSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- OSJVTYVKQNOXPP-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline-2-carboxylic acid Chemical compound C1=CC=C2NC(C(=O)O)CCC2=C1 OSJVTYVKQNOXPP-UHFFFAOYSA-N 0.000 description 1
- 125000004512 1,2,3-thiadiazol-4-yl group Chemical group S1N=NC(=C1)* 0.000 description 1
- YWSBWHMBCHGEGX-UHFFFAOYSA-N 1,4-dioxa-8-azaspiro[4.5]decyl Chemical group [O+]1=CCOC11CC[N-]CC1 YWSBWHMBCHGEGX-UHFFFAOYSA-N 0.000 description 1
- IKJIWGFFKIXRCP-UHFFFAOYSA-N 1-(5-benzoyloxy-4-methoxycarbonyl-6-oxo-1H-pyrimidin-2-yl)-7-azabicyclo[2.2.1]heptane-7-carboxylic acid Chemical compound COC(=O)C=1NC(C23CCC(CC2)N3C(O)=O)=NC(=O)C=1OC(=O)C1=CC=CC=C1 IKJIWGFFKIXRCP-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004972 1-butynyl group Chemical group [H]C([H])([H])C([H])([H])C#C* 0.000 description 1
- WZTRQGJMMHMFGH-UHFFFAOYSA-N 1-methyl-imidazole-4-carboxylic acid Chemical compound CN1C=NC(C(O)=O)=C1 WZTRQGJMMHMFGH-UHFFFAOYSA-N 0.000 description 1
- 125000004484 1-methylpiperidin-4-yl group Chemical group CN1CCC(CC1)* 0.000 description 1
- LOOVBYKQYNMGAC-UHFFFAOYSA-N 1-o-benzyl 4-o-tert-butyl 2-(5-benzoyloxy-6-methoxycarbonyl-4-oxo-1h-pyrimidin-2-yl)-2-methylpiperazine-1,4-dicarboxylate Chemical compound COC(=O)C1=NC(C2(C)N(CCN(C2)C(=O)OC(C)(C)C)C(=O)OCC=2C=CC=CC=2)=NC(O)=C1OC(=O)C1=CC=CC=C1 LOOVBYKQYNMGAC-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- ABEXEQSGABRUHS-UHFFFAOYSA-N 16-methylheptadecyl 16-methylheptadecanoate Chemical compound CC(C)CCCCCCCCCCCCCCCOC(=O)CCCCCCCCCCCCCCC(C)C ABEXEQSGABRUHS-UHFFFAOYSA-N 0.000 description 1
- 125000000980 1H-indol-3-ylmethyl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C(C([H])([H])[*])C2=C1[H] 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- UDELMRIGXNCYLU-UHFFFAOYSA-N 2,2-diethoxyacetonitrile Chemical compound CCOC(C#N)OCC UDELMRIGXNCYLU-UHFFFAOYSA-N 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 1
- 125000001617 2,3-dimethoxy phenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- 125000006507 2,4-difluorobenzyl group Chemical group [H]C1=C(F)C([H])=C(F)C(=C1[H])C([H])([H])* 0.000 description 1
- 125000004215 2,4-difluorophenyl group Chemical group [H]C1=C([H])C(*)=C(F)C([H])=C1F 0.000 description 1
- 125000006183 2,4-dimethyl benzyl group Chemical group [H]C1=C(C([H])=C(C(=C1[H])C([H])([H])*)C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- LDXJRKWFNNFDSA-UHFFFAOYSA-N 2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound C1CN(CC2=NNN=C21)CC(=O)N3CCN(CC3)C4=CN=C(N=C4)NCC5=CC(=CC=C5)OC(F)(F)F LDXJRKWFNNFDSA-UHFFFAOYSA-N 0.000 description 1
- OEGQLWTZOFAYOC-UHFFFAOYSA-N 2-(2-aminopropan-2-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CC(C)(N)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 OEGQLWTZOFAYOC-UHFFFAOYSA-N 0.000 description 1
- BHAFZQBKRPLKBC-UHFFFAOYSA-N 2-(3-acetyl-3-azabicyclo[2.1.1]hexan-4-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CC(=O)N1CC(C2)CC12C(N=1)=NC(O)=C(O)C=1C(=O)NCC1=CC=C(F)C=C1 BHAFZQBKRPLKBC-UHFFFAOYSA-N 0.000 description 1
- LHDRZZVWVQWKCA-UHFFFAOYSA-N 2-(4-acetylthiomorpholin-3-yl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CC(=O)N1CCSCC1C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 LHDRZZVWVQWKCA-UHFFFAOYSA-N 0.000 description 1
- NNEOFCKGHHNQHD-UHFFFAOYSA-N 2-(4-aminooxan-4-yl)-n-[(4-fluoro-2-methylsulfonylphenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CS(=O)(=O)C1=CC(F)=CC=C1CNC(=O)C1=C(O)C(=O)N=C(C2(N)CCOCC2)N1 NNEOFCKGHHNQHD-UHFFFAOYSA-N 0.000 description 1
- XSENZTAWXDBXHL-UHFFFAOYSA-N 2-(4-aminooxan-4-yl)-n-[(4-fluoro-2-methylsulfonylphenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CS(=O)(=O)C1=CC(F)=CC=C1CNC(=O)C1=C(O)C(=O)N=C(C2(N)CCOCC2)N1 XSENZTAWXDBXHL-UHFFFAOYSA-N 0.000 description 1
- KBTHDVOAGOWSFD-UHFFFAOYSA-N 2-(diethoxymethyl)-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CCOC(OCC)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 KBTHDVOAGOWSFD-UHFFFAOYSA-N 0.000 description 1
- WOXFMYVTSLAQMO-UHFFFAOYSA-N 2-Pyridinemethanamine Chemical compound NCC1=CC=CC=N1 WOXFMYVTSLAQMO-UHFFFAOYSA-N 0.000 description 1
- DKVDYRIRFAWZNQ-UHFFFAOYSA-N 2-[(2-ethoxyphenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CCOC1=CC=CC=C1CC1=NC(O)=C(O)C(C(N)=O)=N1 DKVDYRIRFAWZNQ-UHFFFAOYSA-N 0.000 description 1
- ZNIHJRMUSZSQJQ-UHFFFAOYSA-N 2-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound OC1=C(O)C(C(=O)N)=NC(CC=2C=CC(F)=CC=2)=N1 ZNIHJRMUSZSQJQ-UHFFFAOYSA-N 0.000 description 1
- TWUZGVMXPUJCPY-SOFGYWHQSA-N 2-[(E)-N'-[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]oxycarbamimidoyl]-2-methylpiperazine-1,4-dicarboxylic acid Chemical compound CC1(CN(CCN1C(=O)O)C(=O)O)/C(=N\O/C(=C/C(=O)OC)/C(=O)OC)/N TWUZGVMXPUJCPY-SOFGYWHQSA-N 0.000 description 1
- OKICWQFEAYDACG-UHFFFAOYSA-N 2-[2-(dimethylamino)propan-2-yl]-n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide;hydrochloride Chemical compound Cl.CN(C)C(C)(C)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 OKICWQFEAYDACG-UHFFFAOYSA-N 0.000 description 1
- GWFOVSGRNGAGDL-FSDSQADBSA-N 2-amino-9-[(1r,2r,3s)-2,3-bis(hydroxymethyl)cyclobutyl]-3h-purin-6-one Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1[C@@H]1C[C@H](CO)[C@H]1CO GWFOVSGRNGAGDL-FSDSQADBSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- GAPKCDYCHKGEBJ-UHFFFAOYSA-N 2-butyl-n-[(3-chloro-4-methylphenyl)methyl]-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CCCCC1=NC(O)=C(O)C(C(=O)NCC=2C=C(Cl)C(C)=CC=2)=N1 GAPKCDYCHKGEBJ-UHFFFAOYSA-N 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- PBIUDEUWYGBHDW-UHFFFAOYSA-N 2-chloro-1-pyridin-3-ylethanone;hydrochloride Chemical compound Cl.ClCC(=O)C1=CC=CN=C1 PBIUDEUWYGBHDW-UHFFFAOYSA-N 0.000 description 1
- 125000003541 2-chlorobenzoyl group Chemical group ClC1=C(C(=O)*)C=CC=C1 0.000 description 1
- 125000004847 2-fluorobenzyl group Chemical group [H]C1=C([H])C(F)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- QKVCSJBBYNYZNM-UHFFFAOYSA-N 2-methyl-2-(phenylmethoxycarbonylamino)propanoic acid Chemical compound OC(=O)C(C)(C)NC(=O)OCC1=CC=CC=C1 QKVCSJBBYNYZNM-UHFFFAOYSA-N 0.000 description 1
- BKZPJZNMQXLJGJ-UHFFFAOYSA-N 2-methyl-n-phenylpyridine-4-carboxamide Chemical compound C1=NC(C)=CC(C(=O)NC=2C=CC=CC=2)=C1 BKZPJZNMQXLJGJ-UHFFFAOYSA-N 0.000 description 1
- QCDWFXQBSFUVSP-UHFFFAOYSA-N 2-phenoxyethanol Chemical compound OCCOC1=CC=CC=C1 QCDWFXQBSFUVSP-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- PFQMATZSWHEMQS-UHFFFAOYSA-N 2-thiophen-2-ylpyrimidine-4-carboxamide Chemical compound NC(=O)C1=CC=NC(C=2SC=CC=2)=N1 PFQMATZSWHEMQS-UHFFFAOYSA-N 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- 125000006288 3,5-difluorobenzyl group Chemical group [H]C1=C(F)C([H])=C(C([H])=C1F)C([H])([H])* 0.000 description 1
- YLZOPXRUQYQQID-UHFFFAOYSA-N 3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]propan-1-one Chemical compound N1N=NC=2CN(CCC=21)CCC(=O)N1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F YLZOPXRUQYQQID-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- 125000006284 3-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(F)=C1[H])C([H])([H])* 0.000 description 1
- DUFGYCAXVIUXIP-UHFFFAOYSA-N 4,6-dihydroxypyrimidine Chemical class OC1=CC(O)=NC=N1 DUFGYCAXVIUXIP-UHFFFAOYSA-N 0.000 description 1
- NBJHDLKSWUDGJG-UHFFFAOYSA-N 4-(2-chloroethyl)morpholin-4-ium;chloride Chemical compound Cl.ClCCN1CCOCC1 NBJHDLKSWUDGJG-UHFFFAOYSA-N 0.000 description 1
- ZAPMTSHEXFEPSD-UHFFFAOYSA-N 4-(2-chloroethyl)morpholine Chemical compound ClCCN1CCOCC1 ZAPMTSHEXFEPSD-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- IMBBXSASDSZJSX-UHFFFAOYSA-N 4-Carboxypyrazole Chemical compound OC(=O)C=1C=NNC=1 IMBBXSASDSZJSX-UHFFFAOYSA-N 0.000 description 1
- ZZLCFHIKESPLTH-UHFFFAOYSA-N 4-Methylbiphenyl Chemical compound C1=CC(C)=CC=C1C1=CC=CC=C1 ZZLCFHIKESPLTH-UHFFFAOYSA-N 0.000 description 1
- SPPDKPRJPFTBEV-UHFFFAOYSA-N 4-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-4-carboxylic acid Chemical compound CC(C)(C)OC(=O)NC1(C(O)=O)CCOCC1 SPPDKPRJPFTBEV-UHFFFAOYSA-N 0.000 description 1
- ILAYIAGXTHKHNT-UHFFFAOYSA-N 4-[4-(2,4,6-trimethyl-phenylamino)-pyrimidin-2-ylamino]-benzonitrile Chemical compound CC1=CC(C)=CC(C)=C1NC1=CC=NC(NC=2C=CC(=CC=2)C#N)=N1 ILAYIAGXTHKHNT-UHFFFAOYSA-N 0.000 description 1
- HSBKFSPNDWWPSL-VDTYLAMSSA-N 4-amino-5-fluoro-1-[(2s,5r)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]pyrimidin-2-one Chemical compound C1=C(F)C(N)=NC(=O)N1[C@@H]1C=C[C@H](CO)O1 HSBKFSPNDWWPSL-VDTYLAMSSA-N 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- RNOVGJWJVRESAA-UHFFFAOYSA-N 4-fluoro-2-(trifluoromethyl)phenol Chemical group OC1=CC=C(F)C=C1C(F)(F)F RNOVGJWJVRESAA-UHFFFAOYSA-N 0.000 description 1
- VCZNNAKNUVJVGX-UHFFFAOYSA-N 4-methylbenzonitrile Chemical compound CC1=CC=C(C#N)C=C1 VCZNNAKNUVJVGX-UHFFFAOYSA-N 0.000 description 1
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 1
- XQRRDUISATZZSV-UHFFFAOYSA-N 5-hydroxy-4-oxo-1h-pyrimidine-6-carboxylic acid Chemical class OC(=O)C1=NC=NC(O)=C1O XQRRDUISATZZSV-UHFFFAOYSA-N 0.000 description 1
- QRGVJIXXHJKLHH-UHFFFAOYSA-N 5-hydroxy-4-oxo-2-[2-(phenylmethoxycarbonylamino)propan-2-yl]-1h-pyrimidine-6-carboxylic acid Chemical compound N=1C(=O)C(O)=C(C(O)=O)NC=1C(C)(C)NC(=O)OCC1=CC=CC=C1 QRGVJIXXHJKLHH-UHFFFAOYSA-N 0.000 description 1
- SCXAUENZKSNKQP-UHFFFAOYSA-N 5-hydroxy-4-oxo-2-thiophen-2-yl-1h-pyrimidine-6-carboxamide Chemical compound OC1=C(O)C(C(=O)N)=NC(C=2SC=CC=2)=N1 SCXAUENZKSNKQP-UHFFFAOYSA-N 0.000 description 1
- VWGOJNFHYLXMAC-UHFFFAOYSA-N 5-hydroxy-6-methoxycarbonyl-4-oxo-1h-pyrimidine-2-carboxylic acid Chemical compound COC(=O)C1=NC(C(O)=O)=NC(O)=C1O VWGOJNFHYLXMAC-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- NVPNMUKHXNVSAC-UHFFFAOYSA-N 7-o-benzyl 4-o-tert-butyl 7-azabicyclo[2.2.1]heptane-4,7-dicarboxylate Chemical compound C1CC2(C(=O)OC(C)(C)C)CCC1N2C(=O)OCC1=CC=CC=C1 NVPNMUKHXNVSAC-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 206010000807 Acute HIV infection Diseases 0.000 description 1
- 241000427202 Adria Species 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- DWRXFEITVBNRMK-UHFFFAOYSA-N Beta-D-1-Arabinofuranosylthymine Natural products O=C1NC(=O)C(C)=CN1C1C(O)C(O)C(CO)O1 DWRXFEITVBNRMK-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VWFCHDSQECPREK-LURJTMIESA-N Cidofovir Chemical compound NC=1C=CN(C[C@@H](CO)OCP(O)(O)=O)C(=O)N=1 VWFCHDSQECPREK-LURJTMIESA-N 0.000 description 1
- 241000543381 Cliftonia monophylla Species 0.000 description 1
- 229920002558 Curdlan Polymers 0.000 description 1
- 239000001879 Curdlan Substances 0.000 description 1
- GSNUFIFRDBKVIE-UHFFFAOYSA-N DMF Natural products CC1=CC=C(C)O1 GSNUFIFRDBKVIE-UHFFFAOYSA-N 0.000 description 1
- 108020004414 DNA Proteins 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 101100170601 Drosophila melanogaster Tet gene Proteins 0.000 description 1
- XQSPYNMVSIKCOC-NTSWFWBYSA-N Emtricitabine Chemical compound C1=C(F)C(N)=NC(=O)N1[C@H]1O[C@@H](CO)SC1 XQSPYNMVSIKCOC-NTSWFWBYSA-N 0.000 description 1
- 108010032976 Enfuvirtide Proteins 0.000 description 1
- 208000007514 Herpes zoster Diseases 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101001033280 Homo sapiens Cytokine receptor common subunit beta Proteins 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- XQFRJNBWHJMXHO-RRKCRQDMSA-N IDUR Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(I)=C1 XQFRJNBWHJMXHO-RRKCRQDMSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 108010054698 Interferon Alfa-n3 Proteins 0.000 description 1
- 108010050904 Interferons Proteins 0.000 description 1
- 102000014150 Interferons Human genes 0.000 description 1
- 241000764238 Isis Species 0.000 description 1
- OFFWOVJBSQMVPI-RMLGOCCBSA-N Kaletra Chemical compound N1([C@@H](C(C)C)C(=O)N[C@H](C[C@H](O)[C@H](CC=2C=CC=CC=2)NC(=O)COC=2C(=CC=CC=2C)C)CC=2C=CC=CC=2)CCCNC1=O.N([C@@H](C(C)C)C(=O)N[C@H](C[C@H](O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1SC=NC=1)CC=1C=CC=CC=1)C(=O)N(C)CC1=CSC(C(C)C)=N1 OFFWOVJBSQMVPI-RMLGOCCBSA-N 0.000 description 1
- NJBBLOIWMSYVCQ-VZTVMPNDSA-N Kynostatin 272 Chemical compound C([C@H](NC(=O)[C@@H](NC(=O)COC=1C2=CC=NC=C2C=CC=1)CSC)[C@H](O)C(=O)N1[C@@H](CSC1)C(=O)NC(C)(C)C)C1=CC=CC=C1 NJBBLOIWMSYVCQ-VZTVMPNDSA-N 0.000 description 1
- 101100369199 Methanopyrus kandleri (strain AV19 / DSM 6324 / JCM 9639 / NBRC 100938) tfe gene Proteins 0.000 description 1
- BKEGTQRNHCVDPW-UHFFFAOYSA-N N-(2-methyl-2,3-dihydroindol-1-yl)benzamide Chemical compound CC1Cc2ccccc2N1NC(=O)c1ccccc1 BKEGTQRNHCVDPW-UHFFFAOYSA-N 0.000 description 1
- WLCUDCRLNMKOEZ-UHFFFAOYSA-N N-[(4-fluorophenyl)methyl]-2-formyl-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxamide Chemical compound OC1=NC(C=O)=NC(C(=O)NCC=2C=CC(F)=CC=2)=C1O WLCUDCRLNMKOEZ-UHFFFAOYSA-N 0.000 description 1
- RXUWWFJDHCMWRV-UHFFFAOYSA-N N=1N=CC(C=1)=NO Chemical compound N=1N=CC(C=1)=NO RXUWWFJDHCMWRV-UHFFFAOYSA-N 0.000 description 1
- 102000011931 Nucleoproteins Human genes 0.000 description 1
- 108010061100 Nucleoproteins Proteins 0.000 description 1
- 108700026244 Open Reading Frames Proteins 0.000 description 1
- YIKSCQDJHCMVMK-UHFFFAOYSA-N Oxamide Chemical compound NC(=O)C(N)=O YIKSCQDJHCMVMK-UHFFFAOYSA-N 0.000 description 1
- 241001631646 Papillomaviridae Species 0.000 description 1
- 229940124158 Protease/peptidase inhibitor Drugs 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- 206010038910 Retinitis Diseases 0.000 description 1
- IWUCXVSUMQZMFG-AFCXAGJDSA-N Ribavirin Chemical compound N1=C(C(=O)N)N=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 IWUCXVSUMQZMFG-AFCXAGJDSA-N 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- 210000001744 T-lymphocyte Anatomy 0.000 description 1
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical compound O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 description 1
- HDOVUKNUBWVHOX-QMMMGPOBSA-N Valacyclovir Chemical compound N1C(N)=NC(=O)C2=C1N(COCCOC(=O)[C@@H](N)C(C)C)C=N2 HDOVUKNUBWVHOX-QMMMGPOBSA-N 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- UGWQMIXVUBLMAH-IVVFTGHFSA-N [(1s,4r)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methanol;4-amino-1-[(2r,5s)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one Chemical compound O=C1N=C(N)C=CN1[C@H]1O[C@@H](CO)SC1.C=12N=CN([C@H]3C=C[C@@H](CO)C3)C2=NC(N)=NC=1NC1CC1 UGWQMIXVUBLMAH-IVVFTGHFSA-N 0.000 description 1
- BINXAIIXOUQUKC-UIPNDDLNSA-N [(3as,4r,6ar)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] n-[(2s,3r)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate Chemical compound C1=CC(OC)=CC=C1S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@@H](NC(=O)O[C@@H]1[C@@H]2CCO[C@@H]2OC1)CC1=CC=CC=C1 BINXAIIXOUQUKC-UIPNDDLNSA-N 0.000 description 1
- ZEEBGORNQSEQBE-UHFFFAOYSA-N [2-(3-phenylphenoxy)-6-(trifluoromethyl)pyridin-4-yl]methanamine Chemical compound C1(=CC(=CC=C1)OC1=NC(=CC(=C1)CN)C(F)(F)F)C1=CC=CC=C1 ZEEBGORNQSEQBE-UHFFFAOYSA-N 0.000 description 1
- REAYFGLASQTHKB-UHFFFAOYSA-N [2-[3-(1H-pyrazol-4-yl)phenoxy]-6-(trifluoromethyl)pyridin-4-yl]methanamine Chemical compound N1N=CC(=C1)C=1C=C(OC2=NC(=CC(=C2)CN)C(F)(F)F)C=CC=1 REAYFGLASQTHKB-UHFFFAOYSA-N 0.000 description 1
- DZSOGABSLZETKO-UHFFFAOYSA-N [tert-butyl(dimethyl)silyl] benzenecarboperoxoate Chemical compound C(C1=CC=CC=C1)(=O)OO[Si](C)(C)C(C)(C)C DZSOGABSLZETKO-UHFFFAOYSA-N 0.000 description 1
- MCGSCOLBFJQGHM-SCZZXKLOSA-N abacavir Chemical compound C=12N=CN([C@H]3C=C[C@@H](CO)C3)C2=NC(N)=NC=1NC1CC1 MCGSCOLBFJQGHM-SCZZXKLOSA-N 0.000 description 1
- 229960005327 acemannan Drugs 0.000 description 1
- 229960004150 aciclovir Drugs 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 229960003205 adefovir dipivoxil Drugs 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000004450 alkenylene group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000004419 alkynylene group Chemical group 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229940124425 anti-infective immunomodulator Drugs 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- JPYQFYIEOUVJDU-UHFFFAOYSA-N beclamide Chemical compound ClCCC(=O)NCC1=CC=CC=C1 JPYQFYIEOUVJDU-UHFFFAOYSA-N 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- PUJDIJCNWFYVJX-UHFFFAOYSA-N benzyl carbamate Chemical compound NC(=O)OCC1=CC=CC=C1 PUJDIJCNWFYVJX-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- IQFYYKKMVGJFEH-UHFFFAOYSA-N beta-L-thymidine Natural products O=C1NC(=O)C(C)=CN1C1OC(CO)C(O)C1 IQFYYKKMVGJFEH-UHFFFAOYSA-N 0.000 description 1
- 238000001815 biotherapy Methods 0.000 description 1
- 125000002529 biphenylenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C12)* 0.000 description 1
- 210000001124 body fluid Anatomy 0.000 description 1
- 239000010839 body fluid Substances 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229950008230 capravirine Drugs 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- SFZULDYEOVSIKM-UHFFFAOYSA-N chembl321317 Chemical compound C1=CC(C(=N)NO)=CC=C1C1=CC=C(C=2C=CC(=CC=2)C(=N)NO)O1 SFZULDYEOVSIKM-UHFFFAOYSA-N 0.000 description 1
- 239000012295 chemical reaction liquid Substances 0.000 description 1
- 239000003067 chemokine receptor CCR5 antagonist Substances 0.000 description 1
- 239000002576 chemokine receptor CXCR4 antagonist Substances 0.000 description 1
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 description 1
- 229960000724 cidofovir Drugs 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 230000006957 competitive inhibition Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 229940088900 crixivan Drugs 0.000 description 1
- 235000019316 curdlan Nutrition 0.000 description 1
- 229940078035 curdlan Drugs 0.000 description 1
- 229940121384 cxc chemokine receptor type 4 (cxcr4) antagonist Drugs 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 229940036098 cytomegalovirus immunoglobulin Drugs 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007850 degeneration Effects 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 229960000633 dextran sulfate Drugs 0.000 description 1
- VILAVOFMIJHSJA-UHFFFAOYSA-N dicarbon monoxide Chemical compound [C]=C=O VILAVOFMIJHSJA-UHFFFAOYSA-N 0.000 description 1
- 229960002656 didanosine Drugs 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- GLUUGHFHXGJENI-UHFFFAOYSA-N diethylenediamine Natural products C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 1
- AYXBAIULRDEVAS-UHFFFAOYSA-N dimethyl-[[4-[[3-(4-methylphenyl)-8,9-dihydro-7h-benzo[7]annulene-6-carbonyl]amino]phenyl]methyl]-(oxan-4-yl)azanium;iodide Chemical compound [I-].C1=CC(C)=CC=C1C1=CC=C(CCCC(=C2)C(=O)NC=3C=CC(C[N+](C)(C)C4CCOCC4)=CC=3)C2=C1 AYXBAIULRDEVAS-UHFFFAOYSA-N 0.000 description 1
- 125000002474 dimethylaminoethoxy group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])O* 0.000 description 1
- 229940042399 direct acting antivirals protease inhibitors Drugs 0.000 description 1
- KAKKHKRHCKCAGH-UHFFFAOYSA-L disodium;(4-nitrophenyl) phosphate;hexahydrate Chemical compound O.O.O.O.O.O.[Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1 KAKKHKRHCKCAGH-UHFFFAOYSA-L 0.000 description 1
- 239000000890 drug combination Substances 0.000 description 1
- 238000009510 drug design Methods 0.000 description 1
- 238000007876 drug discovery Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229960000366 emtricitabine Drugs 0.000 description 1
- 229960002062 enfuvirtide Drugs 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 229940072253 epivir Drugs 0.000 description 1
- QGYKRMZPOOILBA-UHFFFAOYSA-N ethyl (2e)-2-amino-2-hydroxyiminoacetate Chemical compound CCOC(=O)C(\N)=N\O QGYKRMZPOOILBA-UHFFFAOYSA-N 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 229960002049 etravirine Drugs 0.000 description 1
- PYGWGZALEOIKDF-UHFFFAOYSA-N etravirine Chemical compound CC1=CC(C#N)=CC(C)=C1OC1=NC(NC=2C=CC(=CC=2)C#N)=NC(N)=C1Br PYGWGZALEOIKDF-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 229960004396 famciclovir Drugs 0.000 description 1
- GGXKWVWZWMLJEH-UHFFFAOYSA-N famcyclovir Chemical compound N1=C(N)N=C2N(CCC(COC(=O)C)COC(C)=O)C=NC2=C1 GGXKWVWZWMLJEH-UHFFFAOYSA-N 0.000 description 1
- RWTNPBWLLIMQHL-UHFFFAOYSA-N fexofenadine Chemical compound C1=CC(C(C)(C(O)=O)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 RWTNPBWLLIMQHL-UHFFFAOYSA-N 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- MHMNJMPURVTYEJ-UHFFFAOYSA-N fluorescein-5-isothiocyanate Chemical compound O1C(=O)C2=CC(N=C=S)=CC=C2C21C1=CC=C(O)C=C1OC1=CC(O)=CC=C21 MHMNJMPURVTYEJ-UHFFFAOYSA-N 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 229960002963 ganciclovir Drugs 0.000 description 1
- 210000004392 genitalia Anatomy 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000002390 heteroarenes Chemical group 0.000 description 1
- 102000055647 human CSF2RB Human genes 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- MPGWGYQTRSNGDD-UHFFFAOYSA-N hypericin Chemical compound OC1=CC(O)=C(C2=O)C3=C1C1C(O)=CC(=O)C(C4=O)=C1C1=C3C3=C2C(O)=CC(C)=C3C2=C1C4=C(O)C=C2C MPGWGYQTRSNGDD-UHFFFAOYSA-N 0.000 description 1
- 229940005608 hypericin Drugs 0.000 description 1
- PHOKTTKFQUYZPI-UHFFFAOYSA-N hypericin Natural products Cc1cc(O)c2c3C(=O)C(=Cc4c(O)c5c(O)cc(O)c6c7C(=O)C(=Cc8c(C)c1c2c(c78)c(c34)c56)O)O PHOKTTKFQUYZPI-UHFFFAOYSA-N 0.000 description 1
- 238000005417 image-selected in vivo spectroscopy Methods 0.000 description 1
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 description 1
- 125000002140 imidazol-4-yl group Chemical group [H]N1C([H])=NC([*])=C1[H] 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 210000000987 immune system Anatomy 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 238000012739 integrated shape imaging system Methods 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 229940079322 interferon Drugs 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- DQRZDIMTJNNJHB-UHFFFAOYSA-N isis 2922 Chemical compound O=C1NC(=O)C(C)=CN1C1OC(COP(O)(=S)OC2C(OC(C2)N2C(NC(=O)C(C)=C2)=O)COP(O)(=S)OC2C(OC(C2)N2C(NC(=O)C(C)=C2)=O)COP(O)(=S)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(=S)OC2C(OC(C2)N2C(N=C(N)C=C2)=O)COP(O)(=S)OC2C(OC(C2)N2C3=C(C(NC(N)=N3)=O)N=C2)COP(O)(O)=S)C(OP(O)(=S)OCC2C(CC(O2)N2C3=C(C(NC(N)=N3)=O)N=C2)OP(O)(=S)OCC2C(CC(O2)N2C(N=C(N)C=C2)=O)OP(O)(=S)OCC2C(CC(O2)N2C(NC(=O)C(C)=C2)=O)OP(O)(=S)OCC2C(CC(O2)N2C(N=C(N)C=C2)=O)OP(O)(=S)OCC2C(CC(O2)N2C(NC(=O)C(C)=C2)=O)OP(O)(=S)OCC2C(CC(O2)N2C(NC(=O)C(C)=C2)=O)OP(O)(=S)OCC2C(CC(O2)N2C(N=C(N)C=C2)=O)OP(O)(=S)OCC2C(CC(O2)N2C(NC(=O)C(C)=C2)=O)OP(O)(=S)OCC2C(CC(O2)N2C(NC(=O)C(C)=C2)=O)OP(O)(=S)OCC2C(CC(O2)N2C(N=C(N)C=C2)=O)OP(O)(=S)OCC2C(CC(O2)N2C(NC(=O)C(C)=C2)=O)OP(O)(=S)OCC2C(CC(O2)N2C(NC(=O)C(C)=C2)=O)OP(O)(=S)OCC2C(CC(O2)N2C3=C(C(NC(N)=N3)=O)N=C2)OP(S)(=O)OCC2C(CC(O2)N2C(N=C(N)C=C2)=O)OP(O)(=S)OCC2C(CC(O2)N2C3=C(C(NC(N)=N3)=O)N=C2)O)C1 DQRZDIMTJNNJHB-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000003384 isochromanyl group Chemical group C1(OCCC2=CC=CC=C12)* 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- SRJOCJYGOFTFLH-UHFFFAOYSA-N isonipecotic acid Chemical compound OC(=O)C1CCNCC1 SRJOCJYGOFTFLH-UHFFFAOYSA-N 0.000 description 1
- 125000003965 isoxazolidinyl group Chemical group 0.000 description 1
- 229940112586 kaletra Drugs 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- BWHLPLXXIDYSNW-UHFFFAOYSA-N ketorolac tromethamine Chemical compound OCC(N)(CO)CO.OC(=O)C1CCN2C1=CC=C2C(=O)C1=CC=CC=C1 BWHLPLXXIDYSNW-UHFFFAOYSA-N 0.000 description 1
- 108010075606 kynostatin 272 Proteins 0.000 description 1
- HXEACLLIILLPRG-RXMQYKEDSA-N l-pipecolic acid Natural products OC(=O)[C@H]1CCCCN1 HXEACLLIILLPRG-RXMQYKEDSA-N 0.000 description 1
- 229960001627 lamivudine Drugs 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 229940121292 leronlimab Drugs 0.000 description 1
- 229950005339 lobucavir Drugs 0.000 description 1
- 210000004698 lymphocyte Anatomy 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 1
- CXFXOKYUPVBLLF-UHFFFAOYSA-N methyl 2-(diethoxymethyl)-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxylate Chemical compound CCOC(OCC)C1=NC(O)=C(O)C(C(=O)OC)=N1 CXFXOKYUPVBLLF-UHFFFAOYSA-N 0.000 description 1
- OFWITZOSWVSDTN-UHFFFAOYSA-N methyl 2-benzyl-5-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-(2-morpholin-4-ylethoxy)pyrimidine-4-carboxylate Chemical compound N=1C(OCCN2CCOCC2)=C(OC(=O)OC(C)(C)C)C(C(=O)OC)=NC=1CC1=CC=CC=C1 OFWITZOSWVSDTN-UHFFFAOYSA-N 0.000 description 1
- NPJPUPYCOQFYIF-UHFFFAOYSA-N methyl 5,6-dibenzoyloxy-2-(4-methylphenyl)pyrimidine-4-carboxylate Chemical compound C=1C=CC=CC=1C(=O)OC=1C(C(=O)OC)=NC(C=2C=CC(C)=CC=2)=NC=1OC(=O)C1=CC=CC=C1 NPJPUPYCOQFYIF-UHFFFAOYSA-N 0.000 description 1
- ZMILJBYXMOODPB-UHFFFAOYSA-N methyl 5-hydroxy-2-morpholin-3-yl-4-oxo-1h-pyrimidine-6-carboxylate Chemical compound OC1=C(O)C(C(=O)OC)=NC(C2NCCOC2)=N1 ZMILJBYXMOODPB-UHFFFAOYSA-N 0.000 description 1
- QAIMSDCSXBBWEK-UHFFFAOYSA-N methyl 5-hydroxy-4-oxo-2-thiophen-2-yl-1h-pyrimidine-6-carboxylate Chemical compound OC1=C(O)C(C(=O)OC)=NC(C=2SC=CC=2)=N1 QAIMSDCSXBBWEK-UHFFFAOYSA-N 0.000 description 1
- OLXYLDUSSBULGU-UHFFFAOYSA-N methyl pyridine-4-carboxylate Chemical compound COC(=O)C1=CC=NC=C1 OLXYLDUSSBULGU-UHFFFAOYSA-N 0.000 description 1
- GXZQHMHLHHUHAM-UHFFFAOYSA-N methyl pyrimidine-4-carboxylate Chemical compound COC(=O)C1=CC=NC=N1 GXZQHMHLHHUHAM-UHFFFAOYSA-N 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 238000003032 molecular docking Methods 0.000 description 1
- 125000004312 morpholin-2-yl group Chemical group [H]N1C([H])([H])C([H])([H])OC([H])(*)C1([H])[H] 0.000 description 1
- JUNOWSHJELIDQP-UHFFFAOYSA-N morpholin-4-ium-3-carboxylate Chemical compound OC(=O)C1COCCN1 JUNOWSHJELIDQP-UHFFFAOYSA-N 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 229950008798 mozenavir Drugs 0.000 description 1
- NKMNPRXPUZINOM-UHFFFAOYSA-N n'-hydroxythiophene-2-carboximidamide Chemical compound ON=C(N)C1=CC=CS1 NKMNPRXPUZINOM-UHFFFAOYSA-N 0.000 description 1
- ULWOJODHECIZAU-UHFFFAOYSA-N n,n-diethylpropan-2-amine Chemical compound CCN(CC)C(C)C ULWOJODHECIZAU-UHFFFAOYSA-N 0.000 description 1
- KTENEZRUNAHSBN-UHFFFAOYSA-N n-(1-phenylethyl)pyrimidine-4-carboxamide Chemical compound C=1C=CC=CC=1C(C)NC(=O)C1=CC=NC=N1 KTENEZRUNAHSBN-UHFFFAOYSA-N 0.000 description 1
- FEUDFZCTINTQPR-UHFFFAOYSA-N n-[(2,5-difluorophenyl)methyl]-5-hydroxy-4-oxo-2-thiophen-2-yl-1h-pyrimidine-6-carboxamide Chemical compound OC=1C(O)=NC(C=2SC=CC=2)=NC=1C(=O)NCC1=CC(F)=CC=C1F FEUDFZCTINTQPR-UHFFFAOYSA-N 0.000 description 1
- BMKKHIUJDVRPKP-UHFFFAOYSA-N n-[(3-methoxyphenyl)methyl]pyrimidine-4-carboxamide Chemical compound COC1=CC=CC(CNC(=O)C=2N=CN=CC=2)=C1 BMKKHIUJDVRPKP-UHFFFAOYSA-N 0.000 description 1
- VMYZZYQLHKIBQJ-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-2-(1-formylpiperidin-3-yl)-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound OC=1C(O)=NC(C2CN(CCC2)C=O)=NC=1C(=O)NCC1=CC=C(F)C=C1 VMYZZYQLHKIBQJ-UHFFFAOYSA-N 0.000 description 1
- IWSQPVPGKWTVFI-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-5-hydroxy-2-(morpholin-4-ylmethyl)-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound N=1C(C(=O)NCC=2C=CC(F)=CC=2)=C(O)C(O)=NC=1CN1CCOCC1 IWSQPVPGKWTVFI-UHFFFAOYSA-N 0.000 description 1
- QUOVSBFFBCDNHK-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-5-hydroxy-2-methyl-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound CC1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 QUOVSBFFBCDNHK-UHFFFAOYSA-N 0.000 description 1
- SBXSQJQWRFGTTN-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-5-hydroxy-2-morpholin-3-yl-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound OC=1C(O)=NC(C2NCCOC2)=NC=1C(=O)NCC1=CC=C(F)C=C1 SBXSQJQWRFGTTN-UHFFFAOYSA-N 0.000 description 1
- AFNUBWCLISMHFF-MOPGFXCFSA-N n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-2-[(2s,4r)-4-phenylmethoxypiperidin-2-yl]-1h-pyrimidine-6-carboxamide Chemical compound OC=1C(O)=NC([C@H]2NCC[C@H](C2)OCC=2C=CC=CC=2)=NC=1C(=O)NCC1=CC=C(F)C=C1 AFNUBWCLISMHFF-MOPGFXCFSA-N 0.000 description 1
- ZLOFMAVYNFGKRE-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-5-hydroxy-4-oxo-2-pyrrolidin-2-yl-1h-pyrimidine-6-carboxamide Chemical compound OC=1C(O)=NC(C2NCCC2)=NC=1C(=O)NCC1=CC=C(F)C=C1 ZLOFMAVYNFGKRE-UHFFFAOYSA-N 0.000 description 1
- IFYDWYVPVAMGRO-UHFFFAOYSA-N n-[3-(dimethylamino)propyl]tetradecanamide Chemical compound CCCCCCCCCCCCCC(=O)NCCCN(C)C IFYDWYVPVAMGRO-UHFFFAOYSA-N 0.000 description 1
- MFJZWABXKFIBQM-UHFFFAOYSA-N n-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-5-hydroxy-4-oxo-2-propan-2-yl-1h-pyrimidine-6-carboxamide Chemical compound CC(C)C1=NC(O)=C(O)C(C(=O)NCC=2C(=CC(F)=CC=2)C(F)(F)F)=N1 MFJZWABXKFIBQM-UHFFFAOYSA-N 0.000 description 1
- MXGXWWCOLZRNDY-UHFFFAOYSA-N n-benzyl-2-(1-formylpiperidin-3-yl)-5-hydroxy-4-oxo-1h-pyrimidine-6-carboxamide Chemical compound OC=1C(O)=NC(C2CN(CCC2)C=O)=NC=1C(=O)NCC1=CC=CC=C1 MXGXWWCOLZRNDY-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- XOCDZEUPMBOJKX-UHFFFAOYSA-N n-methylpyrimidine-4-carboxamide Chemical compound CNC(=O)C1=CC=NC=N1 XOCDZEUPMBOJKX-UHFFFAOYSA-N 0.000 description 1
- 239000007922 nasal spray Substances 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 229960000689 nevirapine Drugs 0.000 description 1
- 150000002829 nitrogen Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- 229940078552 o-xylene Drugs 0.000 description 1
- 239000013110 organic ligand Substances 0.000 description 1
- LVSJDHGRKAEGLX-UHFFFAOYSA-N oxolane;2,2,2-trifluoroacetic acid Chemical compound C1CCOC1.OC(=O)C(F)(F)F LVSJDHGRKAEGLX-UHFFFAOYSA-N 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 210000001428 peripheral nervous system Anatomy 0.000 description 1
- 230000005043 peripheral vision Effects 0.000 description 1
- 239000008177 pharmaceutical agent Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- 229960005323 phenoxyethanol Drugs 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- ZJAOAACCNHFJAH-UHFFFAOYSA-N phosphonoformic acid Chemical compound OC(=O)P(O)(O)=O ZJAOAACCNHFJAH-UHFFFAOYSA-N 0.000 description 1
- 229940081066 picolinic acid Drugs 0.000 description 1
- HXEACLLIILLPRG-UHFFFAOYSA-N pipecolic acid Chemical compound OC(=O)C1CCCCN1 HXEACLLIILLPRG-UHFFFAOYSA-N 0.000 description 1
- RIXVESSVKLKKFV-UHFFFAOYSA-N piperazine-1,4-dicarboxylic acid Chemical compound OC(=O)N1CCN(C(O)=O)CC1 RIXVESSVKLKKFV-UHFFFAOYSA-N 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-M pivalate Chemical compound CC(C)(C)C([O-])=O IUGYQRQAERSCNH-UHFFFAOYSA-M 0.000 description 1
- 229950010765 pivalate Drugs 0.000 description 1
- YIQPUIGJQJDJOS-UHFFFAOYSA-N plerixafor Chemical compound C=1C=C(CN2CCNCCCNCCNCCC2)C=CC=1CN1CCCNCCNCCCNCC1 YIQPUIGJQJDJOS-UHFFFAOYSA-N 0.000 description 1
- 229960002169 plerixafor Drugs 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- FYPMFJGVHOHGLL-UHFFFAOYSA-N probucol Chemical compound C=1C(C(C)(C)C)=C(O)C(C(C)(C)C)=CC=1SC(C)(C)SC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 FYPMFJGVHOHGLL-UHFFFAOYSA-N 0.000 description 1
- 229960003912 probucol Drugs 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- SSKVDVBQSWQEGJ-UHFFFAOYSA-N pseudohypericin Natural products C12=C(O)C=C(O)C(C(C=3C(O)=CC(O)=C4C=33)=O)=C2C3=C2C3=C4C(C)=CC(O)=C3C(=O)C3=C(O)C=C(O)C1=C32 SSKVDVBQSWQEGJ-UHFFFAOYSA-N 0.000 description 1
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 1
- UDHZYEWSTDYKCZ-UHFFFAOYSA-N pyridine-4-carboxamide;hydrochloride Chemical compound Cl.NC(=O)C1=CC=NC=C1 UDHZYEWSTDYKCZ-UHFFFAOYSA-N 0.000 description 1
- CYCHPJBNLPTBMG-UHFFFAOYSA-N pyrimidine-2,4-dicarboxamide Chemical compound NC(=O)C1=CC=NC(C(N)=O)=N1 CYCHPJBNLPTBMG-UHFFFAOYSA-N 0.000 description 1
- BZXVQZQFUROPDY-UHFFFAOYSA-N pyrimidine-4-carboximidamide;hydrochloride Chemical compound Cl.NC(=N)C1=CC=NC=N1 BZXVQZQFUROPDY-UHFFFAOYSA-N 0.000 description 1
- YPOXGDJGKBXRFP-UHFFFAOYSA-M pyrimidine-4-carboxylate Chemical compound [O-]C(=O)C1=CC=NC=N1 YPOXGDJGKBXRFP-UHFFFAOYSA-M 0.000 description 1
- DRGCXLJWMQGVJA-UHFFFAOYSA-N pyrimidine;dihydrochloride Chemical compound Cl.Cl.C1=CN=CN=C1 DRGCXLJWMQGVJA-UHFFFAOYSA-N 0.000 description 1
- NYCVCXMSZNOGDH-UHFFFAOYSA-N pyrrolidine-1-carboxylic acid Chemical compound OC(=O)N1CCCC1 NYCVCXMSZNOGDH-UHFFFAOYSA-N 0.000 description 1
- IQHXABCGSFAKPN-UHFFFAOYSA-N pyrrolidine-3-carboxamide Chemical compound NC(=O)C1CCNC1 IQHXABCGSFAKPN-UHFFFAOYSA-N 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 108700018720 recombinant interferon alpha 2b-like Proteins 0.000 description 1
- 230000008439 repair process Effects 0.000 description 1
- 229940063627 rescriptor Drugs 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 229960000329 ribavirin Drugs 0.000 description 1
- HZCAHMRRMINHDJ-DBRKOABJSA-N ribavirin Natural products O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1N=CN=C1 HZCAHMRRMINHDJ-DBRKOABJSA-N 0.000 description 1
- 229960000885 rifabutin Drugs 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 238000002390 rotary evaporation Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000012163 sequencing technique Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- JJICLMJFIKGAAU-UHFFFAOYSA-M sodium;2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)purin-6-olate Chemical compound [Na+].NC1=NC([O-])=C2N=CN(COC(CO)CO)C2=N1 JJICLMJFIKGAAU-UHFFFAOYSA-M 0.000 description 1
- RMLUKZWYIKEASN-UHFFFAOYSA-M sodium;2-amino-9-(2-hydroxyethoxymethyl)purin-6-olate Chemical compound [Na+].O=C1[N-]C(N)=NC2=C1N=CN2COCCO RMLUKZWYIKEASN-UHFFFAOYSA-M 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 229960001203 stavudine Drugs 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000006103 sulfonylation Effects 0.000 description 1
- 238000005694 sulfonylation reaction Methods 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 229940054565 sustiva Drugs 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229960004556 tenofovir Drugs 0.000 description 1
- 229960001355 tenofovir disoproxil Drugs 0.000 description 1
- 125000006633 tert-butoxycarbonylamino group Chemical group 0.000 description 1
- MDMSZBHMBCNYNO-UHFFFAOYSA-N tert-butyl 2-cyanopyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCCC1C#N MDMSZBHMBCNYNO-UHFFFAOYSA-N 0.000 description 1
- HQYQZXOVQCEILY-UHFFFAOYSA-N tert-butyl 3-[6-[(4-fluorophenyl)methylcarbamoyl]-5-hydroxy-4-oxo-1h-pyrimidin-2-yl]-3,4-dimethylpiperazine-1-carboxylate Chemical compound CN1CCN(C(=O)OC(C)(C)C)CC1(C)C1=NC(O)=C(O)C(C(=O)NCC=2C=CC(F)=CC=2)=N1 HQYQZXOVQCEILY-UHFFFAOYSA-N 0.000 description 1
- CTJYSVRXJDACIO-UHFFFAOYSA-N tert-butyl thiomorpholine-4-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCSCC1 CTJYSVRXJDACIO-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 101150002091 tfa1 gene Proteins 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 229940104230 thymidine Drugs 0.000 description 1
- ZFEAMMNVDPDEGE-LGRGJMMZSA-N tifuvirtide Chemical compound C([C@H](NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(C)=O)[C@@H](C)CC)[C@@H](C)O)[C@@H](C)CC)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(N)=O)C1=CC=C(O)C=C1 ZFEAMMNVDPDEGE-LGRGJMMZSA-N 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 125000000165 tricyclic carbocycle group Chemical group 0.000 description 1
- 125000000169 tricyclic heterocycle group Chemical group 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 229940111527 trizivir Drugs 0.000 description 1
- 229940093257 valacyclovir Drugs 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 229940023080 viracept Drugs 0.000 description 1
- 229940098802 viramune Drugs 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
- 229940087450 zerit Drugs 0.000 description 1
- 229940052255 ziagen Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/52—Two oxygen atoms
- C07D239/54—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals
- C07D239/545—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals with other hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/557—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals with other hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms, e.g. orotic acid
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
- A61P31/14—Antivirals for RNA viruses
- A61P31/18—Antivirals for RNA viruses for HIV
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/06—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/08—Bridged systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/10—Spiro-condensed systems
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Virology (AREA)
- General Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Oncology (AREA)
- Tropical Medicine & Parasitology (AREA)
- Communicable Diseases (AREA)
- Molecular Biology (AREA)
- AIDS & HIV (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Medicines Containing Plant Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US34819501P | 2001-10-26 | 2001-10-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PT1441734E true PT1441734E (pt) | 2007-05-31 |
Family
ID=23366990
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PT02801949T PT1441734E (pt) | 2001-10-26 | 2002-10-21 | Di-hidroxipirimidinocarboxamidas inibidoras da integrase do vih |
Country Status (13)
| Country | Link |
|---|---|
| US (2) | US7232819B2 (enExample) |
| EP (1) | EP1441734B1 (enExample) |
| JP (1) | JP4351053B2 (enExample) |
| AT (1) | ATE355064T1 (enExample) |
| AU (1) | AU2002334205B2 (enExample) |
| CA (1) | CA2463975A1 (enExample) |
| CY (1) | CY1106606T1 (enExample) |
| DE (1) | DE60218511T2 (enExample) |
| DK (1) | DK1441734T3 (enExample) |
| ES (1) | ES2281565T3 (enExample) |
| PT (1) | PT1441734E (enExample) |
| SI (1) | SI1441734T1 (enExample) |
| WO (1) | WO2003035076A1 (enExample) |
Families Citing this family (164)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6545004B1 (en) | 1999-10-27 | 2003-04-08 | Cytokinetics, Inc. | Methods and compositions utilizing quinazolinones |
| US7230000B1 (en) | 1999-10-27 | 2007-06-12 | Cytokinetics, Incorporated | Methods and compositions utilizing quinazolinones |
| IL155089A0 (en) | 2000-10-12 | 2003-10-31 | Merck & Co Inc | Aza and polyaza-naphthalenyl carboxamides useful as hiv integrase inhibitors |
| CA2425625A1 (en) | 2000-10-12 | 2002-07-18 | Merck & Co., Inc. | Aza-and polyaza-naphthalenyl carboxamides useful as hiv integrase inhibitors |
| EP1326611B1 (en) | 2000-10-12 | 2007-06-13 | Merck & Co., Inc. | Aza- and polyaza-naphthalenyl-carboxamides useful as hiv integrase inhibitors |
| US7169932B2 (en) | 2001-06-11 | 2007-01-30 | Pfizer Inc. | HIV protease inhibitors, compositions containing the same, their pharmaceutical uses, material for their synthesis |
| US7094909B2 (en) | 2001-06-11 | 2006-08-22 | Agouron Pharmaceuticals, Inc. | HIV protease inhibitors, compositions containing the same, their pharmaceutical uses and materials for their synthesis |
| HN2002000136A (es) | 2001-06-11 | 2003-07-31 | Basf Ag | Inhibidores de la proteasa del virus hiv, compuestos que contienen a los mismos, sus usos farmaceuticos y los materiales para su sintesis |
| CN101513402B (zh) | 2001-08-10 | 2012-03-21 | 盐野义制药株式会社 | 抗病毒药 |
| AR036256A1 (es) | 2001-08-17 | 2004-08-25 | Merck & Co Inc | Sal sodica de un inhibidor de integrasa del vih, procesos para su preparacion, composiciones farmaceuticas que lo contienen y su uso para la manufactura de un medicamento |
| AU2002334205B2 (en) * | 2001-10-26 | 2007-07-05 | Istituto Di Ricerche Di Biologia Molecolara P. Angeletti Spa | Dihydroxypyrimidine carboxamide inhibitors of HIV integrase |
| DK1441735T3 (da) * | 2001-10-26 | 2006-06-12 | Angeletti P Ist Richerche Bio | N-substituerede hydroxypyrimidinon-carboxamid-inhibitorer af HIV-integrase |
| JP2005529076A (ja) | 2002-02-15 | 2005-09-29 | サイトキネティクス・インコーポレーテッド | キナゾリノンの合成 |
| WO2003077850A2 (en) | 2002-03-15 | 2003-09-25 | Merck & Co., Inc. | N-(substituted benzyl)-8-hydroxy-1,6-naphthyridine-7- carboxamides useful as hiv integrase inhibitors |
| WO2003097053A1 (en) | 2002-05-09 | 2003-11-27 | Cytokinetics, Inc. | Compounds, compositions, and methods |
| JP2006508030A (ja) | 2002-05-09 | 2006-03-09 | サイトキネティクス・インコーポレーテッド | ピリミジノン化合物、組成物および方法 |
| US20050234080A1 (en) * | 2002-05-23 | 2005-10-20 | Coleman Paul J | Mitotic kinesin inhibitors |
| EP1513820A4 (en) | 2002-05-23 | 2006-09-13 | Cytokinetics Inc | COMPOUNDS, COMPOSITIONS AND METHODS |
| US7109186B2 (en) | 2002-07-09 | 2006-09-19 | Bristol-Myers Squibb Company | HIV integrase inhibitors |
| EP1537089A4 (en) | 2002-07-23 | 2008-04-16 | Cytokinetics Inc | CONNECTIONS, COMPOSITIONS AND PROCEDURES |
| ATE404563T1 (de) | 2002-09-11 | 2008-08-15 | Merck & Co Inc | 8-hydroxy-1- oxotetrahydropyrrolopyrazinverbindungen, die sich als inhibitoren von hiv-integrase eignen |
| US7517532B2 (en) | 2002-09-11 | 2009-04-14 | Merck & Co., Inc. | Dihydroxypyridopyrazine-1,6-dione compounds useful as HIV integrase inhibitors |
| EP1558083A4 (en) | 2002-09-30 | 2008-04-16 | Cytokinetics Inc | COMPOUNDS, COMPOSITIONS AND METHODS |
| PA8586801A1 (es) | 2002-10-31 | 2005-02-04 | Pfizer | Inhibidores de hiv-integrasa, composiciones farmaceuticas y metodos para su uso |
| KR20050087865A (ko) * | 2002-12-27 | 2005-08-31 | 이스티투토 디 리세르쉐 디 비올로지아 몰레콜라레 피. 안젤레티에스.피.에이. | HIV 인테그라제 억제제로서 유용한테트라하이드로-4H-피리도[1,2-a]피리미딘 및 관련화합물 |
| WO2004062613A2 (en) * | 2003-01-13 | 2004-07-29 | Bristol-Myers Squibb Company | Hiv integrase inhibitors |
| BRPI0407052A (pt) | 2003-01-27 | 2006-01-17 | Pfizer | Inibidores da hiv-integrase, composições farmacêuticas, e métodos para sua utilização |
| US7037908B2 (en) | 2003-04-24 | 2006-05-02 | Bristol-Myers Squibb Company | HIV integrase inhibitors |
| TW200510425A (en) | 2003-08-13 | 2005-03-16 | Japan Tobacco Inc | Nitrogen-containing fused ring compound and use thereof as HIV integrase inhibitor |
| US7435735B2 (en) * | 2003-10-20 | 2008-10-14 | Merck & Co., Inc. | Hydroxy pyridopyrrolopyrazine dione compounds useful as HIV integrase inhibitors |
| US20050090668A1 (en) * | 2003-10-28 | 2005-04-28 | Dreher Spencer D. | Preparation of 5-hydroxy-6-oxo-1,6-dihydropyrimidine compounds |
| WO2005042524A1 (en) * | 2003-10-30 | 2005-05-12 | Virochem Pharma Inc. | Pyridine carboxamide and methods for inhibiting hiv integrase |
| EP1682534A2 (en) * | 2003-11-03 | 2006-07-26 | Cytokinetics, Inc. | Pyrimidin-4-one compounds, compositions, and methods |
| WO2005061460A1 (en) | 2003-12-08 | 2005-07-07 | Cytokinetics, Inc. | Compounds, compositions, and methods |
| AR046938A1 (es) * | 2003-12-12 | 2006-01-04 | Merck & Co Inc | Procedimiento para preparar hexahidropirimido[1,2-a]azepin-2-carboxilatos y compuetos similares |
| WO2005060654A2 (en) | 2003-12-19 | 2005-07-07 | Merck & Co., Inc. | Mitotic kinesin inhibitors |
| TW200526635A (en) * | 2003-12-22 | 2005-08-16 | Shionogi & Co | Hydroxypyrimidinone derivative having HIV integrase inhibitory activity |
| AU2005206511A1 (en) * | 2004-01-12 | 2005-08-04 | Gilead Sciences, Inc. | Pyrimidyl phosphonate antiviral compounds and methods of use |
| JP2007528396A (ja) * | 2004-03-09 | 2007-10-11 | メルク エンド カムパニー インコーポレーテッド | Hivインテグラーゼ阻害薬 |
| US20070161639A1 (en) | 2004-03-09 | 2007-07-12 | Philip Jones | Hiv integrase inhibitors |
| EP1725102A4 (en) | 2004-03-09 | 2009-04-29 | Merck & Co Inc | HIV integrase |
| WO2005087768A1 (en) | 2004-03-09 | 2005-09-22 | Merck & Co., Inc. | Hiv integrase inhibitors |
| ATE374775T1 (de) | 2004-04-26 | 2007-10-15 | Pfizer | Inhibitoren des hiv-integrase-enzyms |
| CA2564356A1 (en) | 2004-04-26 | 2005-11-03 | Pfizer Inc. | Pyrrolopyridine derivatives and their use as hiv-integrase inhibitors |
| US7618981B2 (en) * | 2004-05-06 | 2009-11-17 | Cytokinetics, Inc. | Imidazopyridinyl-benzamide anti-cancer agents |
| US7504413B2 (en) * | 2004-05-06 | 2009-03-17 | Cytokinetics, Inc. | N-(4-(imidazo[1,2A]pyridin-YL)phenethyl)benzamide inhibitors of the mitotic kinesin CENP-E for treating certain cellular proliferation diseases |
| US7795448B2 (en) * | 2004-05-06 | 2010-09-14 | Cytokinetics, Incorporated | Imidazoyl-benzamide anti-cancer agents |
| CN1964975B (zh) * | 2004-05-07 | 2011-11-30 | 默沙东公司 | Hiv整合酶抑制剂 |
| US7273859B2 (en) | 2004-05-12 | 2007-09-25 | Bristol-Myers Squibb Company | HIV integrase inhibitors: cyclic pyrimidinone compounds |
| US7115601B2 (en) | 2004-05-18 | 2006-10-03 | Bristol-Myers Squibb Company | HIV integrase inhibitors |
| US7192948B2 (en) | 2004-05-28 | 2007-03-20 | Bristol-Myers Squibb Company | Bicyclic heterocycles as HIV integrase inhibitors |
| US7173022B2 (en) | 2004-05-28 | 2007-02-06 | Bristol-Myers Squibb Company | Bicyclic heterocycles as HIV integrase inhibitors |
| US7157447B2 (en) | 2004-05-28 | 2007-01-02 | Bristol-Myers Squibb Company | Bicyclic heterocycles as HIV integrase inhibitors |
| US7176196B2 (en) | 2004-05-28 | 2007-02-13 | Bristol-Myers Squibb Company | Bicyclic heterocycles as HIV integrase inhibitors |
| EP1758585A4 (en) | 2004-06-09 | 2009-07-22 | Merck & Co Inc | HIV integrase |
| US7429604B2 (en) * | 2004-06-15 | 2008-09-30 | Bristol Myers Squibb Company | Six-membered heterocycles useful as serine protease inhibitors |
| WO2006030807A1 (ja) * | 2004-09-15 | 2006-03-23 | Shionogi & Co., Ltd. | Hivインテグラーゼ阻害活性を有するカルバモイルピリドン誘導体 |
| JP2008519850A (ja) | 2004-11-10 | 2008-06-12 | シンタ ファーマシューティカルズ コーポレーション | Il−12調節化合物 |
| TR201907729T4 (tr) * | 2004-12-03 | 2019-06-21 | Merck Sharp & Dohme | Bir anti-çekirdekleştirici ajan içeren farmasötik bileşim. |
| US8852632B2 (en) * | 2004-12-03 | 2014-10-07 | Merck Sharp & Dohme Corp. | Pharmaceutical formulation containing a release rate controlling composition |
| US20070259894A1 (en) * | 2004-12-03 | 2007-11-08 | Kelem Kassahun | Use of Atazanavir for Improving the Pharmacokinetics of Drugs Metabolized by Ugt1a1 |
| ATE516026T1 (de) | 2005-02-21 | 2011-07-15 | Shionogi & Co | Bicyclisches carbamoylpyridonderivat mit hiv- integrase-hemmender wirkung |
| AU2006228278C1 (en) * | 2005-03-31 | 2011-06-23 | Msd Italia S.R.L. | HIV integrase inhibitors |
| EP3187225B1 (en) | 2005-04-28 | 2022-01-05 | VIIV Healthcare Company | Polycyclic carbamoylpyridone derivative having hiv integrase inhibitory activity |
| EP1881825B1 (en) * | 2005-05-10 | 2013-07-24 | Merck Sharp & Dohme Corp. | Hiv integrase inhibitors |
| WO2007007588A1 (ja) * | 2005-07-08 | 2007-01-18 | Ono Pharmaceutical Co., Ltd. | 平面性を有する環状基を母核とする化合物 |
| WO2007014352A2 (en) * | 2005-07-27 | 2007-02-01 | Gilead Sciences, Inc. | Antiviral phosphonate conjugates for inhibition of hiv |
| EP1937678B1 (en) * | 2005-10-04 | 2011-07-27 | Istituto Di Ricerche Di Biologia Molecolare P. Angeletti S.P.A. | Hiv integrase inhibitors |
| CA2625673A1 (en) * | 2005-10-27 | 2007-05-03 | Merck & Co., Inc. | Hiv integrase inhibitors |
| KR20080064182A (ko) | 2005-10-27 | 2008-07-08 | 시오노기세야쿠 가부시키가이샤 | Hiv 인테그라아제 억제활성을 가지는 다환성카르바모일피리돈 유도체 |
| JP2009514865A (ja) * | 2005-11-02 | 2009-04-09 | サイトキネティクス・インコーポレーテッド | 有糸分裂キネシン阻害剤 |
| US20070129379A1 (en) * | 2005-12-01 | 2007-06-07 | Bristol-Myers Squibb Company | Hiv integrase inhibitors |
| WO2008004100A2 (en) | 2006-07-05 | 2008-01-10 | Pfizer Products Inc. | Therapeutic compounds |
| JP2009543867A (ja) * | 2006-07-17 | 2009-12-10 | メルク エンド カムパニー インコーポレーテッド | 抗hiv剤としての1−ヒドロキシナフチリジン化合物 |
| WO2008048538A1 (en) * | 2006-10-18 | 2008-04-24 | Merck & Co., Inc. | Hiv integrase inhibitors |
| US7763630B2 (en) * | 2007-06-06 | 2010-07-27 | Bristol-Myers Squibb Company | HIV integrase inhibitors |
| EA201170537A1 (ru) * | 2008-10-06 | 2011-12-30 | Мерк Шарп Энд Домэ Корп. | Ингибиторы вич-интегразы |
| WO2010091310A1 (en) | 2009-02-06 | 2010-08-12 | Elan Pharmaceuticals, Inc. | Inhibitors of jun n-terminal kinase |
| US8143244B2 (en) * | 2009-02-26 | 2012-03-27 | Bristol-Myers Squibb Company | Cyclopropyl fused indolobenzazepine HCV NS5B inhibitors |
| DE102009038123A1 (de) * | 2009-08-17 | 2011-02-24 | Aicuris Gmbh & Co. Kg | Substituierte (Thiazolyl-carbonyl)imidazolidinone und ihre Verwendung |
| US8383639B2 (en) | 2009-10-15 | 2013-02-26 | Bristol-Myers Squibb Company | HIV integrase inhibitors |
| HUE057248T2 (hu) | 2009-10-26 | 2022-04-28 | Merck Sharp & Dohme | Integráz inhibitort tartalmazó szilárd gyógyszerészeti kompozíciók |
| JP2013515692A (ja) | 2009-12-23 | 2013-05-09 | カトリック・ユニベルシティト・ルーヴァン | 新規抗ウイルス化合物 |
| US8283366B2 (en) | 2010-01-22 | 2012-10-09 | Ambrilia Biopharma, Inc. | Derivatives of pyridoxine for inhibiting HIV integrase |
| JP5766690B2 (ja) | 2010-04-12 | 2015-08-19 | 塩野義製薬株式会社 | インテグラーゼ阻害活性を有するピリドン誘導体 |
| KR20110123657A (ko) * | 2010-05-07 | 2011-11-15 | 에스케이케미칼주식회사 | 피콜린아마이드 및 피리미딘-4-카복사미드 화합물, 이의 제조방법 및 이를 함유하는 약제학적 조성물 |
| CN105330675A (zh) | 2010-11-15 | 2016-02-17 | Viiv保健英国有限公司 | Hiv复制的抑制剂 |
| EP2640705A2 (en) | 2010-11-15 | 2013-09-25 | Katholieke Universiteit Leuven | Novel antiviral compounds |
| GB201021104D0 (en) | 2010-12-13 | 2011-01-26 | Univ Leuven Kath | Novel compounds for the treatment of neurodegenerative diseases |
| US9540343B2 (en) * | 2011-07-06 | 2017-01-10 | Gilead Sciences, Inc. | Compounds for the treatment of HIV |
| RS56342B1 (sr) * | 2011-09-02 | 2017-12-29 | Purdue Pharma Lp | Pirimidini kao blokatori natrijumskog kanala |
| EP2774928B1 (en) | 2011-10-12 | 2017-08-30 | Shionogi & Co., Ltd. | Polycyclic pyridone derivative having integrase-inhibiting activity |
| US9013997B2 (en) * | 2012-06-01 | 2015-04-21 | Broadcom Corporation | System for performing distributed data cut-through |
| EP2885289A1 (en) * | 2012-08-06 | 2015-06-24 | Savira Pharmaceuticals GmbH | Dihydroxypyrimidine carbonic acid derivatives and their use in the treatment, amelioration or prevention of a viral disease |
| CN102911124B (zh) * | 2012-10-25 | 2015-11-25 | 山东大学 | 羟基嘧啶酮类化合物及其制备方法与应用 |
| WO2014099586A1 (en) | 2012-12-17 | 2014-06-26 | Merck Sharp & Dohme Corp. | 4-pyridinonetriazine derivatives as hiv integrase inhibitors |
| WO2014172188A2 (en) | 2013-04-16 | 2014-10-23 | Merck Sharp & Dohme Corp. | 4-pyridone derivative compounds and uses thereof as hiv integrase inhibitors |
| EP3330272B1 (en) | 2013-05-17 | 2021-02-17 | Merck Sharp & Dohme Corp. | Fused tricyclic heterocyclic compounds as hiv integrase inhibitors |
| EP3008044B1 (en) | 2013-06-13 | 2018-11-21 | Merck Sharp & Dohme Corp. | Fused tricyclic heterocyclic compounds as hiv integrase inhibitors |
| US10221161B2 (en) | 2013-08-14 | 2019-03-05 | Kalvista Pharmaceuticals Limited | Inhibitors of plasma kallikrein |
| TWI636047B (zh) | 2013-08-14 | 2018-09-21 | 英商卡爾維斯塔製藥有限公司 | 雜環衍生物 |
| UA117499C2 (uk) | 2013-09-27 | 2018-08-10 | Мерк Шарп Енд Доум Корп. | Заміщені похідні хінолізину, які можна використовувати як інгібітори інтегрази віл |
| EP3087060B1 (en) | 2013-12-23 | 2020-05-13 | Merck Sharp & Dohme Corp. | Pyrimidone carboxamide compounds as pde2 inhibitors |
| WO2015130964A1 (en) | 2014-02-28 | 2015-09-03 | Gilead Sciences, Inc. | Therapeutic compounds |
| EP3757105B1 (en) | 2014-08-22 | 2024-07-24 | Shionogi & Co., Ltd. | Polycyclic pyridone derivative having integrase inhibitory activity |
| US9463201B2 (en) | 2014-10-19 | 2016-10-11 | M.G. Therapeutics Ltd | Compositions and methods for the treatment of meibomian gland dysfunction |
| GB201421083D0 (en) | 2014-11-27 | 2015-01-14 | Kalvista Pharmaceuticals Ltd | Enzyme inhibitors |
| GB201421085D0 (en) | 2014-11-27 | 2015-01-14 | Kalvista Pharmaceuticals Ltd | New enzyme inhibitors |
| PT3578547T (pt) | 2015-02-16 | 2021-06-22 | The Provost Fellows Found Scholars And Other Members Of Board Of College Of Holy And Undivided Trini | Sulfonilureias e compostos relacionados e uso dos mesmos |
| WO2016145614A1 (en) | 2015-03-17 | 2016-09-22 | Merck Sharp & Dohme Corp. | Triazolyl pyrimidinone compounds as pde2 inhibitors |
| US10287269B2 (en) | 2015-03-26 | 2019-05-14 | Merck Sharp & Dohme Corp. | Pyrazolyl pyrimidinone compounds as PDE2 inhibitors |
| WO2016187788A1 (en) | 2015-05-25 | 2016-12-01 | Merck Sharp & Dohme Corp. | Fused tricyclic heterocyclic compounds useful for treating hiv infection |
| WO2016209749A1 (en) | 2015-06-25 | 2016-12-29 | Merck Sharp & Dohme Corp. | Substituted pyrazolo/imidazolo bicyclic compounds as pde2 inhibitors |
| WO2017000277A1 (en) | 2015-07-01 | 2017-01-05 | Merck Sharp & Dohme Corp. | Substituted triazolo bicycliccompounds as pde2 inhibitors |
| CA2991171A1 (en) | 2015-07-01 | 2017-01-05 | Lifesci Pharmaceuticals, Inc. | Therapeutic inhibitory compounds |
| CN108472312A (zh) | 2015-09-28 | 2018-08-31 | 阿祖拉眼科有限公司 | 用于增加睑板腺脂质分泌物的含硫醇及二硫化物的药剂 |
| WO2017087257A1 (en) | 2015-11-17 | 2017-05-26 | Merck Sharp & Dohme Corp. | Amido-substituted pyridotriazine derivatives useful as hiv integrase inhibitors |
| WO2017106071A1 (en) | 2015-12-15 | 2017-06-22 | Merck Sharp & Dohme Corp. | Spirocyclic quinolizine derivatives useful as hiv integrase inhibitors |
| US10221191B2 (en) | 2015-12-22 | 2019-03-05 | SHY Therapeutics LLC | Compounds for the treatment of cancer and inflammatory disease |
| WO2017113288A1 (en) | 2015-12-31 | 2017-07-06 | Merck Sharp & Dohme Corp. | Fused tricyclic heterocyclic compounds as hiv integrase inhibitors |
| CA3019349A1 (en) | 2016-04-14 | 2017-10-19 | Azura Ophthalmics Ltd. | Selenium disulfide compositions for use in treating meibomian gland dysfunction |
| SG11201809922YA (en) | 2016-05-31 | 2018-12-28 | Kalvista Pharmaceuticals Ltd | Pyrazole derivatives as plasma kallikrein inhibitors |
| GB201609607D0 (en) | 2016-06-01 | 2016-07-13 | Kalvista Pharmaceuticals Ltd | Polymorphs of N-(3-Fluoro-4-methoxypyridin-2-yl)methyl)-3-(methoxymethyl)-1-({4-((2-oxopy ridin-1-yl)methyl)phenyl}methyl)pyrazole-4-carboxamide and salts |
| GB201609603D0 (en) | 2016-06-01 | 2016-07-13 | Kalvista Pharmaceuticals Ltd | Polymorphs of N-[(6-cyano-2-fluoro-3-methoxyphenyl)Methyl]-3-(methoxymethyl)-1-({4-[(2-ox opyridin-1-YL)Methyl]phenyl}methyl)pyrazole-4-carboxamide |
| BR112018071678B1 (pt) | 2016-08-19 | 2021-01-26 | Gilead Sciences, Inc. | compostos terapêuticos úteis para o tratamento profilático ou terapêutico de uma infecção por vírus hiv e suas composições farmacêuticas |
| EP3290412A1 (en) | 2016-08-31 | 2018-03-07 | Università degli Studi di Siena | Hiv-1 nucleocapsid inhibitors |
| JOP20190130A1 (ar) | 2016-12-02 | 2019-06-02 | Merck Sharp & Dohme | مركبات حلقية غير متجانسة رباعية الحلقات مفيدة كمثبطات إنزيم مدمج لفيروس نقص المناعة البشرية (hiv) |
| AU2017367714B2 (en) | 2016-12-02 | 2020-11-12 | Merck Sharp & Dohme Corp. | Tricyclic heterocycle compounds useful as HIV integrase inhibitors |
| WO2018140368A1 (en) | 2017-01-26 | 2018-08-02 | Merck Sharp & Dohme Corp. | Substituted quinolizine derivatives useful as hiv integrase inhibitors |
| SG11201911929XA (en) | 2017-06-21 | 2020-01-30 | SHY Therapeutics LLC | Compounds that interact with the ras superfamily for the treatment of cancers, inflammatory diseases, rasopathies, and fibrotic disease |
| WO2019008029A1 (en) | 2017-07-07 | 2019-01-10 | Inflazome Limited | SULFONYLURATES AND SULFONYLTHIOURES AS INHIBITORS OF NLRP3 |
| PT3661925T (pt) | 2017-07-07 | 2022-01-31 | Inflazome Ltd | Novos compostos de sulfonamida-carboxamida |
| WO2019034697A1 (en) | 2017-08-15 | 2019-02-21 | Inflazome Limited | NOVEL CARBOXAMIDE SULFONAMIDE COMPOUNDS |
| EP3668861A1 (en) * | 2017-08-15 | 2020-06-24 | Inflazome Limited | Novel sulfonamide carboxamide compounds |
| WO2019034692A1 (en) | 2017-08-15 | 2019-02-21 | Inflazome Limited | SULFONYLURATES AND SULFONYLTHIOURES AS INHIBITORS OF NLRP3 |
| BR112020002906A2 (pt) | 2017-08-15 | 2020-08-04 | Inflazome Limited | novos compostos de sulfonamida-carboxamida |
| UY37847A (es) | 2017-08-15 | 2019-03-29 | Inflazome Ltd | Sulfonilureas y sulfoniltioureas útiles como inhibidores de nlrp3 |
| WO2019034693A1 (en) | 2017-08-15 | 2019-02-21 | Inflazome Limited | SULFONYLURATES AND SULFONYLTHIOURES AS INHIBITORS OF NLRP3 |
| TWI687415B (zh) | 2017-08-17 | 2020-03-11 | 美商基利科學股份有限公司 | Hiv蛋白質膜抑制劑之固體形式 |
| AR112412A1 (es) | 2017-08-17 | 2019-10-23 | Gilead Sciences Inc | Formas de sal de colina de un inhibidor de la cápside del vih |
| HUE067314T2 (hu) | 2017-09-22 | 2024-10-28 | Jubilant Epipad LLC | Heterociklusos vegyületek mint PAD gátlók |
| KR102782563B1 (ko) | 2017-10-18 | 2025-03-14 | 주빌런트 에피파드 엘엘씨 | Pad 억제제로서의 이미다조-피리딘 화합물 |
| KR20200085836A (ko) | 2017-11-06 | 2020-07-15 | 주빌런트 프로델 엘엘씨 | Pd1/pd-l1 활성화 억제제로서의 피리미딘 유도체 |
| EP3707137A1 (en) | 2017-11-09 | 2020-09-16 | Inflazome Limited | Novel sulfonamide carboxamide compounds |
| MX2020004423A (es) | 2017-11-09 | 2020-08-06 | Inflazome Ltd | Nuevos compuestos de sulfonamida carboxamida. |
| BR112020010322A2 (pt) | 2017-11-24 | 2020-11-17 | Jubilant Episcribe Llc | composto da fórmula i; composto da fórmula ia; composto da fórmula ib; processo de preparação de compostos da fórmula i; composição farmacêutica; método para o tratamento e/ou prevenção de várias doenças; uso dos compostos; método para o tratamento de câncer; e método para o tratamento e/ou prevenção de uma afecção mediada por prmt5 ou um distúrbio proliferativo ou câncer |
| RS63069B1 (sr) | 2017-11-29 | 2022-04-29 | Kalvista Pharmaceuticals Ltd | Dozni oblici koji sadrže inhibitor kalikreina plazme |
| GB201719881D0 (en) | 2017-11-29 | 2018-01-10 | Kalvista Pharmaceuticals Ltd | Solid forms of plasma kallikrein inhibitor and salts thereof |
| PL3752495T3 (pl) | 2018-02-15 | 2024-01-15 | Gilead Sciences, Inc. | Pochodne pirydynowe i ich zastosowanie do leczenia infekcji hiv |
| TWI823164B (zh) | 2018-02-16 | 2023-11-21 | 美商基利科學股份有限公司 | 用於製備有療效化合物之方法及中間物 |
| SG11202008950PA (en) | 2018-03-13 | 2020-10-29 | Jubilant Prodel LLC | Bicyclic compounds as inhibitors of pd1/pd-l1 interaction/activation |
| CA3101180A1 (en) * | 2018-04-27 | 2019-10-31 | Merck Sharp & Dohme Corp. | Tricyclic heterocycle compounds useful as hiv integrase inhibitors |
| CA3216031A1 (en) | 2018-07-16 | 2020-01-23 | Gilead Sciences, Inc. | Capsid inhibitors for the treatment of hiv |
| WO2020132071A1 (en) | 2018-12-19 | 2020-06-25 | Shy Therapeutics. Llc | Compounds that interact with the ras superfamily for the treatment of cancers, inflammatory diseases, rasopathies, and f1brotic disease |
| CN114206852A (zh) | 2019-08-09 | 2022-03-18 | 卡尔维斯塔制药有限公司 | 血浆激肽释放酶抑制剂 |
| TWI854067B (zh) | 2019-11-26 | 2024-09-01 | 美商基利科學股份有限公司 | 預防hiv之蛋白殼抑制劑 |
| TW202128660A (zh) | 2019-11-29 | 2021-08-01 | 大陸商江蘇恆瑞醫藥股份有限公司 | 稠合吡啶環衍生物、其製備方法及其在醫藥上的應用 |
| CA3166357A1 (en) | 2020-01-10 | 2021-07-15 | Azura Ophthalmics Ltd. | Instructions for composition and sensitivity |
| CN115697985B (zh) * | 2020-04-07 | 2025-01-21 | 米托布里奇公司 | Cd38抑制剂 |
| TW202502766A (zh) | 2020-06-25 | 2025-01-16 | 美商基利科學股份有限公司 | 用於治療hiv之蛋白殼抑制劑 |
| EP4440702B1 (en) | 2021-12-03 | 2025-05-21 | Gilead Sciences, Inc. | Therapeutic compounds for hiv virus infection |
| EP4440701A1 (en) | 2021-12-03 | 2024-10-09 | Gilead Sciences, Inc. | Therapeutic compounds for hiv virus infection |
| TW202342448A (zh) | 2021-12-03 | 2023-11-01 | 美商基利科學股份有限公司 | 用於hiv病毒感染之治療性化合物 |
| CN119371360B (zh) * | 2024-09-30 | 2025-10-24 | 暨南大学 | 一种5,6-二羟基嘧啶类化合物及其制备方法和应用 |
Family Cites Families (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4636508A (en) * | 1985-04-22 | 1987-01-13 | Uniroyal Chemical Company, Inc. | 5-pyrimidinecarboxyamides and treatment of leukemia therewith |
| US5637618A (en) * | 1990-06-01 | 1997-06-10 | Bioresearch, Inc. | Specific eatable taste modifiers |
| NO934505L (no) | 1992-12-10 | 1994-06-13 | Foster Wheeler Energy Ltd | Fremgangsmåte for fremstilling av en organisk væske |
| TW287160B (enExample) * | 1992-12-10 | 1996-10-01 | Hoffmann La Roche | |
| US6632823B1 (en) | 1997-12-22 | 2003-10-14 | Merck & Co., Inc. | Substituted pyridine compounds useful as modulators of acetylcholine receptors |
| US6306891B1 (en) * | 1998-06-03 | 2001-10-23 | Merck & Co., Inc. | HIV integrase inhibitors |
| EP1086091A4 (en) * | 1998-06-03 | 2001-10-10 | Merck & Co Inc | INTEGRASE HIV INHIBITORS |
| EP1082121A4 (en) | 1998-06-03 | 2003-02-05 | Merck & Co Inc | HIV integrase |
| IL141150A (en) | 1998-08-20 | 2005-08-31 | Toyama Chemical Co Ltd | Nitrogenous heterocyclic carboxamide derivatives or salts thereof and antiviral agents containing them |
| EP1159271B1 (en) | 1999-03-04 | 2004-08-25 | Korea Research Institute of Chemical Technology | Antiviral 2,4-pyrimidinedione derivatives and process for the preparation thereof |
| WO2001000578A1 (en) * | 1999-06-25 | 2001-01-04 | Merck & Co., Inc. | 1-(aromatic- or heteroaromatic-substituted)-3-(heteroaromatic substituted)-1,3-propanediones and uses thereof |
| US7276510B2 (en) | 2000-05-08 | 2007-10-02 | Janssen Pharmaceutica, Inc. | HIV replication inhibitors |
| US6339133B1 (en) | 2000-07-05 | 2002-01-15 | Solvay Polyolefins Europe - Belgium | Emergency stop of a polymerization in the gas phase |
| GB0017676D0 (en) * | 2000-07-19 | 2000-09-06 | Angeletti P Ist Richerche Bio | Inhibitors of viral polymerase |
| CA2425625A1 (en) * | 2000-10-12 | 2002-07-18 | Merck & Co., Inc. | Aza-and polyaza-naphthalenyl carboxamides useful as hiv integrase inhibitors |
| US20050010048A1 (en) * | 2000-10-12 | 2005-01-13 | Linghang Zhuang | Aza-and polyaza-naphthalenly ketones useful as hiv integrase inhibitors |
| EP1326611B1 (en) * | 2000-10-12 | 2007-06-13 | Merck & Co., Inc. | Aza- and polyaza-naphthalenyl-carboxamides useful as hiv integrase inhibitors |
| IL155089A0 (en) | 2000-10-12 | 2003-10-31 | Merck & Co Inc | Aza and polyaza-naphthalenyl carboxamides useful as hiv integrase inhibitors |
| KR20030078958A (ko) * | 2001-03-01 | 2003-10-08 | 시오노기세이야쿠가부시키가이샤 | Hiv 인테그라제 저해 활성을 갖는 질소 함유의헤테로아릴 화합물 |
| CN101513402B (zh) * | 2001-08-10 | 2012-03-21 | 盐野义制药株式会社 | 抗病毒药 |
| AU2002334205B2 (en) * | 2001-10-26 | 2007-07-05 | Istituto Di Ricerche Di Biologia Molecolara P. Angeletti Spa | Dihydroxypyrimidine carboxamide inhibitors of HIV integrase |
| DK1441735T3 (da) * | 2001-10-26 | 2006-06-12 | Angeletti P Ist Richerche Bio | N-substituerede hydroxypyrimidinon-carboxamid-inhibitorer af HIV-integrase |
| US7109186B2 (en) * | 2002-07-09 | 2006-09-19 | Bristol-Myers Squibb Company | HIV integrase inhibitors |
| WO2004062613A2 (en) | 2003-01-13 | 2004-07-29 | Bristol-Myers Squibb Company | Hiv integrase inhibitors |
| US7037908B2 (en) * | 2003-04-24 | 2006-05-02 | Bristol-Myers Squibb Company | HIV integrase inhibitors |
-
2002
- 2002-10-21 AU AU2002334205A patent/AU2002334205B2/en not_active Ceased
- 2002-10-21 WO PCT/GB2002/004742 patent/WO2003035076A1/en not_active Ceased
- 2002-10-21 DK DK02801949T patent/DK1441734T3/da active
- 2002-10-21 ES ES02801949T patent/ES2281565T3/es not_active Expired - Lifetime
- 2002-10-21 DE DE60218511T patent/DE60218511T2/de not_active Expired - Lifetime
- 2002-10-21 AT AT02801949T patent/ATE355064T1/de active
- 2002-10-21 CA CA002463975A patent/CA2463975A1/en not_active Abandoned
- 2002-10-21 US US10/493,279 patent/US7232819B2/en not_active Expired - Fee Related
- 2002-10-21 PT PT02801949T patent/PT1441734E/pt unknown
- 2002-10-21 SI SI200230523T patent/SI1441734T1/sl unknown
- 2002-10-21 JP JP2003537643A patent/JP4351053B2/ja not_active Expired - Fee Related
- 2002-10-21 EP EP02801949A patent/EP1441734B1/en not_active Expired - Lifetime
-
2006
- 2006-09-07 US US11/516,831 patent/US7459452B2/en not_active Expired - Fee Related
-
2007
- 2007-05-18 CY CY20071100679T patent/CY1106606T1/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US7232819B2 (en) | 2007-06-19 |
| AU2002334205B8 (en) | 2003-05-06 |
| WO2003035076A1 (en) | 2003-05-01 |
| CY1106606T1 (el) | 2012-01-25 |
| JP2005510500A (ja) | 2005-04-21 |
| ATE355064T1 (de) | 2006-03-15 |
| AU2002334205B2 (en) | 2007-07-05 |
| DE60218511D1 (de) | 2007-04-12 |
| ES2281565T3 (es) | 2007-10-01 |
| DE60218511T2 (de) | 2007-10-25 |
| DK1441734T3 (da) | 2007-06-11 |
| SI1441734T1 (sl) | 2007-08-31 |
| AU2002334205C1 (en) | 2003-05-06 |
| US20070083045A1 (en) | 2007-04-12 |
| US7459452B2 (en) | 2008-12-02 |
| CA2463975A1 (en) | 2003-05-01 |
| EP1441734A1 (en) | 2004-08-04 |
| US20050075356A1 (en) | 2005-04-07 |
| EP1441734B1 (en) | 2007-02-28 |
| JP4351053B2 (ja) | 2009-10-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PT1441734E (pt) | Di-hidroxipirimidinocarboxamidas inibidoras da integrase do vih | |
| JP7675777B2 (ja) | 免疫調節剤としての複素環式化合物 | |
| JP7629459B2 (ja) | Heliosタンパク質の阻害剤として有用な化合物 | |
| US20230226062A1 (en) | Heterocyclic compounds as immunomodulators | |
| ES2708998T3 (es) | Carboxamidas primarias como inhibidores de btk | |
| AU2003267098B2 (en) | Dihydroxypyridopyrazine-1,6-dione compounds useful as HIV integrase inhibitors | |
| AU2002334205A1 (en) | Dihydroxypyrimidine carboxamide inhibitors of HIV integrase | |
| ES2258668T3 (es) | Hidroxipirimidina carboxamidas n-sustituidas inhibidoras de hiv integrasa. | |
| ES2972507T3 (es) | Moduladores de nueva generación del estimulador de genes de interferón (STING) | |
| ES2944657T3 (es) | Compuestos de alqueno como moduladores del receptor farnesoide X | |
| EP2976341B1 (en) | Acyclic cyanoethylpyrazolo pyridones as janus kinase inhibitors | |
| WO2005023771A1 (ja) | ケモカインレセプターアンタゴニストおよびその医薬用途 | |
| KR20070026414A (ko) | Hiv 인테그라제 억제제 | |
| CN104710423A (zh) | Mk2抑制剂 | |
| AU2002334207B8 (en) | N-substituted hydroxpyrimidinone carboxamide inhibitors of HIV integrase | |
| CN117396477A (zh) | 用于治疗癌症的经吡啶基取代的氧代异吲哚啉化合物 | |
| AU2002334207A1 (en) | N-substituted hydroxpyrimidinone carboxamide inhibitors of HIV integrase |